build: gccbuild luabuild
gccbuild:
- make -C libs/web CC="cc" CFLAGS="" LDFLAGS="" SDK="$(shell test -f .running-sdk && echo 1)" host-install
+ make -C modules/base CC="cc" CFLAGS="" LDFLAGS="" SDK="$(shell test -f .running-sdk && echo 1)" host-install
for i in $(MODULES); do \
make -C$$i SDK="$(shell test -f .running-sdk && echo 1)" compile || { \
echo "*** Compilation of $$i failed!"; \
clean:
rm -f .running-sdk
rm -rf docs
- make -C libs/web host-clean
+ make -C modules/base host-clean
for i in $(MODULES); do make -C$$i clean; done
TITLE:=Freifunk Community Meta-Package
DEPENDS+=$(call add_deps,mod-freifunk-community, \
iptables-mod-nat-extra iptables-mod-ipopt \
- luci-lib-web luci-app-splash luci-i18n-german \
+ luci-app-splash luci-i18n-german \
olsrd olsrd-mod-dyn-gw-plain \
olsrd-mod-jsoninfo olsrd-mod-nameservice \
olsrd-mod-watchdog kmod-tun \
SUBMENU:=4. Themes
TITLE:=$(if $(2),$(2),LuCI $(1) theme)
MAINTAINER:=$(if $(3),$(3),LuCI Development Team <luci@lists.subsignal.org>)
- DEPENDS:=$(if $(filter-out base,$(1)),+luci-theme-base) $(4)
- $(if $(5),DEFAULT:=PACKAGE_luci-lib-core)
+ DEPENDS:=+luci-base $(4)
endef
define Package/luci-theme-$(1)/install
### Core package ###
-define Package/luci-lib-core
+define Package/luci-base
SECTION:=luci
CATEGORY:=LuCI
TITLE:=LuCI - Lua Configuration Interface
TITLE:=LuCI core libraries
endef
-define Package/luci-lib-core/install
- $(call Package/luci/install/template,$(1),libs/core)
+define Package/luci-base/install
+ $(call Package/luci/install/template,$(1),modules/base)
$(PKG_BUILD_DIR)/build/mkversion.sh $(1)/usr/lib/lua/luci/version.lua \
"OpenWrt Firmware" \
"$(OPENWRTVERSION)" \
"$(PKG_VERSION)"
endef
-define Package/luci-lib-core/config
+define Package/luci-base/config
choice
prompt "Build Target"
- default PACKAGE_luci-lib-core_source
+ default PACKAGE_luci-base_source
- config PACKAGE_luci-lib-core_compile
+ config PACKAGE_luci-base_compile
bool "Precompiled"
- config PACKAGE_luci-lib-core_stripped
+ config PACKAGE_luci-base_stripped
bool "Stripped"
- config PACKAGE_luci-lib-core_srcdiet
+ config PACKAGE_luci-base_srcdiet
bool "Compressed Source"
- config PACKAGE_luci-lib-core_source
+ config PACKAGE_luci-base_source
bool "Full Source"
endchoice
endef
-ifneq ($(CONFIG_PACKAGE_luci-lib-core_compile),)
+define Package/luci-base/conffiles
+/etc/config/luci
+endef
+
+ifneq ($(CONFIG_PACKAGE_luci-base_compile),)
LUA_TARGET:=compile
endif
-ifneq ($(CONFIG_PACKAGE_luci-lib-core_stripped),)
+ifneq ($(CONFIG_PACKAGE_luci-base_stripped),)
LUA_TARGET:=strip
endif
-ifneq ($(CONFIG_PACKAGE_luci-lib-core_srcdiet),)
+ifneq ($(CONFIG_PACKAGE_luci-base_srcdiet),)
LUA_TARGET:=diet
endif
-ifneq ($(CONFIG_PACKAGE_luci-lib-core),)
- LUCI_SELECTED_MODULES+=libs/core
+ifneq ($(CONFIG_PACKAGE_luci-base),)
+ LUCI_SELECTED_MODULES+=modules/base
endif
-LUCI_BUILD_PACKAGES += luci-lib-core
+LUCI_BUILD_PACKAGES += luci-base
### Libraries ###
MAINTAINER:=LuCI Development Team <luci@lists.subsignal.org>
SUBMENU:=8. Libraries
TITLE:=$(if $(2),$(2),LuCI $(1) library)
- $(if $(3),DEPENDS:=+luci-lib-core $(3))
+ $(if $(3),DEPENDS:=+luci-base $(3))
endef
define Package/luci-lib-$(1)/install
LUCI_BUILD_PACKAGES += luci-lib-$(1)
endef
-define Package/luci-lib-web/conffiles
-/etc/config/luci
-endef
-
define Package/luci-lib-nixio/config
choice
prompt "TLS Provider"
endif
-$(eval $(call library,httpclient,HTTP(S) client library,+luci-lib-web +luci-lib-nixio))
-$(eval $(call library,ipkg,LuCI IPKG/OPKG call abstraction library))
+$(eval $(call library,httpclient,HTTP(S) client library,+luci-base +luci-lib-nixio))
$(eval $(call library,json,LuCI JSON library))
$(eval $(call library,nixio,NIXIO POSIX library,+PACKAGE_luci-lib-nixio_openssl:libopenssl +PACKAGE_luci-lib-nixio_cyassl:libcyassl))
$(eval $(call library,px5g,RSA/X.509 Key Generator (required for LuCId SSL support),+luci-lib-nixio))
-$(eval $(call library,sys,LuCI Linux/POSIX system library))
-$(eval $(call library,web,MVC Webframework,+luci-lib-sys +luci-lib-nixio +luci-lib-core +luci-sgi-cgi))
-$(eval $(call library,luaneightbl,neightbl - Lua lib for IPv6 neighbors,+luci-lib-core))
+$(eval $(call library,luaneightbl,neightbl - Lua lib for IPv6 neighbors,+luci-base))
### Protocols ###
LUCI_BUILD_PACKAGES += luci-proto-$(1)
endef
-$(eval $(call protocol,core,Support for static/dhcp/none))
$(eval $(call protocol,ppp,Support for PPP/PPPoE/PPPoA/PPtP))
$(eval $(call protocol,ipv6,Support for DHCPv6/6in4/6to4/6rd/DS-Lite))
$(eval $(call protocol,3g,Support for 3G,+PACKAGE_luci-proto-3g:comgt))
endef
-define Package/luci-mod-admin-core/extra-install
- touch $(1)/etc/init.d/luci_fixtime || true
-endef
-
-$(eval $(call module,admin-core,Web UI Core module,+luci-lib-web +luci-proto-core +luci-i18n-english))
-$(eval $(call module,admin-mini,LuCI Essentials - stripped down and user-friendly,+luci-mod-admin-core @BROKEN))
-$(eval $(call module,admin-full,LuCI Administration - full-featured for full control,+luci-mod-admin-core +luci-lib-ipkg))
-$(eval $(call module,failsafe,LuCI Fail-Safe - Fail-Safe sysupgrade module,+luci-mod-admin-core))
+$(eval $(call module,admin-mini,LuCI Essentials - stripped down and user-friendly,+luci-base @BROKEN))
+$(eval $(call module,admin-full,LuCI Administration - full-featured for full control,+luci-base))
+$(eval $(call module,failsafe,LuCI Fail-Safe - Fail-Safe sysupgrade module,+luci-base))
$(eval $(call module,rpc,LuCI RPC - JSON-RPC API,+luci-lib-json))
$(eval $(call application,commands,LuCI Shell Command Module))
-### Server Gateway Interfaces ###
-define sgi
- define Package/luci-sgi-$(1)
- SECTION:=luci
- CATEGORY:=LuCI
- TITLE:=LuCI - Lua Configuration Interface
- URL:=http://luci.subsignal.org/
- MAINTAINER:=LuCI Development Team <luci@lists.subsignal.org>
- SUBMENU:=7. Server Interfaces
- TITLE:=$(if $(2),$(2),LuCI $(1) server gateway interface)
- DEPENDS:=$(3)
- endef
-
- define Package/luci-sgi-$(1)/install
- $(call Package/luci/install/template,$$(1),libs/sgi-$(1))
- endef
-
- ifneq ($(CONFIG_PACKAGE_luci-sgi-$(1)),)
- LUCI_SELECTED_MODULES+=libs/sgi-$(1)
- endif
-
- LUCI_BUILD_PACKAGES += luci-sgi-$(1)
-endef
-
-$(eval $(call sgi,cgi,CGI Gateway behind existing Webserver))
-$(eval $(call sgi,uhttpd,Binding for the uHTTPd server,+uhttpd +uhttpd-mod-lua))
-
-
### Themes ###
define theme
define Package/luci-theme-$(1)
SUBMENU:=4. Themes
TITLE:=$(if $(2),$(2),LuCI $(1) theme)
MAINTAINER:=$(if $(3),$(3),LuCI Development Team <luci@lists.subsignal.org>)
- DEPENDS:=$(if $(filter-out base,$(1)),+luci-theme-base) $(4)
- $(if $(5),DEFAULT:=PACKAGE_luci-lib-core)
+ DEPENDS:=+luci-base $(4)
+ $(if $(5),DEFAULT:=PACKAGE_luci-base)
endef
define Package/luci-theme-$(1)/install
LUCI_BUILD_PACKAGES += luci-theme-$(1)
endef
-$(eval $(call theme,base,Common base for all themes))
$(eval $(call theme,openwrt,OpenWrt.org))
$(eval $(call theme,bootstrap,Bootstrap Theme (default),,,1))
Standard OpenWrt set including full admin with ppp support and the \
default OpenWrt theme,\
+uhttpd +uhttpd-mod-ubus +luci-mod-admin-full +luci-theme-bootstrap \
- +luci-app-firewall +luci-proto-core +luci-proto-ppp +libiwinfo-lua))
+ +luci-app-firewall +luci-proto-ppp +libiwinfo-lua))
$(eval $(call collection,ssl,\
Standard OpenWrt set with HTTPS support,\
+++ /dev/null
-include ../../build/config.mk
-include ../../build/module.mk
+++ /dev/null
---[[
-LuCI - Lua Configuration Interface
-
-Copyright 2008 Steven Barth <steven@midlink.org>
-Copyright 2008 Jo-Philipp Wich <xm@leipzig.freifunk.net>
-
-Licensed under the Apache License, Version 2.0 (the "License");
-you may not use this file except in compliance with the License.
-You may obtain a copy of the License at
-
-http://www.apache.org/licenses/LICENSE-2.0
-
-$Id$
-]]--
-
-local io = require "io"
-local fs = require "nixio.fs"
-local util = require "luci.util"
-local nixio = require "nixio"
-local debug = require "debug"
-local string = require "string"
-local package = require "package"
-
-local type, loadfile = type, loadfile
-
-
-module "luci.ccache"
-
-function cache_ondemand(...)
- if debug.getinfo(1, 'S').source ~= "=?" then
- cache_enable(...)
- end
-end
-
-function cache_enable(cachepath, mode)
- cachepath = cachepath or "/tmp/luci-modulecache"
- mode = mode or "r--r--r--"
-
- local loader = package.loaders[2]
- local uid = nixio.getuid()
-
- if not fs.stat(cachepath) then
- fs.mkdir(cachepath)
- end
-
- local function _encode_filename(name)
- local encoded = ""
- for i=1, #name do
- encoded = encoded .. ("%2X" % string.byte(name, i))
- end
- return encoded
- end
-
- local function _load_sane(file)
- local stat = fs.stat(file)
- if stat and stat.uid == uid and stat.modestr == mode then
- return loadfile(file)
- end
- end
-
- local function _write_sane(file, func)
- if nixio.getuid() == uid then
- local fp = io.open(file, "w")
- if fp then
- fp:write(util.get_bytecode(func))
- fp:close()
- fs.chmod(file, mode)
- end
- end
- end
-
- package.loaders[2] = function(mod)
- local encoded = cachepath .. "/" .. _encode_filename(mod)
- local modcons = _load_sane(encoded)
-
- if modcons then
- return modcons
- end
-
- -- No cachefile
- modcons = loader(mod)
- if type(modcons) == "function" then
- _write_sane(encoded, modcons)
- end
- return modcons
- end
-end
+++ /dev/null
-local debug = require "debug"
-local io = require "io"
-local collectgarbage, floor = collectgarbage, math.floor
-
-module "luci.debug"
-__file__ = debug.getinfo(1, 'S').source:sub(2)
-
--- Enables the memory tracer with given flags and returns a function to disable the tracer again
-function trap_memtrace(flags, dest)
- flags = flags or "clr"
- local tracefile = io.open(dest or "/tmp/memtrace", "w")
- local peak = 0
-
- local function trap(what, line)
- local info = debug.getinfo(2, "Sn")
- local size = floor(collectgarbage("count"))
- if size > peak then
- peak = size
- end
- if tracefile then
- tracefile:write(
- "[", what, "] ", info.source, ":", (line or "?"), "\t",
- (info.namewhat or ""), "\t",
- (info.name or ""), "\t",
- size, " (", peak, ")\n"
- )
- end
- end
-
- debug.sethook(trap, flags)
-
- return function()
- debug.sethook()
- tracefile:close()
- end
-end
-
+++ /dev/null
---[[
-LuCI - Filesystem tools
-
-Description:
-A module offering often needed filesystem manipulation functions
-
-FileId:
-$Id$
-
-License:
-Copyright 2008 Steven Barth <steven@midlink.org>
-
-Licensed under the Apache License, Version 2.0 (the "License");
-you may not use this file except in compliance with the License.
-You may obtain a copy of the License at
-
- http://www.apache.org/licenses/LICENSE-2.0
-
-Unless required by applicable law or agreed to in writing, software
-distributed under the License is distributed on an "AS IS" BASIS,
-WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
-See the License for the specific language governing permissions and
-limitations under the License.
-
-]]--
-
-local io = require "io"
-local os = require "os"
-local ltn12 = require "luci.ltn12"
-local fs = require "nixio.fs"
-local nutil = require "nixio.util"
-
-local type = type
-
---- LuCI filesystem library.
-module "luci.fs"
-
---- Test for file access permission on given path.
--- @class function
--- @name access
--- @param str String value containing the path
--- @return Number containing the return code, 0 on sucess or nil on error
--- @return String containing the error description (if any)
--- @return Number containing the os specific errno (if any)
-access = fs.access
-
---- Evaluate given shell glob pattern and return a table containing all matching
--- file and directory entries.
--- @class function
--- @name glob
--- @param filename String containing the path of the file to read
--- @return Table containing file and directory entries or nil if no matches
--- @return String containing the error description (if no matches)
--- @return Number containing the os specific errno (if no matches)
-function glob(...)
- local iter, code, msg = fs.glob(...)
- if iter then
- return nutil.consume(iter)
- else
- return nil, code, msg
- end
-end
-
---- Checks wheather the given path exists and points to a regular file.
--- @param filename String containing the path of the file to test
--- @return Boolean indicating wheather given path points to regular file
-function isfile(filename)
- return fs.stat(filename, "type") == "reg"
-end
-
---- Checks wheather the given path exists and points to a directory.
--- @param dirname String containing the path of the directory to test
--- @return Boolean indicating wheather given path points to directory
-function isdirectory(dirname)
- return fs.stat(dirname, "type") == "dir"
-end
-
---- Read the whole content of the given file into memory.
--- @param filename String containing the path of the file to read
--- @return String containing the file contents or nil on error
--- @return String containing the error message on error
-readfile = fs.readfile
-
---- Write the contents of given string to given file.
--- @param filename String containing the path of the file to read
--- @param data String containing the data to write
--- @return Boolean containing true on success or nil on error
--- @return String containing the error message on error
-writefile = fs.writefile
-
---- Copies a file.
--- @param source Source file
--- @param dest Destination
--- @return Boolean containing true on success or nil on error
-copy = fs.datacopy
-
---- Renames a file.
--- @param source Source file
--- @param dest Destination
--- @return Boolean containing true on success or nil on error
-rename = fs.move
-
---- Get the last modification time of given file path in Unix epoch format.
--- @param path String containing the path of the file or directory to read
--- @return Number containing the epoch time or nil on error
--- @return String containing the error description (if any)
--- @return Number containing the os specific errno (if any)
-function mtime(path)
- return fs.stat(path, "mtime")
-end
-
---- Set the last modification time of given file path in Unix epoch format.
--- @param path String containing the path of the file or directory to read
--- @param mtime Last modification timestamp
--- @param atime Last accessed timestamp
--- @return 0 in case of success nil on error
--- @return String containing the error description (if any)
--- @return Number containing the os specific errno (if any)
-function utime(path, mtime, atime)
- return fs.utimes(path, atime, mtime)
-end
-
---- Return the last element - usually the filename - from the given path with
--- the directory component stripped.
--- @class function
--- @name basename
--- @param path String containing the path to strip
--- @return String containing the base name of given path
--- @see dirname
-basename = fs.basename
-
---- Return the directory component of the given path with the last element
--- stripped of.
--- @class function
--- @name dirname
--- @param path String containing the path to strip
--- @return String containing the directory component of given path
--- @see basename
-dirname = fs.dirname
-
---- Return a table containing all entries of the specified directory.
--- @class function
--- @name dir
--- @param path String containing the path of the directory to scan
--- @return Table containing file and directory entries or nil on error
--- @return String containing the error description on error
--- @return Number containing the os specific errno on error
-function dir(...)
- local iter, code, msg = fs.dir(...)
- if iter then
- local t = nutil.consume(iter)
- t[#t+1] = "."
- t[#t+1] = ".."
- return t
- else
- return nil, code, msg
- end
-end
-
---- Create a new directory, recursively on demand.
--- @param path String with the name or path of the directory to create
--- @param recursive Create multiple directory levels (optional, default is true)
--- @return Number with the return code, 0 on sucess or nil on error
--- @return String containing the error description on error
--- @return Number containing the os specific errno on error
-function mkdir(path, recursive)
- return recursive and fs.mkdirr(path) or fs.mkdir(path)
-end
-
---- Remove the given empty directory.
--- @class function
--- @name rmdir
--- @param path String containing the path of the directory to remove
--- @return Number with the return code, 0 on sucess or nil on error
--- @return String containing the error description on error
--- @return Number containing the os specific errno on error
-rmdir = fs.rmdir
-
-local stat_tr = {
- reg = "regular",
- dir = "directory",
- lnk = "link",
- chr = "character device",
- blk = "block device",
- fifo = "fifo",
- sock = "socket"
-}
---- Get information about given file or directory.
--- @class function
--- @name stat
--- @param path String containing the path of the directory to query
--- @return Table containing file or directory properties or nil on error
--- @return String containing the error description on error
--- @return Number containing the os specific errno on error
-function stat(path, key)
- local data, code, msg = fs.stat(path)
- if data then
- data.mode = data.modestr
- data.type = stat_tr[data.type] or "?"
- end
- return key and data and data[key] or data, code, msg
-end
-
---- Set permissions on given file or directory.
--- @class function
--- @name chmod
--- @param path String containing the path of the directory
--- @param perm String containing the permissions to set ([ugoa][+-][rwx])
--- @return Number with the return code, 0 on sucess or nil on error
--- @return String containing the error description on error
--- @return Number containing the os specific errno on error
-chmod = fs.chmod
-
---- Create a hard- or symlink from given file (or directory) to specified target
--- file (or directory) path.
--- @class function
--- @name link
--- @param path1 String containing the source path to link
--- @param path2 String containing the destination path for the link
--- @param symlink Boolean indicating wheather to create a symlink (optional)
--- @return Number with the return code, 0 on sucess or nil on error
--- @return String containing the error description on error
--- @return Number containing the os specific errno on error
-function link(src, dest, sym)
- return sym and fs.symlink(src, dest) or fs.link(src, dest)
-end
-
---- Remove the given file.
--- @class function
--- @name unlink
--- @param path String containing the path of the file to remove
--- @return Number with the return code, 0 on sucess or nil on error
--- @return String containing the error description on error
--- @return Number containing the os specific errno on error
-unlink = fs.unlink
-
---- Retrieve target of given symlink.
--- @class function
--- @name readlink
--- @param path String containing the path of the symlink to read
--- @return String containing the link target or nil on error
--- @return String containing the error description on error
--- @return Number containing the os specific errno on error
-readlink = fs.readlink
+++ /dev/null
---[[
-LuCI - Lua Configuration Interface
-
-Description:
-Main class
-
-FileId:
-$Id$
-
-License:
-Copyright 2008 Steven Barth <steven@midlink.org>
-
-Licensed under the Apache License, Version 2.0 (the "License");
-you may not use this file except in compliance with the License.
-You may obtain a copy of the License at
-
- http://www.apache.org/licenses/LICENSE-2.0
-
-Unless required by applicable law or agreed to in writing, software
-distributed under the License is distributed on an "AS IS" BASIS,
-WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
-See the License for the specific language governing permissions and
-limitations under the License.
-
-]]--
-
-local require = require
-
--- Make sure that bitlib is loaded
-if not _G.bit then
- _G.bit = require "bit"
-end
-
-module "luci"
-
-local v = require "luci.version"
-
-__version__ = v.luciversion or "trunk"
-__appname__ = v.luciname or "LuCI"
+++ /dev/null
---[[
-
-LuCI ip calculation libarary
-(c) 2008 Jo-Philipp Wich <xm@leipzig.freifunk.net>
-(c) 2008 Steven Barth <steven@midlink.org>
-
-Licensed under the Apache License, Version 2.0 (the "License");
-you may not use this file except in compliance with the License.
-You may obtain a copy of the License at
-
- http://www.apache.org/licenses/LICENSE-2.0
-
-$Id$
-
-]]--
-
---- LuCI IP calculation library.
-module( "luci.ip", package.seeall )
-
-require "nixio"
-local bit = nixio.bit
-local util = require "luci.util"
-
---- Boolean; true if system is little endian
-LITTLE_ENDIAN = not util.bigendian()
-
---- Boolean; true if system is big endian
-BIG_ENDIAN = not LITTLE_ENDIAN
-
---- Specifier for IPv4 address family
-FAMILY_INET4 = 0x04
-
---- Specifier for IPv6 address family
-FAMILY_INET6 = 0x06
-
-
-local function __bless(x)
- return setmetatable( x, {
- __index = luci.ip.cidr,
- __add = luci.ip.cidr.add,
- __sub = luci.ip.cidr.sub,
- __lt = luci.ip.cidr.lower,
- __eq = luci.ip.cidr.equal,
- __le =
- function(...)
- return luci.ip.cidr.equal(...) or luci.ip.cidr.lower(...)
- end
- } )
-end
-
-local function __array16( x, family )
- local list
-
- if type(x) == "number" then
- list = { bit.rshift(x, 16), bit.band(x, 0xFFFF) }
-
- elseif type(x) == "string" then
- if x:find(":") then x = IPv6(x) else x = IPv4(x) end
- if x then
- assert( x[1] == family, "Can't mix IPv4 and IPv6 addresses" )
- list = { unpack(x[2]) }
- end
-
- elseif type(x) == "table" and type(x[2]) == "table" then
- assert( x[1] == family, "Can't mix IPv4 and IPv6 addresses" )
- list = { unpack(x[2]) }
-
- elseif type(x) == "table" then
- list = { unpack(x) }
- end
-
- assert( list, "Invalid operand" )
-
- return list
-end
-
-local function __mask16(bits)
- return bit.lshift( bit.rshift( 0xFFFF, 16 - bits % 16 ), 16 - bits % 16 )
-end
-
-local function __not16(bits)
- return bit.band( bit.bnot( __mask16(bits) ), 0xFFFF )
-end
-
-local function __maxlen(family)
- return ( family == FAMILY_INET4 ) and 32 or 128
-end
-
-local function __sublen(family)
- return ( family == FAMILY_INET4 ) and 30 or 127
-end
-
-
---- Convert given short value to network byte order on little endian hosts
--- @param x Unsigned integer value between 0x0000 and 0xFFFF
--- @return Byte-swapped value
--- @see htonl
--- @see ntohs
-function htons(x)
- if LITTLE_ENDIAN then
- return bit.bor(
- bit.rshift( x, 8 ),
- bit.band( bit.lshift( x, 8 ), 0xFF00 )
- )
- else
- return x
- end
-end
-
---- Convert given long value to network byte order on little endian hosts
--- @param x Unsigned integer value between 0x00000000 and 0xFFFFFFFF
--- @return Byte-swapped value
--- @see htons
--- @see ntohl
-function htonl(x)
- if LITTLE_ENDIAN then
- return bit.bor(
- bit.lshift( htons( bit.band( x, 0xFFFF ) ), 16 ),
- htons( bit.rshift( x, 16 ) )
- )
- else
- return x
- end
-end
-
---- Convert given short value to host byte order on little endian hosts
--- @class function
--- @name ntohs
--- @param x Unsigned integer value between 0x0000 and 0xFFFF
--- @return Byte-swapped value
--- @see htonl
--- @see ntohs
-ntohs = htons
-
---- Convert given short value to host byte order on little endian hosts
--- @class function
--- @name ntohl
--- @param x Unsigned integer value between 0x00000000 and 0xFFFFFFFF
--- @return Byte-swapped value
--- @see htons
--- @see ntohl
-ntohl = htonl
-
-
---- Parse given IPv4 address in dotted quad or CIDR notation. If an optional
--- netmask is given as second argument and the IP address is encoded in CIDR
--- notation then the netmask parameter takes precedence. If neither a CIDR
--- encoded prefix nor a netmask parameter is given, then a prefix length of
--- 32 bit is assumed.
--- @param address IPv4 address in dotted quad or CIDR notation
--- @param netmask IPv4 netmask in dotted quad notation (optional)
--- @return luci.ip.cidr instance or nil if given address was invalid
--- @see IPv6
--- @see Hex
-function IPv4(address, netmask)
- address = address or "0.0.0.0/0"
-
- local obj = __bless({ FAMILY_INET4 })
-
- local data = {}
- local prefix = address:match("/(.+)")
- address = address:gsub("/.+","")
- address = address:gsub("^%[(.*)%]$", "%1"):upper():gsub("^::FFFF:", "")
-
- if netmask then
- prefix = obj:prefix(netmask)
- elseif prefix then
- prefix = tonumber(prefix)
- if not prefix or prefix < 0 or prefix > 32 then return nil end
- else
- prefix = 32
- end
-
- local b1, b2, b3, b4 = address:match("^(%d+)%.(%d+)%.(%d+)%.(%d+)$")
-
- b1 = tonumber(b1)
- b2 = tonumber(b2)
- b3 = tonumber(b3)
- b4 = tonumber(b4)
-
- if b1 and b1 <= 255 and
- b2 and b2 <= 255 and
- b3 and b3 <= 255 and
- b4 and b4 <= 255 and
- prefix
- then
- table.insert(obj, { b1 * 256 + b2, b3 * 256 + b4 })
- table.insert(obj, prefix)
- return obj
- end
-end
-
---- Parse given IPv6 address in full, compressed, mixed or CIDR notation.
--- If an optional netmask is given as second argument and the IP address is
--- encoded in CIDR notation then the netmask parameter takes precedence.
--- If neither a CIDR encoded prefix nor a netmask parameter is given, then a
--- prefix length of 128 bit is assumed.
--- @param address IPv6 address in full/compressed/mixed or CIDR notation
--- @param netmask IPv6 netmask in full/compressed/mixed notation (optional)
--- @return luci.ip.cidr instance or nil if given address was invalid
--- @see IPv4
--- @see Hex
-function IPv6(address, netmask)
- address = address or "::/0"
-
- local obj = __bless({ FAMILY_INET6 })
-
- local data = {}
- local prefix = address:match("/(.+)")
- address = address:gsub("/.+","")
- address = address:gsub("^%[(.*)%]$", "%1")
-
- if netmask then
- prefix = obj:prefix(netmask)
- elseif prefix then
- prefix = tonumber(prefix)
- if not prefix or prefix < 0 or prefix > 128 then return nil end
- else
- prefix = 128
- end
-
- local borderl = address:sub(1, 1) == ":" and 2 or 1
- local borderh, zeroh, chunk, block, i
-
- if #address > 45 then return nil end
-
- repeat
- borderh = address:find(":", borderl, true)
- if not borderh then break end
-
- block = tonumber(address:sub(borderl, borderh - 1), 16)
- if block and block <= 0xFFFF then
- data[#data+1] = block
- else
- if zeroh or borderh - borderl > 1 then return nil end
- zeroh = #data + 1
- end
-
- borderl = borderh + 1
- until #data == 7
-
- chunk = address:sub(borderl)
- if #chunk > 0 and #chunk <= 4 then
- block = tonumber(chunk, 16)
- if not block or block > 0xFFFF then return nil end
-
- data[#data+1] = block
- elseif #chunk > 4 then
- if #data == 7 or #chunk > 15 then return nil end
- borderl = 1
- for i=1, 4 do
- borderh = chunk:find(".", borderl, true)
- if not borderh and i < 4 then return nil end
- borderh = borderh and borderh - 1
-
- block = tonumber(chunk:sub(borderl, borderh))
- if not block or block > 255 then return nil end
-
- if i == 1 or i == 3 then
- data[#data+1] = block * 256
- else
- data[#data] = data[#data] + block
- end
-
- borderl = borderh and borderh + 2
- end
- end
-
- if zeroh then
- if #data == 8 then return nil end
- while #data < 8 do
- table.insert(data, zeroh, 0)
- end
- end
-
- if #data == 8 and prefix then
- table.insert(obj, data)
- table.insert(obj, prefix)
- return obj
- end
-end
-
---- Transform given hex-encoded value to luci.ip.cidr instance of specified
--- address family.
--- @param hex String containing hex encoded value
--- @param prefix Prefix length of CIDR instance (optional, default is 32/128)
--- @param family Address family, either luci.ip.FAMILY_INET4 or FAMILY_INET6
--- @param swap Bool indicating whether to swap byteorder on low endian host
--- @return luci.ip.cidr instance or nil if given value was invalid
--- @see IPv4
--- @see IPv6
-function Hex( hex, prefix, family, swap )
- family = ( family ~= nil ) and family or FAMILY_INET4
- swap = ( swap == nil ) and true or swap
- prefix = prefix or __maxlen(family)
-
- local len = __maxlen(family)
- local tmp = ""
- local data = { }
- local i
-
- for i = 1, (len/4) - #hex do tmp = tmp .. '0' end
-
- if swap and LITTLE_ENDIAN then
- for i = #hex, 1, -2 do tmp = tmp .. hex:sub( i - 1, i ) end
- else
- tmp = tmp .. hex
- end
-
- hex = tmp
-
- for i = 1, ( len / 4 ), 4 do
- local n = tonumber( hex:sub( i, i+3 ), 16 )
- if n then
- data[#data+1] = n
- else
- return nil
- end
- end
-
- return __bless({ family, data, prefix })
-end
-
-
---- LuCI IP Library / CIDR instances
--- @class module
--- @cstyle instance
--- @name luci.ip.cidr
-cidr = util.class()
-
---- Test whether the instance is a IPv4 address.
--- @return Boolean indicating a IPv4 address type
--- @see cidr.is6
-function cidr.is4( self )
- return self[1] == FAMILY_INET4
-end
-
---- Test whether this instance is an IPv4 RFC1918 private address
--- @return Boolean indicating whether this instance is an RFC1918 address
-function cidr.is4rfc1918( self )
- if self[1] == FAMILY_INET4 then
- return ((self[2][1] >= 0x0A00) and (self[2][1] <= 0x0AFF)) or
- ((self[2][1] >= 0xAC10) and (self[2][1] <= 0xAC1F)) or
- (self[2][1] == 0xC0A8)
- end
- return false
-end
-
---- Test whether this instance is an IPv4 link-local address (Zeroconf)
--- @return Boolean indicating whether this instance is IPv4 link-local
-function cidr.is4linklocal( self )
- if self[1] == FAMILY_INET4 then
- return (self[2][1] == 0xA9FE)
- end
- return false
-end
-
---- Test whether the instance is a IPv6 address.
--- @return Boolean indicating a IPv6 address type
--- @see cidr.is4
-function cidr.is6( self )
- return self[1] == FAMILY_INET6
-end
-
---- Test whether this instance is an IPv6 link-local address
--- @return Boolean indicating whether this instance is IPv6 link-local
-function cidr.is6linklocal( self )
- if self[1] == FAMILY_INET6 then
- return (self[2][1] >= 0xFE80) and (self[2][1] <= 0xFEBF)
- end
- return false
-end
-
---- Return a corresponding string representation of the instance.
--- If the prefix length is lower then the maximum possible prefix length for the
--- corresponding address type then the address is returned in CIDR notation,
--- otherwise the prefix will be left out.
-function cidr.string( self )
- local str
- if self:is4() then
- str = string.format(
- "%d.%d.%d.%d",
- bit.rshift(self[2][1], 8), bit.band(self[2][1], 0xFF),
- bit.rshift(self[2][2], 8), bit.band(self[2][2], 0xFF)
- )
- if self[3] < 32 then
- str = str .. "/" .. self[3]
- end
- elseif self:is6() then
- str = string.format( "%X:%X:%X:%X:%X:%X:%X:%X", unpack(self[2]) )
- if self[3] < 128 then
- str = str .. "/" .. self[3]
- end
- end
- return str
-end
-
---- Test whether the value of the instance is lower then the given address.
--- This function will throw an exception if the given address has a different
--- family than this instance.
--- @param addr A luci.ip.cidr instance to compare against
--- @return Boolean indicating whether this instance is lower
--- @see cidr.higher
--- @see cidr.equal
-function cidr.lower( self, addr )
- assert( self[1] == addr[1], "Can't compare IPv4 and IPv6 addresses" )
- local i
- for i = 1, #self[2] do
- if self[2][i] ~= addr[2][i] then
- return self[2][i] < addr[2][i]
- end
- end
- return false
-end
-
---- Test whether the value of the instance is higher then the given address.
--- This function will throw an exception if the given address has a different
--- family than this instance.
--- @param addr A luci.ip.cidr instance to compare against
--- @return Boolean indicating whether this instance is higher
--- @see cidr.lower
--- @see cidr.equal
-function cidr.higher( self, addr )
- assert( self[1] == addr[1], "Can't compare IPv4 and IPv6 addresses" )
- local i
- for i = 1, #self[2] do
- if self[2][i] ~= addr[2][i] then
- return self[2][i] > addr[2][i]
- end
- end
- return false
-end
-
---- Test whether the value of the instance is equal to the given address.
--- This function will throw an exception if the given address is a different
--- family than this instance.
--- @param addr A luci.ip.cidr instance to compare against
--- @return Boolean indicating whether this instance is equal
--- @see cidr.lower
--- @see cidr.higher
-function cidr.equal( self, addr )
- assert( self[1] == addr[1], "Can't compare IPv4 and IPv6 addresses" )
- local i
- for i = 1, #self[2] do
- if self[2][i] ~= addr[2][i] then
- return false
- end
- end
- return true
-end
-
---- Return the prefix length of this CIDR instance.
--- @param mask Override instance prefix with given netmask (optional)
--- @return Prefix length in bit
-function cidr.prefix( self, mask )
- local prefix = self[3]
-
- if mask then
- prefix = 0
-
- local stop = false
- local obj = type(mask) ~= "table"
- and ( self:is4() and IPv4(mask) or IPv6(mask) ) or mask
-
- if not obj then return nil end
-
- local _, word
- for _, word in ipairs(obj[2]) do
- if word == 0xFFFF then
- prefix = prefix + 16
- else
- local bitmask = bit.lshift(1, 15)
- while bit.band(word, bitmask) == bitmask do
- prefix = prefix + 1
- bitmask = bit.lshift(1, 15 - (prefix % 16))
- end
-
- break
- end
- end
- end
-
- return prefix
-end
-
---- Return a corresponding CIDR representing the network address of this
--- instance.
--- @param bits Override prefix length of this instance (optional)
--- @return CIDR instance containing the network address
--- @see cidr.host
--- @see cidr.broadcast
--- @see cidr.mask
-function cidr.network( self, bits )
- local data = { }
- bits = bits or self[3]
-
- local i
- for i = 1, math.floor( bits / 16 ) do
- data[#data+1] = self[2][i]
- end
-
- if #data < #self[2] then
- data[#data+1] = bit.band( self[2][1+#data], __mask16(bits) )
-
- for i = #data + 1, #self[2] do
- data[#data+1] = 0
- end
- end
-
- return __bless({ self[1], data, __maxlen(self[1]) })
-end
-
---- Return a corresponding CIDR representing the host address of this
--- instance. This is intended to extract the host address from larger subnet.
--- @return CIDR instance containing the network address
--- @see cidr.network
--- @see cidr.broadcast
--- @see cidr.mask
-function cidr.host( self )
- return __bless({ self[1], self[2], __maxlen(self[1]) })
-end
-
---- Return a corresponding CIDR representing the netmask of this instance.
--- @param bits Override prefix length of this instance (optional)
--- @return CIDR instance containing the netmask
--- @see cidr.network
--- @see cidr.host
--- @see cidr.broadcast
-function cidr.mask( self, bits )
- local data = { }
- bits = bits or self[3]
-
- for i = 1, math.floor( bits / 16 ) do
- data[#data+1] = 0xFFFF
- end
-
- if #data < #self[2] then
- data[#data+1] = __mask16(bits)
-
- for i = #data + 1, #self[2] do
- data[#data+1] = 0
- end
- end
-
- return __bless({ self[1], data, __maxlen(self[1]) })
-end
-
---- Return CIDR containing the broadcast address of this instance.
--- @return CIDR instance containing the netmask, always nil for IPv6
--- @see cidr.network
--- @see cidr.host
--- @see cidr.mask
-function cidr.broadcast( self )
- -- IPv6 has no broadcast addresses (XXX: assert() instead?)
- if self[1] == FAMILY_INET4 then
- local data = { unpack(self[2]) }
- local offset = math.floor( self[3] / 16 ) + 1
-
- if offset <= #data then
- data[offset] = bit.bor( data[offset], __not16(self[3]) )
- for i = offset + 1, #data do data[i] = 0xFFFF end
-
- return __bless({ self[1], data, __maxlen(self[1]) })
- end
- end
-end
-
---- Test whether this instance fully contains the given CIDR instance.
--- @param addr CIDR instance to test against
--- @return Boolean indicating whether this instance contains the given CIDR
-function cidr.contains( self, addr )
- assert( self[1] == addr[1], "Can't compare IPv4 and IPv6 addresses" )
-
- if self:prefix() <= addr:prefix() then
- return self:network() == addr:network(self:prefix())
- end
-
- return false
-end
-
---- Add specified amount of hosts to this instance.
--- @param amount Number of hosts to add to this instance
--- @param inplace Boolen indicating whether to alter values inplace (optional)
--- @return CIDR representing the new address or nil on overflow error
--- @see cidr.sub
-function cidr.add( self, amount, inplace )
- local pos
- local data = { unpack(self[2]) }
- local shorts = __array16( amount, self[1] )
-
- for pos = #data, 1, -1 do
- local add = ( #shorts > 0 ) and table.remove( shorts, #shorts ) or 0
- if ( data[pos] + add ) > 0xFFFF then
- data[pos] = ( data[pos] + add ) % 0xFFFF
- if pos > 1 then
- data[pos-1] = data[pos-1] + ( add - data[pos] )
- else
- return nil
- end
- else
- data[pos] = data[pos] + add
- end
- end
-
- if inplace then
- self[2] = data
- return self
- else
- return __bless({ self[1], data, self[3] })
- end
-end
-
---- Substract specified amount of hosts from this instance.
--- @param amount Number of hosts to substract from this instance
--- @param inplace Boolen indicating whether to alter values inplace (optional)
--- @return CIDR representing the new address or nil on underflow error
--- @see cidr.add
-function cidr.sub( self, amount, inplace )
- local pos
- local data = { unpack(self[2]) }
- local shorts = __array16( amount, self[1] )
-
- for pos = #data, 1, -1 do
- local sub = ( #shorts > 0 ) and table.remove( shorts, #shorts ) or 0
- if ( data[pos] - sub ) < 0 then
- data[pos] = ( sub - data[pos] ) % 0xFFFF
- if pos > 1 then
- data[pos-1] = data[pos-1] - ( sub + data[pos] )
- else
- return nil
- end
- else
- data[pos] = data[pos] - sub
- end
- end
-
- if inplace then
- self[2] = data
- return self
- else
- return __bless({ self[1], data, self[3] })
- end
-end
-
---- Return CIDR containing the lowest available host address within this subnet.
--- @return CIDR containing the host address, nil if subnet is too small
--- @see cidr.maxhost
-function cidr.minhost( self )
- if self[3] <= __sublen(self[1]) then
- -- 1st is Network Address in IPv4 and Subnet-Router Anycast Adresse in IPv6
- return self:network():add(1, true)
- end
-end
-
---- Return CIDR containing the highest available host address within the subnet.
--- @return CIDR containing the host address, nil if subnet is too small
--- @see cidr.minhost
-function cidr.maxhost( self )
- if self[3] <= __sublen(self[1]) then
- local i
- local data = { unpack(self[2]) }
- local offset = math.floor( self[3] / 16 ) + 1
-
- data[offset] = bit.bor( data[offset], __not16(self[3]) )
- for i = offset + 1, #data do data[i] = 0xFFFF end
- data = __bless({ self[1], data, __maxlen(self[1]) })
-
- -- Last address in reserved for Broadcast Address in IPv4
- if data[1] == FAMILY_INET4 then data:sub(1, true) end
-
- return data
- end
-end
+++ /dev/null
---[[
-LuaSocket 2.0.2 license
-Copyright � 2004-2007 Diego Nehab
-
-Permission is hereby granted, free of charge, to any person obtaining a
-copy of this software and associated documentation files (the "Software"),
-to deal in the Software without restriction, including without limitation
-the rights to use, copy, modify, merge, publish, distribute, sublicense,
-and/or sell copies of the Software, and to permit persons to whom the
-Software is furnished to do so, subject to the following conditions:
-
-The above copyright notice and this permission notice shall be included in
-all copies or substantial portions of the Software.
-
-THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
-IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
-FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
-AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
-LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING
-FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER
-DEALINGS IN THE SOFTWARE.
-]]--
---[[
- Changes made by LuCI project:
- * Renamed to luci.ltn12 to avoid collisions with luasocket
- * Added inline documentation
-]]--
------------------------------------------------------------------------------
--- LTN12 - Filters, sources, sinks and pumps.
--- LuaSocket toolkit.
--- Author: Diego Nehab
--- RCS ID: $Id$
------------------------------------------------------------------------------
-
------------------------------------------------------------------------------
--- Declare module
------------------------------------------------------------------------------
-local string = require("string")
-local table = require("table")
-local base = _G
-
---- Diego Nehab's LTN12 - Filters, sources, sinks and pumps.
--- See http://lua-users.org/wiki/FiltersSourcesAndSinks for design concepts
-module("luci.ltn12")
-
-filter = {}
-source = {}
-sink = {}
-pump = {}
-
--- 2048 seems to be better in windows...
-BLOCKSIZE = 2048
-_VERSION = "LTN12 1.0.1"
-
------------------------------------------------------------------------------
--- Filter stuff
------------------------------------------------------------------------------
-
---- LTN12 Filter constructors
--- @class module
--- @name luci.ltn12.filter
-
---- Return a high level filter that cycles a low-level filter
--- by passing it each chunk and updating a context between calls.
--- @param low Low-level filter
--- @param ctx Context
--- @param extra Extra argument passed to the low-level filter
--- @return LTN12 filter
-function filter.cycle(low, ctx, extra)
- base.assert(low)
- return function(chunk)
- local ret
- ret, ctx = low(ctx, chunk, extra)
- return ret
- end
-end
-
---- Chain a bunch of filters together.
--- (thanks to Wim Couwenberg)
--- @param ... filters to be chained
--- @return LTN12 filter
-function filter.chain(...)
- local n = table.getn(arg)
- local top, index = 1, 1
- local retry = ""
- return function(chunk)
- retry = chunk and retry
- while true do
- if index == top then
- chunk = arg[index](chunk)
- if chunk == "" or top == n then return chunk
- elseif chunk then index = index + 1
- else
- top = top+1
- index = top
- end
- else
- chunk = arg[index](chunk or "")
- if chunk == "" then
- index = index - 1
- chunk = retry
- elseif chunk then
- if index == n then return chunk
- else index = index + 1 end
- else base.error("filter returned inappropriate nil") end
- end
- end
- end
-end
-
------------------------------------------------------------------------------
--- Source stuff
------------------------------------------------------------------------------
-
---- LTN12 Source constructors
--- @class module
--- @name luci.ltn12.source
-
--- create an empty source
-local function empty()
- return nil
-end
-
---- Create an empty source.
--- @return LTN12 source
-function source.empty()
- return empty
-end
-
---- Return a source that just outputs an error.
--- @param err Error object
--- @return LTN12 source
-function source.error(err)
- return function()
- return nil, err
- end
-end
-
---- Create a file source.
--- @param handle File handle ready for reading
--- @param io_err IO error object
--- @return LTN12 source
-function source.file(handle, io_err)
- if handle then
- return function()
- local chunk = handle:read(BLOCKSIZE)
- if not chunk then handle:close() end
- return chunk
- end
- else return source.error(io_err or "unable to open file") end
-end
-
---- Turn a fancy source into a simple source.
--- @param src fancy source
--- @return LTN12 source
-function source.simplify(src)
- base.assert(src)
- return function()
- local chunk, err_or_new = src()
- src = err_or_new or src
- if not chunk then return nil, err_or_new
- else return chunk end
- end
-end
-
---- Create a string source.
--- @param s Data
--- @return LTN12 source
-function source.string(s)
- if s then
- local i = 1
- return function()
- local chunk = string.sub(s, i, i+BLOCKSIZE-1)
- i = i + BLOCKSIZE
- if chunk ~= "" then return chunk
- else return nil end
- end
- else return source.empty() end
-end
-
---- Creates rewindable source.
--- @param src LTN12 source to be made rewindable
--- @return LTN12 source
-function source.rewind(src)
- base.assert(src)
- local t = {}
- return function(chunk)
- if not chunk then
- chunk = table.remove(t)
- if not chunk then return src()
- else return chunk end
- else
- t[#t+1] = chunk
- end
- end
-end
-
---- Chain a source and a filter together.
--- @param src LTN12 source
--- @param f LTN12 filter
--- @return LTN12 source
-function source.chain(src, f)
- base.assert(src and f)
- local last_in, last_out = "", ""
- local state = "feeding"
- local err
- return function()
- if not last_out then
- base.error('source is empty!', 2)
- end
- while true do
- if state == "feeding" then
- last_in, err = src()
- if err then return nil, err end
- last_out = f(last_in)
- if not last_out then
- if last_in then
- base.error('filter returned inappropriate nil')
- else
- return nil
- end
- elseif last_out ~= "" then
- state = "eating"
- if last_in then last_in = "" end
- return last_out
- end
- else
- last_out = f(last_in)
- if last_out == "" then
- if last_in == "" then
- state = "feeding"
- else
- base.error('filter returned ""')
- end
- elseif not last_out then
- if last_in then
- base.error('filter returned inappropriate nil')
- else
- return nil
- end
- else
- return last_out
- end
- end
- end
- end
-end
-
---- Create a source that produces contents of several sources.
--- Sources will be used one after the other, as if they were concatenated
--- (thanks to Wim Couwenberg)
--- @param ... LTN12 sources
--- @return LTN12 source
-function source.cat(...)
- local src = table.remove(arg, 1)
- return function()
- while src do
- local chunk, err = src()
- if chunk then return chunk end
- if err then return nil, err end
- src = table.remove(arg, 1)
- end
- end
-end
-
------------------------------------------------------------------------------
--- Sink stuff
------------------------------------------------------------------------------
-
---- LTN12 sink constructors
--- @class module
--- @name luci.ltn12.sink
-
---- Create a sink that stores into a table.
--- @param t output table to store into
--- @return LTN12 sink
-function sink.table(t)
- t = t or {}
- local f = function(chunk, err)
- if chunk then t[#t+1] = chunk end
- return 1
- end
- return f, t
-end
-
---- Turn a fancy sink into a simple sink.
--- @param snk fancy sink
--- @return LTN12 sink
-function sink.simplify(snk)
- base.assert(snk)
- return function(chunk, err)
- local ret, err_or_new = snk(chunk, err)
- if not ret then return nil, err_or_new end
- snk = err_or_new or snk
- return 1
- end
-end
-
---- Create a file sink.
--- @param handle file handle to write to
--- @param io_err IO error
--- @return LTN12 sink
-function sink.file(handle, io_err)
- if handle then
- return function(chunk, err)
- if not chunk then
- handle:close()
- return 1
- else return handle:write(chunk) end
- end
- else return sink.error(io_err or "unable to open file") end
-end
-
--- creates a sink that discards data
-local function null()
- return 1
-end
-
---- Create a sink that discards data.
--- @return LTN12 sink
-function sink.null()
- return null
-end
-
---- Create a sink that just returns an error.
--- @param err Error object
--- @return LTN12 sink
-function sink.error(err)
- return function()
- return nil, err
- end
-end
-
---- Chain a sink with a filter.
--- @param f LTN12 filter
--- @param snk LTN12 sink
--- @return LTN12 sink
-function sink.chain(f, snk)
- base.assert(f and snk)
- return function(chunk, err)
- if chunk ~= "" then
- local filtered = f(chunk)
- local done = chunk and ""
- while true do
- local ret, snkerr = snk(filtered, err)
- if not ret then return nil, snkerr end
- if filtered == done then return 1 end
- filtered = f(done)
- end
- else return 1 end
- end
-end
-
------------------------------------------------------------------------------
--- Pump stuff
------------------------------------------------------------------------------
-
---- LTN12 pump functions
--- @class module
--- @name luci.ltn12.pump
-
---- Pump one chunk from the source to the sink.
--- @param src LTN12 source
--- @param snk LTN12 sink
--- @return Chunk of data or nil if an error occured
--- @return Error object
-function pump.step(src, snk)
- local chunk, src_err = src()
- local ret, snk_err = snk(chunk, src_err)
- if chunk and ret then return 1
- else return nil, src_err or snk_err end
-end
-
---- Pump all data from a source to a sink, using a step function.
--- @param src LTN12 source
--- @param snk LTN12 sink
--- @param step step function (optional)
--- @return 1 if the operation succeeded otherwise nil
--- @return Error object
-function pump.all(src, snk, step)
- base.assert(src and snk)
- step = step or pump.step
- while true do
- local ret, err = step(src, snk)
- if not ret then
- if err then return nil, err
- else return 1 end
- end
- end
-end
-
+++ /dev/null
---[[
-LuCI - Firewall model
-
-Copyright 2009 Jo-Philipp Wich <xm@subsignal.org>
-
-Licensed under the Apache License, Version 2.0 (the "License");
-you may not use this file except in compliance with the License.
-You may obtain a copy of the License at
-
- http://www.apache.org/licenses/LICENSE-2.0
-
-Unless required by applicable law or agreed to in writing, software
-distributed under the License is distributed on an "AS IS" BASIS,
-WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
-See the License for the specific language governing permissions and
-limitations under the License.
-
-]]--
-
-local type, pairs, ipairs, table, luci, math
- = type, pairs, ipairs, table, luci, math
-
-local tpl = require "luci.template.parser"
-local utl = require "luci.util"
-local uci = require "luci.model.uci"
-
-module "luci.model.firewall"
-
-
-local uci_r, uci_s
-
-function _valid_id(x)
- return (x and #x > 0 and x:match("^[a-zA-Z0-9_]+$"))
-end
-
-function _get(c, s, o)
- return uci_r:get(c, s, o)
-end
-
-function _set(c, s, o, v)
- if v ~= nil then
- if type(v) == "boolean" then v = v and "1" or "0" end
- return uci_r:set(c, s, o, v)
- else
- return uci_r:delete(c, s, o)
- end
-end
-
-
-function init(cursor)
- uci_r = cursor or uci_r or uci.cursor()
- uci_s = uci_r:substate()
-
- return _M
-end
-
-function save(self, ...)
- uci_r:save(...)
- uci_r:load(...)
-end
-
-function commit(self, ...)
- uci_r:commit(...)
- uci_r:load(...)
-end
-
-function get_defaults()
- return defaults()
-end
-
-function new_zone(self)
- local name = "newzone"
- local count = 1
-
- while self:get_zone(name) do
- count = count + 1
- name = "newzone%d" % count
- end
-
- return self:add_zone(name)
-end
-
-function add_zone(self, n)
- if _valid_id(n) and not self:get_zone(n) then
- local d = defaults()
- local z = uci_r:section("firewall", "zone", nil, {
- name = n,
- network = " ",
- input = d:input() or "DROP",
- forward = d:forward() or "DROP",
- output = d:output() or "DROP"
- })
-
- return z and zone(z)
- end
-end
-
-function get_zone(self, n)
- if uci_r:get("firewall", n) == "zone" then
- return zone(n)
- else
- local z
- uci_r:foreach("firewall", "zone",
- function(s)
- if n and s.name == n then
- z = s['.name']
- return false
- end
- end)
- return z and zone(z)
- end
-end
-
-function get_zones(self)
- local zones = { }
- local znl = { }
-
- uci_r:foreach("firewall", "zone",
- function(s)
- if s.name then
- znl[s.name] = zone(s['.name'])
- end
- end)
-
- local z
- for z in utl.kspairs(znl) do
- zones[#zones+1] = znl[z]
- end
-
- return zones
-end
-
-function get_zone_by_network(self, net)
- local z
-
- uci_r:foreach("firewall", "zone",
- function(s)
- if s.name and net then
- local n
- for n in utl.imatch(s.network or s.name) do
- if n == net then
- z = s['.name']
- return false
- end
- end
- end
- end)
-
- return z and zone(z)
-end
-
-function del_zone(self, n)
- local r = false
-
- if uci_r:get("firewall", n) == "zone" then
- local z = uci_r:get("firewall", n, "name")
- r = uci_r:delete("firewall", n)
- n = z
- else
- uci_r:foreach("firewall", "zone",
- function(s)
- if n and s.name == n then
- r = uci_r:delete("firewall", s['.name'])
- return false
- end
- end)
- end
-
- if r then
- uci_r:foreach("firewall", "rule",
- function(s)
- if s.src == n or s.dest == n then
- uci_r:delete("firewall", s['.name'])
- end
- end)
-
- uci_r:foreach("firewall", "redirect",
- function(s)
- if s.src == n or s.dest == n then
- uci_r:delete("firewall", s['.name'])
- end
- end)
-
- uci_r:foreach("firewall", "forwarding",
- function(s)
- if s.src == n or s.dest == n then
- uci_r:delete("firewall", s['.name'])
- end
- end)
- end
-
- return r
-end
-
-function rename_zone(self, old, new)
- local r = false
-
- if _valid_id(new) and not self:get_zone(new) then
- uci_r:foreach("firewall", "zone",
- function(s)
- if old and s.name == old then
- if not s.network then
- uci_r:set("firewall", s['.name'], "network", old)
- end
- uci_r:set("firewall", s['.name'], "name", new)
- r = true
- return false
- end
- end)
-
- if r then
- uci_r:foreach("firewall", "rule",
- function(s)
- if s.src == old then
- uci_r:set("firewall", s['.name'], "src", new)
- end
- if s.dest == old then
- uci_r:set("firewall", s['.name'], "dest", new)
- end
- end)
-
- uci_r:foreach("firewall", "redirect",
- function(s)
- if s.src == old then
- uci_r:set("firewall", s['.name'], "src", new)
- end
- if s.dest == old then
- uci_r:set("firewall", s['.name'], "dest", new)
- end
- end)
-
- uci_r:foreach("firewall", "forwarding",
- function(s)
- if s.src == old then
- uci_r:set("firewall", s['.name'], "src", new)
- end
- if s.dest == old then
- uci_r:set("firewall", s['.name'], "dest", new)
- end
- end)
- end
- end
-
- return r
-end
-
-function del_network(self, net)
- local z
- if net then
- for _, z in ipairs(self:get_zones()) do
- z:del_network(net)
- end
- end
-end
-
-
-defaults = utl.class()
-function defaults.__init__(self)
- uci_r:foreach("firewall", "defaults",
- function(s)
- self.sid = s['.name']
- return false
- end)
-
- self.sid = self.sid or uci_r:section("firewall", "defaults", nil, { })
-end
-
-function defaults.get(self, opt)
- return _get("firewall", self.sid, opt)
-end
-
-function defaults.set(self, opt, val)
- return _set("firewall", self.sid, opt, val)
-end
-
-function defaults.syn_flood(self)
- return (self:get("syn_flood") == "1")
-end
-
-function defaults.drop_invalid(self)
- return (self:get("drop_invalid") == "1")
-end
-
-function defaults.input(self)
- return self:get("input") or "DROP"
-end
-
-function defaults.forward(self)
- return self:get("forward") or "DROP"
-end
-
-function defaults.output(self)
- return self:get("output") or "DROP"
-end
-
-
-zone = utl.class()
-function zone.__init__(self, z)
- if uci_r:get("firewall", z) == "zone" then
- self.sid = z
- self.data = uci_r:get_all("firewall", z)
- else
- uci_r:foreach("firewall", "zone",
- function(s)
- if s.name == z then
- self.sid = s['.name']
- self.data = s
- return false
- end
- end)
- end
-end
-
-function zone.get(self, opt)
- return _get("firewall", self.sid, opt)
-end
-
-function zone.set(self, opt, val)
- return _set("firewall", self.sid, opt, val)
-end
-
-function zone.masq(self)
- return (self:get("masq") == "1")
-end
-
-function zone.name(self)
- return self:get("name")
-end
-
-function zone.network(self)
- return self:get("network")
-end
-
-function zone.input(self)
- return self:get("input") or defaults():input() or "DROP"
-end
-
-function zone.forward(self)
- return self:get("forward") or defaults():forward() or "DROP"
-end
-
-function zone.output(self)
- return self:get("output") or defaults():output() or "DROP"
-end
-
-function zone.add_network(self, net)
- if uci_r:get("network", net) == "interface" then
- local nets = { }
-
- local n
- for n in utl.imatch(self:get("network") or self:get("name")) do
- if n ~= net then
- nets[#nets+1] = n
- end
- end
-
- nets[#nets+1] = net
-
- _M:del_network(net)
- self:set("network", table.concat(nets, " "))
- end
-end
-
-function zone.del_network(self, net)
- local nets = { }
-
- local n
- for n in utl.imatch(self:get("network") or self:get("name")) do
- if n ~= net then
- nets[#nets+1] = n
- end
- end
-
- if #nets > 0 then
- self:set("network", table.concat(nets, " "))
- else
- self:set("network", " ")
- end
-end
-
-function zone.get_networks(self)
- local nets = { }
-
- local n
- for n in utl.imatch(self:get("network") or self:get("name")) do
- nets[#nets+1] = n
- end
-
- return nets
-end
-
-function zone.clear_networks(self)
- self:set("network", " ")
-end
-
-function zone.get_forwardings_by(self, what)
- local name = self:name()
- local forwards = { }
-
- uci_r:foreach("firewall", "forwarding",
- function(s)
- if s.src and s.dest and s[what] == name then
- forwards[#forwards+1] = forwarding(s['.name'])
- end
- end)
-
- return forwards
-end
-
-function zone.add_forwarding_to(self, dest)
- local exist, forward
-
- for _, forward in ipairs(self:get_forwardings_by('src')) do
- if forward:dest() == dest then
- exist = true
- break
- end
- end
-
- if not exist and dest ~= self:name() and _valid_id(dest) then
- local s = uci_r:section("firewall", "forwarding", nil, {
- src = self:name(),
- dest = dest
- })
-
- return s and forwarding(s)
- end
-end
-
-function zone.add_forwarding_from(self, src)
- local exist, forward
-
- for _, forward in ipairs(self:get_forwardings_by('dest')) do
- if forward:src() == src then
- exist = true
- break
- end
- end
-
- if not exist and src ~= self:name() and _valid_id(src) then
- local s = uci_r:section("firewall", "forwarding", nil, {
- src = src,
- dest = self:name()
- })
-
- return s and forwarding(s)
- end
-end
-
-function zone.del_forwardings_by(self, what)
- local name = self:name()
-
- uci_r:delete_all("firewall", "forwarding",
- function(s)
- return (s.src and s.dest and s[what] == name)
- end)
-end
-
-function zone.add_redirect(self, options)
- options = options or { }
- options.src = self:name()
-
- local s = uci_r:section("firewall", "redirect", nil, options)
- return s and redirect(s)
-end
-
-function zone.add_rule(self, options)
- options = options or { }
- options.src = self:name()
-
- local s = uci_r:section("firewall", "rule", nil, options)
- return s and rule(s)
-end
-
-function zone.get_color(self)
- if self and self:name() == "lan" then
- return "#90f090"
- elseif self and self:name() == "wan" then
- return "#f09090"
- elseif self then
- math.randomseed(tpl.hash(self:name()))
-
- local r = math.random(128)
- local g = math.random(128)
- local min = 0
- local max = 128
-
- if ( r + g ) < 128 then
- min = 128 - r - g
- else
- max = 255 - r - g
- end
-
- local b = min + math.floor( math.random() * ( max - min ) )
-
- return "#%02x%02x%02x" % { 0xFF - r, 0xFF - g, 0xFF - b }
- else
- return "#eeeeee"
- end
-end
-
-
-forwarding = utl.class()
-function forwarding.__init__(self, f)
- self.sid = f
-end
-
-function forwarding.src(self)
- return uci_r:get("firewall", self.sid, "src")
-end
-
-function forwarding.dest(self)
- return uci_r:get("firewall", self.sid, "dest")
-end
-
-function forwarding.src_zone(self)
- return zone(self:src())
-end
-
-function forwarding.dest_zone(self)
- return zone(self:dest())
-end
-
-
-rule = utl.class()
-function rule.__init__(self, f)
- self.sid = f
-end
-
-function rule.get(self, opt)
- return _get("firewall", self.sid, opt)
-end
-
-function rule.set(self, opt, val)
- return _set("firewall", self.sid, opt, val)
-end
-
-function rule.src(self)
- return uci_r:get("firewall", self.sid, "src")
-end
-
-function rule.dest(self)
- return uci_r:get("firewall", self.sid, "dest")
-end
-
-function rule.src_zone(self)
- return zone(self:src())
-end
-
-function rule.dest_zone(self)
- return zone(self:dest())
-end
-
-
-redirect = utl.class()
-function redirect.__init__(self, f)
- self.sid = f
-end
-
-function redirect.get(self, opt)
- return _get("firewall", self.sid, opt)
-end
-
-function redirect.set(self, opt, val)
- return _set("firewall", self.sid, opt, val)
-end
-
-function redirect.src(self)
- return uci_r:get("firewall", self.sid, "src")
-end
-
-function redirect.dest(self)
- return uci_r:get("firewall", self.sid, "dest")
-end
-
-function redirect.src_zone(self)
- return zone(self:src())
-end
-
-function redirect.dest_zone(self)
- return zone(self:dest())
-end
+++ /dev/null
---[[
-LuCI - Network model
-
-Copyright 2009-2010 Jo-Philipp Wich <xm@subsignal.org>
-
-Licensed under the Apache License, Version 2.0 (the "License");
-you may not use this file except in compliance with the License.
-You may obtain a copy of the License at
-
- http://www.apache.org/licenses/LICENSE-2.0
-
-Unless required by applicable law or agreed to in writing, software
-distributed under the License is distributed on an "AS IS" BASIS,
-WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
-See the License for the specific language governing permissions and
-limitations under the License.
-
-]]--
-
-local type, next, pairs, ipairs, loadfile, table
- = type, next, pairs, ipairs, loadfile, table
-
-local tonumber, tostring, math = tonumber, tostring, math
-
-local require = require
-
-local bus = require "ubus"
-local nxo = require "nixio"
-local nfs = require "nixio.fs"
-local ipc = require "luci.ip"
-local sys = require "luci.sys"
-local utl = require "luci.util"
-local dsp = require "luci.dispatcher"
-local uci = require "luci.model.uci"
-local lng = require "luci.i18n"
-
-module "luci.model.network"
-
-
-IFACE_PATTERNS_VIRTUAL = { }
-IFACE_PATTERNS_IGNORE = { "^wmaster%d", "^wifi%d", "^hwsim%d", "^imq%d", "^ifb%d", "^mon%.wlan%d", "^sit%d", "^gre%d", "^lo$" }
-IFACE_PATTERNS_WIRELESS = { "^wlan%d", "^wl%d", "^ath%d", "^%w+%.network%d" }
-
-
-protocol = utl.class()
-
-local _protocols = { }
-
-local _interfaces, _bridge, _switch, _tunnel
-local _ubus, _ubusnetcache, _ubusdevcache, _ubuswificache
-local _uci_real, _uci_state
-
-function _filter(c, s, o, r)
- local val = _uci_real:get(c, s, o)
- if val then
- local l = { }
- if type(val) == "string" then
- for val in val:gmatch("%S+") do
- if val ~= r then
- l[#l+1] = val
- end
- end
- if #l > 0 then
- _uci_real:set(c, s, o, table.concat(l, " "))
- else
- _uci_real:delete(c, s, o)
- end
- elseif type(val) == "table" then
- for _, val in ipairs(val) do
- if val ~= r then
- l[#l+1] = val
- end
- end
- if #l > 0 then
- _uci_real:set(c, s, o, l)
- else
- _uci_real:delete(c, s, o)
- end
- end
- end
-end
-
-function _append(c, s, o, a)
- local val = _uci_real:get(c, s, o) or ""
- if type(val) == "string" then
- local l = { }
- for val in val:gmatch("%S+") do
- if val ~= a then
- l[#l+1] = val
- end
- end
- l[#l+1] = a
- _uci_real:set(c, s, o, table.concat(l, " "))
- elseif type(val) == "table" then
- local l = { }
- for _, val in ipairs(val) do
- if val ~= a then
- l[#l+1] = val
- end
- end
- l[#l+1] = a
- _uci_real:set(c, s, o, l)
- end
-end
-
-function _stror(s1, s2)
- if not s1 or #s1 == 0 then
- return s2 and #s2 > 0 and s2
- else
- return s1
- end
-end
-
-function _get(c, s, o)
- return _uci_real:get(c, s, o)
-end
-
-function _set(c, s, o, v)
- if v ~= nil then
- if type(v) == "boolean" then v = v and "1" or "0" end
- return _uci_real:set(c, s, o, v)
- else
- return _uci_real:delete(c, s, o)
- end
-end
-
-function _wifi_iface(x)
- local _, p
- for _, p in ipairs(IFACE_PATTERNS_WIRELESS) do
- if x:match(p) then
- return true
- end
- end
- return false
-end
-
-function _wifi_state(key, val, field)
- if not next(_ubuswificache) then
- _ubuswificache = _ubus:call("network.wireless", "status", {}) or {}
- end
-
- local radio, radiostate
- for radio, radiostate in pairs(_ubuswificache) do
- local ifc, ifcstate
- for ifc, ifcstate in pairs(radiostate.interfaces) do
- if ifcstate[key] == val then
- return ifcstate[field]
- end
- end
- end
-end
-
-function _wifi_lookup(ifn)
- -- got a radio#.network# pseudo iface, locate the corresponding section
- local radio, ifnidx = ifn:match("^(%w+)%.network(%d+)$")
- if radio and ifnidx then
- local sid = nil
- local num = 0
-
- ifnidx = tonumber(ifnidx)
- _uci_real:foreach("wireless", "wifi-iface",
- function(s)
- if s.device == radio then
- num = num + 1
- if num == ifnidx then
- sid = s['.name']
- return false
- end
- end
- end)
-
- return sid
-
- -- looks like wifi, try to locate the section via state vars
- elseif _wifi_iface(ifn) then
- local sid = _wifi_state("ifname", ifn, "section")
- if not sid then
- _uci_state:foreach("wireless", "wifi-iface",
- function(s)
- if s.ifname == ifn then
- sid = s['.name']
- return false
- end
- end)
- end
-
- return sid
- end
-end
-
-function _iface_virtual(x)
- local _, p
- for _, p in ipairs(IFACE_PATTERNS_VIRTUAL) do
- if x:match(p) then
- return true
- end
- end
- return false
-end
-
-function _iface_ignore(x)
- local _, p
- for _, p in ipairs(IFACE_PATTERNS_IGNORE) do
- if x:match(p) then
- return true
- end
- end
- return _iface_virtual(x)
-end
-
-
-function init(cursor)
- _uci_real = cursor or _uci_real or uci.cursor()
- _uci_state = _uci_real:substate()
-
- _interfaces = { }
- _bridge = { }
- _switch = { }
- _tunnel = { }
-
- _ubus = bus.connect()
- _ubusnetcache = { }
- _ubusdevcache = { }
- _ubuswificache = { }
-
- -- read interface information
- local n, i
- for n, i in ipairs(nxo.getifaddrs()) do
- local name = i.name:match("[^:]+")
- local prnt = name:match("^([^%.]+)%.")
-
- if _iface_virtual(name) then
- _tunnel[name] = true
- end
-
- if _tunnel[name] or not _iface_ignore(name) then
- _interfaces[name] = _interfaces[name] or {
- idx = i.ifindex or n,
- name = name,
- rawname = i.name,
- flags = { },
- ipaddrs = { },
- ip6addrs = { }
- }
-
- if prnt then
- _switch[name] = true
- _switch[prnt] = true
- end
-
- if i.family == "packet" then
- _interfaces[name].flags = i.flags
- _interfaces[name].stats = i.data
- _interfaces[name].macaddr = i.addr
- elseif i.family == "inet" then
- _interfaces[name].ipaddrs[#_interfaces[name].ipaddrs+1] = ipc.IPv4(i.addr, i.netmask)
- elseif i.family == "inet6" then
- _interfaces[name].ip6addrs[#_interfaces[name].ip6addrs+1] = ipc.IPv6(i.addr, i.netmask)
- end
- end
- end
-
- -- read bridge informaton
- local b, l
- for l in utl.execi("brctl show") do
- if not l:match("STP") then
- local r = utl.split(l, "%s+", nil, true)
- if #r == 4 then
- b = {
- name = r[1],
- id = r[2],
- stp = r[3] == "yes",
- ifnames = { _interfaces[r[4]] }
- }
- if b.ifnames[1] then
- b.ifnames[1].bridge = b
- end
- _bridge[r[1]] = b
- elseif b then
- b.ifnames[#b.ifnames+1] = _interfaces[r[2]]
- b.ifnames[#b.ifnames].bridge = b
- end
- end
- end
-
- return _M
-end
-
-function save(self, ...)
- _uci_real:save(...)
- _uci_real:load(...)
-end
-
-function commit(self, ...)
- _uci_real:commit(...)
- _uci_real:load(...)
-end
-
-function ifnameof(self, x)
- if utl.instanceof(x, interface) then
- return x:name()
- elseif utl.instanceof(x, protocol) then
- return x:ifname()
- elseif type(x) == "string" then
- return x:match("^[^:]+")
- end
-end
-
-function get_protocol(self, protoname, netname)
- local v = _protocols[protoname]
- if v then
- return v(netname or "__dummy__")
- end
-end
-
-function get_protocols(self)
- local p = { }
- local _, v
- for _, v in ipairs(_protocols) do
- p[#p+1] = v("__dummy__")
- end
- return p
-end
-
-function register_protocol(self, protoname)
- local proto = utl.class(protocol)
-
- function proto.__init__(self, name)
- self.sid = name
- end
-
- function proto.proto(self)
- return protoname
- end
-
- _protocols[#_protocols+1] = proto
- _protocols[protoname] = proto
-
- return proto
-end
-
-function register_pattern_virtual(self, pat)
- IFACE_PATTERNS_VIRTUAL[#IFACE_PATTERNS_VIRTUAL+1] = pat
-end
-
-
-function has_ipv6(self)
- return nfs.access("/proc/net/ipv6_route")
-end
-
-function add_network(self, n, options)
- local oldnet = self:get_network(n)
- if n and #n > 0 and n:match("^[a-zA-Z0-9_]+$") and not oldnet then
- if _uci_real:section("network", "interface", n, options) then
- return network(n)
- end
- elseif oldnet and oldnet:is_empty() then
- if options then
- local k, v
- for k, v in pairs(options) do
- oldnet:set(k, v)
- end
- end
- return oldnet
- end
-end
-
-function get_network(self, n)
- if n and _uci_real:get("network", n) == "interface" then
- return network(n)
- end
-end
-
-function get_networks(self)
- local nets = { }
- local nls = { }
-
- _uci_real:foreach("network", "interface",
- function(s)
- nls[s['.name']] = network(s['.name'])
- end)
-
- local n
- for n in utl.kspairs(nls) do
- nets[#nets+1] = nls[n]
- end
-
- return nets
-end
-
-function del_network(self, n)
- local r = _uci_real:delete("network", n)
- if r then
- _uci_real:delete_all("network", "alias",
- function(s) return (s.interface == n) end)
-
- _uci_real:delete_all("network", "route",
- function(s) return (s.interface == n) end)
-
- _uci_real:delete_all("network", "route6",
- function(s) return (s.interface == n) end)
-
- _uci_real:foreach("wireless", "wifi-iface",
- function(s)
- local net
- local rest = { }
- for net in utl.imatch(s.network) do
- if net ~= n then
- rest[#rest+1] = net
- end
- end
- if #rest > 0 then
- _uci_real:set("wireless", s['.name'], "network",
- table.concat(rest, " "))
- else
- _uci_real:delete("wireless", s['.name'], "network")
- end
- end)
- end
- return r
-end
-
-function rename_network(self, old, new)
- local r
- if new and #new > 0 and new:match("^[a-zA-Z0-9_]+$") and not self:get_network(new) then
- r = _uci_real:section("network", "interface", new, _uci_real:get_all("network", old))
-
- if r then
- _uci_real:foreach("network", "alias",
- function(s)
- if s.interface == old then
- _uci_real:set("network", s['.name'], "interface", new)
- end
- end)
-
- _uci_real:foreach("network", "route",
- function(s)
- if s.interface == old then
- _uci_real:set("network", s['.name'], "interface", new)
- end
- end)
-
- _uci_real:foreach("network", "route6",
- function(s)
- if s.interface == old then
- _uci_real:set("network", s['.name'], "interface", new)
- end
- end)
-
- _uci_real:foreach("wireless", "wifi-iface",
- function(s)
- local net
- local list = { }
- for net in utl.imatch(s.network) do
- if net == old then
- list[#list+1] = new
- else
- list[#list+1] = net
- end
- end
- if #list > 0 then
- _uci_real:set("wireless", s['.name'], "network",
- table.concat(list, " "))
- end
- end)
-
- _uci_real:delete("network", old)
- end
- end
- return r or false
-end
-
-function get_interface(self, i)
- if _interfaces[i] or _wifi_iface(i) then
- return interface(i)
- else
- local ifc
- local num = { }
- _uci_real:foreach("wireless", "wifi-iface",
- function(s)
- if s.device then
- num[s.device] = num[s.device] and num[s.device] + 1 or 1
- if s['.name'] == i then
- ifc = interface(
- "%s.network%d" %{s.device, num[s.device] })
- return false
- end
- end
- end)
- return ifc
- end
-end
-
-function get_interfaces(self)
- local iface
- local ifaces = { }
- local seen = { }
- local nfs = { }
- local baseof = { }
-
- -- find normal interfaces
- _uci_real:foreach("network", "interface",
- function(s)
- for iface in utl.imatch(s.ifname) do
- if not _iface_ignore(iface) and not _wifi_iface(iface) then
- seen[iface] = true
- nfs[iface] = interface(iface)
- end
- end
- end)
-
- for iface in utl.kspairs(_interfaces) do
- if not (seen[iface] or _iface_ignore(iface) or _wifi_iface(iface)) then
- nfs[iface] = interface(iface)
- end
- end
-
- -- find vlan interfaces
- _uci_real:foreach("network", "switch_vlan",
- function(s)
- if not s.device then
- return
- end
-
- local base = baseof[s.device]
- if not base then
- if not s.device:match("^eth%d") then
- local l
- for l in utl.execi("swconfig dev %q help 2>/dev/null" % s.device) do
- if not base then
- base = l:match("^%w+: (%w+)")
- end
- end
- if not base or not base:match("^eth%d") then
- base = "eth0"
- end
- else
- base = s.device
- end
- baseof[s.device] = base
- end
-
- local vid = tonumber(s.vid or s.vlan)
- if vid ~= nil and vid >= 0 and vid <= 4095 then
- local iface = "%s.%d" %{ base, vid }
- if not seen[iface] then
- seen[iface] = true
- nfs[iface] = interface(iface)
- end
- end
- end)
-
- for iface in utl.kspairs(nfs) do
- ifaces[#ifaces+1] = nfs[iface]
- end
-
- -- find wifi interfaces
- local num = { }
- local wfs = { }
- _uci_real:foreach("wireless", "wifi-iface",
- function(s)
- if s.device then
- num[s.device] = num[s.device] and num[s.device] + 1 or 1
- local i = "%s.network%d" %{ s.device, num[s.device] }
- wfs[i] = interface(i)
- end
- end)
-
- for iface in utl.kspairs(wfs) do
- ifaces[#ifaces+1] = wfs[iface]
- end
-
- return ifaces
-end
-
-function ignore_interface(self, x)
- return _iface_ignore(x)
-end
-
-function get_wifidev(self, dev)
- if _uci_real:get("wireless", dev) == "wifi-device" then
- return wifidev(dev)
- end
-end
-
-function get_wifidevs(self)
- local devs = { }
- local wfd = { }
-
- _uci_real:foreach("wireless", "wifi-device",
- function(s) wfd[#wfd+1] = s['.name'] end)
-
- local dev
- for _, dev in utl.vspairs(wfd) do
- devs[#devs+1] = wifidev(dev)
- end
-
- return devs
-end
-
-function get_wifinet(self, net)
- local wnet = _wifi_lookup(net)
- if wnet then
- return wifinet(wnet)
- end
-end
-
-function add_wifinet(self, net, options)
- if type(options) == "table" and options.device and
- _uci_real:get("wireless", options.device) == "wifi-device"
- then
- local wnet = _uci_real:section("wireless", "wifi-iface", nil, options)
- return wifinet(wnet)
- end
-end
-
-function del_wifinet(self, net)
- local wnet = _wifi_lookup(net)
- if wnet then
- _uci_real:delete("wireless", wnet)
- return true
- end
- return false
-end
-
-function get_status_by_route(self, addr, mask)
- local _, object
- for _, object in ipairs(_ubus:objects()) do
- local net = object:match("^network%.interface%.(.+)")
- if net then
- local s = _ubus:call(object, "status", {})
- if s and s.route then
- local rt
- for _, rt in ipairs(s.route) do
- if not rt.table and rt.target == addr and rt.mask == mask then
- return net, s
- end
- end
- end
- end
- end
-end
-
-function get_status_by_address(self, addr)
- local _, object
- for _, object in ipairs(_ubus:objects()) do
- local net = object:match("^network%.interface%.(.+)")
- if net then
- local s = _ubus:call(object, "status", {})
- if s and s['ipv4-address'] then
- local a
- for _, a in ipairs(s['ipv4-address']) do
- if a.address == addr then
- return net, s
- end
- end
- end
- if s and s['ipv6-address'] then
- local a
- for _, a in ipairs(s['ipv6-address']) do
- if a.address == addr then
- return net, s
- end
- end
- end
- end
- end
-end
-
-function get_wannet(self)
- local net = self:get_status_by_route("0.0.0.0", 0)
- return net and network(net)
-end
-
-function get_wandev(self)
- local _, stat = self:get_status_by_route("0.0.0.0", 0)
- return stat and interface(stat.l3_device or stat.device)
-end
-
-function get_wan6net(self)
- local net = self:get_status_by_route("::", 0)
- return net and network(net)
-end
-
-function get_wan6dev(self)
- local _, stat = self:get_status_by_route("::", 0)
- return stat and interface(stat.l3_device or stat.device)
-end
-
-
-function network(name, proto)
- if name then
- local p = proto or _uci_real:get("network", name, "proto")
- local c = p and _protocols[p] or protocol
- return c(name)
- end
-end
-
-function protocol.__init__(self, name)
- self.sid = name
-end
-
-function protocol._get(self, opt)
- local v = _uci_real:get("network", self.sid, opt)
- if type(v) == "table" then
- return table.concat(v, " ")
- end
- return v or ""
-end
-
-function protocol._ubus(self, field)
- if not _ubusnetcache[self.sid] then
- _ubusnetcache[self.sid] = _ubus:call("network.interface.%s" % self.sid,
- "status", { })
- end
- if _ubusnetcache[self.sid] and field then
- return _ubusnetcache[self.sid][field]
- end
- return _ubusnetcache[self.sid]
-end
-
-function protocol.get(self, opt)
- return _get("network", self.sid, opt)
-end
-
-function protocol.set(self, opt, val)
- return _set("network", self.sid, opt, val)
-end
-
-function protocol.ifname(self)
- local ifname
- if self:is_floating() then
- ifname = self:_ubus("l3_device")
- else
- ifname = self:_ubus("device")
- end
- if not ifname then
- local num = { }
- _uci_real:foreach("wireless", "wifi-iface",
- function(s)
- if s.device then
- num[s.device] = num[s.device]
- and num[s.device] + 1 or 1
-
- local net
- for net in utl.imatch(s.network) do
- if net == self.sid then
- ifname = "%s.network%d" %{ s.device, num[s.device] }
- return false
- end
- end
- end
- end)
- end
- return ifname
-end
-
-function protocol.proto(self)
- return "none"
-end
-
-function protocol.get_i18n(self)
- local p = self:proto()
- if p == "none" then
- return lng.translate("Unmanaged")
- elseif p == "static" then
- return lng.translate("Static address")
- elseif p == "dhcp" then
- return lng.translate("DHCP client")
- else
- return lng.translate("Unknown")
- end
-end
-
-function protocol.type(self)
- return self:_get("type")
-end
-
-function protocol.name(self)
- return self.sid
-end
-
-function protocol.uptime(self)
- return self:_ubus("uptime") or 0
-end
-
-function protocol.expires(self)
- local a = tonumber(_uci_state:get("network", self.sid, "lease_acquired"))
- local l = tonumber(_uci_state:get("network", self.sid, "lease_lifetime"))
- if a and l then
- l = l - (nxo.sysinfo().uptime - a)
- return l > 0 and l or 0
- end
- return -1
-end
-
-function protocol.metric(self)
- return tonumber(_uci_state:get("network", self.sid, "metric")) or 0
-end
-
-function protocol.ipaddr(self)
- local addrs = self:_ubus("ipv4-address")
- return addrs and #addrs > 0 and addrs[1].address
-end
-
-function protocol.netmask(self)
- local addrs = self:_ubus("ipv4-address")
- return addrs and #addrs > 0 and
- ipc.IPv4("0.0.0.0/%d" % addrs[1].mask):mask():string()
-end
-
-function protocol.gwaddr(self)
- local _, route
- for _, route in ipairs(self:_ubus("route") or { }) do
- if route.target == "0.0.0.0" and route.mask == 0 then
- return route.nexthop
- end
- end
-end
-
-function protocol.dnsaddrs(self)
- local dns = { }
- local _, addr
- for _, addr in ipairs(self:_ubus("dns-server") or { }) do
- if not addr:match(":") then
- dns[#dns+1] = addr
- end
- end
- return dns
-end
-
-function protocol.ip6addr(self)
- local addrs = self:_ubus("ipv6-address")
- if addrs and #addrs > 0 then
- return "%s/%d" %{ addrs[1].address, addrs[1].mask }
- else
- addrs = self:_ubus("ipv6-prefix-assignment")
- if addrs and #addrs > 0 then
- return "%s/%d" %{ addrs[1].address, addrs[1].mask }
- end
- end
-end
-
-function protocol.gw6addr(self)
- local _, route
- for _, route in ipairs(self:_ubus("route") or { }) do
- if route.target == "::" and route.mask == 0 then
- return ipc.IPv6(route.nexthop):string()
- end
- end
-end
-
-function protocol.dns6addrs(self)
- local dns = { }
- local _, addr
- for _, addr in ipairs(self:_ubus("dns-server") or { }) do
- if addr:match(":") then
- dns[#dns+1] = addr
- end
- end
- return dns
-end
-
-function protocol.is_bridge(self)
- return (not self:is_virtual() and self:type() == "bridge")
-end
-
-function protocol.opkg_package(self)
- return nil
-end
-
-function protocol.is_installed(self)
- return true
-end
-
-function protocol.is_virtual(self)
- return false
-end
-
-function protocol.is_floating(self)
- return false
-end
-
-function protocol.is_empty(self)
- if self:is_floating() then
- return false
- else
- local rv = true
-
- if (self:_get("ifname") or ""):match("%S+") then
- rv = false
- end
-
- _uci_real:foreach("wireless", "wifi-iface",
- function(s)
- local n
- for n in utl.imatch(s.network) do
- if n == self.sid then
- rv = false
- return false
- end
- end
- end)
-
- return rv
- end
-end
-
-function protocol.add_interface(self, ifname)
- ifname = _M:ifnameof(ifname)
- if ifname and not self:is_floating() then
- -- if its a wifi interface, change its network option
- local wif = _wifi_lookup(ifname)
- if wif then
- _append("wireless", wif, "network", self.sid)
-
- -- add iface to our iface list
- else
- _append("network", self.sid, "ifname", ifname)
- end
- end
-end
-
-function protocol.del_interface(self, ifname)
- ifname = _M:ifnameof(ifname)
- if ifname and not self:is_floating() then
- -- if its a wireless interface, clear its network option
- local wif = _wifi_lookup(ifname)
- if wif then _filter("wireless", wif, "network", self.sid) end
-
- -- remove the interface
- _filter("network", self.sid, "ifname", ifname)
- end
-end
-
-function protocol.get_interface(self)
- if self:is_virtual() then
- _tunnel[self:proto() .. "-" .. self.sid] = true
- return interface(self:proto() .. "-" .. self.sid, self)
- elseif self:is_bridge() then
- _bridge["br-" .. self.sid] = true
- return interface("br-" .. self.sid, self)
- else
- local ifn = nil
- local num = { }
- for ifn in utl.imatch(_uci_real:get("network", self.sid, "ifname")) do
- ifn = ifn:match("^[^:/]+")
- return ifn and interface(ifn, self)
- end
- ifn = nil
- _uci_real:foreach("wireless", "wifi-iface",
- function(s)
- if s.device then
- num[s.device] = num[s.device] and num[s.device] + 1 or 1
-
- local net
- for net in utl.imatch(s.network) do
- if net == self.sid then
- ifn = "%s.network%d" %{ s.device, num[s.device] }
- return false
- end
- end
- end
- end)
- return ifn and interface(ifn, self)
- end
-end
-
-function protocol.get_interfaces(self)
- if self:is_bridge() or (self:is_virtual() and not self:is_floating()) then
- local ifaces = { }
-
- local ifn
- local nfs = { }
- for ifn in utl.imatch(self:get("ifname")) do
- ifn = ifn:match("^[^:/]+")
- nfs[ifn] = interface(ifn, self)
- end
-
- for ifn in utl.kspairs(nfs) do
- ifaces[#ifaces+1] = nfs[ifn]
- end
-
- local num = { }
- local wfs = { }
- _uci_real:foreach("wireless", "wifi-iface",
- function(s)
- if s.device then
- num[s.device] = num[s.device] and num[s.device] + 1 or 1
-
- local net
- for net in utl.imatch(s.network) do
- if net == self.sid then
- ifn = "%s.network%d" %{ s.device, num[s.device] }
- wfs[ifn] = interface(ifn, self)
- end
- end
- end
- end)
-
- for ifn in utl.kspairs(wfs) do
- ifaces[#ifaces+1] = wfs[ifn]
- end
-
- return ifaces
- end
-end
-
-function protocol.contains_interface(self, ifname)
- ifname = _M:ifnameof(ifname)
- if not ifname then
- return false
- elseif self:is_virtual() and self:proto() .. "-" .. self.sid == ifname then
- return true
- elseif self:is_bridge() and "br-" .. self.sid == ifname then
- return true
- else
- local ifn
- for ifn in utl.imatch(self:get("ifname")) do
- ifn = ifn:match("[^:]+")
- if ifn == ifname then
- return true
- end
- end
-
- local wif = _wifi_lookup(ifname)
- if wif then
- local n
- for n in utl.imatch(_uci_real:get("wireless", wif, "network")) do
- if n == self.sid then
- return true
- end
- end
- end
- end
-
- return false
-end
-
-function protocol.adminlink(self)
- return dsp.build_url("admin", "network", "network", self.sid)
-end
-
-
-interface = utl.class()
-
-function interface.__init__(self, ifname, network)
- local wif = _wifi_lookup(ifname)
- if wif then
- self.wif = wifinet(wif)
- self.ifname = _wifi_state("section", wif, "ifname")
- end
-
- self.ifname = self.ifname or ifname
- self.dev = _interfaces[self.ifname]
- self.network = network
-end
-
-function interface._ubus(self, field)
- if not _ubusdevcache[self.ifname] then
- _ubusdevcache[self.ifname] = _ubus:call("network.device", "status",
- { name = self.ifname })
- end
- if _ubusdevcache[self.ifname] and field then
- return _ubusdevcache[self.ifname][field]
- end
- return _ubusdevcache[self.ifname]
-end
-
-function interface.name(self)
- return self.wif and self.wif:ifname() or self.ifname
-end
-
-function interface.mac(self)
- return (self:_ubus("macaddr") or "00:00:00:00:00:00"):upper()
-end
-
-function interface.ipaddrs(self)
- return self.dev and self.dev.ipaddrs or { }
-end
-
-function interface.ip6addrs(self)
- return self.dev and self.dev.ip6addrs or { }
-end
-
-function interface.type(self)
- if self.wif or _wifi_iface(self.ifname) then
- return "wifi"
- elseif _bridge[self.ifname] then
- return "bridge"
- elseif _tunnel[self.ifname] then
- return "tunnel"
- elseif self.ifname:match("%.") then
- return "vlan"
- elseif _switch[self.ifname] then
- return "switch"
- else
- return "ethernet"
- end
-end
-
-function interface.shortname(self)
- if self.wif then
- return "%s %q" %{
- self.wif:active_mode(),
- self.wif:active_ssid() or self.wif:active_bssid()
- }
- else
- return self.ifname
- end
-end
-
-function interface.get_i18n(self)
- if self.wif then
- return "%s: %s %q" %{
- lng.translate("Wireless Network"),
- self.wif:active_mode(),
- self.wif:active_ssid() or self.wif:active_bssid()
- }
- else
- return "%s: %q" %{ self:get_type_i18n(), self:name() }
- end
-end
-
-function interface.get_type_i18n(self)
- local x = self:type()
- if x == "wifi" then
- return lng.translate("Wireless Adapter")
- elseif x == "bridge" then
- return lng.translate("Bridge")
- elseif x == "switch" then
- return lng.translate("Ethernet Switch")
- elseif x == "vlan" then
- return lng.translate("VLAN Interface")
- elseif x == "tunnel" then
- return lng.translate("Tunnel Interface")
- else
- return lng.translate("Ethernet Adapter")
- end
-end
-
-function interface.adminlink(self)
- if self.wif then
- return self.wif:adminlink()
- end
-end
-
-function interface.ports(self)
- local members = self:_ubus("bridge-members")
- if members then
- local _, iface
- local ifaces = { }
- for _, iface in ipairs(members) do
- ifaces[#ifaces+1] = interface(iface)
- end
- end
-end
-
-function interface.bridge_id(self)
- if self.br then
- return self.br.id
- else
- return nil
- end
-end
-
-function interface.bridge_stp(self)
- if self.br then
- return self.br.stp
- else
- return false
- end
-end
-
-function interface.is_up(self)
- return self:_ubus("up") or false
-end
-
-function interface.is_bridge(self)
- return (self:type() == "bridge")
-end
-
-function interface.is_bridgeport(self)
- return self.dev and self.dev.bridge and true or false
-end
-
-function interface.tx_bytes(self)
- local stat = self:_ubus("statistics")
- return stat and stat.tx_bytes or 0
-end
-
-function interface.rx_bytes(self)
- local stat = self:_ubus("statistics")
- return stat and stat.rx_bytes or 0
-end
-
-function interface.tx_packets(self)
- local stat = self:_ubus("statistics")
- return stat and stat.tx_packets or 0
-end
-
-function interface.rx_packets(self)
- local stat = self:_ubus("statistics")
- return stat and stat.rx_packets or 0
-end
-
-function interface.get_network(self)
- return self:get_networks()[1]
-end
-
-function interface.get_networks(self)
- if not self.networks then
- local nets = { }
- local _, net
- for _, net in ipairs(_M:get_networks()) do
- if net:contains_interface(self.ifname) or
- net:ifname() == self.ifname
- then
- nets[#nets+1] = net
- end
- end
- table.sort(nets, function(a, b) return a.sid < b.sid end)
- self.networks = nets
- return nets
- else
- return self.networks
- end
-end
-
-function interface.get_wifinet(self)
- return self.wif
-end
-
-
-wifidev = utl.class()
-
-function wifidev.__init__(self, dev)
- self.sid = dev
- self.iwinfo = dev and sys.wifi.getiwinfo(dev) or { }
-end
-
-function wifidev.get(self, opt)
- return _get("wireless", self.sid, opt)
-end
-
-function wifidev.set(self, opt, val)
- return _set("wireless", self.sid, opt, val)
-end
-
-function wifidev.name(self)
- return self.sid
-end
-
-function wifidev.hwmodes(self)
- local l = self.iwinfo.hwmodelist
- if l and next(l) then
- return l
- else
- return { b = true, g = true }
- end
-end
-
-function wifidev.get_i18n(self)
- local t = "Generic"
- if self.iwinfo.type == "wl" then
- t = "Broadcom"
- elseif self.iwinfo.type == "madwifi" then
- t = "Atheros"
- end
-
- local m = ""
- local l = self:hwmodes()
- if l.a then m = m .. "a" end
- if l.b then m = m .. "b" end
- if l.g then m = m .. "g" end
- if l.n then m = m .. "n" end
-
- return "%s 802.11%s Wireless Controller (%s)" %{ t, m, self:name() }
-end
-
-function wifidev.is_up(self)
- if _ubuswificache[self.sid] then
- return (_ubuswificache[self.sid].up == true)
- end
-
- local up = false
- _uci_state:foreach("wireless", "wifi-iface",
- function(s)
- if s.device == self.sid then
- if s.up == "1" then
- up = true
- return false
- end
- end
- end)
-
- return up
-end
-
-function wifidev.get_wifinet(self, net)
- if _uci_real:get("wireless", net) == "wifi-iface" then
- return wifinet(net)
- else
- local wnet = _wifi_lookup(net)
- if wnet then
- return wifinet(wnet)
- end
- end
-end
-
-function wifidev.get_wifinets(self)
- local nets = { }
-
- _uci_real:foreach("wireless", "wifi-iface",
- function(s)
- if s.device == self.sid then
- nets[#nets+1] = wifinet(s['.name'])
- end
- end)
-
- return nets
-end
-
-function wifidev.add_wifinet(self, options)
- options = options or { }
- options.device = self.sid
-
- local wnet = _uci_real:section("wireless", "wifi-iface", nil, options)
- if wnet then
- return wifinet(wnet, options)
- end
-end
-
-function wifidev.del_wifinet(self, net)
- if utl.instanceof(net, wifinet) then
- net = net.sid
- elseif _uci_real:get("wireless", net) ~= "wifi-iface" then
- net = _wifi_lookup(net)
- end
-
- if net and _uci_real:get("wireless", net, "device") == self.sid then
- _uci_real:delete("wireless", net)
- return true
- end
-
- return false
-end
-
-
-wifinet = utl.class()
-
-function wifinet.__init__(self, net, data)
- self.sid = net
-
- local num = { }
- local netid
- _uci_real:foreach("wireless", "wifi-iface",
- function(s)
- if s.device then
- num[s.device] = num[s.device] and num[s.device] + 1 or 1
- if s['.name'] == self.sid then
- netid = "%s.network%d" %{ s.device, num[s.device] }
- return false
- end
- end
- end)
-
- local dev = _wifi_state("section", self.sid, "ifname") or netid
-
- self.netid = netid
- self.wdev = dev
- self.iwinfo = dev and sys.wifi.getiwinfo(dev) or { }
- self.iwdata = data or _uci_state:get_all("wireless", self.sid) or
- _uci_real:get_all("wireless", self.sid) or { }
-end
-
-function wifinet.get(self, opt)
- return _get("wireless", self.sid, opt)
-end
-
-function wifinet.set(self, opt, val)
- return _set("wireless", self.sid, opt, val)
-end
-
-function wifinet.mode(self)
- return _uci_state:get("wireless", self.sid, "mode") or "ap"
-end
-
-function wifinet.ssid(self)
- return _uci_state:get("wireless", self.sid, "ssid")
-end
-
-function wifinet.bssid(self)
- return _uci_state:get("wireless", self.sid, "bssid")
-end
-
-function wifinet.network(self)
- return _uci_state:get("wifinet", self.sid, "network")
-end
-
-function wifinet.id(self)
- return self.netid
-end
-
-function wifinet.name(self)
- return self.sid
-end
-
-function wifinet.ifname(self)
- local ifname = self.iwinfo.ifname
- if not ifname or ifname:match("^wifi%d") or ifname:match("^radio%d") then
- ifname = self.wdev
- end
- return ifname
-end
-
-function wifinet.get_device(self)
- if self.iwdata.device then
- return wifidev(self.iwdata.device)
- end
-end
-
-function wifinet.is_up(self)
- local ifc = self:get_interface()
- return (ifc and ifc:is_up() or false)
-end
-
-function wifinet.active_mode(self)
- local m = _stror(self.iwinfo.mode, self.iwdata.mode) or "ap"
-
- if m == "ap" then m = "Master"
- elseif m == "sta" then m = "Client"
- elseif m == "adhoc" then m = "Ad-Hoc"
- elseif m == "mesh" then m = "Mesh"
- elseif m == "monitor" then m = "Monitor"
- end
-
- return m
-end
-
-function wifinet.active_mode_i18n(self)
- return lng.translate(self:active_mode())
-end
-
-function wifinet.active_ssid(self)
- return _stror(self.iwinfo.ssid, self.iwdata.ssid)
-end
-
-function wifinet.active_bssid(self)
- return _stror(self.iwinfo.bssid, self.iwdata.bssid) or "00:00:00:00:00:00"
-end
-
-function wifinet.active_encryption(self)
- local enc = self.iwinfo and self.iwinfo.encryption
- return enc and enc.description or "-"
-end
-
-function wifinet.assoclist(self)
- return self.iwinfo.assoclist or { }
-end
-
-function wifinet.frequency(self)
- local freq = self.iwinfo.frequency
- if freq and freq > 0 then
- return "%.03f" % (freq / 1000)
- end
-end
-
-function wifinet.bitrate(self)
- local rate = self.iwinfo.bitrate
- if rate and rate > 0 then
- return (rate / 1000)
- end
-end
-
-function wifinet.channel(self)
- return self.iwinfo.channel or
- tonumber(_uci_state:get("wireless", self.iwdata.device, "channel"))
-end
-
-function wifinet.signal(self)
- return self.iwinfo.signal or 0
-end
-
-function wifinet.noise(self)
- return self.iwinfo.noise or 0
-end
-
-function wifinet.country(self)
- return self.iwinfo.country or "00"
-end
-
-function wifinet.txpower(self)
- local pwr = (self.iwinfo.txpower or 0)
- return pwr + self:txpower_offset()
-end
-
-function wifinet.txpower_offset(self)
- return self.iwinfo.txpower_offset or 0
-end
-
-function wifinet.signal_level(self, s, n)
- if self:active_bssid() ~= "00:00:00:00:00:00" then
- local signal = s or self:signal()
- local noise = n or self:noise()
-
- if signal < 0 and noise < 0 then
- local snr = -1 * (noise - signal)
- return math.floor(snr / 5)
- else
- return 0
- end
- else
- return -1
- end
-end
-
-function wifinet.signal_percent(self)
- local qc = self.iwinfo.quality or 0
- local qm = self.iwinfo.quality_max or 0
-
- if qc > 0 and qm > 0 then
- return math.floor((100 / qm) * qc)
- else
- return 0
- end
-end
-
-function wifinet.shortname(self)
- return "%s %q" %{
- lng.translate(self:active_mode()),
- self:active_ssid() or self:active_bssid()
- }
-end
-
-function wifinet.get_i18n(self)
- return "%s: %s %q (%s)" %{
- lng.translate("Wireless Network"),
- lng.translate(self:active_mode()),
- self:active_ssid() or self:active_bssid(),
- self:ifname()
- }
-end
-
-function wifinet.adminlink(self)
- return dsp.build_url("admin", "network", "wireless", self.netid)
-end
-
-function wifinet.get_network(self)
- return self:get_networks()[1]
-end
-
-function wifinet.get_networks(self)
- local nets = { }
- local net
- for net in utl.imatch(tostring(self.iwdata.network)) do
- if _uci_real:get("network", net) == "interface" then
- nets[#nets+1] = network(net)
- end
- end
- table.sort(nets, function(a, b) return a.sid < b.sid end)
- return nets
-end
-
-function wifinet.get_interface(self)
- return interface(self:ifname())
-end
-
-
--- setup base protocols
-_M:register_protocol("static")
-_M:register_protocol("dhcp")
-_M:register_protocol("none")
-
--- load protocol extensions
-local exts = nfs.dir(utl.libpath() .. "/model/network")
-if exts then
- local ext
- for ext in exts do
- if ext:match("%.lua$") then
- require("luci.model.network." .. ext:gsub("%.lua$", ""))
- end
- end
-end
+++ /dev/null
---[[
-LuCI - UCI model
-
-Description:
-Generalized UCI model
-
-FileId:
-$Id$
-
-License:
-Copyright 2008 Steven Barth <steven@midlink.org>
-
-Licensed under the Apache License, Version 2.0 (the "License");
-you may not use this file except in compliance with the License.
-You may obtain a copy of the License at
-
- http://www.apache.org/licenses/LICENSE-2.0
-
-Unless required by applicable law or agreed to in writing, software
-distributed under the License is distributed on an "AS IS" BASIS,
-WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
-See the License for the specific language governing permissions and
-limitations under the License.
-
-]]--
-local os = require "os"
-local uci = require "uci"
-local util = require "luci.util"
-local table = require "table"
-
-
-local setmetatable, rawget, rawset = setmetatable, rawget, rawset
-local require, getmetatable = require, getmetatable
-local error, pairs, ipairs = error, pairs, ipairs
-local type, tostring, tonumber, unpack = type, tostring, tonumber, unpack
-
---- LuCI UCI model library.
--- The typical workflow for UCI is: Get a cursor instance from the
--- cursor factory, modify data (via Cursor.add, Cursor.delete, etc.),
--- save the changes to the staging area via Cursor.save and finally
--- Cursor.commit the data to the actual config files.
--- LuCI then needs to Cursor.apply the changes so deamons etc. are
--- reloaded.
--- @cstyle instance
-module "luci.model.uci"
-
---- Create a new UCI-Cursor.
--- @class function
--- @name cursor
--- @return UCI-Cursor
-cursor = uci.cursor
-
-APIVERSION = uci.APIVERSION
-
---- Create a new Cursor initialized to the state directory.
--- @return UCI cursor
-function cursor_state()
- return cursor(nil, "/var/state")
-end
-
-
-inst = cursor()
-inst_state = cursor_state()
-
-local Cursor = getmetatable(inst)
-
---- Applies UCI configuration changes
--- @param configlist List of UCI configurations
--- @param command Don't apply only return the command
-function Cursor.apply(self, configlist, command)
- configlist = self:_affected(configlist)
- if command then
- return { "/sbin/luci-reload", unpack(configlist) }
- else
- return os.execute("/sbin/luci-reload %s >/dev/null 2>&1"
- % table.concat(configlist, " "))
- end
-end
-
-
---- Delete all sections of a given type that match certain criteria.
--- @param config UCI config
--- @param type UCI section type
--- @param comparator Function that will be called for each section and
--- returns a boolean whether to delete the current section (optional)
-function Cursor.delete_all(self, config, stype, comparator)
- local del = {}
-
- if type(comparator) == "table" then
- local tbl = comparator
- comparator = function(section)
- for k, v in pairs(tbl) do
- if section[k] ~= v then
- return false
- end
- end
- return true
- end
- end
-
- local function helper (section)
-
- if not comparator or comparator(section) then
- del[#del+1] = section[".name"]
- end
- end
-
- self:foreach(config, stype, helper)
-
- for i, j in ipairs(del) do
- self:delete(config, j)
- end
-end
-
---- Create a new section and initialize it with data.
--- @param config UCI config
--- @param type UCI section type
--- @param name UCI section name (optional)
--- @param values Table of key - value pairs to initialize the section with
--- @return Name of created section
-function Cursor.section(self, config, type, name, values)
- local stat = true
- if name then
- stat = self:set(config, name, type)
- else
- name = self:add(config, type)
- stat = name and true
- end
-
- if stat and values then
- stat = self:tset(config, name, values)
- end
-
- return stat and name
-end
-
---- Updated the data of a section using data from a table.
--- @param config UCI config
--- @param section UCI section name (optional)
--- @param values Table of key - value pairs to update the section with
-function Cursor.tset(self, config, section, values)
- local stat = true
- for k, v in pairs(values) do
- if k:sub(1, 1) ~= "." then
- stat = stat and self:set(config, section, k, v)
- end
- end
- return stat
-end
-
---- Get a boolean option and return it's value as true or false.
--- @param config UCI config
--- @param section UCI section name
--- @param option UCI option
--- @return Boolean
-function Cursor.get_bool(self, ...)
- local val = self:get(...)
- return ( val == "1" or val == "true" or val == "yes" or val == "on" )
-end
-
---- Get an option or list and return values as table.
--- @param config UCI config
--- @param section UCI section name
--- @param option UCI option
--- @return UCI value
-function Cursor.get_list(self, config, section, option)
- if config and section and option then
- local val = self:get(config, section, option)
- return ( type(val) == "table" and val or { val } )
- end
- return nil
-end
-
---- Get the given option from the first section with the given type.
--- @param config UCI config
--- @param type UCI section type
--- @param option UCI option (optional)
--- @param default Default value (optional)
--- @return UCI value
-function Cursor.get_first(self, conf, stype, opt, def)
- local rv = def
-
- self:foreach(conf, stype,
- function(s)
- local val = not opt and s['.name'] or s[opt]
-
- if type(def) == "number" then
- val = tonumber(val)
- elseif type(def) == "boolean" then
- val = (val == "1" or val == "true" or
- val == "yes" or val == "on")
- end
-
- if val ~= nil then
- rv = val
- return false
- end
- end)
-
- return rv
-end
-
---- Set given values as list.
--- @param config UCI config
--- @param section UCI section name
--- @param option UCI option
--- @param value UCI value
--- @return Boolean whether operation succeeded
-function Cursor.set_list(self, config, section, option, value)
- if config and section and option then
- return self:set(
- config, section, option,
- ( type(value) == "table" and value or { value } )
- )
- end
- return false
-end
-
--- Return a list of initscripts affected by configuration changes.
-function Cursor._affected(self, configlist)
- configlist = type(configlist) == "table" and configlist or {configlist}
-
- local c = cursor()
- c:load("ucitrack")
-
- -- Resolve dependencies
- local reloadlist = {}
-
- local function _resolve_deps(name)
- local reload = {name}
- local deps = {}
-
- c:foreach("ucitrack", name,
- function(section)
- if section.affects then
- for i, aff in ipairs(section.affects) do
- deps[#deps+1] = aff
- end
- end
- end)
-
- for i, dep in ipairs(deps) do
- for j, add in ipairs(_resolve_deps(dep)) do
- reload[#reload+1] = add
- end
- end
-
- return reload
- end
-
- -- Collect initscripts
- for j, config in ipairs(configlist) do
- for i, e in ipairs(_resolve_deps(config)) do
- if not util.contains(reloadlist, e) then
- reloadlist[#reloadlist+1] = e
- end
- end
- end
-
- return reloadlist
-end
-
---- Create a sub-state of this cursor. The sub-state is tied to the parent
--- curser, means it the parent unloads or loads configs, the sub state will
--- do so as well.
--- @return UCI state cursor tied to the parent cursor
-function Cursor.substate(self)
- Cursor._substates = Cursor._substates or { }
- Cursor._substates[self] = Cursor._substates[self] or cursor_state()
- return Cursor._substates[self]
-end
-
-local _load = Cursor.load
-function Cursor.load(self, ...)
- if Cursor._substates and Cursor._substates[self] then
- _load(Cursor._substates[self], ...)
- end
- return _load(self, ...)
-end
-
-local _unload = Cursor.unload
-function Cursor.unload(self, ...)
- if Cursor._substates and Cursor._substates[self] then
- _unload(Cursor._substates[self], ...)
- end
- return _unload(self, ...)
-end
-
-
---- Add an anonymous section.
--- @class function
--- @name Cursor.add
--- @param config UCI config
--- @param type UCI section type
--- @return Name of created section
-
---- Get a table of saved but uncommitted changes.
--- @class function
--- @name Cursor.changes
--- @param config UCI config
--- @return Table of changes
--- @see Cursor.save
-
---- Commit saved changes.
--- @class function
--- @name Cursor.commit
--- @param config UCI config
--- @return Boolean whether operation succeeded
--- @see Cursor.revert
--- @see Cursor.save
-
---- Deletes a section or an option.
--- @class function
--- @name Cursor.delete
--- @param config UCI config
--- @param section UCI section name
--- @param option UCI option (optional)
--- @return Boolean whether operation succeeded
-
---- Call a function for every section of a certain type.
--- @class function
--- @name Cursor.foreach
--- @param config UCI config
--- @param type UCI section type
--- @param callback Function to be called
--- @return Boolean whether operation succeeded
-
---- Get a section type or an option
--- @class function
--- @name Cursor.get
--- @param config UCI config
--- @param section UCI section name
--- @param option UCI option (optional)
--- @return UCI value
-
---- Get all sections of a config or all values of a section.
--- @class function
--- @name Cursor.get_all
--- @param config UCI config
--- @param section UCI section name (optional)
--- @return Table of UCI sections or table of UCI values
-
---- Manually load a config.
--- @class function
--- @name Cursor.load
--- @param config UCI config
--- @return Boolean whether operation succeeded
--- @see Cursor.save
--- @see Cursor.unload
-
---- Revert saved but uncommitted changes.
--- @class function
--- @name Cursor.revert
--- @param config UCI config
--- @return Boolean whether operation succeeded
--- @see Cursor.commit
--- @see Cursor.save
-
---- Saves changes made to a config to make them committable.
--- @class function
--- @name Cursor.save
--- @param config UCI config
--- @return Boolean whether operation succeeded
--- @see Cursor.load
--- @see Cursor.unload
-
---- Set a value or create a named section.
--- @class function
--- @name Cursor.set
--- @param config UCI config
--- @param section UCI section name
--- @param option UCI option or UCI section type
--- @param value UCI value or nil if you want to create a section
--- @return Boolean whether operation succeeded
-
---- Get the configuration directory.
--- @class function
--- @name Cursor.get_confdir
--- @return Configuration directory
-
---- Get the directory for uncomitted changes.
--- @class function
--- @name Cursor.get_savedir
--- @return Save directory
-
---- Set the configuration directory.
--- @class function
--- @name Cursor.set_confdir
--- @param directory UCI configuration directory
--- @return Boolean whether operation succeeded
-
---- Set the directory for uncommited changes.
--- @class function
--- @name Cursor.set_savedir
--- @param directory UCI changes directory
--- @return Boolean whether operation succeeded
-
---- Discard changes made to a config.
--- @class function
--- @name Cursor.unload
--- @param config UCI config
--- @return Boolean whether operation succeeded
--- @see Cursor.load
--- @see Cursor.save
+++ /dev/null
---[[
-
-LuCI - Lua Development Framework
-(c) 2009 Steven Barth <steven@midlink.org>
-(c) 2009 Jo-Philipp Wich <xm@leipzig.freifunk.net>
-
-Licensed under the Apache License, Version 2.0 (the "License");
-you may not use this file except in compliance with the License.
-You may obtain a copy of the License at
-
- http://www.apache.org/licenses/LICENSE-2.0
-
-]]--
-
-local util = require "luci.util"
-module("luci.store", util.threadlocal)
\ No newline at end of file
+++ /dev/null
---[[
-LuCI - Utility library
-
-Description:
-Several common useful Lua functions
-
-License:
-Copyright 2008 Steven Barth <steven@midlink.org>
-
-Licensed under the Apache License, Version 2.0 (the "License");
-you may not use this file except in compliance with the License.
-You may obtain a copy of the License at
-
- http://www.apache.org/licenses/LICENSE-2.0
-
-Unless required by applicable law or agreed to in writing, software
-distributed under the License is distributed on an "AS IS" BASIS,
-WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
-See the License for the specific language governing permissions and
-limitations under the License.
-
-]]--
-
-local io = require "io"
-local math = require "math"
-local table = require "table"
-local debug = require "debug"
-local ldebug = require "luci.debug"
-local string = require "string"
-local coroutine = require "coroutine"
-local tparser = require "luci.template.parser"
-
-local getmetatable, setmetatable = getmetatable, setmetatable
-local rawget, rawset, unpack = rawget, rawset, unpack
-local tostring, type, assert = tostring, type, assert
-local ipairs, pairs, next, loadstring = ipairs, pairs, next, loadstring
-local require, pcall, xpcall = require, pcall, xpcall
-local collectgarbage, get_memory_limit = collectgarbage, get_memory_limit
-
---- LuCI utility functions.
-module "luci.util"
-
---
--- Pythonic string formatting extension
---
-getmetatable("").__mod = function(a, b)
- if not b then
- return a
- elseif type(b) == "table" then
- for k, _ in pairs(b) do if type(b[k]) == "userdata" then b[k] = tostring(b[k]) end end
- return a:format(unpack(b))
- else
- if type(b) == "userdata" then b = tostring(b) end
- return a:format(b)
- end
-end
-
-
---
--- Class helper routines
---
-
--- Instantiates a class
-local function _instantiate(class, ...)
- local inst = setmetatable({}, {__index = class})
-
- if inst.__init__ then
- inst:__init__(...)
- end
-
- return inst
-end
-
---- Create a Class object (Python-style object model).
--- The class object can be instantiated by calling itself.
--- Any class functions or shared parameters can be attached to this object.
--- Attaching a table to the class object makes this table shared between
--- all instances of this class. For object parameters use the __init__ function.
--- Classes can inherit member functions and values from a base class.
--- Class can be instantiated by calling them. All parameters will be passed
--- to the __init__ function of this class - if such a function exists.
--- The __init__ function must be used to set any object parameters that are not shared
--- with other objects of this class. Any return values will be ignored.
--- @param base The base class to inherit from (optional)
--- @return A class object
--- @see instanceof
--- @see clone
-function class(base)
- return setmetatable({}, {
- __call = _instantiate,
- __index = base
- })
-end
-
---- Test whether the given object is an instance of the given class.
--- @param object Object instance
--- @param class Class object to test against
--- @return Boolean indicating whether the object is an instance
--- @see class
--- @see clone
-function instanceof(object, class)
- local meta = getmetatable(object)
- while meta and meta.__index do
- if meta.__index == class then
- return true
- end
- meta = getmetatable(meta.__index)
- end
- return false
-end
-
-
---
--- Scope manipulation routines
---
-
-local tl_meta = {
- __mode = "k",
-
- __index = function(self, key)
- local t = rawget(self, coxpt[coroutine.running()]
- or coroutine.running() or 0)
- return t and t[key]
- end,
-
- __newindex = function(self, key, value)
- local c = coxpt[coroutine.running()] or coroutine.running() or 0
- if not rawget(self, c) then
- rawset(self, c, { [key] = value })
- else
- rawget(self, c)[key] = value
- end
- end
-}
-
---- Create a new or get an already existing thread local store associated with
--- the current active coroutine. A thread local store is private a table object
--- whose values can't be accessed from outside of the running coroutine.
--- @return Table value representing the corresponding thread local store
-function threadlocal(tbl)
- return setmetatable(tbl or {}, tl_meta)
-end
-
-
---
--- Debugging routines
---
-
---- Write given object to stderr.
--- @param obj Value to write to stderr
--- @return Boolean indicating whether the write operation was successful
-function perror(obj)
- return io.stderr:write(tostring(obj) .. "\n")
-end
-
---- Recursively dumps a table to stdout, useful for testing and debugging.
--- @param t Table value to dump
--- @param maxdepth Maximum depth
--- @return Always nil
-function dumptable(t, maxdepth, i, seen)
- i = i or 0
- seen = seen or setmetatable({}, {__mode="k"})
-
- for k,v in pairs(t) do
- perror(string.rep("\t", i) .. tostring(k) .. "\t" .. tostring(v))
- if type(v) == "table" and (not maxdepth or i < maxdepth) then
- if not seen[v] then
- seen[v] = true
- dumptable(v, maxdepth, i+1, seen)
- else
- perror(string.rep("\t", i) .. "*** RECURSION ***")
- end
- end
- end
-end
-
-
---
--- String and data manipulation routines
---
-
---- Create valid XML PCDATA from given string.
--- @param value String value containing the data to escape
--- @return String value containing the escaped data
-function pcdata(value)
- return value and tparser.pcdata(tostring(value))
-end
-
---- Strip HTML tags from given string.
--- @param value String containing the HTML text
--- @return String with HTML tags stripped of
-function striptags(value)
- return value and tparser.striptags(tostring(value))
-end
-
---- Splits given string on a defined separator sequence and return a table
--- containing the resulting substrings. The optional max parameter specifies
--- the number of bytes to process, regardless of the actual length of the given
--- string. The optional last parameter, regex, specifies whether the separator
--- sequence is interpreted as regular expression.
--- @param str String value containing the data to split up
--- @param pat String with separator pattern (optional, defaults to "\n")
--- @param max Maximum times to split (optional)
--- @param regex Boolean indicating whether to interpret the separator
--- pattern as regular expression (optional, default is false)
--- @return Table containing the resulting substrings
-function split(str, pat, max, regex)
- pat = pat or "\n"
- max = max or #str
-
- local t = {}
- local c = 1
-
- if #str == 0 then
- return {""}
- end
-
- if #pat == 0 then
- return nil
- end
-
- if max == 0 then
- return str
- end
-
- repeat
- local s, e = str:find(pat, c, not regex)
- max = max - 1
- if s and max < 0 then
- t[#t+1] = str:sub(c)
- else
- t[#t+1] = str:sub(c, s and s - 1)
- end
- c = e and e + 1 or #str + 1
- until not s or max < 0
-
- return t
-end
-
---- Remove leading and trailing whitespace from given string value.
--- @param str String value containing whitespace padded data
--- @return String value with leading and trailing space removed
-function trim(str)
- return (str:gsub("^%s*(.-)%s*$", "%1"))
-end
-
---- Count the occurences of given substring in given string.
--- @param str String to search in
--- @param pattern String containing pattern to find
--- @return Number of found occurences
-function cmatch(str, pat)
- local count = 0
- for _ in str:gmatch(pat) do count = count + 1 end
- return count
-end
-
---- Return a matching iterator for the given value. The iterator will return
--- one token per invocation, the tokens are separated by whitespace. If the
--- input value is a table, it is transformed into a string first. A nil value
--- will result in a valid interator which aborts with the first invocation.
--- @param val The value to scan (table, string or nil)
--- @return Iterator which returns one token per call
-function imatch(v)
- if type(v) == "table" then
- local k = nil
- return function()
- k = next(v, k)
- return v[k]
- end
-
- elseif type(v) == "number" or type(v) == "boolean" then
- local x = true
- return function()
- if x then
- x = false
- return tostring(v)
- end
- end
-
- elseif type(v) == "userdata" or type(v) == "string" then
- return tostring(v):gmatch("%S+")
- end
-
- return function() end
-end
-
---- Parse certain units from the given string and return the canonical integer
--- value or 0 if the unit is unknown. Upper- or lower case is irrelevant.
--- Recognized units are:
--- o "y" - one year (60*60*24*366)
--- o "m" - one month (60*60*24*31)
--- o "w" - one week (60*60*24*7)
--- o "d" - one day (60*60*24)
--- o "h" - one hour (60*60)
--- o "min" - one minute (60)
--- o "kb" - one kilobyte (1024)
--- o "mb" - one megabyte (1024*1024)
--- o "gb" - one gigabyte (1024*1024*1024)
--- o "kib" - one si kilobyte (1000)
--- o "mib" - one si megabyte (1000*1000)
--- o "gib" - one si gigabyte (1000*1000*1000)
--- @param ustr String containing a numerical value with trailing unit
--- @return Number containing the canonical value
-function parse_units(ustr)
-
- local val = 0
-
- -- unit map
- local map = {
- -- date stuff
- y = 60 * 60 * 24 * 366,
- m = 60 * 60 * 24 * 31,
- w = 60 * 60 * 24 * 7,
- d = 60 * 60 * 24,
- h = 60 * 60,
- min = 60,
-
- -- storage sizes
- kb = 1024,
- mb = 1024 * 1024,
- gb = 1024 * 1024 * 1024,
-
- -- storage sizes (si)
- kib = 1000,
- mib = 1000 * 1000,
- gib = 1000 * 1000 * 1000
- }
-
- -- parse input string
- for spec in ustr:lower():gmatch("[0-9%.]+[a-zA-Z]*") do
-
- local num = spec:gsub("[^0-9%.]+$","")
- local spn = spec:gsub("^[0-9%.]+", "")
-
- if map[spn] or map[spn:sub(1,1)] then
- val = val + num * ( map[spn] or map[spn:sub(1,1)] )
- else
- val = val + num
- end
- end
-
-
- return val
-end
-
--- also register functions above in the central string class for convenience
-string.pcdata = pcdata
-string.striptags = striptags
-string.split = split
-string.trim = trim
-string.cmatch = cmatch
-string.parse_units = parse_units
-
-
---- Appends numerically indexed tables or single objects to a given table.
--- @param src Target table
--- @param ... Objects to insert
--- @return Target table
-function append(src, ...)
- for i, a in ipairs({...}) do
- if type(a) == "table" then
- for j, v in ipairs(a) do
- src[#src+1] = v
- end
- else
- src[#src+1] = a
- end
- end
- return src
-end
-
---- Combines two or more numerically indexed tables and single objects into one table.
--- @param tbl1 Table value to combine
--- @param tbl2 Table value to combine
--- @param ... More tables to combine
--- @return Table value containing all values of given tables
-function combine(...)
- return append({}, ...)
-end
-
---- Checks whether the given table contains the given value.
--- @param table Table value
--- @param value Value to search within the given table
--- @return Boolean indicating whether the given value occurs within table
-function contains(table, value)
- for k, v in pairs(table) do
- if value == v then
- return k
- end
- end
- return false
-end
-
---- Update values in given table with the values from the second given table.
--- Both table are - in fact - merged together.
--- @param t Table which should be updated
--- @param updates Table containing the values to update
--- @return Always nil
-function update(t, updates)
- for k, v in pairs(updates) do
- t[k] = v
- end
-end
-
---- Retrieve all keys of given associative table.
--- @param t Table to extract keys from
--- @return Sorted table containing the keys
-function keys(t)
- local keys = { }
- if t then
- for k, _ in kspairs(t) do
- keys[#keys+1] = k
- end
- end
- return keys
-end
-
---- Clones the given object and return it's copy.
--- @param object Table value to clone
--- @param deep Boolean indicating whether to do recursive cloning
--- @return Cloned table value
-function clone(object, deep)
- local copy = {}
-
- for k, v in pairs(object) do
- if deep and type(v) == "table" then
- v = clone(v, deep)
- end
- copy[k] = v
- end
-
- return setmetatable(copy, getmetatable(object))
-end
-
-
---- Create a dynamic table which automatically creates subtables.
--- @return Dynamic Table
-function dtable()
- return setmetatable({}, { __index =
- function(tbl, key)
- return rawget(tbl, key)
- or rawget(rawset(tbl, key, dtable()), key)
- end
- })
-end
-
-
--- Serialize the contents of a table value.
-function _serialize_table(t, seen)
- assert(not seen[t], "Recursion detected.")
- seen[t] = true
-
- local data = ""
- local idata = ""
- local ilen = 0
-
- for k, v in pairs(t) do
- if type(k) ~= "number" or k < 1 or math.floor(k) ~= k or ( k - #t ) > 3 then
- k = serialize_data(k, seen)
- v = serialize_data(v, seen)
- data = data .. ( #data > 0 and ", " or "" ) ..
- '[' .. k .. '] = ' .. v
- elseif k > ilen then
- ilen = k
- end
- end
-
- for i = 1, ilen do
- local v = serialize_data(t[i], seen)
- idata = idata .. ( #idata > 0 and ", " or "" ) .. v
- end
-
- return idata .. ( #data > 0 and #idata > 0 and ", " or "" ) .. data
-end
-
---- Recursively serialize given data to lua code, suitable for restoring
--- with loadstring().
--- @param val Value containing the data to serialize
--- @return String value containing the serialized code
--- @see restore_data
--- @see get_bytecode
-function serialize_data(val, seen)
- seen = seen or setmetatable({}, {__mode="k"})
-
- if val == nil then
- return "nil"
- elseif type(val) == "number" then
- return val
- elseif type(val) == "string" then
- return "%q" % val
- elseif type(val) == "boolean" then
- return val and "true" or "false"
- elseif type(val) == "function" then
- return "loadstring(%q)" % get_bytecode(val)
- elseif type(val) == "table" then
- return "{ " .. _serialize_table(val, seen) .. " }"
- else
- return '"[unhandled data type:' .. type(val) .. ']"'
- end
-end
-
---- Restore data previously serialized with serialize_data().
--- @param str String containing the data to restore
--- @return Value containing the restored data structure
--- @see serialize_data
--- @see get_bytecode
-function restore_data(str)
- return loadstring("return " .. str)()
-end
-
-
---
--- Byte code manipulation routines
---
-
---- Return the current runtime bytecode of the given data. The byte code
--- will be stripped before it is returned.
--- @param val Value to return as bytecode
--- @return String value containing the bytecode of the given data
-function get_bytecode(val)
- local code
-
- if type(val) == "function" then
- code = string.dump(val)
- else
- code = string.dump( loadstring( "return " .. serialize_data(val) ) )
- end
-
- return code -- and strip_bytecode(code)
-end
-
---- Strips unnescessary lua bytecode from given string. Information like line
--- numbers and debugging numbers will be discarded. Original version by
--- Peter Cawley (http://lua-users.org/lists/lua-l/2008-02/msg01158.html)
--- @param code String value containing the original lua byte code
--- @return String value containing the stripped lua byte code
-function strip_bytecode(code)
- local version, format, endian, int, size, ins, num, lnum = code:byte(5, 12)
- local subint
- if endian == 1 then
- subint = function(code, i, l)
- local val = 0
- for n = l, 1, -1 do
- val = val * 256 + code:byte(i + n - 1)
- end
- return val, i + l
- end
- else
- subint = function(code, i, l)
- local val = 0
- for n = 1, l, 1 do
- val = val * 256 + code:byte(i + n - 1)
- end
- return val, i + l
- end
- end
-
- local function strip_function(code)
- local count, offset = subint(code, 1, size)
- local stripped = { string.rep("\0", size) }
- local dirty = offset + count
- offset = offset + count + int * 2 + 4
- offset = offset + int + subint(code, offset, int) * ins
- count, offset = subint(code, offset, int)
- for n = 1, count do
- local t
- t, offset = subint(code, offset, 1)
- if t == 1 then
- offset = offset + 1
- elseif t == 4 then
- offset = offset + size + subint(code, offset, size)
- elseif t == 3 then
- offset = offset + num
- elseif t == 254 or t == 9 then
- offset = offset + lnum
- end
- end
- count, offset = subint(code, offset, int)
- stripped[#stripped+1] = code:sub(dirty, offset - 1)
- for n = 1, count do
- local proto, off = strip_function(code:sub(offset, -1))
- stripped[#stripped+1] = proto
- offset = offset + off - 1
- end
- offset = offset + subint(code, offset, int) * int + int
- count, offset = subint(code, offset, int)
- for n = 1, count do
- offset = offset + subint(code, offset, size) + size + int * 2
- end
- count, offset = subint(code, offset, int)
- for n = 1, count do
- offset = offset + subint(code, offset, size) + size
- end
- stripped[#stripped+1] = string.rep("\0", int * 3)
- return table.concat(stripped), offset
- end
-
- return code:sub(1,12) .. strip_function(code:sub(13,-1))
-end
-
-
---
--- Sorting iterator functions
---
-
-function _sortiter( t, f )
- local keys = { }
-
- local k, v
- for k, v in pairs(t) do
- keys[#keys+1] = k
- end
-
- local _pos = 0
-
- table.sort( keys, f )
-
- return function()
- _pos = _pos + 1
- if _pos <= #keys then
- return keys[_pos], t[keys[_pos]], _pos
- end
- end
-end
-
---- Return a key, value iterator which returns the values sorted according to
--- the provided callback function.
--- @param t The table to iterate
--- @param f A callback function to decide the order of elements
--- @return Function value containing the corresponding iterator
-function spairs(t,f)
- return _sortiter( t, f )
-end
-
---- Return a key, value iterator for the given table.
--- The table pairs are sorted by key.
--- @param t The table to iterate
--- @return Function value containing the corresponding iterator
-function kspairs(t)
- return _sortiter( t )
-end
-
---- Return a key, value iterator for the given table.
--- The table pairs are sorted by value.
--- @param t The table to iterate
--- @return Function value containing the corresponding iterator
-function vspairs(t)
- return _sortiter( t, function (a,b) return t[a] < t[b] end )
-end
-
-
---
--- System utility functions
---
-
---- Test whether the current system is operating in big endian mode.
--- @return Boolean value indicating whether system is big endian
-function bigendian()
- return string.byte(string.dump(function() end), 7) == 0
-end
-
---- Execute given commandline and gather stdout.
--- @param command String containing command to execute
--- @return String containing the command's stdout
-function exec(command)
- local pp = io.popen(command)
- local data = pp:read("*a")
- pp:close()
-
- return data
-end
-
---- Return a line-buffered iterator over the output of given command.
--- @param command String containing the command to execute
--- @return Iterator
-function execi(command)
- local pp = io.popen(command)
-
- return pp and function()
- local line = pp:read()
-
- if not line then
- pp:close()
- end
-
- return line
- end
-end
-
--- Deprecated
-function execl(command)
- local pp = io.popen(command)
- local line = ""
- local data = {}
-
- while true do
- line = pp:read()
- if (line == nil) then break end
- data[#data+1] = line
- end
- pp:close()
-
- return data
-end
-
---- Returns the absolute path to LuCI base directory.
--- @return String containing the directory path
-function libpath()
- return require "nixio.fs".dirname(ldebug.__file__)
-end
-
-
---
--- Coroutine safe xpcall and pcall versions modified for Luci
--- original version:
--- coxpcall 1.13 - Copyright 2005 - Kepler Project (www.keplerproject.org)
---
--- Copyright © 2005 Kepler Project.
--- Permission is hereby granted, free of charge, to any person obtaining a
--- copy of this software and associated documentation files (the "Software"),
--- to deal in the Software without restriction, including without limitation
--- the rights to use, copy, modify, merge, publish, distribute, sublicense,
--- and/or sell copies of the Software, and to permit persons to whom the
--- Software is furnished to do so, subject to the following conditions:
---
--- The above copyright notice and this permission notice shall be
--- included in all copies or substantial portions of the Software.
---
--- THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND,
--- EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES
--- OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
--- IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM,
--- DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT,
--- TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE
--- OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
-
-local performResume, handleReturnValue
-local oldpcall, oldxpcall = pcall, xpcall
-coxpt = {}
-setmetatable(coxpt, {__mode = "kv"})
-
--- Identity function for copcall
-local function copcall_id(trace, ...)
- return ...
-end
-
---- This is a coroutine-safe drop-in replacement for Lua's "xpcall"-function
--- @param f Lua function to be called protected
--- @param err Custom error handler
--- @param ... Parameters passed to the function
--- @return A boolean whether the function call succeeded and the return
--- values of either the function or the error handler
-function coxpcall(f, err, ...)
- local res, co = oldpcall(coroutine.create, f)
- if not res then
- local params = {...}
- local newf = function() return f(unpack(params)) end
- co = coroutine.create(newf)
- end
- local c = coroutine.running()
- coxpt[co] = coxpt[c] or c or 0
-
- return performResume(err, co, ...)
-end
-
---- This is a coroutine-safe drop-in replacement for Lua's "pcall"-function
--- @param f Lua function to be called protected
--- @param ... Parameters passed to the function
--- @return A boolean whether the function call succeeded and the returns
--- values of the function or the error object
-function copcall(f, ...)
- return coxpcall(f, copcall_id, ...)
-end
-
--- Handle return value of protected call
-function handleReturnValue(err, co, status, ...)
- if not status then
- return false, err(debug.traceback(co, (...)), ...)
- end
-
- if coroutine.status(co) ~= 'suspended' then
- return true, ...
- end
-
- return performResume(err, co, coroutine.yield(...))
-end
-
--- Resume execution of protected function call
-function performResume(err, co, ...)
- return handleReturnValue(err, co, coroutine.resume(co, ...))
-end
+++ /dev/null
---[[
-LuCI - Lua Configuration Interface
-Version definition - do not edit this file
-]]--
-
-module "luci.version"
-
-distname = "Host System"
-distversion = "SDK"
-
-luciname = "LuCI"
-luciversion = "SVN"
+++ /dev/null
-config network
- option init network
- list affects dhcp
- list affects radvd
-
-config wireless
- list affects network
-
-config firewall
- option init firewall
- list affects luci-splash
- list affects qos
- list affects miniupnpd
-
-config olsr
- option init olsrd
-
-config dhcp
- option init dnsmasq
-
-config dropbear
- option init dropbear
-
-config httpd
- option init httpd
-
-config fstab
- option init fstab
-
-config qos
- option init qos
-
-config system
- option init led
- list affects luci_statistics
-
-config luci_splash
- option init luci_splash
-
-config upnpd
- option init miniupnpd
-
-config ntpclient
- option init ntpclient
-
-config samba
- option init samba
-
-config tinyproxy
- option init tinyproxy
-
-config 6relayd
- option init 6relayd
+++ /dev/null
-#!/bin/sh
-. /lib/functions.sh
-
-apply_config() {
- config_get init "$1" init
- config_get exec "$1" exec
- config_get test "$1" test
-
- echo "$2" > "/var/run/luci-reload-status"
-
- [ -n "$init" ] && reload_init "$2" "$init" "$test"
- [ -n "$exec" ] && reload_exec "$2" "$exec" "$test"
-}
-
-reload_exec() {
- local service="$1"
- local ok="$3"
- set -- $2
- local cmd="$1"; shift
-
- [ -x "$cmd" ] && {
- echo "Reloading $service... "
- ( $cmd "$@" ) 2>/dev/null 1>&2
- [ -n "$ok" -a "$?" != "$ok" ] && echo '!!! Failed to reload' $service '!!!'
- }
-}
-
-reload_init() {
- [ -x /etc/init.d/$2 ] && /etc/init.d/$2 enabled && {
- echo "Reloading $1... "
- /etc/init.d/$2 reload >/dev/null 2>&1
- [ -n "$3" -a "$?" != "$3" ] && echo '!!! Failed to reload' $1 '!!!'
- }
-}
-
-lock "/var/run/luci-reload"
-
-config_load ucitrack
-
-for i in $*; do
- config_foreach apply_config $i $i
-done
-
-rm -f "/var/run/luci-reload-status"
-lock -u "/var/run/luci-reload"
+++ /dev/null
-include ../../build/config.mk
-include ../../build/module.mk
+++ /dev/null
---[[
-LuCI - Lua Configuration Interface
-
-(c) 2008-2011 Jo-Philipp Wich <xm@subsignal.org>
-(c) 2008 Steven Barth <steven@midlink.org>
-
-Licensed under the Apache License, Version 2.0 (the "License");
-you may not use this file except in compliance with the License.
-You may obtain a copy of the License at
-
-http://www.apache.org/licenses/LICENSE-2.0
-
-]]--
-
-local os = require "os"
-local io = require "io"
-local fs = require "nixio.fs"
-local util = require "luci.util"
-
-local type = type
-local pairs = pairs
-local error = error
-local table = table
-
-local ipkg = "opkg --force-removal-of-dependent-packages --force-overwrite --nocase"
-local icfg = "/etc/opkg.conf"
-
---- LuCI OPKG call abstraction library
-module "luci.model.ipkg"
-
-
--- Internal action function
-local function _action(cmd, ...)
- local pkg = ""
- for k, v in pairs({...}) do
- pkg = pkg .. " '" .. v:gsub("'", "") .. "'"
- end
-
- local c = "%s %s %s >/tmp/opkg.stdout 2>/tmp/opkg.stderr" %{ ipkg, cmd, pkg }
- local r = os.execute(c)
- local e = fs.readfile("/tmp/opkg.stderr")
- local o = fs.readfile("/tmp/opkg.stdout")
-
- fs.unlink("/tmp/opkg.stderr")
- fs.unlink("/tmp/opkg.stdout")
-
- return r, o or "", e or ""
-end
-
--- Internal parser function
-local function _parselist(rawdata)
- if type(rawdata) ~= "function" then
- error("OPKG: Invalid rawdata given")
- end
-
- local data = {}
- local c = {}
- local l = nil
-
- for line in rawdata do
- if line:sub(1, 1) ~= " " then
- local key, val = line:match("(.-): ?(.*)%s*")
-
- if key and val then
- if key == "Package" then
- c = {Package = val}
- data[val] = c
- elseif key == "Status" then
- c.Status = {}
- for j in val:gmatch("([^ ]+)") do
- c.Status[j] = true
- end
- else
- c[key] = val
- end
- l = key
- end
- else
- -- Multi-line field
- c[l] = c[l] .. "\n" .. line
- end
- end
-
- return data
-end
-
--- Internal lookup function
-local function _lookup(act, pkg)
- local cmd = ipkg .. " " .. act
- if pkg then
- cmd = cmd .. " '" .. pkg:gsub("'", "") .. "'"
- end
-
- -- OPKG sometimes kills the whole machine because it sucks
- -- Therefore we have to use a sucky approach too and use
- -- tmpfiles instead of directly reading the output
- local tmpfile = os.tmpname()
- os.execute(cmd .. (" >%s 2>/dev/null" % tmpfile))
-
- local data = _parselist(io.lines(tmpfile))
- os.remove(tmpfile)
- return data
-end
-
-
---- Return information about installed and available packages.
--- @param pkg Limit output to a (set of) packages
--- @return Table containing package information
-function info(pkg)
- return _lookup("info", pkg)
-end
-
---- Return the package status of one or more packages.
--- @param pkg Limit output to a (set of) packages
--- @return Table containing package status information
-function status(pkg)
- return _lookup("status", pkg)
-end
-
---- Install one or more packages.
--- @param ... List of packages to install
--- @return Boolean indicating the status of the action
--- @return OPKG return code, STDOUT and STDERR
-function install(...)
- return _action("install", ...)
-end
-
---- Determine whether a given package is installed.
--- @param pkg Package
--- @return Boolean
-function installed(pkg)
- local p = status(pkg)[pkg]
- return (p and p.Status and p.Status.installed)
-end
-
---- Remove one or more packages.
--- @param ... List of packages to install
--- @return Boolean indicating the status of the action
--- @return OPKG return code, STDOUT and STDERR
-function remove(...)
- return _action("remove", ...)
-end
-
---- Update package lists.
--- @return Boolean indicating the status of the action
--- @return OPKG return code, STDOUT and STDERR
-function update()
- return _action("update")
-end
-
---- Upgrades all installed packages.
--- @return Boolean indicating the status of the action
--- @return OPKG return code, STDOUT and STDERR
-function upgrade()
- return _action("upgrade")
-end
-
--- List helper
-function _list(action, pat, cb)
- local fd = io.popen(ipkg .. " " .. action ..
- (pat and (" '%s'" % pat:gsub("'", "")) or ""))
-
- if fd then
- local name, version, desc
- while true do
- local line = fd:read("*l")
- if not line then break end
-
- name, version, desc = line:match("^(.-) %- (.-) %- (.+)")
-
- if not name then
- name, version = line:match("^(.-) %- (.+)")
- desc = ""
- end
-
- cb(name, version, desc)
-
- name = nil
- version = nil
- desc = nil
- end
-
- fd:close()
- end
-end
-
---- List all packages known to opkg.
--- @param pat Only find packages matching this pattern, nil lists all packages
--- @param cb Callback function invoked for each package, receives name, version and description as arguments
--- @return nothing
-function list_all(pat, cb)
- _list("list", pat, cb)
-end
-
---- List installed packages.
--- @param pat Only find packages matching this pattern, nil lists all packages
--- @param cb Callback function invoked for each package, receives name, version and description as arguments
--- @return nothing
-function list_installed(pat, cb)
- _list("list_installed", pat, cb)
-end
-
---- Find packages that match the given pattern.
--- @param pat Find packages whose names or descriptions match this pattern, nil results in zero results
--- @param cb Callback function invoked for each patckage, receives name, version and description as arguments
--- @return nothing
-function find(pat, cb)
- _list("find", pat, cb)
-end
-
-
---- Determines the overlay root used by opkg.
--- @return String containing the directory path of the overlay root.
-function overlay_root()
- local od = "/"
- local fd = io.open(icfg, "r")
-
- if fd then
- local ln
-
- repeat
- ln = fd:read("*l")
- if ln and ln:match("^%s*option%s+overlay_root%s+") then
- od = ln:match("^%s*option%s+overlay_root%s+(%S+)")
-
- local s = fs.stat(od)
- if not s or s.type ~= "dir" then
- od = "/"
- end
-
- break
- end
- until not ln
-
- fd:close()
- end
-
- return od
-end
+++ /dev/null
-include ../../build/config.mk
-include ../../build/module.mk
\ No newline at end of file
+++ /dev/null
-#!/usr/bin/lua
-require "luci.cacheloader"
-require "luci.sgi.cgi"
-luci.dispatcher.indexcache = "/tmp/luci-indexcache"
-luci.sgi.cgi.run()
\ No newline at end of file
+++ /dev/null
---[[
-LuCI - SGI-Module for CGI
-
-Description:
-Server Gateway Interface for CGI
-
-FileId:
-$Id$
-
-License:
-Copyright 2008 Steven Barth <steven@midlink.org>
-
-Licensed under the Apache License, Version 2.0 (the "License");
-you may not use this file except in compliance with the License.
-You may obtain a copy of the License at
-
- http://www.apache.org/licenses/LICENSE-2.0
-
-Unless required by applicable law or agreed to in writing, software
-distributed under the License is distributed on an "AS IS" BASIS,
-WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
-See the License for the specific language governing permissions and
-limitations under the License.
-
-]]--
-exectime = os.clock()
-module("luci.sgi.cgi", package.seeall)
-local ltn12 = require("luci.ltn12")
-require("nixio.util")
-require("luci.http")
-require("luci.sys")
-require("luci.dispatcher")
-
--- Limited source to avoid endless blocking
-local function limitsource(handle, limit)
- limit = limit or 0
- local BLOCKSIZE = ltn12.BLOCKSIZE
-
- return function()
- if limit < 1 then
- handle:close()
- return nil
- else
- local read = (limit > BLOCKSIZE) and BLOCKSIZE or limit
- limit = limit - read
-
- local chunk = handle:read(read)
- if not chunk then handle:close() end
- return chunk
- end
- end
-end
-
-function run()
- local r = luci.http.Request(
- luci.sys.getenv(),
- limitsource(io.stdin, tonumber(luci.sys.getenv("CONTENT_LENGTH"))),
- ltn12.sink.file(io.stderr)
- )
-
- local x = coroutine.create(luci.dispatcher.httpdispatch)
- local hcache = ""
- local active = true
-
- while coroutine.status(x) ~= "dead" do
- local res, id, data1, data2 = coroutine.resume(x, r)
-
- if not res then
- print("Status: 500 Internal Server Error")
- print("Content-Type: text/plain\n")
- print(id)
- break;
- end
-
- if active then
- if id == 1 then
- io.write("Status: " .. tostring(data1) .. " " .. data2 .. "\r\n")
- elseif id == 2 then
- hcache = hcache .. data1 .. ": " .. data2 .. "\r\n"
- elseif id == 3 then
- io.write(hcache)
- io.write("\r\n")
- elseif id == 4 then
- io.write(tostring(data1 or ""))
- elseif id == 5 then
- io.flush()
- io.close()
- active = false
- elseif id == 6 then
- data1:copyz(nixio.stdout, data2)
- data1:close()
- end
- end
- end
-end
+++ /dev/null
-include ../../build/config.mk
-include ../../build/module.mk
\ No newline at end of file
+++ /dev/null
---[[
-LuCI - Server Gateway Interface for the uHTTPd server
-
-Copyright 2010 Jo-Philipp Wich <xm@subsignal.org>
-
-Licensed under the Apache License, Version 2.0 (the "License");
-you may not use this file except in compliance with the License.
-You may obtain a copy of the License at
-
- http://www.apache.org/licenses/LICENSE-2.0
-
-Unless required by applicable law or agreed to in writing, software
-distributed under the License is distributed on an "AS IS" BASIS,
-WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
-See the License for the specific language governing permissions and
-limitations under the License.
-
-]]--
-
-require "nixio.util"
-require "luci.http"
-require "luci.sys"
-require "luci.dispatcher"
-require "luci.ltn12"
-
-function handle_request(env)
- exectime = os.clock()
- local renv = {
- CONTENT_LENGTH = env.CONTENT_LENGTH,
- CONTENT_TYPE = env.CONTENT_TYPE,
- REQUEST_METHOD = env.REQUEST_METHOD,
- REQUEST_URI = env.REQUEST_URI,
- PATH_INFO = env.PATH_INFO,
- SCRIPT_NAME = env.SCRIPT_NAME:gsub("/+$", ""),
- SCRIPT_FILENAME = env.SCRIPT_NAME,
- SERVER_PROTOCOL = env.SERVER_PROTOCOL,
- QUERY_STRING = env.QUERY_STRING
- }
-
- local k, v
- for k, v in pairs(env.headers) do
- k = k:upper():gsub("%-", "_")
- renv["HTTP_" .. k] = v
- end
-
- local len = tonumber(env.CONTENT_LENGTH) or 0
- local function recv()
- if len > 0 then
- local rlen, rbuf = uhttpd.recv(4096)
- if rlen >= 0 then
- len = len - rlen
- return rbuf
- end
- end
- return nil
- end
-
- local send = uhttpd.send
-
- local req = luci.http.Request(
- renv, recv, luci.ltn12.sink.file(io.stderr)
- )
-
-
- local x = coroutine.create(luci.dispatcher.httpdispatch)
- local hcache = { }
- local active = true
-
- while coroutine.status(x) ~= "dead" do
- local res, id, data1, data2 = coroutine.resume(x, req)
-
- if not res then
- send("Status: 500 Internal Server Error\r\n")
- send("Content-Type: text/plain\r\n\r\n")
- send(tostring(id))
- break
- end
-
- if active then
- if id == 1 then
- send("Status: ")
- send(tostring(data1))
- send(" ")
- send(tostring(data2))
- send("\r\n")
- elseif id == 2 then
- hcache[data1] = data2
- elseif id == 3 then
- for k, v in pairs(hcache) do
- send(tostring(k))
- send(": ")
- send(tostring(v))
- send("\r\n")
- end
- send("\r\n")
- elseif id == 4 then
- send(tostring(data1 or ""))
- elseif id == 5 then
- active = false
- elseif id == 6 then
- data1:copyz(nixio.stdout, data2)
- end
- end
- end
-end
+++ /dev/null
-include ../../build/config.mk
-include ../../build/module.mk
+++ /dev/null
---[[
-LuCI - System library
-
-Description:
-Utilities for interaction with the Linux system
-
-FileId:
-$Id$
-
-License:
-Copyright 2008 Steven Barth <steven@midlink.org>
-
-Licensed under the Apache License, Version 2.0 (the "License");
-you may not use this file except in compliance with the License.
-You may obtain a copy of the License at
-
- http://www.apache.org/licenses/LICENSE-2.0
-
-Unless required by applicable law or agreed to in writing, software
-distributed under the License is distributed on an "AS IS" BASIS,
-WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
-See the License for the specific language governing permissions and
-limitations under the License.
-
-]]--
-
-
-local io = require "io"
-local os = require "os"
-local table = require "table"
-local nixio = require "nixio"
-local fs = require "nixio.fs"
-local uci = require "luci.model.uci"
-
-local luci = {}
-luci.util = require "luci.util"
-luci.ip = require "luci.ip"
-
-local tonumber, ipairs, pairs, pcall, type, next, setmetatable, require, select =
- tonumber, ipairs, pairs, pcall, type, next, setmetatable, require, select
-
-
---- LuCI Linux and POSIX system utilities.
-module "luci.sys"
-
---- Execute a given shell command and return the error code
--- @class function
--- @name call
--- @param ... Command to call
--- @return Error code of the command
-function call(...)
- return os.execute(...) / 256
-end
-
---- Execute a given shell command and capture its standard output
--- @class function
--- @name exec
--- @param command Command to call
--- @return String containg the return the output of the command
-exec = luci.util.exec
-
---- Retrieve information about currently mounted file systems.
--- @return Table containing mount information
-function mounts()
- local data = {}
- local k = {"fs", "blocks", "used", "available", "percent", "mountpoint"}
- local ps = luci.util.execi("df")
-
- if not ps then
- return
- else
- ps()
- end
-
- for line in ps do
- local row = {}
-
- local j = 1
- for value in line:gmatch("[^%s]+") do
- row[k[j]] = value
- j = j + 1
- end
-
- if row[k[1]] then
-
- -- this is a rather ugly workaround to cope with wrapped lines in
- -- the df output:
- --
- -- /dev/scsi/host0/bus0/target0/lun0/part3
- -- 114382024 93566472 15005244 86% /mnt/usb
- --
-
- if not row[k[2]] then
- j = 2
- line = ps()
- for value in line:gmatch("[^%s]+") do
- row[k[j]] = value
- j = j + 1
- end
- end
-
- table.insert(data, row)
- end
- end
-
- return data
-end
-
---- Retrieve environment variables. If no variable is given then a table
--- containing the whole environment is returned otherwise this function returns
--- the corresponding string value for the given name or nil if no such variable
--- exists.
--- @class function
--- @name getenv
--- @param var Name of the environment variable to retrieve (optional)
--- @return String containg the value of the specified variable
--- @return Table containing all variables if no variable name is given
-getenv = nixio.getenv
-
---- Get or set the current hostname.
--- @param String containing a new hostname to set (optional)
--- @return String containing the system hostname
-function hostname(newname)
- if type(newname) == "string" and #newname > 0 then
- fs.writefile( "/proc/sys/kernel/hostname", newname )
- return newname
- else
- return nixio.uname().nodename
- end
-end
-
---- Returns the contents of a documented referred by an URL.
--- @param url The URL to retrieve
--- @param stream Return a stream instead of a buffer
--- @param target Directly write to target file name
--- @return String containing the contents of given the URL
-function httpget(url, stream, target)
- if not target then
- local source = stream and io.popen or luci.util.exec
- return source("wget -qO- '"..url:gsub("'", "").."'")
- else
- return os.execute("wget -qO '%s' '%s'" %
- {target:gsub("'", ""), url:gsub("'", "")})
- end
-end
-
---- Returns the system load average values.
--- @return String containing the average load value 1 minute ago
--- @return String containing the average load value 5 minutes ago
--- @return String containing the average load value 15 minutes ago
-function loadavg()
- local info = nixio.sysinfo()
- return info.loads[1], info.loads[2], info.loads[3]
-end
-
---- Initiate a system reboot.
--- @return Return value of os.execute()
-function reboot()
- return os.execute("reboot >/dev/null 2>&1")
-end
-
---- Returns the system type, cpu name and installed physical memory.
--- @return String containing the system or platform identifier
--- @return String containing hardware model information
--- @return String containing the total memory amount in kB
--- @return String containing the memory used for caching in kB
--- @return String containing the memory used for buffering in kB
--- @return String containing the free memory amount in kB
--- @return String containing the cpu bogomips (number)
-function sysinfo()
- local cpuinfo = fs.readfile("/proc/cpuinfo")
- local meminfo = fs.readfile("/proc/meminfo")
-
- local memtotal = tonumber(meminfo:match("MemTotal:%s*(%d+)"))
- local memcached = tonumber(meminfo:match("\nCached:%s*(%d+)"))
- local memfree = tonumber(meminfo:match("MemFree:%s*(%d+)"))
- local membuffers = tonumber(meminfo:match("Buffers:%s*(%d+)"))
- local bogomips = tonumber(cpuinfo:match("[Bb]ogo[Mm][Ii][Pp][Ss].-: ([^\n]+)")) or 0
- local swaptotal = tonumber(meminfo:match("SwapTotal:%s*(%d+)"))
- local swapcached = tonumber(meminfo:match("SwapCached:%s*(%d+)"))
- local swapfree = tonumber(meminfo:match("SwapFree:%s*(%d+)"))
-
- local system =
- cpuinfo:match("system type\t+: ([^\n]+)") or
- cpuinfo:match("Processor\t+: ([^\n]+)") or
- cpuinfo:match("model name\t+: ([^\n]+)")
-
- local model =
- luci.util.pcdata(fs.readfile("/tmp/sysinfo/model")) or
- cpuinfo:match("machine\t+: ([^\n]+)") or
- cpuinfo:match("Hardware\t+: ([^\n]+)") or
- luci.util.pcdata(fs.readfile("/proc/diag/model")) or
- nixio.uname().machine or
- system
-
- return system, model, memtotal, memcached, membuffers, memfree, bogomips, swaptotal, swapcached, swapfree
-end
-
---- Retrieves the output of the "logread" command.
--- @return String containing the current log buffer
-function syslog()
- return luci.util.exec("logread")
-end
-
---- Retrieves the output of the "dmesg" command.
--- @return String containing the current log buffer
-function dmesg()
- return luci.util.exec("dmesg")
-end
-
---- Generates a random id with specified length.
--- @param bytes Number of bytes for the unique id
--- @return String containing hex encoded id
-function uniqueid(bytes)
- local rand = fs.readfile("/dev/urandom", bytes)
- return rand and nixio.bin.hexlify(rand)
-end
-
---- Returns the current system uptime stats.
--- @return String containing total uptime in seconds
-function uptime()
- return nixio.sysinfo().uptime
-end
-
-
---- LuCI system utilities / network related functions.
--- @class module
--- @name luci.sys.net
-net = {}
-
---- Returns the current arp-table entries as two-dimensional table.
--- @return Table of table containing the current arp entries.
--- The following fields are defined for arp entry objects:
--- { "IP address", "HW address", "HW type", "Flags", "Mask", "Device" }
-function net.arptable(callback)
- local arp = (not callback) and {} or nil
- local e, r, v
- if fs.access("/proc/net/arp") then
- for e in io.lines("/proc/net/arp") do
- local r = { }, v
- for v in e:gmatch("%S+") do
- r[#r+1] = v
- end
-
- if r[1] ~= "IP" then
- local x = {
- ["IP address"] = r[1],
- ["HW type"] = r[2],
- ["Flags"] = r[3],
- ["HW address"] = r[4],
- ["Mask"] = r[5],
- ["Device"] = r[6]
- }
-
- if callback then
- callback(x)
- else
- arp = arp or { }
- arp[#arp+1] = x
- end
- end
- end
- end
- return arp
-end
-
-local function _nethints(what, callback)
- local _, k, e, mac, ip, name
- local cur = uci.cursor()
- local ifn = { }
- local hosts = { }
-
- local function _add(i, ...)
- local k = select(i, ...)
- if k then
- if not hosts[k] then hosts[k] = { } end
- hosts[k][1] = select(1, ...) or hosts[k][1]
- hosts[k][2] = select(2, ...) or hosts[k][2]
- hosts[k][3] = select(3, ...) or hosts[k][3]
- hosts[k][4] = select(4, ...) or hosts[k][4]
- end
- end
-
- if fs.access("/proc/net/arp") then
- for e in io.lines("/proc/net/arp") do
- ip, mac = e:match("^([%d%.]+)%s+%S+%s+%S+%s+([a-fA-F0-9:]+)%s+")
- if ip and mac then
- _add(what, mac:upper(), ip, nil, nil)
- end
- end
- end
-
- if fs.access("/etc/ethers") then
- for e in io.lines("/etc/ethers") do
- mac, ip = e:match("^([a-f0-9]%S+) (%S+)")
- if mac and ip then
- _add(what, mac:upper(), ip, nil, nil)
- end
- end
- end
-
- if fs.access("/var/dhcp.leases") then
- for e in io.lines("/var/dhcp.leases") do
- mac, ip, name = e:match("^%d+ (%S+) (%S+) (%S+)")
- if mac and ip then
- _add(what, mac:upper(), ip, nil, name ~= "*" and name)
- end
- end
- end
-
- cur:foreach("dhcp", "host",
- function(s)
- for mac in luci.util.imatch(s.mac) do
- _add(what, mac:upper(), s.ip, nil, s.name)
- end
- end)
-
- for _, e in ipairs(nixio.getifaddrs()) do
- if e.name ~= "lo" then
- ifn[e.name] = ifn[e.name] or { }
- if e.family == "packet" and e.addr and #e.addr == 17 then
- ifn[e.name][1] = e.addr:upper()
- elseif e.family == "inet" then
- ifn[e.name][2] = e.addr
- elseif e.family == "inet6" then
- ifn[e.name][3] = e.addr
- end
- end
- end
-
- for _, e in pairs(ifn) do
- if e[what] and (e[2] or e[3]) then
- _add(what, e[1], e[2], e[3], e[4])
- end
- end
-
- for _, e in luci.util.kspairs(hosts) do
- callback(e[1], e[2], e[3], e[4])
- end
-end
-
---- Returns a two-dimensional table of mac address hints.
--- @return Table of table containing known hosts from various sources.
--- Each entry contains the values in the following order:
--- [ "mac", "name" ]
-function net.mac_hints(callback)
- if callback then
- _nethints(1, function(mac, v4, v6, name)
- name = name or nixio.getnameinfo(v4 or v6, nil, 100) or v4
- if name and name ~= mac then
- callback(mac, name or nixio.getnameinfo(v4 or v6, nil, 100) or v4)
- end
- end)
- else
- local rv = { }
- _nethints(1, function(mac, v4, v6, name)
- name = name or nixio.getnameinfo(v4 or v6, nil, 100) or v4
- if name and name ~= mac then
- rv[#rv+1] = { mac, name or nixio.getnameinfo(v4 or v6, nil, 100) or v4 }
- end
- end)
- return rv
- end
-end
-
---- Returns a two-dimensional table of IPv4 address hints.
--- @return Table of table containing known hosts from various sources.
--- Each entry contains the values in the following order:
--- [ "ip", "name" ]
-function net.ipv4_hints(callback)
- if callback then
- _nethints(2, function(mac, v4, v6, name)
- name = name or nixio.getnameinfo(v4, nil, 100) or mac
- if name and name ~= v4 then
- callback(v4, name)
- end
- end)
- else
- local rv = { }
- _nethints(2, function(mac, v4, v6, name)
- name = name or nixio.getnameinfo(v4, nil, 100) or mac
- if name and name ~= v4 then
- rv[#rv+1] = { v4, name }
- end
- end)
- return rv
- end
-end
-
---- Returns a two-dimensional table of IPv6 address hints.
--- @return Table of table containing known hosts from various sources.
--- Each entry contains the values in the following order:
--- [ "ip", "name" ]
-function net.ipv6_hints(callback)
- if callback then
- _nethints(3, function(mac, v4, v6, name)
- name = name or nixio.getnameinfo(v6, nil, 100) or mac
- if name and name ~= v6 then
- callback(v6, name)
- end
- end)
- else
- local rv = { }
- _nethints(3, function(mac, v4, v6, name)
- name = name or nixio.getnameinfo(v6, nil, 100) or mac
- if name and name ~= v6 then
- rv[#rv+1] = { v6, name }
- end
- end)
- return rv
- end
-end
-
---- Returns conntrack information
--- @return Table with the currently tracked IP connections
-function net.conntrack(callback)
- local connt = {}
- if fs.access("/proc/net/nf_conntrack", "r") then
- for line in io.lines("/proc/net/nf_conntrack") do
- line = line:match "^(.-( [^ =]+=).-)%2"
- local entry, flags = _parse_mixed_record(line, " +")
- if flags[6] ~= "TIME_WAIT" then
- entry.layer3 = flags[1]
- entry.layer4 = flags[3]
- for i=1, #entry do
- entry[i] = nil
- end
-
- if callback then
- callback(entry)
- else
- connt[#connt+1] = entry
- end
- end
- end
- elseif fs.access("/proc/net/ip_conntrack", "r") then
- for line in io.lines("/proc/net/ip_conntrack") do
- line = line:match "^(.-( [^ =]+=).-)%2"
- local entry, flags = _parse_mixed_record(line, " +")
- if flags[4] ~= "TIME_WAIT" then
- entry.layer3 = "ipv4"
- entry.layer4 = flags[1]
- for i=1, #entry do
- entry[i] = nil
- end
-
- if callback then
- callback(entry)
- else
- connt[#connt+1] = entry
- end
- end
- end
- else
- return nil
- end
- return connt
-end
-
---- Determine the current IPv4 default route. If multiple default routes exist,
--- return the one with the lowest metric.
--- @return Table with the properties of the current default route.
--- The following fields are defined:
--- { "dest", "gateway", "metric", "refcount", "usecount", "irtt",
--- "flags", "device" }
-function net.defaultroute()
- local route
-
- net.routes(function(rt)
- if rt.dest:prefix() == 0 and (not route or route.metric > rt.metric) then
- route = rt
- end
- end)
-
- return route
-end
-
---- Determine the current IPv6 default route. If multiple default routes exist,
--- return the one with the lowest metric.
--- @return Table with the properties of the current default route.
--- The following fields are defined:
--- { "source", "dest", "nexthop", "metric", "refcount", "usecount",
--- "flags", "device" }
-function net.defaultroute6()
- local route
-
- net.routes6(function(rt)
- if rt.dest:prefix() == 0 and rt.device ~= "lo" and
- (not route or route.metric > rt.metric)
- then
- route = rt
- end
- end)
-
- if not route then
- local global_unicast = luci.ip.IPv6("2000::/3")
- net.routes6(function(rt)
- if rt.dest:equal(global_unicast) and
- (not route or route.metric > rt.metric)
- then
- route = rt
- end
- end)
- end
-
- return route
-end
-
---- Determine the names of available network interfaces.
--- @return Table containing all current interface names
-function net.devices()
- local devs = {}
- for k, v in ipairs(nixio.getifaddrs()) do
- if v.family == "packet" then
- devs[#devs+1] = v.name
- end
- end
- return devs
-end
-
-
---- Return information about available network interfaces.
--- @return Table containing all current interface names and their information
-function net.deviceinfo()
- local devs = {}
- for k, v in ipairs(nixio.getifaddrs()) do
- if v.family == "packet" then
- local d = v.data
- d[1] = d.rx_bytes
- d[2] = d.rx_packets
- d[3] = d.rx_errors
- d[4] = d.rx_dropped
- d[5] = 0
- d[6] = 0
- d[7] = 0
- d[8] = d.multicast
- d[9] = d.tx_bytes
- d[10] = d.tx_packets
- d[11] = d.tx_errors
- d[12] = d.tx_dropped
- d[13] = 0
- d[14] = d.collisions
- d[15] = 0
- d[16] = 0
- devs[v.name] = d
- end
- end
- return devs
-end
-
-
--- Determine the MAC address belonging to the given IP address.
--- @param ip IPv4 address
--- @return String containing the MAC address or nil if it cannot be found
-function net.ip4mac(ip)
- local mac = nil
- net.arptable(function(e)
- if e["IP address"] == ip then
- mac = e["HW address"]
- end
- end)
- return mac
-end
-
---- Returns the current kernel routing table entries.
--- @return Table of tables with properties of the corresponding routes.
--- The following fields are defined for route entry tables:
--- { "dest", "gateway", "metric", "refcount", "usecount", "irtt",
--- "flags", "device" }
-function net.routes(callback)
- local routes = { }
-
- for line in io.lines("/proc/net/route") do
-
- local dev, dst_ip, gateway, flags, refcnt, usecnt, metric,
- dst_mask, mtu, win, irtt = line:match(
- "([^%s]+)\t([A-F0-9]+)\t([A-F0-9]+)\t([A-F0-9]+)\t" ..
- "(%d+)\t(%d+)\t(%d+)\t([A-F0-9]+)\t(%d+)\t(%d+)\t(%d+)"
- )
-
- if dev then
- gateway = luci.ip.Hex( gateway, 32, luci.ip.FAMILY_INET4 )
- dst_mask = luci.ip.Hex( dst_mask, 32, luci.ip.FAMILY_INET4 )
- dst_ip = luci.ip.Hex(
- dst_ip, dst_mask:prefix(dst_mask), luci.ip.FAMILY_INET4
- )
-
- local rt = {
- dest = dst_ip,
- gateway = gateway,
- metric = tonumber(metric),
- refcount = tonumber(refcnt),
- usecount = tonumber(usecnt),
- mtu = tonumber(mtu),
- window = tonumber(window),
- irtt = tonumber(irtt),
- flags = tonumber(flags, 16),
- device = dev
- }
-
- if callback then
- callback(rt)
- else
- routes[#routes+1] = rt
- end
- end
- end
-
- return routes
-end
-
---- Returns the current ipv6 kernel routing table entries.
--- @return Table of tables with properties of the corresponding routes.
--- The following fields are defined for route entry tables:
--- { "source", "dest", "nexthop", "metric", "refcount", "usecount",
--- "flags", "device" }
-function net.routes6(callback)
- if fs.access("/proc/net/ipv6_route", "r") then
- local routes = { }
-
- for line in io.lines("/proc/net/ipv6_route") do
-
- local dst_ip, dst_prefix, src_ip, src_prefix, nexthop,
- metric, refcnt, usecnt, flags, dev = line:match(
- "([a-f0-9]+) ([a-f0-9]+) " ..
- "([a-f0-9]+) ([a-f0-9]+) " ..
- "([a-f0-9]+) ([a-f0-9]+) " ..
- "([a-f0-9]+) ([a-f0-9]+) " ..
- "([a-f0-9]+) +([^%s]+)"
- )
-
- if dst_ip and dst_prefix and
- src_ip and src_prefix and
- nexthop and metric and
- refcnt and usecnt and
- flags and dev
- then
- src_ip = luci.ip.Hex(
- src_ip, tonumber(src_prefix, 16), luci.ip.FAMILY_INET6, false
- )
-
- dst_ip = luci.ip.Hex(
- dst_ip, tonumber(dst_prefix, 16), luci.ip.FAMILY_INET6, false
- )
-
- nexthop = luci.ip.Hex( nexthop, 128, luci.ip.FAMILY_INET6, false )
-
- local rt = {
- source = src_ip,
- dest = dst_ip,
- nexthop = nexthop,
- metric = tonumber(metric, 16),
- refcount = tonumber(refcnt, 16),
- usecount = tonumber(usecnt, 16),
- flags = tonumber(flags, 16),
- device = dev,
-
- -- lua number is too small for storing the metric
- -- add a metric_raw field with the original content
- metric_raw = metric
- }
-
- if callback then
- callback(rt)
- else
- routes[#routes+1] = rt
- end
- end
- end
-
- return routes
- end
-end
-
---- Tests whether the given host responds to ping probes.
--- @param host String containing a hostname or IPv4 address
--- @return Number containing 0 on success and >= 1 on error
-function net.pingtest(host)
- return os.execute("ping -c1 '"..host:gsub("'", '').."' >/dev/null 2>&1")
-end
-
-
---- LuCI system utilities / process related functions.
--- @class module
--- @name luci.sys.process
-process = {}
-
---- Get the current process id.
--- @class function
--- @name process.info
--- @return Number containing the current pid
-function process.info(key)
- local s = {uid = nixio.getuid(), gid = nixio.getgid()}
- return not key and s or s[key]
-end
-
---- Retrieve information about currently running processes.
--- @return Table containing process information
-function process.list()
- local data = {}
- local k
- local ps = luci.util.execi("/bin/busybox top -bn1")
-
- if not ps then
- return
- end
-
- for line in ps do
- local pid, ppid, user, stat, vsz, mem, cpu, cmd = line:match(
- "^ *(%d+) +(%d+) +(%S.-%S) +([RSDZTW][W ][<N ]) +(%d+) +(%d+%%) +(%d+%%) +(.+)"
- )
-
- local idx = tonumber(pid)
- if idx then
- data[idx] = {
- ['PID'] = pid,
- ['PPID'] = ppid,
- ['USER'] = user,
- ['STAT'] = stat,
- ['VSZ'] = vsz,
- ['%MEM'] = mem,
- ['%CPU'] = cpu,
- ['COMMAND'] = cmd
- }
- end
- end
-
- return data
-end
-
---- Set the gid of a process identified by given pid.
--- @param gid Number containing the Unix group id
--- @return Boolean indicating successful operation
--- @return String containing the error message if failed
--- @return Number containing the error code if failed
-function process.setgroup(gid)
- return nixio.setgid(gid)
-end
-
---- Set the uid of a process identified by given pid.
--- @param uid Number containing the Unix user id
--- @return Boolean indicating successful operation
--- @return String containing the error message if failed
--- @return Number containing the error code if failed
-function process.setuser(uid)
- return nixio.setuid(uid)
-end
-
---- Send a signal to a process identified by given pid.
--- @class function
--- @name process.signal
--- @param pid Number containing the process id
--- @param sig Signal to send (default: 15 [SIGTERM])
--- @return Boolean indicating successful operation
--- @return Number containing the error code if failed
-process.signal = nixio.kill
-
-
---- LuCI system utilities / user related functions.
--- @class module
--- @name luci.sys.user
-user = {}
-
---- Retrieve user informations for given uid.
--- @class function
--- @name getuser
--- @param uid Number containing the Unix user id
--- @return Table containing the following fields:
--- { "uid", "gid", "name", "passwd", "dir", "shell", "gecos" }
-user.getuser = nixio.getpw
-
---- Retrieve the current user password hash.
--- @param username String containing the username to retrieve the password for
--- @return String containing the hash or nil if no password is set.
--- @return Password database entry
-function user.getpasswd(username)
- local pwe = nixio.getsp and nixio.getsp(username) or nixio.getpw(username)
- local pwh = pwe and (pwe.pwdp or pwe.passwd)
- if not pwh or #pwh < 1 or pwh == "!" or pwh == "x" then
- return nil, pwe
- else
- return pwh, pwe
- end
-end
-
---- Test whether given string matches the password of a given system user.
--- @param username String containing the Unix user name
--- @param pass String containing the password to compare
--- @return Boolean indicating wheather the passwords are equal
-function user.checkpasswd(username, pass)
- local pwh, pwe = user.getpasswd(username)
- if pwe then
- return (pwh == nil or nixio.crypt(pass, pwh) == pwh)
- end
- return false
-end
-
---- Change the password of given user.
--- @param username String containing the Unix user name
--- @param password String containing the password to compare
--- @return Number containing 0 on success and >= 1 on error
-function user.setpasswd(username, password)
- if password then
- password = password:gsub("'", [['"'"']])
- end
-
- if username then
- username = username:gsub("'", [['"'"']])
- end
-
- return os.execute(
- "(echo '" .. password .. "'; sleep 1; echo '" .. password .. "') | " ..
- "passwd '" .. username .. "' >/dev/null 2>&1"
- )
-end
-
-
---- LuCI system utilities / wifi related functions.
--- @class module
--- @name luci.sys.wifi
-wifi = {}
-
---- Get wireless information for given interface.
--- @param ifname String containing the interface name
--- @return A wrapped iwinfo object instance
-function wifi.getiwinfo(ifname)
- local stat, iwinfo = pcall(require, "iwinfo")
-
- if ifname then
- local c = 0
- local u = uci.cursor_state()
- local d, n = ifname:match("^(%w+)%.network(%d+)")
- if d and n then
- ifname = d
- n = tonumber(n)
- u:foreach("wireless", "wifi-iface",
- function(s)
- if s.device == d then
- c = c + 1
- if c == n then
- ifname = s.ifname or s.device
- return false
- end
- end
- end)
- elseif u:get("wireless", ifname) == "wifi-device" then
- u:foreach("wireless", "wifi-iface",
- function(s)
- if s.device == ifname and s.ifname then
- ifname = s.ifname
- return false
- end
- end)
- end
-
- local t = stat and iwinfo.type(ifname)
- local x = t and iwinfo[t] or { }
- return setmetatable({}, {
- __index = function(t, k)
- if k == "ifname" then
- return ifname
- elseif x[k] then
- return x[k](ifname)
- end
- end
- })
- end
-end
-
-
---- LuCI system utilities / init related functions.
--- @class module
--- @name luci.sys.init
-init = {}
-init.dir = "/etc/init.d/"
-
---- Get the names of all installed init scripts
--- @return Table containing the names of all inistalled init scripts
-function init.names()
- local names = { }
- for name in fs.glob(init.dir.."*") do
- names[#names+1] = fs.basename(name)
- end
- return names
-end
-
---- Get the index of he given init script
--- @param name Name of the init script
--- @return Numeric index value
-function init.index(name)
- if fs.access(init.dir..name) then
- return call("env -i sh -c 'source %s%s enabled; exit ${START:-255}' >/dev/null"
- %{ init.dir, name })
- end
-end
-
-local function init_action(action, name)
- if fs.access(init.dir..name) then
- return call("env -i %s%s %s >/dev/null" %{ init.dir, name, action })
- end
-end
-
---- Test whether the given init script is enabled
--- @param name Name of the init script
--- @return Boolean indicating whether init is enabled
-function init.enabled(name)
- return (init_action("enabled", name) == 0)
-end
-
---- Enable the given init script
--- @param name Name of the init script
--- @return Boolean indicating success
-function init.enable(name)
- return (init_action("enable", name) == 1)
-end
-
---- Disable the given init script
--- @param name Name of the init script
--- @return Boolean indicating success
-function init.disable(name)
- return (init_action("disable", name) == 0)
-end
-
---- Start the given init script
--- @param name Name of the init script
--- @return Boolean indicating success
-function init.start(name)
- return (init_action("start", name) == 0)
-end
-
---- Stop the given init script
--- @param name Name of the init script
--- @return Boolean indicating success
-function init.stop(name)
- return (init_action("stop", name) == 0)
-end
-
-
--- Internal functions
-
-function _parse_mixed_record(cnt, delimiter)
- delimiter = delimiter or " "
- local data = {}
- local flags = {}
-
- for i, l in pairs(luci.util.split(luci.util.trim(cnt), "\n")) do
- for j, f in pairs(luci.util.split(luci.util.trim(l), delimiter, nil, true)) do
- local k, x, v = f:match('([^%s][^:=]*) *([:=]*) *"*([^\n"]*)"*')
-
- if k then
- if x == "" then
- table.insert(flags, k)
- else
- data[k] = v
- end
- end
- end
- end
-
- return data, flags
-end
+++ /dev/null
---[[
-
-Iptables parser and query library
-(c) 2008-2009 Jo-Philipp Wich <xm@leipzig.freifunk.net>
-(c) 2008-2009 Steven Barth <steven@midlink.org>
-
-Licensed under the Apache License, Version 2.0 (the "License");
-you may not use this file except in compliance with the License.
-You may obtain a copy of the License at
-
- http://www.apache.org/licenses/LICENSE-2.0
-
-$Id$
-
-]]--
-
-local luci = {}
-luci.util = require "luci.util"
-luci.sys = require "luci.sys"
-luci.ip = require "luci.ip"
-
-local tonumber, ipairs, table = tonumber, ipairs, table
-
---- LuCI iptables parser and query library
--- @cstyle instance
-module("luci.sys.iptparser")
-
---- Create a new iptables parser object.
--- @class function
--- @name IptParser
--- @param family Number specifying the address family. 4 for IPv4, 6 for IPv6
--- @return IptParser instance
-IptParser = luci.util.class()
-
-function IptParser.__init__( self, family )
- self._family = (tonumber(family) == 6) and 6 or 4
- self._rules = { }
- self._chains = { }
-
- if self._family == 4 then
- self._nulladdr = "0.0.0.0/0"
- self._tables = { "filter", "nat", "mangle", "raw" }
- self._command = "iptables -t %s --line-numbers -nxvL"
- else
- self._nulladdr = "::/0"
- self._tables = { "filter", "mangle", "raw" }
- self._command = "ip6tables -t %s --line-numbers -nxvL"
- end
-
- self:_parse_rules()
-end
-
---- Find all firewall rules that match the given criteria. Expects a table with
--- search criteria as only argument. If args is nil or an empty table then all
--- rules will be returned.
---
--- The following keys in the args table are recognized:
--- <ul>
--- <li> table - Match rules that are located within the given table
--- <li> chain - Match rules that are located within the given chain
--- <li> target - Match rules with the given target
--- <li> protocol - Match rules that match the given protocol, rules with
--- protocol "all" are always matched
--- <li> source - Match rules with the given source, rules with source
--- "0.0.0.0/0" (::/0) are always matched
--- <li> destination - Match rules with the given destination, rules with
--- destination "0.0.0.0/0" (::/0) are always matched
--- <li> inputif - Match rules with the given input interface, rules
--- with input interface "*" (=all) are always matched
--- <li> outputif - Match rules with the given output interface, rules
--- with output interface "*" (=all) are always matched
--- <li> flags - Match rules that match the given flags, current
--- supported values are "-f" (--fragment)
--- and "!f" (! --fragment)
--- <li> options - Match rules containing all given options
--- </ul>
--- The return value is a list of tables representing the matched rules.
--- Each rule table contains the following fields:
--- <ul>
--- <li> index - The index number of the rule
--- <li> table - The table where the rule is located, can be one
--- of "filter", "nat" or "mangle"
--- <li> chain - The chain where the rule is located, e.g. "INPUT"
--- or "postrouting_wan"
--- <li> target - The rule target, e.g. "REJECT" or "DROP"
--- <li> protocol The matching protocols, e.g. "all" or "tcp"
--- <li> flags - Special rule options ("--", "-f" or "!f")
--- <li> inputif - Input interface of the rule, e.g. "eth0.0"
--- or "*" for all interfaces
--- <li> outputif - Output interface of the rule,e.g. "eth0.0"
--- or "*" for all interfaces
--- <li> source - The source ip range, e.g. "0.0.0.0/0" (::/0)
--- <li> destination - The destination ip range, e.g. "0.0.0.0/0" (::/0)
--- <li> options - A list of specific options of the rule,
--- e.g. { "reject-with", "tcp-reset" }
--- <li> packets - The number of packets matched by the rule
--- <li> bytes - The number of total bytes matched by the rule
--- </ul>
--- Example:
--- <pre>
--- ip = luci.sys.iptparser.IptParser()
--- result = ip.find( {
--- target="REJECT",
--- protocol="tcp",
--- options={ "reject-with", "tcp-reset" }
--- } )
--- </pre>
--- This will match all rules with target "-j REJECT",
--- protocol "-p tcp" (or "-p all")
--- and the option "--reject-with tcp-reset".
--- @params args Table containing the search arguments (optional)
--- @return Table of matching rule tables
-function IptParser.find( self, args )
-
- local args = args or { }
- local rv = { }
-
- args.source = args.source and self:_parse_addr(args.source)
- args.destination = args.destination and self:_parse_addr(args.destination)
-
- for i, rule in ipairs(self._rules) do
- local match = true
-
- -- match table
- if not ( not args.table or args.table:lower() == rule.table ) then
- match = false
- end
-
- -- match chain
- if not ( match == true and (
- not args.chain or args.chain == rule.chain
- ) ) then
- match = false
- end
-
- -- match target
- if not ( match == true and (
- not args.target or args.target == rule.target
- ) ) then
- match = false
- end
-
- -- match protocol
- if not ( match == true and (
- not args.protocol or rule.protocol == "all" or
- args.protocol:lower() == rule.protocol
- ) ) then
- match = false
- end
-
- -- match source
- if not ( match == true and (
- not args.source or rule.source == self._nulladdr or
- self:_parse_addr(rule.source):contains(args.source)
- ) ) then
- match = false
- end
-
- -- match destination
- if not ( match == true and (
- not args.destination or rule.destination == self._nulladdr or
- self:_parse_addr(rule.destination):contains(args.destination)
- ) ) then
- match = false
- end
-
- -- match input interface
- if not ( match == true and (
- not args.inputif or rule.inputif == "*" or
- args.inputif == rule.inputif
- ) ) then
- match = false
- end
-
- -- match output interface
- if not ( match == true and (
- not args.outputif or rule.outputif == "*" or
- args.outputif == rule.outputif
- ) ) then
- match = false
- end
-
- -- match flags (the "opt" column)
- if not ( match == true and (
- not args.flags or rule.flags == args.flags
- ) ) then
- match = false
- end
-
- -- match specific options
- if not ( match == true and (
- not args.options or
- self:_match_options( rule.options, args.options )
- ) ) then
- match = false
- end
-
- -- insert match
- if match == true then
- rv[#rv+1] = rule
- end
- end
-
- return rv
-end
-
-
---- Rebuild the internal lookup table, for example when rules have changed
--- through external commands.
--- @return nothing
-function IptParser.resync( self )
- self._rules = { }
- self._chain = nil
- self:_parse_rules()
-end
-
-
---- Find the names of all tables.
--- @return Table of table names.
-function IptParser.tables( self )
- return self._tables
-end
-
-
---- Find the names of all chains within the given table name.
--- @param table String containing the table name
--- @return Table of chain names in the order they occur.
-function IptParser.chains( self, table )
- local lookup = { }
- local chains = { }
- for _, r in ipairs(self:find({table=table})) do
- if not lookup[r.chain] then
- lookup[r.chain] = true
- chains[#chains+1] = r.chain
- end
- end
- return chains
-end
-
-
---- Return the given firewall chain within the given table name.
--- @param table String containing the table name
--- @param chain String containing the chain name
--- @return Table containing the fields "policy", "packets", "bytes"
--- and "rules". The "rules" field is a table of rule tables.
-function IptParser.chain( self, table, chain )
- return self._chains[table:lower()] and self._chains[table:lower()][chain]
-end
-
-
---- Test whether the given target points to a custom chain.
--- @param target String containing the target action
--- @return Boolean indicating whether target is a custom chain.
-function IptParser.is_custom_target( self, target )
- for _, r in ipairs(self._rules) do
- if r.chain == target then
- return true
- end
- end
- return false
-end
-
-
--- [internal] Parse address according to family.
-function IptParser._parse_addr( self, addr )
- if self._family == 4 then
- return luci.ip.IPv4(addr)
- else
- return luci.ip.IPv6(addr)
- end
-end
-
--- [internal] Parse iptables output from all tables.
-function IptParser._parse_rules( self )
-
- for i, tbl in ipairs(self._tables) do
-
- self._chains[tbl] = { }
-
- for i, rule in ipairs(luci.util.execl(self._command % tbl)) do
-
- if rule:find( "^Chain " ) == 1 then
-
- local crefs
- local cname, cpol, cpkt, cbytes = rule:match(
- "^Chain ([^%s]*) %(policy (%w+) " ..
- "(%d+) packets, (%d+) bytes%)"
- )
-
- if not cname then
- cname, crefs = rule:match(
- "^Chain ([^%s]*) %((%d+) references%)"
- )
- end
-
- self._chain = cname
- self._chains[tbl][cname] = {
- policy = cpol,
- packets = tonumber(cpkt or 0),
- bytes = tonumber(cbytes or 0),
- references = tonumber(crefs or 0),
- rules = { }
- }
-
- else
- if rule:find("%d") == 1 then
-
- local rule_parts = luci.util.split( rule, "%s+", nil, true )
- local rule_details = { }
-
- -- cope with rules that have no target assigned
- if rule:match("^%d+%s+%d+%s+%d+%s%s") then
- table.insert(rule_parts, 4, nil)
- end
-
- -- ip6tables opt column is usually zero-width
- if self._family == 6 then
- table.insert(rule_parts, 6, "--")
- end
-
- rule_details["table"] = tbl
- rule_details["chain"] = self._chain
- rule_details["index"] = tonumber(rule_parts[1])
- rule_details["packets"] = tonumber(rule_parts[2])
- rule_details["bytes"] = tonumber(rule_parts[3])
- rule_details["target"] = rule_parts[4]
- rule_details["protocol"] = rule_parts[5]
- rule_details["flags"] = rule_parts[6]
- rule_details["inputif"] = rule_parts[7]
- rule_details["outputif"] = rule_parts[8]
- rule_details["source"] = rule_parts[9]
- rule_details["destination"] = rule_parts[10]
- rule_details["options"] = { }
-
- for i = 11, #rule_parts do
- if #rule_parts[i] > 0 then
- rule_details["options"][i-10] = rule_parts[i]
- end
- end
-
- self._rules[#self._rules+1] = rule_details
-
- self._chains[tbl][self._chain].rules[
- #self._chains[tbl][self._chain].rules + 1
- ] = rule_details
- end
- end
- end
- end
-
- self._chain = nil
-end
-
-
--- [internal] Return true if optlist1 contains all elements of optlist 2.
--- Return false in all other cases.
-function IptParser._match_options( self, o1, o2 )
-
- -- construct a hashtable of first options list to speed up lookups
- local oh = { }
- for i, opt in ipairs( o1 ) do oh[opt] = true end
-
- -- iterate over second options list
- -- each string in o2 must be also present in o1
- -- if o2 contains a string which is not found in o1 then return false
- for i, opt in ipairs( o2 ) do
- if not oh[opt] then
- return false
- end
- end
-
- return true
-end
+++ /dev/null
---[[
-LuCI - Autogenerated Zoneinfo Module
-
-Licensed under the Apache License, Version 2.0 (the "License");
-you may not use this file except in compliance with the License.
-You may obtain a copy of the License at
-
- http://www.apache.org/licenses/LICENSE-2.0
-
-]]--
-
-local setmetatable, require, rawget, rawset = setmetatable, require, rawget, rawset
-
-module "luci.sys.zoneinfo"
-
-setmetatable(_M, {
- __index = function(t, k)
- if k == "TZ" and not rawget(t, k) then
- local m = require "luci.sys.zoneinfo.tzdata"
- rawset(t, k, rawget(m, k))
- elseif k == "OFFSET" and not rawget(t, k) then
- local m = require "luci.sys.zoneinfo.tzoffset"
- rawset(t, k, rawget(m, k))
- end
-
- return rawget(t, k)
- end
-})
+++ /dev/null
---[[
-LuCI - Autogenerated Zoneinfo Module
-
-Licensed under the Apache License, Version 2.0 (the "License");
-you may not use this file except in compliance with the License.
-You may obtain a copy of the License at
-
- http://www.apache.org/licenses/LICENSE-2.0
-
-]]--
-
-module "luci.sys.zoneinfo.tzdata"
-
-TZ = {
- { 'Africa/Abidjan', 'GMT0' },
- { 'Africa/Accra', 'GMT0' },
- { 'Africa/Addis Ababa', 'EAT-3' },
- { 'Africa/Algiers', 'CET-1' },
- { 'Africa/Asmara', 'EAT-3' },
- { 'Africa/Bamako', 'GMT0' },
- { 'Africa/Bangui', 'WAT-1' },
- { 'Africa/Banjul', 'GMT0' },
- { 'Africa/Bissau', 'GMT0' },
- { 'Africa/Blantyre', 'CAT-2' },
- { 'Africa/Brazzaville', 'WAT-1' },
- { 'Africa/Bujumbura', 'CAT-2' },
- { 'Africa/Casablanca', 'WET0' },
- { 'Africa/Ceuta', 'CET-1CEST,M3.5.0,M10.5.0/3' },
- { 'Africa/Conakry', 'GMT0' },
- { 'Africa/Dakar', 'GMT0' },
- { 'Africa/Dar es Salaam', 'EAT-3' },
- { 'Africa/Djibouti', 'EAT-3' },
- { 'Africa/Douala', 'WAT-1' },
- { 'Africa/El Aaiun', 'WET0' },
- { 'Africa/Freetown', 'GMT0' },
- { 'Africa/Gaborone', 'CAT-2' },
- { 'Africa/Harare', 'CAT-2' },
- { 'Africa/Johannesburg', 'SAST-2' },
- { 'Africa/Juba', 'EAT-3' },
- { 'Africa/Kampala', 'EAT-3' },
- { 'Africa/Khartoum', 'EAT-3' },
- { 'Africa/Kigali', 'CAT-2' },
- { 'Africa/Kinshasa', 'WAT-1' },
- { 'Africa/Lagos', 'WAT-1' },
- { 'Africa/Libreville', 'WAT-1' },
- { 'Africa/Lome', 'GMT0' },
- { 'Africa/Luanda', 'WAT-1' },
- { 'Africa/Lubumbashi', 'CAT-2' },
- { 'Africa/Lusaka', 'CAT-2' },
- { 'Africa/Malabo', 'WAT-1' },
- { 'Africa/Maputo', 'CAT-2' },
- { 'Africa/Maseru', 'SAST-2' },
- { 'Africa/Mbabane', 'SAST-2' },
- { 'Africa/Mogadishu', 'EAT-3' },
- { 'Africa/Monrovia', 'GMT0' },
- { 'Africa/Nairobi', 'EAT-3' },
- { 'Africa/Ndjamena', 'WAT-1' },
- { 'Africa/Niamey', 'WAT-1' },
- { 'Africa/Nouakchott', 'GMT0' },
- { 'Africa/Ouagadougou', 'GMT0' },
- { 'Africa/Porto-Novo', 'WAT-1' },
- { 'Africa/Sao Tome', 'GMT0' },
- { 'Africa/Tripoli', 'EET-2' },
- { 'Africa/Tunis', 'CET-1' },
- { 'Africa/Windhoek', 'WAT-1WAST,M9.1.0,M4.1.0' },
- { 'America/Adak', 'HAST10HADT,M3.2.0,M11.1.0' },
- { 'America/Anchorage', 'AKST9AKDT,M3.2.0,M11.1.0' },
- { 'America/Anguilla', 'AST4' },
- { 'America/Antigua', 'AST4' },
- { 'America/Araguaina', 'BRT3' },
- { 'America/Argentina/Buenos Aires', 'ART3' },
- { 'America/Argentina/Catamarca', 'ART3' },
- { 'America/Argentina/Cordoba', 'ART3' },
- { 'America/Argentina/Jujuy', 'ART3' },
- { 'America/Argentina/La Rioja', 'ART3' },
- { 'America/Argentina/Mendoza', 'ART3' },
- { 'America/Argentina/Rio Gallegos', 'ART3' },
- { 'America/Argentina/Salta', 'ART3' },
- { 'America/Argentina/San Juan', 'ART3' },
- { 'America/Argentina/Tucuman', 'ART3' },
- { 'America/Argentina/Ushuaia', 'ART3' },
- { 'America/Aruba', 'AST4' },
- { 'America/Asuncion', 'PYT4PYST,M10.1.0/0,M4.2.0/0' },
- { 'America/Atikokan', 'EST5' },
- { 'America/Bahia', 'BRT3BRST,M10.3.0/0,M2.3.0/0' },
- { 'America/Bahia Banderas', 'CST6CDT,M4.1.0,M10.5.0' },
- { 'America/Barbados', 'AST4' },
- { 'America/Belem', 'BRT3' },
- { 'America/Belize', 'CST6' },
- { 'America/Blanc-Sablon', 'AST4' },
- { 'America/Boa Vista', 'AMT4' },
- { 'America/Bogota', 'COT5' },
- { 'America/Boise', 'MST7MDT,M3.2.0,M11.1.0' },
- { 'America/Cambridge Bay', 'MST7MDT,M3.2.0,M11.1.0' },
- { 'America/Campo Grande', 'AMT4AMST,M10.3.0/0,M2.3.0/0' },
- { 'America/Cancun', 'CST6CDT,M4.1.0,M10.5.0' },
- { 'America/Caracas', 'VET4:30' },
- { 'America/Cayenne', 'GFT3' },
- { 'America/Cayman', 'EST5' },
- { 'America/Chicago', 'CST6CDT,M3.2.0,M11.1.0' },
- { 'America/Chihuahua', 'MST7MDT,M4.1.0,M10.5.0' },
- { 'America/Costa Rica', 'CST6' },
- { 'America/Cuiaba', 'AMT4AMST,M10.3.0/0,M2.3.0/0' },
- { 'America/Curacao', 'AST4' },
- { 'America/Danmarkshavn', 'GMT0' },
- { 'America/Dawson', 'PST8PDT,M3.2.0,M11.1.0' },
- { 'America/Dawson Creek', 'MST7' },
- { 'America/Denver', 'MST7MDT,M3.2.0,M11.1.0' },
- { 'America/Detroit', 'EST5EDT,M3.2.0,M11.1.0' },
- { 'America/Dominica', 'AST4' },
- { 'America/Edmonton', 'MST7MDT,M3.2.0,M11.1.0' },
- { 'America/Eirunepe', 'AMT4' },
- { 'America/El Salvador', 'CST6' },
- { 'America/Fortaleza', 'BRT3' },
- { 'America/Glace Bay', 'AST4ADT,M3.2.0,M11.1.0' },
- { 'America/Goose Bay', 'AST4ADT,M3.2.0,M11.1.0' },
- { 'America/Grand Turk', 'EST5EDT,M3.2.0,M11.1.0' },
- { 'America/Grenada', 'AST4' },
- { 'America/Guadeloupe', 'AST4' },
- { 'America/Guatemala', 'CST6' },
- { 'America/Guayaquil', 'ECT5' },
- { 'America/Guyana', 'GYT4' },
- { 'America/Halifax', 'AST4ADT,M3.2.0,M11.1.0' },
- { 'America/Havana', 'CST5CDT,M3.2.0/0,M10.5.0/1' },
- { 'America/Hermosillo', 'MST7' },
- { 'America/Indiana/Indianapolis', 'EST5EDT,M3.2.0,M11.1.0' },
- { 'America/Indiana/Knox', 'CST6CDT,M3.2.0,M11.1.0' },
- { 'America/Indiana/Marengo', 'EST5EDT,M3.2.0,M11.1.0' },
- { 'America/Indiana/Petersburg', 'EST5EDT,M3.2.0,M11.1.0' },
- { 'America/Indiana/Tell City', 'CST6CDT,M3.2.0,M11.1.0' },
- { 'America/Indiana/Vevay', 'EST5EDT,M3.2.0,M11.1.0' },
- { 'America/Indiana/Vincennes', 'EST5EDT,M3.2.0,M11.1.0' },
- { 'America/Indiana/Winamac', 'EST5EDT,M3.2.0,M11.1.0' },
- { 'America/Inuvik', 'MST7MDT,M3.2.0,M11.1.0' },
- { 'America/Iqaluit', 'EST5EDT,M3.2.0,M11.1.0' },
- { 'America/Jamaica', 'EST5' },
- { 'America/Juneau', 'AKST9AKDT,M3.2.0,M11.1.0' },
- { 'America/Kentucky/Louisville', 'EST5EDT,M3.2.0,M11.1.0' },
- { 'America/Kentucky/Monticello', 'EST5EDT,M3.2.0,M11.1.0' },
- { 'America/Kralendijk', 'AST4' },
- { 'America/La Paz', 'BOT4' },
- { 'America/Lima', 'PET5' },
- { 'America/Los Angeles', 'PST8PDT,M3.2.0,M11.1.0' },
- { 'America/Lower Princes', 'AST4' },
- { 'America/Maceio', 'BRT3' },
- { 'America/Managua', 'CST6' },
- { 'America/Manaus', 'AMT4' },
- { 'America/Marigot', 'AST4' },
- { 'America/Martinique', 'AST4' },
- { 'America/Matamoros', 'CST6CDT,M3.2.0,M11.1.0' },
- { 'America/Mazatlan', 'MST7MDT,M4.1.0,M10.5.0' },
- { 'America/Menominee', 'CST6CDT,M3.2.0,M11.1.0' },
- { 'America/Merida', 'CST6CDT,M4.1.0,M10.5.0' },
- { 'America/Metlakatla', 'MeST8' },
- { 'America/Mexico City', 'CST6CDT,M4.1.0,M10.5.0' },
- { 'America/Miquelon', 'PMST3PMDT,M3.2.0,M11.1.0' },
- { 'America/Moncton', 'AST4ADT,M3.2.0,M11.1.0' },
- { 'America/Monterrey', 'CST6CDT,M4.1.0,M10.5.0' },
- { 'America/Montevideo', 'UYT3UYST,M10.1.0,M3.2.0' },
- { 'America/Montreal', 'EST5EDT,M3.2.0,M11.1.0' },
- { 'America/Montserrat', 'AST4' },
- { 'America/Nassau', 'EST5EDT,M3.2.0,M11.1.0' },
- { 'America/New York', 'EST5EDT,M3.2.0,M11.1.0' },
- { 'America/Nipigon', 'EST5EDT,M3.2.0,M11.1.0' },
- { 'America/Nome', 'AKST9AKDT,M3.2.0,M11.1.0' },
- { 'America/Noronha', 'FNT2' },
- { 'America/North Dakota/Beulah', 'CST6CDT,M3.2.0,M11.1.0' },
- { 'America/North Dakota/Center', 'CST6CDT,M3.2.0,M11.1.0' },
- { 'America/North Dakota/New Salem', 'CST6CDT,M3.2.0,M11.1.0' },
- { 'America/Ojinaga', 'MST7MDT,M3.2.0,M11.1.0' },
- { 'America/Panama', 'EST5' },
- { 'America/Pangnirtung', 'EST5EDT,M3.2.0,M11.1.0' },
- { 'America/Paramaribo', 'SRT3' },
- { 'America/Phoenix', 'MST7' },
- { 'America/Port of Spain', 'AST4' },
- { 'America/Port-au-Prince', 'EST5' },
- { 'America/Porto Velho', 'AMT4' },
- { 'America/Puerto Rico', 'AST4' },
- { 'America/Rainy River', 'CST6CDT,M3.2.0,M11.1.0' },
- { 'America/Rankin Inlet', 'CST6CDT,M3.2.0,M11.1.0' },
- { 'America/Recife', 'BRT3' },
- { 'America/Regina', 'CST6' },
- { 'America/Resolute', 'CST6CDT,M3.2.0,M11.1.0' },
- { 'America/Rio Branco', 'AMT4' },
- { 'America/Santa Isabel', 'PST8PDT,M4.1.0,M10.5.0' },
- { 'America/Santarem', 'BRT3' },
- { 'America/Santo Domingo', 'AST4' },
- { 'America/Sao Paulo', 'BRT3BRST,M10.3.0/0,M2.3.0/0' },
- { 'America/Scoresbysund', 'EGT1EGST,M3.5.0/0,M10.5.0/1' },
- { 'America/Shiprock', 'MST7MDT,M3.2.0,M11.1.0' },
- { 'America/Sitka', 'AKST9AKDT,M3.2.0,M11.1.0' },
- { 'America/St Barthelemy', 'AST4' },
- { 'America/St Johns', 'NST3:30NDT,M3.2.0,M11.1.0' },
- { 'America/St Kitts', 'AST4' },
- { 'America/St Lucia', 'AST4' },
- { 'America/St Thomas', 'AST4' },
- { 'America/St Vincent', 'AST4' },
- { 'America/Swift Current', 'CST6' },
- { 'America/Tegucigalpa', 'CST6' },
- { 'America/Thule', 'AST4ADT,M3.2.0,M11.1.0' },
- { 'America/Thunder Bay', 'EST5EDT,M3.2.0,M11.1.0' },
- { 'America/Tijuana', 'PST8PDT,M3.2.0,M11.1.0' },
- { 'America/Toronto', 'EST5EDT,M3.2.0,M11.1.0' },
- { 'America/Tortola', 'AST4' },
- { 'America/Vancouver', 'PST8PDT,M3.2.0,M11.1.0' },
- { 'America/Whitehorse', 'PST8PDT,M3.2.0,M11.1.0' },
- { 'America/Winnipeg', 'CST6CDT,M3.2.0,M11.1.0' },
- { 'America/Yakutat', 'AKST9AKDT,M3.2.0,M11.1.0' },
- { 'America/Yellowknife', 'MST7MDT,M3.2.0,M11.1.0' },
- { 'Antarctica/Casey', 'WST-8' },
- { 'Antarctica/Davis', 'DAVT-7' },
- { 'Antarctica/DumontDUrville', 'DDUT-10' },
- { 'Antarctica/Macquarie', 'MIST-11' },
- { 'Antarctica/Mawson', 'MAWT-5' },
- { 'Antarctica/McMurdo', 'NZST-12NZDT,M9.5.0,M4.1.0/3' },
- { 'Antarctica/Rothera', 'ROTT3' },
- { 'Antarctica/South Pole', 'NZST-12NZDT,M9.5.0,M4.1.0/3' },
- { 'Antarctica/Syowa', 'SYOT-3' },
- { 'Antarctica/Vostok', 'VOST-6' },
- { 'Arctic/Longyearbyen', 'CET-1CEST,M3.5.0,M10.5.0/3' },
- { 'Asia/Aden', 'AST-3' },
- { 'Asia/Almaty', 'ALMT-6' },
- { 'Asia/Anadyr', 'ANAT-12' },
- { 'Asia/Aqtau', 'AQTT-5' },
- { 'Asia/Aqtobe', 'AQTT-5' },
- { 'Asia/Ashgabat', 'TMT-5' },
- { 'Asia/Baghdad', 'AST-3' },
- { 'Asia/Bahrain', 'AST-3' },
- { 'Asia/Baku', 'AZT-4AZST,M3.5.0/4,M10.5.0/5' },
- { 'Asia/Bangkok', 'ICT-7' },
- { 'Asia/Beirut', 'EET-2EEST,M3.5.0/0,M10.5.0/0' },
- { 'Asia/Bishkek', 'KGT-6' },
- { 'Asia/Brunei', 'BNT-8' },
- { 'Asia/Choibalsan', 'CHOT-8' },
- { 'Asia/Chongqing', 'CST-8' },
- { 'Asia/Colombo', 'IST-5:30' },
- { 'Asia/Damascus', 'EET-2EEST,M4.1.5/0,M10.5.5/0' },
- { 'Asia/Dhaka', 'BDT-6' },
- { 'Asia/Dili', 'TLT-9' },
- { 'Asia/Dubai', 'GST-4' },
- { 'Asia/Dushanbe', 'TJT-5' },
- { 'Asia/Gaza', 'EET-2' },
- { 'Asia/Harbin', 'CST-8' },
- { 'Asia/Hebron', 'EET-2' },
- { 'Asia/Ho Chi Minh', 'ICT-7' },
- { 'Asia/Hong Kong', 'HKT-8' },
- { 'Asia/Hovd', 'HOVT-7' },
- { 'Asia/Irkutsk', 'IRKT-9' },
- { 'Asia/Jakarta', 'WIT-7' },
- { 'Asia/Jayapura', 'EIT-9' },
- { 'Asia/Kabul', 'AFT-4:30' },
- { 'Asia/Kamchatka', 'PETT-12' },
- { 'Asia/Karachi', 'PKT-5' },
- { 'Asia/Kashgar', 'CST-8' },
- { 'Asia/Kathmandu', 'NPT-5:45' },
- { 'Asia/Kolkata', 'IST-5:30' },
- { 'Asia/Krasnoyarsk', 'KRAT-8' },
- { 'Asia/Kuala Lumpur', 'MYT-8' },
- { 'Asia/Kuching', 'MYT-8' },
- { 'Asia/Kuwait', 'AST-3' },
- { 'Asia/Macau', 'CST-8' },
- { 'Asia/Magadan', 'MAGT-12' },
- { 'Asia/Makassar', 'CIT-8' },
- { 'Asia/Manila', 'PHT-8' },
- { 'Asia/Muscat', 'GST-4' },
- { 'Asia/Nicosia', 'EET-2EEST,M3.5.0/3,M10.5.0/4' },
- { 'Asia/Novokuznetsk', 'NOVT-7' },
- { 'Asia/Novosibirsk', 'NOVT-7' },
- { 'Asia/Omsk', 'OMST-7' },
- { 'Asia/Oral', 'ORAT-5' },
- { 'Asia/Phnom Penh', 'ICT-7' },
- { 'Asia/Pontianak', 'WIT-7' },
- { 'Asia/Pyongyang', 'KST-9' },
- { 'Asia/Qatar', 'AST-3' },
- { 'Asia/Qyzylorda', 'QYZT-6' },
- { 'Asia/Rangoon', 'MMT-6:30' },
- { 'Asia/Riyadh', 'AST-3' },
- { 'Asia/Sakhalin', 'SAKT-11' },
- { 'Asia/Samarkand', 'UZT-5' },
- { 'Asia/Seoul', 'KST-9' },
- { 'Asia/Shanghai', 'CST-8' },
- { 'Asia/Singapore', 'SGT-8' },
- { 'Asia/Taipei', 'CST-8' },
- { 'Asia/Tashkent', 'UZT-5' },
- { 'Asia/Tbilisi', 'GET-4' },
- { 'Asia/Thimphu', 'BTT-6' },
- { 'Asia/Tokyo', 'JST-9' },
- { 'Asia/Ulaanbaatar', 'ULAT-8' },
- { 'Asia/Urumqi', 'CST-8' },
- { 'Asia/Vientiane', 'ICT-7' },
- { 'Asia/Vladivostok', 'VLAT-11' },
- { 'Asia/Yakutsk', 'YAKT-10' },
- { 'Asia/Yekaterinburg', 'YEKT-6' },
- { 'Asia/Yerevan', 'AMT-4AMST,M3.5.0,M10.5.0/3' },
- { 'Atlantic/Azores', 'AZOT1AZOST,M3.5.0/0,M10.5.0/1' },
- { 'Atlantic/Bermuda', 'AST4ADT,M3.2.0,M11.1.0' },
- { 'Atlantic/Canary', 'WET0WEST,M3.5.0/1,M10.5.0' },
- { 'Atlantic/Cape Verde', 'CVT1' },
- { 'Atlantic/Faroe', 'WET0WEST,M3.5.0/1,M10.5.0' },
- { 'Atlantic/Madeira', 'WET0WEST,M3.5.0/1,M10.5.0' },
- { 'Atlantic/Reykjavik', 'GMT0' },
- { 'Atlantic/South Georgia', 'GST2' },
- { 'Atlantic/St Helena', 'GMT0' },
- { 'Atlantic/Stanley', 'FKT4FKST,M9.1.0,M4.3.0' },
- { 'Australia/Adelaide', 'CST-9:30CST,M10.1.0,M4.1.0/3' },
- { 'Australia/Brisbane', 'EST-10' },
- { 'Australia/Broken Hill', 'CST-9:30CST,M10.1.0,M4.1.0/3' },
- { 'Australia/Currie', 'EST-10EST,M10.1.0,M4.1.0/3' },
- { 'Australia/Darwin', 'CST-9:30' },
- { 'Australia/Eucla', 'CWST-8:45' },
- { 'Australia/Hobart', 'EST-10EST,M10.1.0,M4.1.0/3' },
- { 'Australia/Lindeman', 'EST-10' },
- { 'Australia/Lord Howe', 'LHST-10:30LHST-11,M10.1.0,M4.1.0' },
- { 'Australia/Melbourne', 'EST-10EST,M10.1.0,M4.1.0/3' },
- { 'Australia/Perth', 'WST-8' },
- { 'Australia/Sydney', 'EST-10EST,M10.1.0,M4.1.0/3' },
- { 'Europe/Amsterdam', 'CET-1CEST,M3.5.0,M10.5.0/3' },
- { 'Europe/Andorra', 'CET-1CEST,M3.5.0,M10.5.0/3' },
- { 'Europe/Athens', 'EET-2EEST,M3.5.0/3,M10.5.0/4' },
- { 'Europe/Belgrade', 'CET-1CEST,M3.5.0,M10.5.0/3' },
- { 'Europe/Berlin', 'CET-1CEST,M3.5.0,M10.5.0/3' },
- { 'Europe/Bratislava', 'CET-1CEST,M3.5.0,M10.5.0/3' },
- { 'Europe/Brussels', 'CET-1CEST,M3.5.0,M10.5.0/3' },
- { 'Europe/Bucharest', 'EET-2EEST,M3.5.0/3,M10.5.0/4' },
- { 'Europe/Budapest', 'CET-1CEST,M3.5.0,M10.5.0/3' },
- { 'Europe/Chisinau', 'EET-2EEST,M3.5.0/3,M10.5.0/4' },
- { 'Europe/Copenhagen', 'CET-1CEST,M3.5.0,M10.5.0/3' },
- { 'Europe/Dublin', 'GMT0IST,M3.5.0/1,M10.5.0' },
- { 'Europe/Gibraltar', 'CET-1CEST,M3.5.0,M10.5.0/3' },
- { 'Europe/Guernsey', 'GMT0BST,M3.5.0/1,M10.5.0' },
- { 'Europe/Helsinki', 'EET-2EEST,M3.5.0/3,M10.5.0/4' },
- { 'Europe/Isle of Man', 'GMT0BST,M3.5.0/1,M10.5.0' },
- { 'Europe/Istanbul', 'EET-2EEST,M3.5.0/3,M10.5.0/4' },
- { 'Europe/Jersey', 'GMT0BST,M3.5.0/1,M10.5.0' },
- { 'Europe/Kaliningrad', 'FET-3' },
- { 'Europe/Kiev', 'EET-2EEST,M3.5.0/3,M10.5.0/4' },
- { 'Europe/Lisbon', 'WET0WEST,M3.5.0/1,M10.5.0' },
- { 'Europe/Ljubljana', 'CET-1CEST,M3.5.0,M10.5.0/3' },
- { 'Europe/London', 'GMT0BST,M3.5.0/1,M10.5.0' },
- { 'Europe/Luxembourg', 'CET-1CEST,M3.5.0,M10.5.0/3' },
- { 'Europe/Madrid', 'CET-1CEST,M3.5.0,M10.5.0/3' },
- { 'Europe/Malta', 'CET-1CEST,M3.5.0,M10.5.0/3' },
- { 'Europe/Mariehamn', 'EET-2EEST,M3.5.0/3,M10.5.0/4' },
- { 'Europe/Minsk', 'FET-3' },
- { 'Europe/Monaco', 'CET-1CEST,M3.5.0,M10.5.0/3' },
- { 'Europe/Moscow', 'MSK-4' },
- { 'Europe/Oslo', 'CET-1CEST,M3.5.0,M10.5.0/3' },
- { 'Europe/Paris', 'CET-1CEST,M3.5.0,M10.5.0/3' },
- { 'Europe/Podgorica', 'CET-1CEST,M3.5.0,M10.5.0/3' },
- { 'Europe/Prague', 'CET-1CEST,M3.5.0,M10.5.0/3' },
- { 'Europe/Riga', 'EET-2EEST,M3.5.0/3,M10.5.0/4' },
- { 'Europe/Rome', 'CET-1CEST,M3.5.0,M10.5.0/3' },
- { 'Europe/Samara', 'SAMT-4' },
- { 'Europe/San Marino', 'CET-1CEST,M3.5.0,M10.5.0/3' },
- { 'Europe/Sarajevo', 'CET-1CEST,M3.5.0,M10.5.0/3' },
- { 'Europe/Simferopol', 'EET-2EEST,M3.5.0/3,M10.5.0/4' },
- { 'Europe/Skopje', 'CET-1CEST,M3.5.0,M10.5.0/3' },
- { 'Europe/Sofia', 'EET-2EEST,M3.5.0/3,M10.5.0/4' },
- { 'Europe/Stockholm', 'CET-1CEST,M3.5.0,M10.5.0/3' },
- { 'Europe/Tallinn', 'EET-2EEST,M3.5.0/3,M10.5.0/4' },
- { 'Europe/Tirane', 'CET-1CEST,M3.5.0,M10.5.0/3' },
- { 'Europe/Uzhgorod', 'EET-2EEST,M3.5.0/3,M10.5.0/4' },
- { 'Europe/Vaduz', 'CET-1CEST,M3.5.0,M10.5.0/3' },
- { 'Europe/Vatican', 'CET-1CEST,M3.5.0,M10.5.0/3' },
- { 'Europe/Vienna', 'CET-1CEST,M3.5.0,M10.5.0/3' },
- { 'Europe/Vilnius', 'EET-2EEST,M3.5.0/3,M10.5.0/4' },
- { 'Europe/Volgograd', 'VOLT-4' },
- { 'Europe/Warsaw', 'CET-1CEST,M3.5.0,M10.5.0/3' },
- { 'Europe/Zagreb', 'CET-1CEST,M3.5.0,M10.5.0/3' },
- { 'Europe/Zaporozhye', 'EET-2EEST,M3.5.0/3,M10.5.0/4' },
- { 'Europe/Zurich', 'CET-1CEST,M3.5.0,M10.5.0/3' },
- { 'Indian/Antananarivo', 'EAT-3' },
- { 'Indian/Chagos', 'IOT-6' },
- { 'Indian/Christmas', 'CXT-7' },
- { 'Indian/Cocos', 'CCT-6:30' },
- { 'Indian/Comoro', 'EAT-3' },
- { 'Indian/Kerguelen', 'TFT-5' },
- { 'Indian/Mahe', 'SCT-4' },
- { 'Indian/Maldives', 'MVT-5' },
- { 'Indian/Mauritius', 'MUT-4' },
- { 'Indian/Mayotte', 'EAT-3' },
- { 'Indian/Reunion', 'RET-4' },
- { 'Pacific/Apia', 'WST-13' },
- { 'Pacific/Auckland', 'NZST-12NZDT,M9.5.0,M4.1.0/3' },
- { 'Pacific/Chatham', 'CHAST-12:45CHADT,M9.5.0/2:45,M4.1.0/3:45' },
- { 'Pacific/Chuuk', 'CHUT-10' },
- { 'Pacific/Efate', 'VUT-11' },
- { 'Pacific/Enderbury', 'PHOT-13' },
- { 'Pacific/Fakaofo', 'TKT10' },
- { 'Pacific/Fiji', 'FJT-12' },
- { 'Pacific/Funafuti', 'TVT-12' },
- { 'Pacific/Galapagos', 'GALT6' },
- { 'Pacific/Gambier', 'GAMT9' },
- { 'Pacific/Guadalcanal', 'SBT-11' },
- { 'Pacific/Guam', 'ChST-10' },
- { 'Pacific/Honolulu', 'HST10' },
- { 'Pacific/Johnston', 'HST10' },
- { 'Pacific/Kiritimati', 'LINT-14' },
- { 'Pacific/Kosrae', 'KOST-11' },
- { 'Pacific/Kwajalein', 'MHT-12' },
- { 'Pacific/Majuro', 'MHT-12' },
- { 'Pacific/Marquesas', 'MART9:30' },
- { 'Pacific/Midway', 'SST11' },
- { 'Pacific/Nauru', 'NRT-12' },
- { 'Pacific/Niue', 'NUT11' },
- { 'Pacific/Norfolk', 'NFT-11:30' },
- { 'Pacific/Noumea', 'NCT-11' },
- { 'Pacific/Pago Pago', 'SST11' },
- { 'Pacific/Palau', 'PWT-9' },
- { 'Pacific/Pitcairn', 'PST8' },
- { 'Pacific/Pohnpei', 'PONT-11' },
- { 'Pacific/Port Moresby', 'PGT-10' },
- { 'Pacific/Rarotonga', 'CKT10' },
- { 'Pacific/Saipan', 'ChST-10' },
- { 'Pacific/Tahiti', 'TAHT10' },
- { 'Pacific/Tarawa', 'GILT-12' },
- { 'Pacific/Tongatapu', 'TOT-13' },
- { 'Pacific/Wake', 'WAKT-12' },
- { 'Pacific/Wallis', 'WFT-12' },
-}
+++ /dev/null
---[[
-LuCI - Autogenerated Zoneinfo Module
-
-Licensed under the Apache License, Version 2.0 (the "License");
-you may not use this file except in compliance with the License.
-You may obtain a copy of the License at
-
- http://www.apache.org/licenses/LICENSE-2.0
-
-]]--
-
-module "luci.sys.zoneinfo.tzoffset"
-
-OFFSET = {
- gmt = 0, -- GMT
- eat = 10800, -- EAT
- cet = 3600, -- CET
- wat = 3600, -- WAT
- cat = 7200, -- CAT
- wet = 0, -- WET
- sast = 7200, -- SAST
- eet = 7200, -- EET
- hast = -36000, -- HAST
- hadt = -32400, -- HADT
- akst = -32400, -- AKST
- akdt = -28800, -- AKDT
- ast = -14400, -- AST
- brt = -10800, -- BRT
- art = -10800, -- ART
- pyt = -14400, -- PYT
- pyst = -10800, -- PYST
- est = -18000, -- EST
- cst = -21600, -- CST
- cdt = -18000, -- CDT
- amt = -14400, -- AMT
- cot = -18000, -- COT
- mst = -25200, -- MST
- mdt = -21600, -- MDT
- vet = -16200, -- VET
- gft = -10800, -- GFT
- pst = -28800, -- PST
- pdt = -25200, -- PDT
- ect = -18000, -- ECT
- gyt = -14400, -- GYT
- bot = -14400, -- BOT
- pet = -18000, -- PET
- pmst = -10800, -- PMST
- pmdt = -7200, -- PMDT
- uyt = -10800, -- UYT
- uyst = -7200, -- UYST
- fnt = -7200, -- FNT
- srt = -10800, -- SRT
- egt = -3600, -- EGT
- egst = 0, -- EGST
- nst = -12600, -- NST
- ndt = -9000, -- NDT
- wst = 28800, -- WST
- davt = 25200, -- DAVT
- ddut = 36000, -- DDUT
- mist = 39600, -- MIST
- mawt = 18000, -- MAWT
- nzst = 43200, -- NZST
- nzdt = 46800, -- NZDT
- rott = -10800, -- ROTT
- syot = 10800, -- SYOT
- vost = 21600, -- VOST
- almt = 21600, -- ALMT
- anat = 43200, -- ANAT
- aqtt = 18000, -- AQTT
- tmt = 18000, -- TMT
- azt = 14400, -- AZT
- azst = 18000, -- AZST
- ict = 25200, -- ICT
- kgt = 21600, -- KGT
- bnt = 28800, -- BNT
- chot = 28800, -- CHOT
- ist = 19800, -- IST
- bdt = 21600, -- BDT
- tlt = 32400, -- TLT
- gst = 14400, -- GST
- tjt = 18000, -- TJT
- hkt = 28800, -- HKT
- hovt = 25200, -- HOVT
- irkt = 32400, -- IRKT
- wit = 25200, -- WIT
- eit = 32400, -- EIT
- aft = 16200, -- AFT
- pett = 43200, -- PETT
- pkt = 18000, -- PKT
- npt = 20700, -- NPT
- krat = 28800, -- KRAT
- myt = 28800, -- MYT
- magt = 43200, -- MAGT
- cit = 28800, -- CIT
- pht = 28800, -- PHT
- novt = 25200, -- NOVT
- omst = 25200, -- OMST
- orat = 18000, -- ORAT
- kst = 32400, -- KST
- qyzt = 21600, -- QYZT
- mmt = 23400, -- MMT
- sakt = 39600, -- SAKT
- uzt = 18000, -- UZT
- sgt = 28800, -- SGT
- get = 14400, -- GET
- btt = 21600, -- BTT
- jst = 32400, -- JST
- ulat = 28800, -- ULAT
- vlat = 39600, -- VLAT
- yakt = 36000, -- YAKT
- yekt = 21600, -- YEKT
- azot = -3600, -- AZOT
- azost = 0, -- AZOST
- cvt = -3600, -- CVT
- fkt = -14400, -- FKT
- fkst = -10800, -- FKST
- cwst = 31500, -- CWST
- lhst = 37800, -- LHST
- lhst = 39600, -- LHST
- fet = 10800, -- FET
- msk = 14400, -- MSK
- samt = 14400, -- SAMT
- volt = 14400, -- VOLT
- iot = 21600, -- IOT
- cxt = 25200, -- CXT
- cct = 23400, -- CCT
- tft = 18000, -- TFT
- sct = 14400, -- SCT
- mvt = 18000, -- MVT
- mut = 14400, -- MUT
- ret = 14400, -- RET
- chast = 45900, -- CHAST
- chadt = 49500, -- CHADT
- chut = 36000, -- CHUT
- vut = 39600, -- VUT
- phot = 46800, -- PHOT
- tkt = -36000, -- TKT
- fjt = 43200, -- FJT
- tvt = 43200, -- TVT
- galt = -21600, -- GALT
- gamt = -32400, -- GAMT
- sbt = 39600, -- SBT
- hst = -36000, -- HST
- lint = 50400, -- LINT
- kost = 39600, -- KOST
- mht = 43200, -- MHT
- mart = -34200, -- MART
- sst = -39600, -- SST
- nrt = 43200, -- NRT
- nut = -39600, -- NUT
- nft = 41400, -- NFT
- nct = 39600, -- NCT
- pwt = 32400, -- PWT
- pont = 39600, -- PONT
- pgt = 36000, -- PGT
- ckt = -36000, -- CKT
- taht = -36000, -- TAHT
- gilt = 43200, -- GILT
- tot = 46800, -- TOT
- wakt = 43200, -- WAKT
- wft = 43200, -- WFT
-}
+++ /dev/null
-ifneq (,$(wildcard ../../build/config.mk))
-include ../../build/config.mk
-include ../../build/module.mk
-include ../../build/gccconfig.mk
-else
-include standalone.mk
-endif
-
-TPL_LDFLAGS =
-TPL_CFLAGS =
-TPL_SO = parser.so
-TPL_PO2LMO = po2lmo
-TPL_PO2LMO_OBJ = src/po2lmo.o
-TPL_LMO_OBJ = src/template_lmo.o
-TPL_COMMON_OBJ = src/template_parser.o src/template_utils.o
-TPL_LUALIB_OBJ = src/template_lualib.o
-
-%.o: %.c
- $(COMPILE) $(TPL_CFLAGS) $(LUA_CFLAGS) $(FPIC) -c -o $@ $<
-
-compile: build-clean $(TPL_COMMON_OBJ) $(TPL_LUALIB_OBJ) $(TPL_LMO_OBJ) $(TPL_PO2LMO_OBJ)
- $(LINK) $(SHLIB_FLAGS) $(TPL_LDFLAGS) -o src/$(TPL_SO) \
- $(TPL_COMMON_OBJ) $(TPL_LMO_OBJ) $(TPL_LUALIB_OBJ)
- $(LINK) -o src/$(TPL_PO2LMO) \
- $(TPL_LMO_OBJ) $(TPL_PO2LMO_OBJ)
- mkdir -p dist$(LUCI_LIBRARYDIR)/template
- cp src/$(TPL_SO) dist$(LUCI_LIBRARYDIR)/template/$(TPL_SO)
-
-install: build
- cp -pR dist$(LUA_LIBRARYDIR)/* $(LUA_LIBRARYDIR)
-
-clean: build-clean
-
-build-clean:
- rm -f src/*.o src/$(TPL_SO)
-
-host-compile: build-clean host-clean $(TPL_LMO_OBJ) $(TPL_PO2LMO_OBJ)
- $(LINK) -o src/$(TPL_PO2LMO) $(TPL_LMO_OBJ) $(TPL_PO2LMO_OBJ)
-
-host-install: host-compile
- cp src/$(TPL_PO2LMO) ../../build/$(TPL_PO2LMO)
-
-host-clean:
- rm -f src/$(TPL_PO2LMO)
- rm -f ../../build/$(TPL_PO2LMO)
+++ /dev/null
-/*
- LuCI - Lua Configuration Interface
-
- Copyright 2008 Steven Barth <steven@midlink.org>
- Copyright 2008-2012 Jo-Philipp Wich <xm@subsignal.org>
-
- Licensed under the Apache License, Version 2.0 (the "License");
- you may not use this file except in compliance with the License.
- You may obtain a copy of the License at
-
- http://www.apache.org/licenses/LICENSE-2.0
-*/
-
-var cbi_d = [];
-var cbi_t = [];
-var cbi_c = [];
-
-var cbi_validators = {
-
- 'integer': function()
- {
- return (this.match(/^-?[0-9]+$/) != null);
- },
-
- 'uinteger': function()
- {
- return (cbi_validators.integer.apply(this) && (this >= 0));
- },
-
- 'float': function()
- {
- return !isNaN(parseFloat(this));
- },
-
- 'ufloat': function()
- {
- return (cbi_validators['float'].apply(this) && (this >= 0));
- },
-
- 'ipaddr': function()
- {
- return cbi_validators.ip4addr.apply(this) ||
- cbi_validators.ip6addr.apply(this);
- },
-
- 'ip4addr': function()
- {
- if (this.match(/^(\d{1,3})\.(\d{1,3})\.(\d{1,3})\.(\d{1,3})(\/(\S+))?$/))
- {
- return (RegExp.$1 >= 0) && (RegExp.$1 <= 255) &&
- (RegExp.$2 >= 0) && (RegExp.$2 <= 255) &&
- (RegExp.$3 >= 0) && (RegExp.$3 <= 255) &&
- (RegExp.$4 >= 0) && (RegExp.$4 <= 255) &&
- ((RegExp.$6.indexOf('.') < 0)
- ? ((RegExp.$6 >= 0) && (RegExp.$6 <= 32))
- : (cbi_validators.ip4addr.apply(RegExp.$6)))
- ;
- }
-
- return false;
- },
-
- 'ip6addr': function()
- {
- if( this.match(/^([a-fA-F0-9:.]+)(\/(\d+))?$/) )
- {
- if( !RegExp.$2 || ((RegExp.$3 >= 0) && (RegExp.$3 <= 128)) )
- {
- var addr = RegExp.$1;
-
- if( addr == '::' )
- {
- return true;
- }
-
- if( addr.indexOf('.') > 0 )
- {
- var off = addr.lastIndexOf(':');
-
- if( !(off && cbi_validators.ip4addr.apply(addr.substr(off+1))) )
- return false;
-
- addr = addr.substr(0, off) + ':0:0';
- }
-
- if( addr.indexOf('::') >= 0 )
- {
- var colons = 0;
- var fill = '0';
-
- for( var i = 1; i < (addr.length-1); i++ )
- if( addr.charAt(i) == ':' )
- colons++;
-
- if( colons > 7 )
- return false;
-
- for( var i = 0; i < (7 - colons); i++ )
- fill += ':0';
-
- if (addr.match(/^(.*?)::(.*?)$/))
- addr = (RegExp.$1 ? RegExp.$1 + ':' : '') + fill +
- (RegExp.$2 ? ':' + RegExp.$2 : '');
- }
-
- return (addr.match(/^(?:[a-fA-F0-9]{1,4}:){7}[a-fA-F0-9]{1,4}$/) != null);
- }
- }
-
- return false;
- },
-
- 'port': function()
- {
- return cbi_validators.integer.apply(this) &&
- (this >= 0) && (this <= 65535);
- },
-
- 'portrange': function()
- {
- if (this.match(/^(\d+)-(\d+)$/))
- {
- var p1 = RegExp.$1;
- var p2 = RegExp.$2;
-
- return cbi_validators.port.apply(p1) &&
- cbi_validators.port.apply(p2) &&
- (parseInt(p1) <= parseInt(p2))
- ;
- }
- else
- {
- return cbi_validators.port.apply(this);
- }
- },
-
- 'macaddr': function()
- {
- return (this.match(/^([a-fA-F0-9]{2}:){5}[a-fA-F0-9]{2}$/) != null);
- },
-
- 'host': function()
- {
- return cbi_validators.hostname.apply(this) ||
- cbi_validators.ipaddr.apply(this);
- },
-
- 'hostname': function()
- {
- if (this.length <= 253)
- return (this.match(/^[a-zA-Z0-9]+$/) != null ||
- (this.match(/^[a-zA-Z0-9_][a-zA-Z0-9_\-.]*[a-zA-Z0-9]$/) &&
- this.match(/[^0-9.]/)));
-
- return false;
- },
-
- 'network': function()
- {
- return cbi_validators.uciname.apply(this) ||
- cbi_validators.host.apply(this);
- },
-
- 'wpakey': function()
- {
- var v = this;
-
- if( v.length == 64 )
- return (v.match(/^[a-fA-F0-9]{64}$/) != null);
- else
- return (v.length >= 8) && (v.length <= 63);
- },
-
- 'wepkey': function()
- {
- var v = this;
-
- if ( v.substr(0,2) == 's:' )
- v = v.substr(2);
-
- if( (v.length == 10) || (v.length == 26) )
- return (v.match(/^[a-fA-F0-9]{10,26}$/) != null);
- else
- return (v.length == 5) || (v.length == 13);
- },
-
- 'uciname': function()
- {
- return (this.match(/^[a-zA-Z0-9_]+$/) != null);
- },
-
- 'range': function(min, max)
- {
- var val = parseFloat(this);
- if (!isNaN(min) && !isNaN(max) && !isNaN(val))
- return ((val >= min) && (val <= max));
-
- return false;
- },
-
- 'min': function(min)
- {
- var val = parseFloat(this);
- if (!isNaN(min) && !isNaN(val))
- return (val >= min);
-
- return false;
- },
-
- 'max': function(max)
- {
- var val = parseFloat(this);
- if (!isNaN(max) && !isNaN(val))
- return (val <= max);
-
- return false;
- },
-
- 'rangelength': function(min, max)
- {
- var val = '' + this;
- if (!isNaN(min) && !isNaN(max))
- return ((val.length >= min) && (val.length <= max));
-
- return false;
- },
-
- 'minlength': function(min)
- {
- var val = '' + this;
- if (!isNaN(min))
- return (val.length >= min);
-
- return false;
- },
-
- 'maxlength': function(max)
- {
- var val = '' + this;
- if (!isNaN(max))
- return (val.length <= max);
-
- return false;
- },
-
- 'or': function()
- {
- for (var i = 0; i < arguments.length; i += 2)
- {
- if (typeof arguments[i] != 'function')
- {
- if (arguments[i] == this)
- return true;
- i--;
- }
- else if (arguments[i].apply(this, arguments[i+1]))
- {
- return true;
- }
- }
- return false;
- },
-
- 'and': function()
- {
- for (var i = 0; i < arguments.length; i += 2)
- {
- if (typeof arguments[i] != 'function')
- {
- if (arguments[i] != this)
- return false;
- i--;
- }
- else if (!arguments[i].apply(this, arguments[i+1]))
- {
- return false;
- }
- }
- return true;
- },
-
- 'neg': function()
- {
- return cbi_validators.or.apply(
- this.replace(/^[ \t]*![ \t]*/, ''), arguments);
- },
-
- 'list': function(subvalidator, subargs)
- {
- if (typeof subvalidator != 'function')
- return false;
-
- var tokens = this.match(/[^ \t]+/g);
- for (var i = 0; i < tokens.length; i++)
- if (!subvalidator.apply(tokens[i], subargs))
- return false;
-
- return true;
- },
- 'phonedigit': function()
- {
- return (this.match(/^[0-9\*#!\.]+$/) != null);
- }
-};
-
-
-function cbi_d_add(field, dep, next) {
- var obj = document.getElementById(field);
- if (obj) {
- var entry
- for (var i=0; i<cbi_d.length; i++) {
- if (cbi_d[i].id == field) {
- entry = cbi_d[i];
- break;
- }
- }
- if (!entry) {
- entry = {
- "node": obj,
- "id": field,
- "parent": obj.parentNode.id,
- "next": next,
- "deps": []
- };
- cbi_d.unshift(entry);
- }
- entry.deps.push(dep)
- }
-}
-
-function cbi_d_checkvalue(target, ref) {
- var t = document.getElementById(target);
- var value;
-
- if (!t) {
- var tl = document.getElementsByName(target);
-
- if( tl.length > 0 && (tl[0].type == 'radio' || tl[0].type == 'checkbox'))
- for( var i = 0; i < tl.length; i++ )
- if( tl[i].checked ) {
- value = tl[i].value;
- break;
- }
-
- value = value ? value : "";
- } else if (!t.value) {
- value = "";
- } else {
- value = t.value;
-
- if (t.type == "checkbox") {
- value = t.checked ? value : "";
- }
- }
-
- return (value == ref)
-}
-
-function cbi_d_check(deps) {
- var reverse;
- var def = false;
- for (var i=0; i<deps.length; i++) {
- var istat = true;
- reverse = false;
- for (var j in deps[i]) {
- if (j == "!reverse") {
- reverse = true;
- } else if (j == "!default") {
- def = true;
- istat = false;
- } else {
- istat = (istat && cbi_d_checkvalue(j, deps[i][j]))
- }
- }
- if (istat) {
- return !reverse;
- }
- }
- return def;
-}
-
-function cbi_d_update() {
- var state = false;
- for (var i=0; i<cbi_d.length; i++) {
- var entry = cbi_d[i];
- var next = document.getElementById(entry.next)
- var node = document.getElementById(entry.id)
- var parent = document.getElementById(entry.parent)
-
- if (node && node.parentNode && !cbi_d_check(entry.deps)) {
- node.parentNode.removeChild(node);
- state = true;
- if( entry.parent )
- cbi_c[entry.parent]--;
- } else if ((!node || !node.parentNode) && cbi_d_check(entry.deps)) {
- if (!next) {
- parent.appendChild(entry.node);
- } else {
- next.parentNode.insertBefore(entry.node, next);
- }
- state = true;
- if( entry.parent )
- cbi_c[entry.parent]++;
- }
- }
-
- if (entry && entry.parent) {
- if (!cbi_t_update())
- cbi_tag_last(parent);
- }
-
- if (state) {
- cbi_d_update();
- }
-}
-
-function cbi_bind(obj, type, callback, mode) {
- if (!obj.addEventListener) {
- obj.attachEvent('on' + type,
- function(){
- var e = window.event;
-
- if (!e.target && e.srcElement)
- e.target = e.srcElement;
-
- return !!callback(e);
- }
- );
- } else {
- obj.addEventListener(type, callback, !!mode);
- }
- return obj;
-}
-
-function cbi_combobox(id, values, def, man) {
- var selid = "cbi.combobox." + id;
- if (document.getElementById(selid)) {
- return
- }
-
- var obj = document.getElementById(id)
- var sel = document.createElement("select");
- sel.id = selid;
- sel.className = obj.className.replace(/cbi-input-text/, 'cbi-input-select');
-
- if (obj.nextSibling) {
- obj.parentNode.insertBefore(sel, obj.nextSibling);
- } else {
- obj.parentNode.appendChild(sel);
- }
-
- var dt = obj.getAttribute('cbi_datatype');
- var op = obj.getAttribute('cbi_optional');
-
- if (dt)
- cbi_validate_field(sel, op == 'true', dt);
-
- if (!values[obj.value]) {
- if (obj.value == "") {
- var optdef = document.createElement("option");
- optdef.value = "";
- optdef.appendChild(document.createTextNode(def));
- sel.appendChild(optdef);
- } else {
- var opt = document.createElement("option");
- opt.value = obj.value;
- opt.selected = "selected";
- opt.appendChild(document.createTextNode(obj.value));
- sel.appendChild(opt);
- }
- }
-
- for (var i in values) {
- var opt = document.createElement("option");
- opt.value = i;
-
- if (obj.value == i) {
- opt.selected = "selected";
- }
-
- opt.appendChild(document.createTextNode(values[i]));
- sel.appendChild(opt);
- }
-
- var optman = document.createElement("option");
- optman.value = "";
- optman.appendChild(document.createTextNode(man));
- sel.appendChild(optman);
-
- obj.style.display = "none";
-
- cbi_bind(sel, "change", function() {
- if (sel.selectedIndex == sel.options.length - 1) {
- obj.style.display = "inline";
- sel.parentNode.removeChild(sel);
- obj.focus();
- } else {
- obj.value = sel.options[sel.selectedIndex].value;
- }
-
- try {
- cbi_d_update();
- } catch (e) {
- //Do nothing
- }
- })
-
- // Retrigger validation in select
- sel.focus();
- sel.blur();
-}
-
-function cbi_combobox_init(id, values, def, man) {
- var obj = document.getElementById(id);
- cbi_bind(obj, "blur", function() {
- cbi_combobox(id, values, def, man)
- });
- cbi_combobox(id, values, def, man);
-}
-
-function cbi_filebrowser(id, url, defpath) {
- var field = document.getElementById(id);
- var browser = window.open(
- url + ( field.value || defpath || '' ) + '?field=' + id,
- "luci_filebrowser", "width=300,height=400,left=100,top=200,scrollbars=yes"
- );
-
- browser.focus();
-}
-
-function cbi_browser_init(id, respath, url, defpath)
-{
- function cbi_browser_btnclick(e) {
- cbi_filebrowser(id, url, defpath);
- return false;
- }
-
- var field = document.getElementById(id);
-
- var btn = document.createElement('img');
- btn.className = 'cbi-image-button';
- btn.src = respath + '/cbi/folder.gif';
- field.parentNode.insertBefore(btn, field.nextSibling);
-
- cbi_bind(btn, 'click', cbi_browser_btnclick);
-}
-
-function cbi_dynlist_init(name, respath, datatype, optional, choices)
-{
- var input0 = document.getElementsByName(name)[0];
- var prefix = input0.name;
- var parent = input0.parentNode;
- var holder = input0.placeholder;
-
- var values;
-
- function cbi_dynlist_redraw(focus, add, del)
- {
- values = [ ];
-
- while (parent.firstChild)
- {
- var n = parent.firstChild;
- var i = parseInt(n.index);
-
- if (i != del)
- {
- if (n.nodeName.toLowerCase() == 'input')
- values.push(n.value || '');
- else if (n.nodeName.toLowerCase() == 'select')
- values[values.length-1] = n.options[n.selectedIndex].value;
- }
-
- parent.removeChild(n);
- }
-
- if (add >= 0)
- {
- focus = add+1;
- values.splice(focus, 0, '');
- }
- else if (values.length == 0)
- {
- focus = 0;
- values.push('');
- }
-
- for (var i = 0; i < values.length; i++)
- {
- var t = document.createElement('input');
- t.id = prefix + '.' + (i+1);
- t.name = prefix;
- t.value = values[i];
- t.type = 'text';
- t.index = i;
- t.className = 'cbi-input-text';
-
- if (i == 0 && holder)
- {
- t.placeholder = holder;
- }
-
- var b = document.createElement('img');
- b.src = respath + ((i+1) < values.length ? '/cbi/remove.gif' : '/cbi/add.gif');
- b.className = 'cbi-image-button';
-
- parent.appendChild(t);
- parent.appendChild(b);
- parent.appendChild(document.createElement('br'));
-
- if (datatype)
- {
- cbi_validate_field(t.id, ((i+1) == values.length) || optional, datatype);
- }
-
- if (choices)
- {
- cbi_combobox_init(t.id, choices[0], '', choices[1]);
- t.nextSibling.index = i;
-
- cbi_bind(t.nextSibling, 'keydown', cbi_dynlist_keydown);
- cbi_bind(t.nextSibling, 'keypress', cbi_dynlist_keypress);
-
- if (i == focus || -i == focus)
- t.nextSibling.focus();
- }
- else
- {
- cbi_bind(t, 'keydown', cbi_dynlist_keydown);
- cbi_bind(t, 'keypress', cbi_dynlist_keypress);
-
- if (i == focus)
- {
- t.focus();
- }
- else if (-i == focus)
- {
- t.focus();
-
- /* force cursor to end */
- var v = t.value;
- t.value = ' '
- t.value = v;
- }
- }
-
- cbi_bind(b, 'click', cbi_dynlist_btnclick);
- }
- }
-
- function cbi_dynlist_keypress(ev)
- {
- ev = ev ? ev : window.event;
-
- var se = ev.target ? ev.target : ev.srcElement;
-
- if (se.nodeType == 3)
- se = se.parentNode;
-
- switch (ev.keyCode)
- {
- /* backspace, delete */
- case 8:
- case 46:
- if (se.value.length == 0)
- {
- if (ev.preventDefault)
- ev.preventDefault();
-
- return false;
- }
-
- return true;
-
- /* enter, arrow up, arrow down */
- case 13:
- case 38:
- case 40:
- if (ev.preventDefault)
- ev.preventDefault();
-
- return false;
- }
-
- return true;
- }
-
- function cbi_dynlist_keydown(ev)
- {
- ev = ev ? ev : window.event;
-
- var se = ev.target ? ev.target : ev.srcElement;
-
- if (se.nodeType == 3)
- se = se.parentNode;
-
- var prev = se.previousSibling;
- while (prev && prev.name != name)
- prev = prev.previousSibling;
-
- var next = se.nextSibling;
- while (next && next.name != name)
- next = next.nextSibling;
-
- /* advance one further in combobox case */
- if (next && next.nextSibling.name == name)
- next = next.nextSibling;
-
- switch (ev.keyCode)
- {
- /* backspace, delete */
- case 8:
- case 46:
- var del = (se.nodeName.toLowerCase() == 'select')
- ? true : (se.value.length == 0);
-
- if (del)
- {
- if (ev.preventDefault)
- ev.preventDefault();
-
- var focus = se.index;
- if (ev.keyCode == 8)
- focus = -focus+1;
-
- cbi_dynlist_redraw(focus, -1, se.index);
-
- return false;
- }
-
- break;
-
- /* enter */
- case 13:
- cbi_dynlist_redraw(-1, se.index, -1);
- break;
-
- /* arrow up */
- case 38:
- if (prev)
- prev.focus();
-
- break;
-
- /* arrow down */
- case 40:
- if (next)
- next.focus();
-
- break;
- }
-
- return true;
- }
-
- function cbi_dynlist_btnclick(ev)
- {
- ev = ev ? ev : window.event;
-
- var se = ev.target ? ev.target : ev.srcElement;
-
- if (se.src.indexOf('remove') > -1)
- {
- se.previousSibling.value = '';
-
- cbi_dynlist_keydown({
- target: se.previousSibling,
- keyCode: 8
- });
- }
- else
- {
- cbi_dynlist_keydown({
- target: se.previousSibling,
- keyCode: 13
- });
- }
-
- return false;
- }
-
- cbi_dynlist_redraw(NaN, -1, -1);
-}
-
-//Hijacks the CBI form to send via XHR (requires Prototype)
-function cbi_hijack_forms(layer, win, fail, load) {
- var forms = layer.getElementsByTagName('form');
- for (var i=0; i<forms.length; i++) {
- $(forms[i]).observe('submit', function(event) {
- // Prevent the form from also submitting the regular way
- event.stop();
-
- // Submit via XHR
- event.element().request({
- onSuccess: win,
- onFailure: fail
- });
-
- if (load) {
- load();
- }
- });
- }
-}
-
-
-function cbi_t_add(section, tab) {
- var t = document.getElementById('tab.' + section + '.' + tab);
- var c = document.getElementById('container.' + section + '.' + tab);
-
- if( t && c ) {
- cbi_t[section] = (cbi_t[section] || [ ]);
- cbi_t[section][tab] = { 'tab': t, 'container': c, 'cid': c.id };
- }
-}
-
-function cbi_t_switch(section, tab) {
- if( cbi_t[section] && cbi_t[section][tab] ) {
- var o = cbi_t[section][tab];
- var h = document.getElementById('tab.' + section);
- for( var tid in cbi_t[section] ) {
- var o2 = cbi_t[section][tid];
- if( o.tab.id != o2.tab.id ) {
- o2.tab.className = o2.tab.className.replace(/(^| )cbi-tab( |$)/, " cbi-tab-disabled ");
- o2.container.style.display = 'none';
- }
- else {
- if(h) h.value = tab;
- o2.tab.className = o2.tab.className.replace(/(^| )cbi-tab-disabled( |$)/, " cbi-tab ");
- o2.container.style.display = 'block';
- }
- }
- }
- return false
-}
-
-function cbi_t_update() {
- var hl_tabs = [ ];
- var updated = false;
-
- for( var sid in cbi_t )
- for( var tid in cbi_t[sid] )
- {
- if( cbi_c[cbi_t[sid][tid].cid] == 0 ) {
- cbi_t[sid][tid].tab.style.display = 'none';
- }
- else if( cbi_t[sid][tid].tab && cbi_t[sid][tid].tab.style.display == 'none' ) {
- cbi_t[sid][tid].tab.style.display = '';
-
- var t = cbi_t[sid][tid].tab;
- t.className += ' cbi-tab-highlighted';
- hl_tabs.push(t);
- }
-
- cbi_tag_last(cbi_t[sid][tid].container);
- updated = true;
- }
-
- if( hl_tabs.length > 0 )
- window.setTimeout(function() {
- for( var i = 0; i < hl_tabs.length; i++ )
- hl_tabs[i].className = hl_tabs[i].className.replace(/ cbi-tab-highlighted/g, '');
- }, 750);
-
- return updated;
-}
-
-
-function cbi_validate_form(form, errmsg)
-{
- /* if triggered by a section removal or addition, don't validate */
- if( form.cbi_state == 'add-section' || form.cbi_state == 'del-section' )
- return true;
-
- if( form.cbi_validators )
- {
- for( var i = 0; i < form.cbi_validators.length; i++ )
- {
- var validator = form.cbi_validators[i];
- if( !validator() && errmsg )
- {
- alert(errmsg);
- return false;
- }
- }
- }
-
- return true;
-}
-
-function cbi_validate_reset(form)
-{
- window.setTimeout(
- function() { cbi_validate_form(form, null) }, 100
- );
-
- return true;
-}
-
-function cbi_validate_compile(code)
-{
- var pos = 0;
- var esc = false;
- var depth = 0;
- var stack = [ ];
-
- code += ',';
-
- for (var i = 0; i < code.length; i++)
- {
- if (esc)
- {
- esc = false;
- continue;
- }
-
- switch (code.charCodeAt(i))
- {
- case 92:
- esc = true;
- break;
-
- case 40:
- case 44:
- if (depth <= 0)
- {
- if (pos < i)
- {
- var label = code.substring(pos, i);
- label = label.replace(/\\(.)/g, '$1');
- label = label.replace(/^[ \t]+/g, '');
- label = label.replace(/[ \t]+$/g, '');
-
- if (label && !isNaN(label))
- {
- stack.push(parseFloat(label));
- }
- else if (label.match(/^(['"]).*\1$/))
- {
- stack.push(label.replace(/^(['"])(.*)\1$/, '$2'));
- }
- else if (typeof cbi_validators[label] == 'function')
- {
- stack.push(cbi_validators[label]);
- stack.push(null);
- }
- else
- {
- throw "Syntax error, unhandled token '"+label+"'";
- }
- }
- pos = i+1;
- }
- depth += (code.charCodeAt(i) == 40);
- break;
-
- case 41:
- if (--depth <= 0)
- {
- if (typeof stack[stack.length-2] != 'function')
- throw "Syntax error, argument list follows non-function";
-
- stack[stack.length-1] =
- arguments.callee(code.substring(pos, i));
-
- pos = i+1;
- }
- break;
- }
- }
-
- return stack;
-}
-
-function cbi_validate_field(cbid, optional, type)
-{
- var field = (typeof cbid == "string") ? document.getElementById(cbid) : cbid;
- var vstack; try { vstack = cbi_validate_compile(type); } catch(e) { };
-
- if (field && vstack && typeof vstack[0] == "function")
- {
- var validator = function()
- {
- // is not detached
- if( field.form )
- {
- field.className = field.className.replace(/ cbi-input-invalid/g, '');
-
- // validate value
- var value = (field.options && field.options.selectedIndex > -1)
- ? field.options[field.options.selectedIndex].value : field.value;
-
- if (!(((value.length == 0) && optional) || vstack[0].apply(value, vstack[1])))
- {
- // invalid
- field.className += ' cbi-input-invalid';
- return false;
- }
- }
-
- return true;
- };
-
- if( ! field.form.cbi_validators )
- field.form.cbi_validators = [ ];
-
- field.form.cbi_validators.push(validator);
-
- cbi_bind(field, "blur", validator);
- cbi_bind(field, "keyup", validator);
-
- if (field.nodeName == 'SELECT')
- {
- cbi_bind(field, "change", validator);
- cbi_bind(field, "click", validator);
- }
-
- field.setAttribute("cbi_validate", validator);
- field.setAttribute("cbi_datatype", type);
- field.setAttribute("cbi_optional", (!!optional).toString());
-
- validator();
-
- var fcbox = document.getElementById('cbi.combobox.' + field.id);
- if (fcbox)
- cbi_validate_field(fcbox, optional, type);
- }
-}
-
-function cbi_row_swap(elem, up, store)
-{
- var tr = elem.parentNode;
- while (tr && tr.nodeName.toLowerCase() != 'tr')
- tr = tr.parentNode;
-
- if (!tr)
- return false;
-
- var table = tr.parentNode;
- while (table && table.nodeName.toLowerCase() != 'table')
- table = table.parentNode;
-
- if (!table)
- return false;
-
- var s = up ? 3 : 2;
- var e = up ? table.rows.length : table.rows.length - 1;
-
- for (var idx = s; idx < e; idx++)
- {
- if (table.rows[idx] == tr)
- {
- if (up)
- tr.parentNode.insertBefore(table.rows[idx], table.rows[idx-1]);
- else
- tr.parentNode.insertBefore(table.rows[idx+1], table.rows[idx]);
-
- break;
- }
- }
-
- var ids = [ ];
- for (idx = 2; idx < table.rows.length; idx++)
- {
- table.rows[idx].className = table.rows[idx].className.replace(
- /cbi-rowstyle-[12]/, 'cbi-rowstyle-' + (1 + (idx % 2))
- );
-
- if (table.rows[idx].id && table.rows[idx].id.match(/-([^\-]+)$/) )
- ids.push(RegExp.$1);
- }
-
- var input = document.getElementById(store);
- if (input)
- input.value = ids.join(' ');
-
- return false;
-}
-
-function cbi_tag_last(container)
-{
- var last;
-
- for (var i = 0; i < container.childNodes.length; i++)
- {
- var c = container.childNodes[i];
- if (c.nodeType == 1 && c.nodeName.toLowerCase() == 'div')
- {
- c.className = c.className.replace(/ cbi-value-last$/, '');
- last = c;
- }
- }
-
- if (last)
- {
- last.className += ' cbi-value-last';
- }
-}
-
-String.prototype.serialize = function()
-{
- var o = this;
- switch(typeof(o))
- {
- case 'object':
- // null
- if( o == null )
- {
- return 'null';
- }
-
- // array
- else if( o.length )
- {
- var i, s = '';
-
- for( var i = 0; i < o.length; i++ )
- s += (s ? ', ' : '') + String.serialize(o[i]);
-
- return '[ ' + s + ' ]';
- }
-
- // object
- else
- {
- var k, s = '';
-
- for( k in o )
- s += (s ? ', ' : '') + k + ': ' + String.serialize(o[k]);
-
- return '{ ' + s + ' }';
- }
-
- break;
-
- case 'string':
- // complex string
- if( o.match(/[^a-zA-Z0-9_,.: -]/) )
- return 'decodeURIComponent("' + encodeURIComponent(o) + '")';
-
- // simple string
- else
- return '"' + o + '"';
-
- break;
-
- default:
- return o.toString();
- }
-}
-
-String.prototype.format = function()
-{
- if (!RegExp)
- return;
-
- var html_esc = [/&/g, '&', /"/g, '"', /'/g, ''', /</g, '<', />/g, '>'];
- var quot_esc = [/"/g, '"', /'/g, '''];
-
- function esc(s, r) {
- for( var i = 0; i < r.length; i += 2 )
- s = s.replace(r[i], r[i+1]);
- return s;
- }
-
- var str = this;
- var out = '';
- var re = /^(([^%]*)%('.|0|\x20)?(-)?(\d+)?(\.\d+)?(%|b|c|d|u|f|o|s|x|X|q|h|j|t|m))/;
- var a = b = [], numSubstitutions = 0, numMatches = 0;
-
- while( a = re.exec(str) )
- {
- var m = a[1];
- var leftpart = a[2], pPad = a[3], pJustify = a[4], pMinLength = a[5];
- var pPrecision = a[6], pType = a[7];
-
- numMatches++;
-
- if (pType == '%')
- {
- subst = '%';
- }
- else
- {
- if (numSubstitutions < arguments.length)
- {
- var param = arguments[numSubstitutions++];
-
- var pad = '';
- if (pPad && pPad.substr(0,1) == "'")
- pad = leftpart.substr(1,1);
- else if (pPad)
- pad = pPad;
-
- var justifyRight = true;
- if (pJustify && pJustify === "-")
- justifyRight = false;
-
- var minLength = -1;
- if (pMinLength)
- minLength = parseInt(pMinLength);
-
- var precision = -1;
- if (pPrecision && pType == 'f')
- precision = parseInt(pPrecision.substring(1));
-
- var subst = param;
-
- switch(pType)
- {
- case 'b':
- subst = (parseInt(param) || 0).toString(2);
- break;
-
- case 'c':
- subst = String.fromCharCode(parseInt(param) || 0);
- break;
-
- case 'd':
- subst = (parseInt(param) || 0);
- break;
-
- case 'u':
- subst = Math.abs(parseInt(param) || 0);
- break;
-
- case 'f':
- subst = (precision > -1)
- ? ((parseFloat(param) || 0.0)).toFixed(precision)
- : (parseFloat(param) || 0.0);
- break;
-
- case 'o':
- subst = (parseInt(param) || 0).toString(8);
- break;
-
- case 's':
- subst = param;
- break;
-
- case 'x':
- subst = ('' + (parseInt(param) || 0).toString(16)).toLowerCase();
- break;
-
- case 'X':
- subst = ('' + (parseInt(param) || 0).toString(16)).toUpperCase();
- break;
-
- case 'h':
- subst = esc(param, html_esc);
- break;
-
- case 'q':
- subst = esc(param, quot_esc);
- break;
-
- case 'j':
- subst = String.serialize(param);
- break;
-
- case 't':
- var td = 0;
- var th = 0;
- var tm = 0;
- var ts = (param || 0);
-
- if (ts > 60) {
- tm = Math.floor(ts / 60);
- ts = (ts % 60);
- }
-
- if (tm > 60) {
- th = Math.floor(tm / 60);
- tm = (tm % 60);
- }
-
- if (th > 24) {
- td = Math.floor(th / 24);
- th = (th % 24);
- }
-
- subst = (td > 0)
- ? String.format('%dd %dh %dm %ds', td, th, tm, ts)
- : String.format('%dh %dm %ds', th, tm, ts);
-
- break;
-
- case 'm':
- var mf = pMinLength ? parseInt(pMinLength) : 1000;
- var pr = pPrecision ? Math.floor(10*parseFloat('0'+pPrecision)) : 2;
-
- var i = 0;
- var val = parseFloat(param || 0);
- var units = [ '', 'K', 'M', 'G', 'T', 'P', 'E' ];
-
- for (i = 0; (i < units.length) && (val > mf); i++)
- val /= mf;
-
- subst = val.toFixed(pr) + ' ' + units[i];
- break;
- }
- }
- }
-
- out += leftpart + subst;
- str = str.substr(m.length);
- }
-
- return out + str;
-}
-
-String.prototype.nobr = function()
-{
- return this.replace(/[\s\n]+/g, ' ');
-}
-
-String.serialize = function()
-{
- var a = [ ];
- for (var i = 1; i < arguments.length; i++)
- a.push(arguments[i]);
- return ''.serialize.apply(arguments[0], a);
-}
-
-String.format = function()
-{
- var a = [ ];
- for (var i = 1; i < arguments.length; i++)
- a.push(arguments[i]);
- return ''.format.apply(arguments[0], a);
-}
-
-String.nobr = function()
-{
- var a = [ ];
- for (var i = 1; i < arguments.length; i++)
- a.push(arguments[i]);
- return ''.nobr.apply(arguments[0], a);
-}
+++ /dev/null
---[[
-LuCI - Lua Configuration Interface
-
-Copyright 2008 Steven Barth <steven@midlink.org>
-Copyright 2008 Jo-Philipp Wich <xm@leipzig.freifunk.net>
-
-Licensed under the Apache License, Version 2.0 (the "License");
-you may not use this file except in compliance with the License.
-You may obtain a copy of the License at
-
-http://www.apache.org/licenses/LICENSE-2.0
-
-$Id$
-]]--
-
-local config = require "luci.config"
-local ccache = require "luci.ccache"
-
-module "luci.cacheloader"
-
-if config.ccache and config.ccache.enable == "1" then
- ccache.cache_ondemand()
-end
\ No newline at end of file
+++ /dev/null
---[[
-LuCI - Configuration Bind Interface
-
-Description:
-Offers an interface for binding configuration values to certain
-data types. Supports value and range validation and basic dependencies.
-
-FileId:
-$Id$
-
-License:
-Copyright 2008 Steven Barth <steven@midlink.org>
-
-Licensed under the Apache License, Version 2.0 (the "License");
-you may not use this file except in compliance with the License.
-You may obtain a copy of the License at
-
- http://www.apache.org/licenses/LICENSE-2.0
-
-Unless required by applicable law or agreed to in writing, software
-distributed under the License is distributed on an "AS IS" BASIS,
-WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
-See the License for the specific language governing permissions and
-limitations under the License.
-
-]]--
-module("luci.cbi", package.seeall)
-
-require("luci.template")
-local util = require("luci.util")
-require("luci.http")
-
-
---local event = require "luci.sys.event"
-local fs = require("nixio.fs")
-local uci = require("luci.model.uci")
-local datatypes = require("luci.cbi.datatypes")
-local class = util.class
-local instanceof = util.instanceof
-
-FORM_NODATA = 0
-FORM_PROCEED = 0
-FORM_VALID = 1
-FORM_DONE = 1
-FORM_INVALID = -1
-FORM_CHANGED = 2
-FORM_SKIP = 4
-
-AUTO = true
-
-CREATE_PREFIX = "cbi.cts."
-REMOVE_PREFIX = "cbi.rts."
-RESORT_PREFIX = "cbi.sts."
-FEXIST_PREFIX = "cbi.cbe."
-
--- Loads a CBI map from given file, creating an environment and returns it
-function load(cbimap, ...)
- local fs = require "nixio.fs"
- local i18n = require "luci.i18n"
- require("luci.config")
- require("luci.util")
-
- local upldir = "/lib/uci/upload/"
- local cbidir = luci.util.libpath() .. "/model/cbi/"
- local func, err
-
- if fs.access(cbidir..cbimap..".lua") then
- func, err = loadfile(cbidir..cbimap..".lua")
- elseif fs.access(cbimap) then
- func, err = loadfile(cbimap)
- else
- func, err = nil, "Model '" .. cbimap .. "' not found!"
- end
-
- assert(func, err)
-
- local env = {
- translate=i18n.translate,
- translatef=i18n.translatef,
- arg={...}
- }
-
- setfenv(func, setmetatable(env, {__index =
- function(tbl, key)
- return rawget(tbl, key) or _M[key] or _G[key]
- end}))
-
- local maps = { func() }
- local uploads = { }
- local has_upload = false
-
- for i, map in ipairs(maps) do
- if not instanceof(map, Node) then
- error("CBI map returns no valid map object!")
- return nil
- else
- map:prepare()
- if map.upload_fields then
- has_upload = true
- for _, field in ipairs(map.upload_fields) do
- uploads[
- field.config .. '.' ..
- (field.section.sectiontype or '1') .. '.' ..
- field.option
- ] = true
- end
- end
- end
- end
-
- if has_upload then
- local uci = luci.model.uci.cursor()
- local prm = luci.http.context.request.message.params
- local fd, cbid
-
- luci.http.setfilehandler(
- function( field, chunk, eof )
- if not field then return end
- if field.name and not cbid then
- local c, s, o = field.name:gmatch(
- "cbid%.([^%.]+)%.([^%.]+)%.([^%.]+)"
- )()
-
- if c and s and o then
- local t = uci:get( c, s ) or s
- if uploads[c.."."..t.."."..o] then
- local path = upldir .. field.name
- fd = io.open(path, "w")
- if fd then
- cbid = field.name
- prm[cbid] = path
- end
- end
- end
- end
-
- if field.name == cbid and fd then
- fd:write(chunk)
- end
-
- if eof and fd then
- fd:close()
- fd = nil
- cbid = nil
- end
- end
- )
- end
-
- return maps
-end
-
---
--- Compile a datatype specification into a parse tree for evaluation later on
---
-local cdt_cache = { }
-
-function compile_datatype(code)
- local i
- local pos = 0
- local esc = false
- local depth = 0
- local stack = { }
-
- for i = 1, #code+1 do
- local byte = code:byte(i) or 44
- if esc then
- esc = false
- elseif byte == 92 then
- esc = true
- elseif byte == 40 or byte == 44 then
- if depth <= 0 then
- if pos < i then
- local label = code:sub(pos, i-1)
- :gsub("\\(.)", "%1")
- :gsub("^%s+", "")
- :gsub("%s+$", "")
-
- if #label > 0 and tonumber(label) then
- stack[#stack+1] = tonumber(label)
- elseif label:match("^'.*'$") or label:match('^".*"$') then
- stack[#stack+1] = label:gsub("[\"'](.*)[\"']", "%1")
- elseif type(datatypes[label]) == "function" then
- stack[#stack+1] = datatypes[label]
- stack[#stack+1] = { }
- else
- error("Datatype error, bad token %q" % label)
- end
- end
- pos = i + 1
- end
- depth = depth + (byte == 40 and 1 or 0)
- elseif byte == 41 then
- depth = depth - 1
- if depth <= 0 then
- if type(stack[#stack-1]) ~= "function" then
- error("Datatype error, argument list follows non-function")
- end
- stack[#stack] = compile_datatype(code:sub(pos, i-1))
- pos = i + 1
- end
- end
- end
-
- return stack
-end
-
-function verify_datatype(dt, value)
- if dt and #dt > 0 then
- if not cdt_cache[dt] then
- local c = compile_datatype(dt)
- if c and type(c[1]) == "function" then
- cdt_cache[dt] = c
- else
- error("Datatype error, not a function expression")
- end
- end
- if cdt_cache[dt] then
- return cdt_cache[dt][1](value, unpack(cdt_cache[dt][2]))
- end
- end
- return true
-end
-
-
--- Node pseudo abstract class
-Node = class()
-
-function Node.__init__(self, title, description)
- self.children = {}
- self.title = title or ""
- self.description = description or ""
- self.template = "cbi/node"
-end
-
--- hook helper
-function Node._run_hook(self, hook)
- if type(self[hook]) == "function" then
- return self[hook](self)
- end
-end
-
-function Node._run_hooks(self, ...)
- local f
- local r = false
- for _, f in ipairs(arg) do
- if type(self[f]) == "function" then
- self[f](self)
- r = true
- end
- end
- return r
-end
-
--- Prepare nodes
-function Node.prepare(self, ...)
- for k, child in ipairs(self.children) do
- child:prepare(...)
- end
-end
-
--- Append child nodes
-function Node.append(self, obj)
- table.insert(self.children, obj)
-end
-
--- Parse this node and its children
-function Node.parse(self, ...)
- for k, child in ipairs(self.children) do
- child:parse(...)
- end
-end
-
--- Render this node
-function Node.render(self, scope)
- scope = scope or {}
- scope.self = self
-
- luci.template.render(self.template, scope)
-end
-
--- Render the children
-function Node.render_children(self, ...)
- local k, node
- for k, node in ipairs(self.children) do
- node.last_child = (k == #self.children)
- node:render(...)
- end
-end
-
-
---[[
-A simple template element
-]]--
-Template = class(Node)
-
-function Template.__init__(self, template)
- Node.__init__(self)
- self.template = template
-end
-
-function Template.render(self)
- luci.template.render(self.template, {self=self})
-end
-
-function Template.parse(self, readinput)
- self.readinput = (readinput ~= false)
- return Map.formvalue(self, "cbi.submit") and FORM_DONE or FORM_NODATA
-end
-
-
---[[
-Map - A map describing a configuration file
-]]--
-Map = class(Node)
-
-function Map.__init__(self, config, ...)
- Node.__init__(self, ...)
-
- self.config = config
- self.parsechain = {self.config}
- self.template = "cbi/map"
- self.apply_on_parse = nil
- self.readinput = true
- self.proceed = false
- self.flow = {}
-
- self.uci = uci.cursor()
- self.save = true
-
- self.changed = false
-
- if not self.uci:load(self.config) then
- error("Unable to read UCI data: " .. self.config)
- end
-end
-
-function Map.formvalue(self, key)
- return self.readinput and luci.http.formvalue(key)
-end
-
-function Map.formvaluetable(self, key)
- return self.readinput and luci.http.formvaluetable(key) or {}
-end
-
-function Map.get_scheme(self, sectiontype, option)
- if not option then
- return self.scheme and self.scheme.sections[sectiontype]
- else
- return self.scheme and self.scheme.variables[sectiontype]
- and self.scheme.variables[sectiontype][option]
- end
-end
-
-function Map.submitstate(self)
- return self:formvalue("cbi.submit")
-end
-
--- Chain foreign config
-function Map.chain(self, config)
- table.insert(self.parsechain, config)
-end
-
-function Map.state_handler(self, state)
- return state
-end
-
--- Use optimized UCI writing
-function Map.parse(self, readinput, ...)
- self.readinput = (readinput ~= false)
- self:_run_hooks("on_parse")
-
- if self:formvalue("cbi.skip") then
- self.state = FORM_SKIP
- return self:state_handler(self.state)
- end
-
- Node.parse(self, ...)
-
- if self.save then
- self:_run_hooks("on_save", "on_before_save")
- for i, config in ipairs(self.parsechain) do
- self.uci:save(config)
- end
- self:_run_hooks("on_after_save")
- if self:submitstate() and ((not self.proceed and self.flow.autoapply) or luci.http.formvalue("cbi.apply")) then
- self:_run_hooks("on_before_commit")
- for i, config in ipairs(self.parsechain) do
- self.uci:commit(config)
-
- -- Refresh data because commit changes section names
- self.uci:load(config)
- end
- self:_run_hooks("on_commit", "on_after_commit", "on_before_apply")
- if self.apply_on_parse then
- self.uci:apply(self.parsechain)
- self:_run_hooks("on_apply", "on_after_apply")
- else
- -- This is evaluated by the dispatcher and delegated to the
- -- template which in turn fires XHR to perform the actual
- -- apply actions.
- self.apply_needed = true
- end
-
- -- Reparse sections
- Node.parse(self, true)
-
- end
- for i, config in ipairs(self.parsechain) do
- self.uci:unload(config)
- end
- if type(self.commit_handler) == "function" then
- self:commit_handler(self:submitstate())
- end
- end
-
- if self:submitstate() then
- if not self.save then
- self.state = FORM_INVALID
- elseif self.proceed then
- self.state = FORM_PROCEED
- else
- self.state = self.changed and FORM_CHANGED or FORM_VALID
- end
- else
- self.state = FORM_NODATA
- end
-
- return self:state_handler(self.state)
-end
-
-function Map.render(self, ...)
- self:_run_hooks("on_init")
- Node.render(self, ...)
-end
-
--- Creates a child section
-function Map.section(self, class, ...)
- if instanceof(class, AbstractSection) then
- local obj = class(self, ...)
- self:append(obj)
- return obj
- else
- error("class must be a descendent of AbstractSection")
- end
-end
-
--- UCI add
-function Map.add(self, sectiontype)
- return self.uci:add(self.config, sectiontype)
-end
-
--- UCI set
-function Map.set(self, section, option, value)
- if type(value) ~= "table" or #value > 0 then
- if option then
- return self.uci:set(self.config, section, option, value)
- else
- return self.uci:set(self.config, section, value)
- end
- else
- return Map.del(self, section, option)
- end
-end
-
--- UCI del
-function Map.del(self, section, option)
- if option then
- return self.uci:delete(self.config, section, option)
- else
- return self.uci:delete(self.config, section)
- end
-end
-
--- UCI get
-function Map.get(self, section, option)
- if not section then
- return self.uci:get_all(self.config)
- elseif option then
- return self.uci:get(self.config, section, option)
- else
- return self.uci:get_all(self.config, section)
- end
-end
-
---[[
-Compound - Container
-]]--
-Compound = class(Node)
-
-function Compound.__init__(self, ...)
- Node.__init__(self)
- self.template = "cbi/compound"
- self.children = {...}
-end
-
-function Compound.populate_delegator(self, delegator)
- for _, v in ipairs(self.children) do
- v.delegator = delegator
- end
-end
-
-function Compound.parse(self, ...)
- local cstate, state = 0
-
- for k, child in ipairs(self.children) do
- cstate = child:parse(...)
- state = (not state or cstate < state) and cstate or state
- end
-
- return state
-end
-
-
---[[
-Delegator - Node controller
-]]--
-Delegator = class(Node)
-function Delegator.__init__(self, ...)
- Node.__init__(self, ...)
- self.nodes = {}
- self.defaultpath = {}
- self.pageaction = false
- self.readinput = true
- self.allow_reset = false
- self.allow_cancel = false
- self.allow_back = false
- self.allow_finish = false
- self.template = "cbi/delegator"
-end
-
-function Delegator.set(self, name, node)
- assert(not self.nodes[name], "Duplicate entry")
-
- self.nodes[name] = node
-end
-
-function Delegator.add(self, name, node)
- node = self:set(name, node)
- self.defaultpath[#self.defaultpath+1] = name
-end
-
-function Delegator.insert_after(self, name, after)
- local n = #self.chain + 1
- for k, v in ipairs(self.chain) do
- if v == after then
- n = k + 1
- break
- end
- end
- table.insert(self.chain, n, name)
-end
-
-function Delegator.set_route(self, ...)
- local n, chain, route = 0, self.chain, {...}
- for i = 1, #chain do
- if chain[i] == self.current then
- n = i
- break
- end
- end
- for i = 1, #route do
- n = n + 1
- chain[n] = route[i]
- end
- for i = n + 1, #chain do
- chain[i] = nil
- end
-end
-
-function Delegator.get(self, name)
- local node = self.nodes[name]
-
- if type(node) == "string" then
- node = load(node, name)
- end
-
- if type(node) == "table" and getmetatable(node) == nil then
- node = Compound(unpack(node))
- end
-
- return node
-end
-
-function Delegator.parse(self, ...)
- if self.allow_cancel and Map.formvalue(self, "cbi.cancel") then
- if self:_run_hooks("on_cancel") then
- return FORM_DONE
- end
- end
-
- if not Map.formvalue(self, "cbi.delg.current") then
- self:_run_hooks("on_init")
- end
-
- local newcurrent
- self.chain = self.chain or self:get_chain()
- self.current = self.current or self:get_active()
- self.active = self.active or self:get(self.current)
- assert(self.active, "Invalid state")
-
- local stat = FORM_DONE
- if type(self.active) ~= "function" then
- self.active:populate_delegator(self)
- stat = self.active:parse()
- else
- self:active()
- end
-
- if stat > FORM_PROCEED then
- if Map.formvalue(self, "cbi.delg.back") then
- newcurrent = self:get_prev(self.current)
- else
- newcurrent = self:get_next(self.current)
- end
- elseif stat < FORM_PROCEED then
- return stat
- end
-
-
- if not Map.formvalue(self, "cbi.submit") then
- return FORM_NODATA
- elseif stat > FORM_PROCEED
- and (not newcurrent or not self:get(newcurrent)) then
- return self:_run_hook("on_done") or FORM_DONE
- else
- self.current = newcurrent or self.current
- self.active = self:get(self.current)
- if type(self.active) ~= "function" then
- self.active:populate_delegator(self)
- local stat = self.active:parse(false)
- if stat == FORM_SKIP then
- return self:parse(...)
- else
- return FORM_PROCEED
- end
- else
- return self:parse(...)
- end
- end
-end
-
-function Delegator.get_next(self, state)
- for k, v in ipairs(self.chain) do
- if v == state then
- return self.chain[k+1]
- end
- end
-end
-
-function Delegator.get_prev(self, state)
- for k, v in ipairs(self.chain) do
- if v == state then
- return self.chain[k-1]
- end
- end
-end
-
-function Delegator.get_chain(self)
- local x = Map.formvalue(self, "cbi.delg.path") or self.defaultpath
- return type(x) == "table" and x or {x}
-end
-
-function Delegator.get_active(self)
- return Map.formvalue(self, "cbi.delg.current") or self.chain[1]
-end
-
---[[
-Page - A simple node
-]]--
-
-Page = class(Node)
-Page.__init__ = Node.__init__
-Page.parse = function() end
-
-
---[[
-SimpleForm - A Simple non-UCI form
-]]--
-SimpleForm = class(Node)
-
-function SimpleForm.__init__(self, config, title, description, data)
- Node.__init__(self, title, description)
- self.config = config
- self.data = data or {}
- self.template = "cbi/simpleform"
- self.dorender = true
- self.pageaction = false
- self.readinput = true
-end
-
-SimpleForm.formvalue = Map.formvalue
-SimpleForm.formvaluetable = Map.formvaluetable
-
-function SimpleForm.parse(self, readinput, ...)
- self.readinput = (readinput ~= false)
-
- if self:formvalue("cbi.skip") then
- return FORM_SKIP
- end
-
- if self:formvalue("cbi.cancel") and self:_run_hooks("on_cancel") then
- return FORM_DONE
- end
-
- if self:submitstate() then
- Node.parse(self, 1, ...)
- end
-
- local valid = true
- for k, j in ipairs(self.children) do
- for i, v in ipairs(j.children) do
- valid = valid
- and (not v.tag_missing or not v.tag_missing[1])
- and (not v.tag_invalid or not v.tag_invalid[1])
- and (not v.error)
- end
- end
-
- local state =
- not self:submitstate() and FORM_NODATA
- or valid and FORM_VALID
- or FORM_INVALID
-
- self.dorender = not self.handle
- if self.handle then
- local nrender, nstate = self:handle(state, self.data)
- self.dorender = self.dorender or (nrender ~= false)
- state = nstate or state
- end
- return state
-end
-
-function SimpleForm.render(self, ...)
- if self.dorender then
- Node.render(self, ...)
- end
-end
-
-function SimpleForm.submitstate(self)
- return self:formvalue("cbi.submit")
-end
-
-function SimpleForm.section(self, class, ...)
- if instanceof(class, AbstractSection) then
- local obj = class(self, ...)
- self:append(obj)
- return obj
- else
- error("class must be a descendent of AbstractSection")
- end
-end
-
--- Creates a child field
-function SimpleForm.field(self, class, ...)
- local section
- for k, v in ipairs(self.children) do
- if instanceof(v, SimpleSection) then
- section = v
- break
- end
- end
- if not section then
- section = self:section(SimpleSection)
- end
-
- if instanceof(class, AbstractValue) then
- local obj = class(self, section, ...)
- obj.track_missing = true
- section:append(obj)
- return obj
- else
- error("class must be a descendent of AbstractValue")
- end
-end
-
-function SimpleForm.set(self, section, option, value)
- self.data[option] = value
-end
-
-
-function SimpleForm.del(self, section, option)
- self.data[option] = nil
-end
-
-
-function SimpleForm.get(self, section, option)
- return self.data[option]
-end
-
-
-function SimpleForm.get_scheme()
- return nil
-end
-
-
-Form = class(SimpleForm)
-
-function Form.__init__(self, ...)
- SimpleForm.__init__(self, ...)
- self.embedded = true
-end
-
-
---[[
-AbstractSection
-]]--
-AbstractSection = class(Node)
-
-function AbstractSection.__init__(self, map, sectiontype, ...)
- Node.__init__(self, ...)
- self.sectiontype = sectiontype
- self.map = map
- self.config = map.config
- self.optionals = {}
- self.defaults = {}
- self.fields = {}
- self.tag_error = {}
- self.tag_invalid = {}
- self.tag_deperror = {}
- self.changed = false
-
- self.optional = true
- self.addremove = false
- self.dynamic = false
-end
-
--- Define a tab for the section
-function AbstractSection.tab(self, tab, title, desc)
- self.tabs = self.tabs or { }
- self.tab_names = self.tab_names or { }
-
- self.tab_names[#self.tab_names+1] = tab
- self.tabs[tab] = {
- title = title,
- description = desc,
- childs = { }
- }
-end
-
--- Check whether the section has tabs
-function AbstractSection.has_tabs(self)
- return (self.tabs ~= nil) and (next(self.tabs) ~= nil)
-end
-
--- Appends a new option
-function AbstractSection.option(self, class, option, ...)
- if instanceof(class, AbstractValue) then
- local obj = class(self.map, self, option, ...)
- self:append(obj)
- self.fields[option] = obj
- return obj
- elseif class == true then
- error("No valid class was given and autodetection failed.")
- else
- error("class must be a descendant of AbstractValue")
- end
-end
-
--- Appends a new tabbed option
-function AbstractSection.taboption(self, tab, ...)
-
- assert(tab and self.tabs and self.tabs[tab],
- "Cannot assign option to not existing tab %q" % tostring(tab))
-
- local l = self.tabs[tab].childs
- local o = AbstractSection.option(self, ...)
-
- if o then l[#l+1] = o end
-
- return o
-end
-
--- Render a single tab
-function AbstractSection.render_tab(self, tab, ...)
-
- assert(tab and self.tabs and self.tabs[tab],
- "Cannot render not existing tab %q" % tostring(tab))
-
- local k, node
- for k, node in ipairs(self.tabs[tab].childs) do
- node.last_child = (k == #self.tabs[tab].childs)
- node:render(...)
- end
-end
-
--- Parse optional options
-function AbstractSection.parse_optionals(self, section)
- if not self.optional then
- return
- end
-
- self.optionals[section] = {}
-
- local field = self.map:formvalue("cbi.opt."..self.config.."."..section)
- for k,v in ipairs(self.children) do
- if v.optional and not v:cfgvalue(section) and not self:has_tabs() then
- if field == v.option then
- field = nil
- self.map.proceed = true
- else
- table.insert(self.optionals[section], v)
- end
- end
- end
-
- if field and #field > 0 and self.dynamic then
- self:add_dynamic(field)
- end
-end
-
--- Add a dynamic option
-function AbstractSection.add_dynamic(self, field, optional)
- local o = self:option(Value, field, field)
- o.optional = optional
-end
-
--- Parse all dynamic options
-function AbstractSection.parse_dynamic(self, section)
- if not self.dynamic then
- return
- end
-
- local arr = luci.util.clone(self:cfgvalue(section))
- local form = self.map:formvaluetable("cbid."..self.config.."."..section)
- for k, v in pairs(form) do
- arr[k] = v
- end
-
- for key,val in pairs(arr) do
- local create = true
-
- for i,c in ipairs(self.children) do
- if c.option == key then
- create = false
- end
- end
-
- if create and key:sub(1, 1) ~= "." then
- self.map.proceed = true
- self:add_dynamic(key, true)
- end
- end
-end
-
--- Returns the section's UCI table
-function AbstractSection.cfgvalue(self, section)
- return self.map:get(section)
-end
-
--- Push events
-function AbstractSection.push_events(self)
- --luci.util.append(self.map.events, self.events)
- self.map.changed = true
-end
-
--- Removes the section
-function AbstractSection.remove(self, section)
- self.map.proceed = true
- return self.map:del(section)
-end
-
--- Creates the section
-function AbstractSection.create(self, section)
- local stat
-
- if section then
- stat = section:match("^[%w_]+$") and self.map:set(section, nil, self.sectiontype)
- else
- section = self.map:add(self.sectiontype)
- stat = section
- end
-
- if stat then
- for k,v in pairs(self.children) do
- if v.default then
- self.map:set(section, v.option, v.default)
- end
- end
-
- for k,v in pairs(self.defaults) do
- self.map:set(section, k, v)
- end
- end
-
- self.map.proceed = true
-
- return stat
-end
-
-
-SimpleSection = class(AbstractSection)
-
-function SimpleSection.__init__(self, form, ...)
- AbstractSection.__init__(self, form, nil, ...)
- self.template = "cbi/nullsection"
-end
-
-
-Table = class(AbstractSection)
-
-function Table.__init__(self, form, data, ...)
- local datasource = {}
- local tself = self
- datasource.config = "table"
- self.data = data or {}
-
- datasource.formvalue = Map.formvalue
- datasource.formvaluetable = Map.formvaluetable
- datasource.readinput = true
-
- function datasource.get(self, section, option)
- return tself.data[section] and tself.data[section][option]
- end
-
- function datasource.submitstate(self)
- return Map.formvalue(self, "cbi.submit")
- end
-
- function datasource.del(...)
- return true
- end
-
- function datasource.get_scheme()
- return nil
- end
-
- AbstractSection.__init__(self, datasource, "table", ...)
- self.template = "cbi/tblsection"
- self.rowcolors = true
- self.anonymous = true
-end
-
-function Table.parse(self, readinput)
- self.map.readinput = (readinput ~= false)
- for i, k in ipairs(self:cfgsections()) do
- if self.map:submitstate() then
- Node.parse(self, k)
- end
- end
-end
-
-function Table.cfgsections(self)
- local sections = {}
-
- for i, v in luci.util.kspairs(self.data) do
- table.insert(sections, i)
- end
-
- return sections
-end
-
-function Table.update(self, data)
- self.data = data
-end
-
-
-
---[[
-NamedSection - A fixed configuration section defined by its name
-]]--
-NamedSection = class(AbstractSection)
-
-function NamedSection.__init__(self, map, section, stype, ...)
- AbstractSection.__init__(self, map, stype, ...)
-
- -- Defaults
- self.addremove = false
- self.template = "cbi/nsection"
- self.section = section
-end
-
-function NamedSection.parse(self, novld)
- local s = self.section
- local active = self:cfgvalue(s)
-
- if self.addremove then
- local path = self.config.."."..s
- if active then -- Remove the section
- if self.map:formvalue("cbi.rns."..path) and self:remove(s) then
- self:push_events()
- return
- end
- else -- Create and apply default values
- if self.map:formvalue("cbi.cns."..path) then
- self:create(s)
- return
- end
- end
- end
-
- if active then
- AbstractSection.parse_dynamic(self, s)
- if self.map:submitstate() then
- Node.parse(self, s)
- end
- AbstractSection.parse_optionals(self, s)
-
- if self.changed then
- self:push_events()
- end
- end
-end
-
-
---[[
-TypedSection - A (set of) configuration section(s) defined by the type
- addremove: Defines whether the user can add/remove sections of this type
- anonymous: Allow creating anonymous sections
- validate: a validation function returning nil if the section is invalid
-]]--
-TypedSection = class(AbstractSection)
-
-function TypedSection.__init__(self, map, type, ...)
- AbstractSection.__init__(self, map, type, ...)
-
- self.template = "cbi/tsection"
- self.deps = {}
- self.anonymous = false
-end
-
--- Return all matching UCI sections for this TypedSection
-function TypedSection.cfgsections(self)
- local sections = {}
- self.map.uci:foreach(self.map.config, self.sectiontype,
- function (section)
- if self:checkscope(section[".name"]) then
- table.insert(sections, section[".name"])
- end
- end)
-
- return sections
-end
-
--- Limits scope to sections that have certain option => value pairs
-function TypedSection.depends(self, option, value)
- table.insert(self.deps, {option=option, value=value})
-end
-
-function TypedSection.parse(self, novld)
- if self.addremove then
- -- Remove
- local crval = REMOVE_PREFIX .. self.config
- local name = self.map:formvaluetable(crval)
- for k,v in pairs(name) do
- if k:sub(-2) == ".x" then
- k = k:sub(1, #k - 2)
- end
- if self:cfgvalue(k) and self:checkscope(k) then
- self:remove(k)
- end
- end
- end
-
- local co
- for i, k in ipairs(self:cfgsections()) do
- AbstractSection.parse_dynamic(self, k)
- if self.map:submitstate() then
- Node.parse(self, k, novld)
- end
- AbstractSection.parse_optionals(self, k)
- end
-
- if self.addremove then
- -- Create
- local created
- local crval = CREATE_PREFIX .. self.config .. "." .. self.sectiontype
- local origin, name = next(self.map:formvaluetable(crval))
- if self.anonymous then
- if name then
- created = self:create(nil, origin)
- end
- else
- if name then
- -- Ignore if it already exists
- if self:cfgvalue(name) then
- name = nil;
- end
-
- name = self:checkscope(name)
-
- if not name then
- self.err_invalid = true
- end
-
- if name and #name > 0 then
- created = self:create(name, origin) and name
- if not created then
- self.invalid_cts = true
- end
- end
- end
- end
-
- if created then
- AbstractSection.parse_optionals(self, created)
- end
- end
-
- if self.sortable then
- local stval = RESORT_PREFIX .. self.config .. "." .. self.sectiontype
- local order = self.map:formvalue(stval)
- if order and #order > 0 then
- local sid
- local num = 0
- for sid in util.imatch(order) do
- self.map.uci:reorder(self.config, sid, num)
- num = num + 1
- end
- self.changed = (num > 0)
- end
- end
-
- if created or self.changed then
- self:push_events()
- end
-end
-
--- Verifies scope of sections
-function TypedSection.checkscope(self, section)
- -- Check if we are not excluded
- if self.filter and not self:filter(section) then
- return nil
- end
-
- -- Check if at least one dependency is met
- if #self.deps > 0 and self:cfgvalue(section) then
- local stat = false
-
- for k, v in ipairs(self.deps) do
- if self:cfgvalue(section)[v.option] == v.value then
- stat = true
- end
- end
-
- if not stat then
- return nil
- end
- end
-
- return self:validate(section)
-end
-
-
--- Dummy validate function
-function TypedSection.validate(self, section)
- return section
-end
-
-
---[[
-AbstractValue - An abstract Value Type
- null: Value can be empty
- valid: A function returning the value if it is valid otherwise nil
- depends: A table of option => value pairs of which one must be true
- default: The default value
- size: The size of the input fields
- rmempty: Unset value if empty
- optional: This value is optional (see AbstractSection.optionals)
-]]--
-AbstractValue = class(Node)
-
-function AbstractValue.__init__(self, map, section, option, ...)
- Node.__init__(self, ...)
- self.section = section
- self.option = option
- self.map = map
- self.config = map.config
- self.tag_invalid = {}
- self.tag_missing = {}
- self.tag_reqerror = {}
- self.tag_error = {}
- self.deps = {}
- self.subdeps = {}
- --self.cast = "string"
-
- self.track_missing = false
- self.rmempty = true
- self.default = nil
- self.size = nil
- self.optional = false
-end
-
-function AbstractValue.prepare(self)
- self.cast = self.cast or "string"
-end
-
--- Add a dependencie to another section field
-function AbstractValue.depends(self, field, value)
- local deps
- if type(field) == "string" then
- deps = {}
- deps[field] = value
- else
- deps = field
- end
-
- table.insert(self.deps, {deps=deps, add=""})
-end
-
--- Generates the unique CBID
-function AbstractValue.cbid(self, section)
- return "cbid."..self.map.config.."."..section.."."..self.option
-end
-
--- Return whether this object should be created
-function AbstractValue.formcreated(self, section)
- local key = "cbi.opt."..self.config.."."..section
- return (self.map:formvalue(key) == self.option)
-end
-
--- Returns the formvalue for this object
-function AbstractValue.formvalue(self, section)
- return self.map:formvalue(self:cbid(section))
-end
-
-function AbstractValue.additional(self, value)
- self.optional = value
-end
-
-function AbstractValue.mandatory(self, value)
- self.rmempty = not value
-end
-
-function AbstractValue.add_error(self, section, type, msg)
- self.error = self.error or { }
- self.error[section] = msg or type
-
- self.section.error = self.section.error or { }
- self.section.error[section] = self.section.error[section] or { }
- table.insert(self.section.error[section], msg or type)
-
- if type == "invalid" then
- self.tag_invalid[section] = true
- elseif type == "missing" then
- self.tag_missing[section] = true
- end
-
- self.tag_error[section] = true
- self.map.save = false
-end
-
-function AbstractValue.parse(self, section, novld)
- local fvalue = self:formvalue(section)
- local cvalue = self:cfgvalue(section)
-
- -- If favlue and cvalue are both tables and have the same content
- -- make them identical
- if type(fvalue) == "table" and type(cvalue) == "table" then
- local equal = #fvalue == #cvalue
- if equal then
- for i=1, #fvalue do
- if cvalue[i] ~= fvalue[i] then
- equal = false
- end
- end
- end
- if equal then
- fvalue = cvalue
- end
- end
-
- if fvalue and #fvalue > 0 then -- If we have a form value, write it to UCI
- local val_err
- fvalue, val_err = self:validate(fvalue, section)
- fvalue = self:transform(fvalue)
-
- if not fvalue and not novld then
- self:add_error(section, "invalid", val_err)
- end
-
- if fvalue and (self.forcewrite or not (fvalue == cvalue)) then
- if self:write(section, fvalue) then
- -- Push events
- self.section.changed = true
- --luci.util.append(self.map.events, self.events)
- end
- end
- else -- Unset the UCI or error
- if self.rmempty or self.optional then
- if self:remove(section) then
- -- Push events
- self.section.changed = true
- --luci.util.append(self.map.events, self.events)
- end
- elseif cvalue ~= fvalue and not novld then
- -- trigger validator with nil value to get custom user error msg.
- local _, val_err = self:validate(nil, section)
- self:add_error(section, "missing", val_err)
- end
- end
-end
-
--- Render if this value exists or if it is mandatory
-function AbstractValue.render(self, s, scope)
- if not self.optional or self.section:has_tabs() or self:cfgvalue(s) or self:formcreated(s) then
- scope = scope or {}
- scope.section = s
- scope.cbid = self:cbid(s)
- Node.render(self, scope)
- end
-end
-
--- Return the UCI value of this object
-function AbstractValue.cfgvalue(self, section)
- local value
- if self.tag_error[section] then
- value = self:formvalue(section)
- else
- value = self.map:get(section, self.option)
- end
-
- if not value then
- return nil
- elseif not self.cast or self.cast == type(value) then
- return value
- elseif self.cast == "string" then
- if type(value) == "table" then
- return value[1]
- end
- elseif self.cast == "table" then
- return { value }
- end
-end
-
--- Validate the form value
-function AbstractValue.validate(self, value)
- if self.datatype and value then
- if type(value) == "table" then
- local v
- for _, v in ipairs(value) do
- if v and #v > 0 and not verify_datatype(self.datatype, v) then
- return nil
- end
- end
- else
- if not verify_datatype(self.datatype, value) then
- return nil
- end
- end
- end
-
- return value
-end
-
-AbstractValue.transform = AbstractValue.validate
-
-
--- Write to UCI
-function AbstractValue.write(self, section, value)
- return self.map:set(section, self.option, value)
-end
-
--- Remove from UCI
-function AbstractValue.remove(self, section)
- return self.map:del(section, self.option)
-end
-
-
-
-
---[[
-Value - A one-line value
- maxlength: The maximum length
-]]--
-Value = class(AbstractValue)
-
-function Value.__init__(self, ...)
- AbstractValue.__init__(self, ...)
- self.template = "cbi/value"
- self.keylist = {}
- self.vallist = {}
-end
-
-function Value.reset_values(self)
- self.keylist = {}
- self.vallist = {}
-end
-
-function Value.value(self, key, val)
- val = val or key
- table.insert(self.keylist, tostring(key))
- table.insert(self.vallist, tostring(val))
-end
-
-
--- DummyValue - This does nothing except being there
-DummyValue = class(AbstractValue)
-
-function DummyValue.__init__(self, ...)
- AbstractValue.__init__(self, ...)
- self.template = "cbi/dvalue"
- self.value = nil
-end
-
-function DummyValue.cfgvalue(self, section)
- local value
- if self.value then
- if type(self.value) == "function" then
- value = self:value(section)
- else
- value = self.value
- end
- else
- value = AbstractValue.cfgvalue(self, section)
- end
- return value
-end
-
-function DummyValue.parse(self)
-
-end
-
-
---[[
-Flag - A flag being enabled or disabled
-]]--
-Flag = class(AbstractValue)
-
-function Flag.__init__(self, ...)
- AbstractValue.__init__(self, ...)
- self.template = "cbi/fvalue"
-
- self.enabled = "1"
- self.disabled = "0"
- self.default = self.disabled
-end
-
--- A flag can only have two states: set or unset
-function Flag.parse(self, section)
- local fexists = self.map:formvalue(
- FEXIST_PREFIX .. self.config .. "." .. section .. "." .. self.option)
-
- if fexists then
- local fvalue = self:formvalue(section) and self.enabled or self.disabled
- if fvalue ~= self.default or (not self.optional and not self.rmempty) then
- self:write(section, fvalue)
- else
- self:remove(section)
- end
- else
- self:remove(section)
- end
-end
-
-function Flag.cfgvalue(self, section)
- return AbstractValue.cfgvalue(self, section) or self.default
-end
-
-
---[[
-ListValue - A one-line value predefined in a list
- widget: The widget that will be used (select, radio)
-]]--
-ListValue = class(AbstractValue)
-
-function ListValue.__init__(self, ...)
- AbstractValue.__init__(self, ...)
- self.template = "cbi/lvalue"
-
- self.keylist = {}
- self.vallist = {}
- self.size = 1
- self.widget = "select"
-end
-
-function ListValue.reset_values(self)
- self.keylist = {}
- self.vallist = {}
-end
-
-function ListValue.value(self, key, val, ...)
- if luci.util.contains(self.keylist, key) then
- return
- end
-
- val = val or key
- table.insert(self.keylist, tostring(key))
- table.insert(self.vallist, tostring(val))
-
- for i, deps in ipairs({...}) do
- self.subdeps[#self.subdeps + 1] = {add = "-"..key, deps=deps}
- end
-end
-
-function ListValue.validate(self, val)
- if luci.util.contains(self.keylist, val) then
- return val
- else
- return nil
- end
-end
-
-
-
---[[
-MultiValue - Multiple delimited values
- widget: The widget that will be used (select, checkbox)
- delimiter: The delimiter that will separate the values (default: " ")
-]]--
-MultiValue = class(AbstractValue)
-
-function MultiValue.__init__(self, ...)
- AbstractValue.__init__(self, ...)
- self.template = "cbi/mvalue"
-
- self.keylist = {}
- self.vallist = {}
-
- self.widget = "checkbox"
- self.delimiter = " "
-end
-
-function MultiValue.render(self, ...)
- if self.widget == "select" and not self.size then
- self.size = #self.vallist
- end
-
- AbstractValue.render(self, ...)
-end
-
-function MultiValue.reset_values(self)
- self.keylist = {}
- self.vallist = {}
-end
-
-function MultiValue.value(self, key, val)
- if luci.util.contains(self.keylist, key) then
- return
- end
-
- val = val or key
- table.insert(self.keylist, tostring(key))
- table.insert(self.vallist, tostring(val))
-end
-
-function MultiValue.valuelist(self, section)
- local val = self:cfgvalue(section)
-
- if not(type(val) == "string") then
- return {}
- end
-
- return luci.util.split(val, self.delimiter)
-end
-
-function MultiValue.validate(self, val)
- val = (type(val) == "table") and val or {val}
-
- local result
-
- for i, value in ipairs(val) do
- if luci.util.contains(self.keylist, value) then
- result = result and (result .. self.delimiter .. value) or value
- end
- end
-
- return result
-end
-
-
-StaticList = class(MultiValue)
-
-function StaticList.__init__(self, ...)
- MultiValue.__init__(self, ...)
- self.cast = "table"
- self.valuelist = self.cfgvalue
-
- if not self.override_scheme
- and self.map:get_scheme(self.section.sectiontype, self.option) then
- local vs = self.map:get_scheme(self.section.sectiontype, self.option)
- if self.value and vs.values and not self.override_values then
- for k, v in pairs(vs.values) do
- self:value(k, v)
- end
- end
- end
-end
-
-function StaticList.validate(self, value)
- value = (type(value) == "table") and value or {value}
-
- local valid = {}
- for i, v in ipairs(value) do
- if luci.util.contains(self.keylist, v) then
- table.insert(valid, v)
- end
- end
- return valid
-end
-
-
-DynamicList = class(AbstractValue)
-
-function DynamicList.__init__(self, ...)
- AbstractValue.__init__(self, ...)
- self.template = "cbi/dynlist"
- self.cast = "table"
- self.keylist = {}
- self.vallist = {}
-end
-
-function DynamicList.reset_values(self)
- self.keylist = {}
- self.vallist = {}
-end
-
-function DynamicList.value(self, key, val)
- val = val or key
- table.insert(self.keylist, tostring(key))
- table.insert(self.vallist, tostring(val))
-end
-
-function DynamicList.write(self, section, value)
- local t = { }
-
- if type(value) == "table" then
- local x
- for _, x in ipairs(value) do
- if x and #x > 0 then
- t[#t+1] = x
- end
- end
- else
- t = { value }
- end
-
- if self.cast == "string" then
- value = table.concat(t, " ")
- else
- value = t
- end
-
- return AbstractValue.write(self, section, value)
-end
-
-function DynamicList.cfgvalue(self, section)
- local value = AbstractValue.cfgvalue(self, section)
-
- if type(value) == "string" then
- local x
- local t = { }
- for x in value:gmatch("%S+") do
- if #x > 0 then
- t[#t+1] = x
- end
- end
- value = t
- end
-
- return value
-end
-
-function DynamicList.formvalue(self, section)
- local value = AbstractValue.formvalue(self, section)
-
- if type(value) == "string" then
- if self.cast == "string" then
- local x
- local t = { }
- for x in value:gmatch("%S+") do
- t[#t+1] = x
- end
- value = t
- else
- value = { value }
- end
- end
-
- return value
-end
-
-
---[[
-TextValue - A multi-line value
- rows: Rows
-]]--
-TextValue = class(AbstractValue)
-
-function TextValue.__init__(self, ...)
- AbstractValue.__init__(self, ...)
- self.template = "cbi/tvalue"
-end
-
---[[
-Button
-]]--
-Button = class(AbstractValue)
-
-function Button.__init__(self, ...)
- AbstractValue.__init__(self, ...)
- self.template = "cbi/button"
- self.inputstyle = nil
- self.rmempty = true
-end
-
-
-FileUpload = class(AbstractValue)
-
-function FileUpload.__init__(self, ...)
- AbstractValue.__init__(self, ...)
- self.template = "cbi/upload"
- if not self.map.upload_fields then
- self.map.upload_fields = { self }
- else
- self.map.upload_fields[#self.map.upload_fields+1] = self
- end
-end
-
-function FileUpload.formcreated(self, section)
- return AbstractValue.formcreated(self, section) or
- self.map:formvalue("cbi.rlf."..section.."."..self.option) or
- self.map:formvalue("cbi.rlf."..section.."."..self.option..".x")
-end
-
-function FileUpload.cfgvalue(self, section)
- local val = AbstractValue.cfgvalue(self, section)
- if val and fs.access(val) then
- return val
- end
- return nil
-end
-
-function FileUpload.formvalue(self, section)
- local val = AbstractValue.formvalue(self, section)
- if val then
- if not self.map:formvalue("cbi.rlf."..section.."."..self.option) and
- not self.map:formvalue("cbi.rlf."..section.."."..self.option..".x")
- then
- return val
- end
- fs.unlink(val)
- self.value = nil
- end
- return nil
-end
-
-function FileUpload.remove(self, section)
- local val = AbstractValue.formvalue(self, section)
- if val and fs.access(val) then fs.unlink(val) end
- return AbstractValue.remove(self, section)
-end
-
-
-FileBrowser = class(AbstractValue)
-
-function FileBrowser.__init__(self, ...)
- AbstractValue.__init__(self, ...)
- self.template = "cbi/browser"
-end
+++ /dev/null
---[[
-
-LuCI - Configuration Bind Interface - Datatype Tests
-(c) 2010 Jo-Philipp Wich <xm@subsignal.org>
-
-Licensed under the Apache License, Version 2.0 (the "License");
-you may not use this file except in compliance with the License.
-You may obtain a copy of the License at
-
- http://www.apache.org/licenses/LICENSE-2.0
-
-$Id$
-
-]]--
-
-local fs = require "nixio.fs"
-local ip = require "luci.ip"
-local math = require "math"
-local util = require "luci.util"
-local tonumber, tostring, type, unpack, select = tonumber, tostring, type, unpack, select
-
-
-module "luci.cbi.datatypes"
-
-
-_M['or'] = function(v, ...)
- local i
- for i = 1, select('#', ...), 2 do
- local f = select(i, ...)
- local a = select(i+1, ...)
- if type(f) ~= "function" then
- if f == v then
- return true
- end
- i = i - 1
- elseif f(v, unpack(a)) then
- return true
- end
- end
- return false
-end
-
-_M['and'] = function(v, ...)
- local i
- for i = 1, select('#', ...), 2 do
- local f = select(i, ...)
- local a = select(i+1, ...)
- if type(f) ~= "function" then
- if f ~= v then
- return false
- end
- i = i - 1
- elseif not f(v, unpack(a)) then
- return false
- end
- end
- return true
-end
-
-function neg(v, ...)
- return _M['or'](v:gsub("^%s*!%s*", ""), ...)
-end
-
-function list(v, subvalidator, subargs)
- if type(subvalidator) ~= "function" then
- return false
- end
- local token
- for token in v:gmatch("%S+") do
- if not subvalidator(token, unpack(subargs)) then
- return false
- end
- end
- return true
-end
-
-function bool(val)
- if val == "1" or val == "yes" or val == "on" or val == "true" then
- return true
- elseif val == "0" or val == "no" or val == "off" or val == "false" then
- return true
- elseif val == "" or val == nil then
- return true
- end
-
- return false
-end
-
-function uinteger(val)
- local n = tonumber(val)
- if n ~= nil and math.floor(n) == n and n >= 0 then
- return true
- end
-
- return false
-end
-
-function integer(val)
- local n = tonumber(val)
- if n ~= nil and math.floor(n) == n then
- return true
- end
-
- return false
-end
-
-function ufloat(val)
- local n = tonumber(val)
- return ( n ~= nil and n >= 0 )
-end
-
-function float(val)
- return ( tonumber(val) ~= nil )
-end
-
-function ipaddr(val)
- return ip4addr(val) or ip6addr(val)
-end
-
-function ip4addr(val)
- if val then
- return ip.IPv4(val) and true or false
- end
-
- return false
-end
-
-function ip4prefix(val)
- val = tonumber(val)
- return ( val and val >= 0 and val <= 32 )
-end
-
-function ip6addr(val)
- if val then
- return ip.IPv6(val) and true or false
- end
-
- return false
-end
-
-function ip6prefix(val)
- val = tonumber(val)
- return ( val and val >= 0 and val <= 128 )
-end
-
-function port(val)
- val = tonumber(val)
- return ( val and val >= 0 and val <= 65535 )
-end
-
-function portrange(val)
- local p1, p2 = val:match("^(%d+)%-(%d+)$")
- if p1 and p2 and port(p1) and port(p2) then
- return true
- else
- return port(val)
- end
-end
-
-function macaddr(val)
- if val and val:match(
- "^[a-fA-F0-9]+:[a-fA-F0-9]+:[a-fA-F0-9]+:" ..
- "[a-fA-F0-9]+:[a-fA-F0-9]+:[a-fA-F0-9]+$"
- ) then
- local parts = util.split( val, ":" )
-
- for i = 1,6 do
- parts[i] = tonumber( parts[i], 16 )
- if parts[i] < 0 or parts[i] > 255 then
- return false
- end
- end
-
- return true
- end
-
- return false
-end
-
-function hostname(val)
- if val and (#val < 254) and (
- val:match("^[a-zA-Z_]+$") or
- (val:match("^[a-zA-Z0-9_][a-zA-Z0-9_%-%.]*[a-zA-Z0-9]$") and
- val:match("[^0-9%.]"))
- ) then
- return true
- end
- return false
-end
-
-function host(val)
- return hostname(val) or ipaddr(val)
-end
-
-function network(val)
- return uciname(val) or host(val)
-end
-
-function wpakey(val)
- if #val == 64 then
- return (val:match("^[a-fA-F0-9]+$") ~= nil)
- else
- return (#val >= 8) and (#val <= 63)
- end
-end
-
-function wepkey(val)
- if val:sub(1, 2) == "s:" then
- val = val:sub(3)
- end
-
- if (#val == 10) or (#val == 26) then
- return (val:match("^[a-fA-F0-9]+$") ~= nil)
- else
- return (#val == 5) or (#val == 13)
- end
-end
-
-function string(val)
- return true -- Everything qualifies as valid string
-end
-
-function directory( val, seen )
- local s = fs.stat(val)
- seen = seen or { }
-
- if s and not seen[s.ino] then
- seen[s.ino] = true
- if s.type == "dir" then
- return true
- elseif s.type == "lnk" then
- return directory( fs.readlink(val), seen )
- end
- end
-
- return false
-end
-
-function file( val, seen )
- local s = fs.stat(val)
- seen = seen or { }
-
- if s and not seen[s.ino] then
- seen[s.ino] = true
- if s.type == "reg" then
- return true
- elseif s.type == "lnk" then
- return file( fs.readlink(val), seen )
- end
- end
-
- return false
-end
-
-function device( val, seen )
- local s = fs.stat(val)
- seen = seen or { }
-
- if s and not seen[s.ino] then
- seen[s.ino] = true
- if s.type == "chr" or s.type == "blk" then
- return true
- elseif s.type == "lnk" then
- return device( fs.readlink(val), seen )
- end
- end
-
- return false
-end
-
-function uciname(val)
- return (val:match("^[a-zA-Z0-9_]+$") ~= nil)
-end
-
-function range(val, min, max)
- val = tonumber(val)
- min = tonumber(min)
- max = tonumber(max)
-
- if val ~= nil and min ~= nil and max ~= nil then
- return ((val >= min) and (val <= max))
- end
-
- return false
-end
-
-function min(val, min)
- val = tonumber(val)
- min = tonumber(min)
-
- if val ~= nil and min ~= nil then
- return (val >= min)
- end
-
- return false
-end
-
-function max(val, max)
- val = tonumber(val)
- max = tonumber(max)
-
- if val ~= nil and max ~= nil then
- return (val <= max)
- end
-
- return false
-end
-
-function rangelength(val, min, max)
- val = tostring(val)
- min = tonumber(min)
- max = tonumber(max)
-
- if val ~= nil and min ~= nil and max ~= nil then
- return ((#val >= min) and (#val <= max))
- end
-
- return false
-end
-
-function minlength(val, min)
- val = tostring(val)
- min = tonumber(min)
-
- if val ~= nil and min ~= nil then
- return (#val >= min)
- end
-
- return false
-end
-
-function maxlength(val, max)
- val = tostring(val)
- max = tonumber(max)
-
- if val ~= nil and max ~= nil then
- return (#val <= max)
- end
-
- return false
-end
-
-function phonedigit(val)
- return (val:match("^[0-9\*#!%.]+$") ~= nil)
-end
+++ /dev/null
---[[
-LuCI - Configuration
-
-Description:
-Some LuCI configuration values read from uci file "luci"
-
-
-FileId:
-$Id$
-
-License:
-Copyright 2008 Steven Barth <steven@midlink.org>
-
-Licensed under the Apache License, Version 2.0 (the "License");
-you may not use this file except in compliance with the License.
-You may obtain a copy of the License at
-
- http://www.apache.org/licenses/LICENSE-2.0
-
-Unless required by applicable law or agreed to in writing, software
-distributed under the License is distributed on an "AS IS" BASIS,
-WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
-See the License for the specific language governing permissions and
-limitations under the License.
-
-]]--
-
-local util = require "luci.util"
-module("luci.config",
- function(m)
- if pcall(require, "luci.model.uci") then
- local config = util.threadlocal()
- setmetatable(m, {
- __index = function(tbl, key)
- if not config[key] then
- config[key] = luci.model.uci.cursor():get_all("luci", key)
- end
- return config[key]
- end
- })
- end
- end)
+++ /dev/null
---[[
-LuCI - Dispatcher
-
-Description:
-The request dispatcher and module dispatcher generators
-
-FileId:
-$Id$
-
-License:
-Copyright 2008 Steven Barth <steven@midlink.org>
-
-Licensed under the Apache License, Version 2.0 (the "License");
-you may not use this file except in compliance with the License.
-You may obtain a copy of the License at
-
- http://www.apache.org/licenses/LICENSE-2.0
-
-Unless required by applicable law or agreed to in writing, software
-distributed under the License is distributed on an "AS IS" BASIS,
-WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
-See the License for the specific language governing permissions and
-limitations under the License.
-
-]]--
-
---- LuCI web dispatcher.
-local fs = require "nixio.fs"
-local sys = require "luci.sys"
-local init = require "luci.init"
-local util = require "luci.util"
-local http = require "luci.http"
-local nixio = require "nixio", require "nixio.util"
-
-module("luci.dispatcher", package.seeall)
-context = util.threadlocal()
-uci = require "luci.model.uci"
-i18n = require "luci.i18n"
-_M.fs = fs
-
-authenticator = {}
-
--- Index table
-local index = nil
-
--- Fastindex
-local fi
-
-
---- Build the URL relative to the server webroot from given virtual path.
--- @param ... Virtual path
--- @return Relative URL
-function build_url(...)
- local path = {...}
- local url = { http.getenv("SCRIPT_NAME") or "" }
-
- local k, v
- for k, v in pairs(context.urltoken) do
- url[#url+1] = "/;"
- url[#url+1] = http.urlencode(k)
- url[#url+1] = "="
- url[#url+1] = http.urlencode(v)
- end
-
- local p
- for _, p in ipairs(path) do
- if p:match("^[a-zA-Z0-9_%-%.%%/,;]+$") then
- url[#url+1] = "/"
- url[#url+1] = p
- end
- end
-
- return table.concat(url, "")
-end
-
---- Check whether a dispatch node shall be visible
--- @param node Dispatch node
--- @return Boolean indicating whether the node should be visible
-function node_visible(node)
- if node then
- return not (
- (not node.title or #node.title == 0) or
- (not node.target or node.hidden == true) or
- (type(node.target) == "table" and node.target.type == "firstchild" and
- (type(node.nodes) ~= "table" or not next(node.nodes)))
- )
- end
- return false
-end
-
---- Return a sorted table of visible childs within a given node
--- @param node Dispatch node
--- @return Ordered table of child node names
-function node_childs(node)
- local rv = { }
- if node then
- local k, v
- for k, v in util.spairs(node.nodes,
- function(a, b)
- return (node.nodes[a].order or 100)
- < (node.nodes[b].order or 100)
- end)
- do
- if node_visible(v) then
- rv[#rv+1] = k
- end
- end
- end
- return rv
-end
-
-
---- Send a 404 error code and render the "error404" template if available.
--- @param message Custom error message (optional)
--- @return false
-function error404(message)
- luci.http.status(404, "Not Found")
- message = message or "Not Found"
-
- require("luci.template")
- if not luci.util.copcall(luci.template.render, "error404") then
- luci.http.prepare_content("text/plain")
- luci.http.write(message)
- end
- return false
-end
-
---- Send a 500 error code and render the "error500" template if available.
--- @param message Custom error message (optional)#
--- @return false
-function error500(message)
- luci.util.perror(message)
- if not context.template_header_sent then
- luci.http.status(500, "Internal Server Error")
- luci.http.prepare_content("text/plain")
- luci.http.write(message)
- else
- require("luci.template")
- if not luci.util.copcall(luci.template.render, "error500", {message=message}) then
- luci.http.prepare_content("text/plain")
- luci.http.write(message)
- end
- end
- return false
-end
-
-function authenticator.htmlauth(validator, accs, default)
- local user = luci.http.formvalue("username")
- local pass = luci.http.formvalue("password")
-
- if user and validator(user, pass) then
- return user
- end
-
- require("luci.i18n")
- require("luci.template")
- context.path = {}
- luci.template.render("sysauth", {duser=default, fuser=user})
- return false
-
-end
-
---- Dispatch an HTTP request.
--- @param request LuCI HTTP Request object
-function httpdispatch(request, prefix)
- luci.http.context.request = request
-
- local r = {}
- context.request = r
- context.urltoken = {}
-
- local pathinfo = http.urldecode(request:getenv("PATH_INFO") or "", true)
-
- if prefix then
- for _, node in ipairs(prefix) do
- r[#r+1] = node
- end
- end
-
- local tokensok = true
- for node in pathinfo:gmatch("[^/]+") do
- local tkey, tval
- if tokensok then
- tkey, tval = node:match(";(%w+)=([a-fA-F0-9]*)")
- end
- if tkey then
- context.urltoken[tkey] = tval
- else
- tokensok = false
- r[#r+1] = node
- end
- end
-
- local stat, err = util.coxpcall(function()
- dispatch(context.request)
- end, error500)
-
- luci.http.close()
-
- --context._disable_memtrace()
-end
-
---- Dispatches a LuCI virtual path.
--- @param request Virtual path
-function dispatch(request)
- --context._disable_memtrace = require "luci.debug".trap_memtrace("l")
- local ctx = context
- ctx.path = request
-
- local conf = require "luci.config"
- assert(conf.main,
- "/etc/config/luci seems to be corrupt, unable to find section 'main'")
-
- local lang = conf.main.lang or "auto"
- if lang == "auto" then
- local aclang = http.getenv("HTTP_ACCEPT_LANGUAGE") or ""
- for lpat in aclang:gmatch("[%w-]+") do
- lpat = lpat and lpat:gsub("-", "_")
- if conf.languages[lpat] then
- lang = lpat
- break
- end
- end
- end
- require "luci.i18n".setlanguage(lang)
-
- local c = ctx.tree
- local stat
- if not c then
- c = createtree()
- end
-
- local track = {}
- local args = {}
- ctx.args = args
- ctx.requestargs = ctx.requestargs or args
- local n
- local token = ctx.urltoken
- local preq = {}
- local freq = {}
-
- for i, s in ipairs(request) do
- preq[#preq+1] = s
- freq[#freq+1] = s
- c = c.nodes[s]
- n = i
- if not c then
- break
- end
-
- util.update(track, c)
-
- if c.leaf then
- break
- end
- end
-
- if c and c.leaf then
- for j=n+1, #request do
- args[#args+1] = request[j]
- freq[#freq+1] = request[j]
- end
- end
-
- ctx.requestpath = ctx.requestpath or freq
- ctx.path = preq
-
- if track.i18n then
- i18n.loadc(track.i18n)
- end
-
- -- Init template engine
- if (c and c.index) or not track.notemplate then
- local tpl = require("luci.template")
- local media = track.mediaurlbase or luci.config.main.mediaurlbase
- if not pcall(tpl.Template, "themes/%s/header" % fs.basename(media)) then
- media = nil
- for name, theme in pairs(luci.config.themes) do
- if name:sub(1,1) ~= "." and pcall(tpl.Template,
- "themes/%s/header" % fs.basename(theme)) then
- media = theme
- end
- end
- assert(media, "No valid theme found")
- end
-
- local function _ifattr(cond, key, val)
- if cond then
- local env = getfenv(3)
- local scope = (type(env.self) == "table") and env.self
- return string.format(
- ' %s="%s"', tostring(key),
- luci.util.pcdata(tostring( val
- or (type(env[key]) ~= "function" and env[key])
- or (scope and type(scope[key]) ~= "function" and scope[key])
- or "" ))
- )
- else
- return ''
- end
- end
-
- tpl.context.viewns = setmetatable({
- write = luci.http.write;
- include = function(name) tpl.Template(name):render(getfenv(2)) end;
- translate = i18n.translate;
- translatef = i18n.translatef;
- export = function(k, v) if tpl.context.viewns[k] == nil then tpl.context.viewns[k] = v end end;
- striptags = util.striptags;
- pcdata = util.pcdata;
- media = media;
- theme = fs.basename(media);
- resource = luci.config.main.resourcebase;
- ifattr = function(...) return _ifattr(...) end;
- attr = function(...) return _ifattr(true, ...) end;
- }, {__index=function(table, key)
- if key == "controller" then
- return build_url()
- elseif key == "REQUEST_URI" then
- return build_url(unpack(ctx.requestpath))
- else
- return rawget(table, key) or _G[key]
- end
- end})
- end
-
- track.dependent = (track.dependent ~= false)
- assert(not track.dependent or not track.auto,
- "Access Violation\nThe page at '" .. table.concat(request, "/") .. "/' " ..
- "has no parent node so the access to this location has been denied.\n" ..
- "This is a software bug, please report this message at " ..
- "http://luci.subsignal.org/trac/newticket"
- )
-
- if track.sysauth then
- local sauth = require "luci.sauth"
-
- local authen = type(track.sysauth_authenticator) == "function"
- and track.sysauth_authenticator
- or authenticator[track.sysauth_authenticator]
-
- local def = (type(track.sysauth) == "string") and track.sysauth
- local accs = def and {track.sysauth} or track.sysauth
- local sess = ctx.authsession
- local verifytoken = false
- if not sess then
- sess = luci.http.getcookie("sysauth")
- sess = sess and sess:match("^[a-f0-9]*$")
- verifytoken = true
- end
-
- local sdat = sauth.read(sess)
- local user
-
- if sdat then
- if not verifytoken or ctx.urltoken.stok == sdat.token then
- user = sdat.user
- end
- else
- local eu = http.getenv("HTTP_AUTH_USER")
- local ep = http.getenv("HTTP_AUTH_PASS")
- if eu and ep and luci.sys.user.checkpasswd(eu, ep) then
- authen = function() return eu end
- end
- end
-
- if not util.contains(accs, user) then
- if authen then
- ctx.urltoken.stok = nil
- local user, sess = authen(luci.sys.user.checkpasswd, accs, def)
- if not user or not util.contains(accs, user) then
- return
- else
- local sid = sess or luci.sys.uniqueid(16)
- if not sess then
- local token = luci.sys.uniqueid(16)
- sauth.reap()
- sauth.write(sid, {
- user=user,
- token=token,
- secret=luci.sys.uniqueid(16)
- })
- ctx.urltoken.stok = token
- end
- luci.http.header("Set-Cookie", "sysauth=" .. sid.."; path="..build_url())
- ctx.authsession = sid
- ctx.authuser = user
- end
- else
- luci.http.status(403, "Forbidden")
- return
- end
- else
- ctx.authsession = sess
- ctx.authuser = user
- end
- end
-
- if track.setgroup then
- luci.sys.process.setgroup(track.setgroup)
- end
-
- if track.setuser then
- luci.sys.process.setuser(track.setuser)
- end
-
- local target = nil
- if c then
- if type(c.target) == "function" then
- target = c.target
- elseif type(c.target) == "table" then
- target = c.target.target
- end
- end
-
- if c and (c.index or type(target) == "function") then
- ctx.dispatched = c
- ctx.requested = ctx.requested or ctx.dispatched
- end
-
- if c and c.index then
- local tpl = require "luci.template"
-
- if util.copcall(tpl.render, "indexer", {}) then
- return true
- end
- end
-
- if type(target) == "function" then
- util.copcall(function()
- local oldenv = getfenv(target)
- local module = require(c.module)
- local env = setmetatable({}, {__index=
-
- function(tbl, key)
- return rawget(tbl, key) or module[key] or oldenv[key]
- end})
-
- setfenv(target, env)
- end)
-
- local ok, err
- if type(c.target) == "table" then
- ok, err = util.copcall(target, c.target, unpack(args))
- else
- ok, err = util.copcall(target, unpack(args))
- end
- assert(ok,
- "Failed to execute " .. (type(c.target) == "function" and "function" or c.target.type or "unknown") ..
- " dispatcher target for entry '/" .. table.concat(request, "/") .. "'.\n" ..
- "The called action terminated with an exception:\n" .. tostring(err or "(unknown)"))
- else
- local root = node()
- if not root or not root.target then
- error404("No root node was registered, this usually happens if no module was installed.\n" ..
- "Install luci-mod-admin-full and retry. " ..
- "If the module is already installed, try removing the /tmp/luci-indexcache file.")
- else
- error404("No page is registered at '/" .. table.concat(request, "/") .. "'.\n" ..
- "If this url belongs to an extension, make sure it is properly installed.\n" ..
- "If the extension was recently installed, try removing the /tmp/luci-indexcache file.")
- end
- end
-end
-
---- Generate the dispatching index using the best possible strategy.
-function createindex()
- local path = luci.util.libpath() .. "/controller/"
- local suff = { ".lua", ".lua.gz" }
-
- if luci.util.copcall(require, "luci.fastindex") then
- createindex_fastindex(path, suff)
- else
- createindex_plain(path, suff)
- end
-end
-
---- Generate the dispatching index using the fastindex C-indexer.
--- @param path Controller base directory
--- @param suffixes Controller file suffixes
-function createindex_fastindex(path, suffixes)
- index = {}
-
- if not fi then
- fi = luci.fastindex.new("index")
- for _, suffix in ipairs(suffixes) do
- fi.add(path .. "*" .. suffix)
- fi.add(path .. "*/*" .. suffix)
- end
- end
- fi.scan()
-
- for k, v in pairs(fi.indexes) do
- index[v[2]] = v[1]
- end
-end
-
---- Generate the dispatching index using the native file-cache based strategy.
--- @param path Controller base directory
--- @param suffixes Controller file suffixes
-function createindex_plain(path, suffixes)
- local controllers = { }
- for _, suffix in ipairs(suffixes) do
- nixio.util.consume((fs.glob(path .. "*" .. suffix)), controllers)
- nixio.util.consume((fs.glob(path .. "*/*" .. suffix)), controllers)
- end
-
- if indexcache then
- local cachedate = fs.stat(indexcache, "mtime")
- if cachedate then
- local realdate = 0
- for _, obj in ipairs(controllers) do
- local omtime = fs.stat(obj, "mtime")
- realdate = (omtime and omtime > realdate) and omtime or realdate
- end
-
- if cachedate > realdate then
- assert(
- sys.process.info("uid") == fs.stat(indexcache, "uid")
- and fs.stat(indexcache, "modestr") == "rw-------",
- "Fatal: Indexcache is not sane!"
- )
-
- index = loadfile(indexcache)()
- return index
- end
- end
- end
-
- index = {}
-
- for i,c in ipairs(controllers) do
- local modname = "luci.controller." .. c:sub(#path+1, #c):gsub("/", ".")
- for _, suffix in ipairs(suffixes) do
- modname = modname:gsub(suffix.."$", "")
- end
-
- local mod = require(modname)
- assert(mod ~= true,
- "Invalid controller file found\n" ..
- "The file '" .. c .. "' contains an invalid module line.\n" ..
- "Please verify whether the module name is set to '" .. modname ..
- "' - It must correspond to the file path!")
-
- local idx = mod.index
- assert(type(idx) == "function",
- "Invalid controller file found\n" ..
- "The file '" .. c .. "' contains no index() function.\n" ..
- "Please make sure that the controller contains a valid " ..
- "index function and verify the spelling!")
-
- index[modname] = idx
- end
-
- if indexcache then
- local f = nixio.open(indexcache, "w", 600)
- f:writeall(util.get_bytecode(index))
- f:close()
- end
-end
-
---- Create the dispatching tree from the index.
--- Build the index before if it does not exist yet.
-function createtree()
- if not index then
- createindex()
- end
-
- local ctx = context
- local tree = {nodes={}, inreq=true}
- local modi = {}
-
- ctx.treecache = setmetatable({}, {__mode="v"})
- ctx.tree = tree
- ctx.modifiers = modi
-
- -- Load default translation
- require "luci.i18n".loadc("base")
-
- local scope = setmetatable({}, {__index = luci.dispatcher})
-
- for k, v in pairs(index) do
- scope._NAME = k
- setfenv(v, scope)
- v()
- end
-
- local function modisort(a,b)
- return modi[a].order < modi[b].order
- end
-
- for _, v in util.spairs(modi, modisort) do
- scope._NAME = v.module
- setfenv(v.func, scope)
- v.func()
- end
-
- return tree
-end
-
---- Register a tree modifier.
--- @param func Modifier function
--- @param order Modifier order value (optional)
-function modifier(func, order)
- context.modifiers[#context.modifiers+1] = {
- func = func,
- order = order or 0,
- module
- = getfenv(2)._NAME
- }
-end
-
---- Clone a node of the dispatching tree to another position.
--- @param path Virtual path destination
--- @param clone Virtual path source
--- @param title Destination node title (optional)
--- @param order Destination node order value (optional)
--- @return Dispatching tree node
-function assign(path, clone, title, order)
- local obj = node(unpack(path))
- obj.nodes = nil
- obj.module = nil
-
- obj.title = title
- obj.order = order
-
- setmetatable(obj, {__index = _create_node(clone)})
-
- return obj
-end
-
---- Create a new dispatching node and define common parameters.
--- @param path Virtual path
--- @param target Target function to call when dispatched.
--- @param title Destination node title
--- @param order Destination node order value (optional)
--- @return Dispatching tree node
-function entry(path, target, title, order)
- local c = node(unpack(path))
-
- c.target = target
- c.title = title
- c.order = order
- c.module = getfenv(2)._NAME
-
- return c
-end
-
---- Fetch or create a dispatching node without setting the target module or
--- enabling the node.
--- @param ... Virtual path
--- @return Dispatching tree node
-function get(...)
- return _create_node({...})
-end
-
---- Fetch or create a new dispatching node.
--- @param ... Virtual path
--- @return Dispatching tree node
-function node(...)
- local c = _create_node({...})
-
- c.module = getfenv(2)._NAME
- c.auto = nil
-
- return c
-end
-
-function _create_node(path)
- if #path == 0 then
- return context.tree
- end
-
- local name = table.concat(path, ".")
- local c = context.treecache[name]
-
- if not c then
- local last = table.remove(path)
- local parent = _create_node(path)
-
- c = {nodes={}, auto=true}
- -- the node is "in request" if the request path matches
- -- at least up to the length of the node path
- if parent.inreq and context.path[#path+1] == last then
- c.inreq = true
- end
- parent.nodes[last] = c
- context.treecache[name] = c
- end
- return c
-end
-
--- Subdispatchers --
-
-function _firstchild()
- local path = { unpack(context.path) }
- local name = table.concat(path, ".")
- local node = context.treecache[name]
-
- local lowest
- if node and node.nodes and next(node.nodes) then
- local k, v
- for k, v in pairs(node.nodes) do
- if not lowest or
- (v.order or 100) < (node.nodes[lowest].order or 100)
- then
- lowest = k
- end
- end
- end
-
- assert(lowest ~= nil,
- "The requested node contains no childs, unable to redispatch")
-
- path[#path+1] = lowest
- dispatch(path)
-end
-
---- Alias the first (lowest order) page automatically
-function firstchild()
- return { type = "firstchild", target = _firstchild }
-end
-
---- Create a redirect to another dispatching node.
--- @param ... Virtual path destination
-function alias(...)
- local req = {...}
- return function(...)
- for _, r in ipairs({...}) do
- req[#req+1] = r
- end
-
- dispatch(req)
- end
-end
-
---- Rewrite the first x path values of the request.
--- @param n Number of path values to replace
--- @param ... Virtual path to replace removed path values with
-function rewrite(n, ...)
- local req = {...}
- return function(...)
- local dispatched = util.clone(context.dispatched)
-
- for i=1,n do
- table.remove(dispatched, 1)
- end
-
- for i, r in ipairs(req) do
- table.insert(dispatched, i, r)
- end
-
- for _, r in ipairs({...}) do
- dispatched[#dispatched+1] = r
- end
-
- dispatch(dispatched)
- end
-end
-
-
-local function _call(self, ...)
- local func = getfenv()[self.name]
- assert(func ~= nil,
- 'Cannot resolve function "' .. self.name .. '". Is it misspelled or local?')
-
- assert(type(func) == "function",
- 'The symbol "' .. self.name .. '" does not refer to a function but data ' ..
- 'of type "' .. type(func) .. '".')
-
- if #self.argv > 0 then
- return func(unpack(self.argv), ...)
- else
- return func(...)
- end
-end
-
---- Create a function-call dispatching target.
--- @param name Target function of local controller
--- @param ... Additional parameters passed to the function
-function call(name, ...)
- return {type = "call", argv = {...}, name = name, target = _call}
-end
-
-
-local _template = function(self, ...)
- require "luci.template".render(self.view)
-end
-
---- Create a template render dispatching target.
--- @param name Template to be rendered
-function template(name)
- return {type = "template", view = name, target = _template}
-end
-
-
-local function _cbi(self, ...)
- local cbi = require "luci.cbi"
- local tpl = require "luci.template"
- local http = require "luci.http"
-
- local config = self.config or {}
- local maps = cbi.load(self.model, ...)
-
- local state = nil
-
- for i, res in ipairs(maps) do
- res.flow = config
- local cstate = res:parse()
- if cstate and (not state or cstate < state) then
- state = cstate
- end
- end
-
- local function _resolve_path(path)
- return type(path) == "table" and build_url(unpack(path)) or path
- end
-
- if config.on_valid_to and state and state > 0 and state < 2 then
- http.redirect(_resolve_path(config.on_valid_to))
- return
- end
-
- if config.on_changed_to and state and state > 1 then
- http.redirect(_resolve_path(config.on_changed_to))
- return
- end
-
- if config.on_success_to and state and state > 0 then
- http.redirect(_resolve_path(config.on_success_to))
- return
- end
-
- if config.state_handler then
- if not config.state_handler(state, maps) then
- return
- end
- end
-
- http.header("X-CBI-State", state or 0)
-
- if not config.noheader then
- tpl.render("cbi/header", {state = state})
- end
-
- local redirect
- local messages
- local applymap = false
- local pageaction = true
- local parsechain = { }
-
- for i, res in ipairs(maps) do
- if res.apply_needed and res.parsechain then
- local c
- for _, c in ipairs(res.parsechain) do
- parsechain[#parsechain+1] = c
- end
- applymap = true
- end
-
- if res.redirect then
- redirect = redirect or res.redirect
- end
-
- if res.pageaction == false then
- pageaction = false
- end
-
- if res.message then
- messages = messages or { }
- messages[#messages+1] = res.message
- end
- end
-
- for i, res in ipairs(maps) do
- res:render({
- firstmap = (i == 1),
- applymap = applymap,
- redirect = redirect,
- messages = messages,
- pageaction = pageaction,
- parsechain = parsechain
- })
- end
-
- if not config.nofooter then
- tpl.render("cbi/footer", {
- flow = config,
- pageaction = pageaction,
- redirect = redirect,
- state = state,
- autoapply = config.autoapply
- })
- end
-end
-
---- Create a CBI model dispatching target.
--- @param model CBI model to be rendered
-function cbi(model, config)
- return {type = "cbi", config = config, model = model, target = _cbi}
-end
-
-
-local function _arcombine(self, ...)
- local argv = {...}
- local target = #argv > 0 and self.targets[2] or self.targets[1]
- setfenv(target.target, self.env)
- target:target(unpack(argv))
-end
-
---- Create a combined dispatching target for non argv and argv requests.
--- @param trg1 Overview Target
--- @param trg2 Detail Target
-function arcombine(trg1, trg2)
- return {type = "arcombine", env = getfenv(), target = _arcombine, targets = {trg1, trg2}}
-end
-
-
-local function _form(self, ...)
- local cbi = require "luci.cbi"
- local tpl = require "luci.template"
- local http = require "luci.http"
-
- local maps = luci.cbi.load(self.model, ...)
- local state = nil
-
- for i, res in ipairs(maps) do
- local cstate = res:parse()
- if cstate and (not state or cstate < state) then
- state = cstate
- end
- end
-
- http.header("X-CBI-State", state or 0)
- tpl.render("header")
- for i, res in ipairs(maps) do
- res:render()
- end
- tpl.render("footer")
-end
-
---- Create a CBI form model dispatching target.
--- @param model CBI form model tpo be rendered
-function form(model)
- return {type = "cbi", model = model, target = _form}
-end
-
---- Access the luci.i18n translate() api.
--- @class function
--- @name translate
--- @param text Text to translate
-translate = i18n.translate
-
---- No-op function used to mark translation entries for menu labels.
--- This function does not actually translate the given argument but
--- is used by build/i18n-scan.pl to find translatable entries.
-function _(text)
- return text
-end
+++ /dev/null
---[[
-LuCI - HTTP-Interaction
-
-Description:
-HTTP-Header manipulator and form variable preprocessor
-
-License:
-Copyright 2008 Steven Barth <steven@midlink.org>
-
-Licensed under the Apache License, Version 2.0 (the "License");
-you may not use this file except in compliance with the License.
-You may obtain a copy of the License at
-
- http://www.apache.org/licenses/LICENSE-2.0
-
-Unless required by applicable law or agreed to in writing, software
-distributed under the License is distributed on an "AS IS" BASIS,
-WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
-See the License for the specific language governing permissions and
-limitations under the License.
-
-]]--
-
-local ltn12 = require "luci.ltn12"
-local protocol = require "luci.http.protocol"
-local util = require "luci.util"
-local string = require "string"
-local coroutine = require "coroutine"
-local table = require "table"
-
-local ipairs, pairs, next, type, tostring, error =
- ipairs, pairs, next, type, tostring, error
-
---- LuCI Web Framework high-level HTTP functions.
-module "luci.http"
-
-context = util.threadlocal()
-
-Request = util.class()
-function Request.__init__(self, env, sourcein, sinkerr)
- self.input = sourcein
- self.error = sinkerr
-
-
- -- File handler
- self.filehandler = function() end
-
- -- HTTP-Message table
- self.message = {
- env = env,
- headers = {},
- params = protocol.urldecode_params(env.QUERY_STRING or ""),
- }
-
- self.parsed_input = false
-end
-
-function Request.formvalue(self, name, noparse)
- if not noparse and not self.parsed_input then
- self:_parse_input()
- end
-
- if name then
- return self.message.params[name]
- else
- return self.message.params
- end
-end
-
-function Request.formvaluetable(self, prefix)
- local vals = {}
- prefix = prefix and prefix .. "." or "."
-
- if not self.parsed_input then
- self:_parse_input()
- end
-
- local void = self.message.params[nil]
- for k, v in pairs(self.message.params) do
- if k:find(prefix, 1, true) == 1 then
- vals[k:sub(#prefix + 1)] = tostring(v)
- end
- end
-
- return vals
-end
-
-function Request.content(self)
- if not self.parsed_input then
- self:_parse_input()
- end
-
- return self.message.content, self.message.content_length
-end
-
-function Request.getcookie(self, name)
- local c = string.gsub(";" .. (self:getenv("HTTP_COOKIE") or "") .. ";", "%s*;%s*", ";")
- local p = ";" .. name .. "=(.-);"
- local i, j, value = c:find(p)
- return value and urldecode(value)
-end
-
-function Request.getenv(self, name)
- if name then
- return self.message.env[name]
- else
- return self.message.env
- end
-end
-
-function Request.setfilehandler(self, callback)
- self.filehandler = callback
-end
-
-function Request._parse_input(self)
- protocol.parse_message_body(
- self.input,
- self.message,
- self.filehandler
- )
- self.parsed_input = true
-end
-
---- Close the HTTP-Connection.
-function close()
- if not context.eoh then
- context.eoh = true
- coroutine.yield(3)
- end
-
- if not context.closed then
- context.closed = true
- coroutine.yield(5)
- end
-end
-
---- Return the request content if the request was of unknown type.
--- @return HTTP request body
--- @return HTTP request body length
-function content()
- return context.request:content()
-end
-
---- Get a certain HTTP input value or a table of all input values.
--- @param name Name of the GET or POST variable to fetch
--- @param noparse Don't parse POST data before getting the value
--- @return HTTP input value or table of all input value
-function formvalue(name, noparse)
- return context.request:formvalue(name, noparse)
-end
-
---- Get a table of all HTTP input values with a certain prefix.
--- @param prefix Prefix
--- @return Table of all HTTP input values with given prefix
-function formvaluetable(prefix)
- return context.request:formvaluetable(prefix)
-end
-
---- Get the value of a certain HTTP-Cookie.
--- @param name Cookie Name
--- @return String containing cookie data
-function getcookie(name)
- return context.request:getcookie(name)
-end
-
---- Get the value of a certain HTTP environment variable
--- or the environment table itself.
--- @param name Environment variable
--- @return HTTP environment value or environment table
-function getenv(name)
- return context.request:getenv(name)
-end
-
---- Set a handler function for incoming user file uploads.
--- @param callback Handler function
-function setfilehandler(callback)
- return context.request:setfilehandler(callback)
-end
-
---- Send a HTTP-Header.
--- @param key Header key
--- @param value Header value
-function header(key, value)
- if not context.headers then
- context.headers = {}
- end
- context.headers[key:lower()] = value
- coroutine.yield(2, key, value)
-end
-
---- Set the mime type of following content data.
--- @param mime Mimetype of following content
-function prepare_content(mime)
- if not context.headers or not context.headers["content-type"] then
- if mime == "application/xhtml+xml" then
- if not getenv("HTTP_ACCEPT") or
- not getenv("HTTP_ACCEPT"):find("application/xhtml+xml", nil, true) then
- mime = "text/html; charset=UTF-8"
- end
- header("Vary", "Accept")
- end
- header("Content-Type", mime)
- end
-end
-
---- Get the RAW HTTP input source
--- @return HTTP LTN12 source
-function source()
- return context.request.input
-end
-
---- Set the HTTP status code and status message.
--- @param code Status code
--- @param message Status message
-function status(code, message)
- code = code or 200
- message = message or "OK"
- context.status = code
- coroutine.yield(1, code, message)
-end
-
---- Send a chunk of content data to the client.
--- This function is as a valid LTN12 sink.
--- If the content chunk is nil this function will automatically invoke close.
--- @param content Content chunk
--- @param src_err Error object from source (optional)
--- @see close
-function write(content, src_err)
- if not content then
- if src_err then
- error(src_err)
- else
- close()
- end
- return true
- elseif #content == 0 then
- return true
- else
- if not context.eoh then
- if not context.status then
- status()
- end
- if not context.headers or not context.headers["content-type"] then
- header("Content-Type", "text/html; charset=utf-8")
- end
- if not context.headers["cache-control"] then
- header("Cache-Control", "no-cache")
- header("Expires", "0")
- end
-
-
- context.eoh = true
- coroutine.yield(3)
- end
- coroutine.yield(4, content)
- return true
- end
-end
-
---- Splice data from a filedescriptor to the client.
--- @param fp File descriptor
--- @param size Bytes to splice (optional)
-function splice(fd, size)
- coroutine.yield(6, fd, size)
-end
-
---- Redirects the client to a new URL and closes the connection.
--- @param url Target URL
-function redirect(url)
- status(302, "Found")
- header("Location", url)
- close()
-end
-
---- Create a querystring out of a table of key - value pairs.
--- @param table Query string source table
--- @return Encoded HTTP query string
-function build_querystring(q)
- local s = { "?" }
-
- for k, v in pairs(q) do
- if #s > 1 then s[#s+1] = "&" end
-
- s[#s+1] = urldecode(k)
- s[#s+1] = "="
- s[#s+1] = urldecode(v)
- end
-
- return table.concat(s, "")
-end
-
---- Return the URL-decoded equivalent of a string.
--- @param str URL-encoded string
--- @param no_plus Don't decode + to " "
--- @return URL-decoded string
--- @see urlencode
-urldecode = protocol.urldecode
-
---- Return the URL-encoded equivalent of a string.
--- @param str Source string
--- @return URL-encoded string
--- @see urldecode
-urlencode = protocol.urlencode
-
---- Send the given data as JSON encoded string.
--- @param data Data to send
-function write_json(x)
- if x == nil then
- write("null")
- elseif type(x) == "table" then
- local k, v
- if type(next(x)) == "number" then
- write("[ ")
- for k, v in ipairs(x) do
- write_json(v)
- if next(x, k) then
- write(", ")
- end
- end
- write(" ]")
- else
- write("{ ")
- for k, v in pairs(x) do
- write("%q: " % k)
- write_json(v)
- if next(x, k) then
- write(", ")
- end
- end
- write(" }")
- end
- elseif type(x) == "number" or type(x) == "boolean" then
- if (x ~= x) then
- -- NaN is the only value that doesn't equal to itself.
- write("Number.NaN")
- else
- write(tostring(x))
- end
- else
- write('"%s"' % tostring(x):gsub('["%z\1-\31]', function(c)
- return '\\u%04x' % c:byte(1)
- end))
- end
-end
+++ /dev/null
---[[
-
-HTTP protocol implementation for LuCI
-(c) 2008 Freifunk Leipzig / Jo-Philipp Wich <xm@leipzig.freifunk.net>
-
-Licensed under the Apache License, Version 2.0 (the "License");
-you may not use this file except in compliance with the License.
-You may obtain a copy of the License at
-
- http://www.apache.org/licenses/LICENSE-2.0
-
-$Id$
-
-]]--
-
---- LuCI http protocol class.
--- This class contains several functions useful for http message- and content
--- decoding and to retrive form data from raw http messages.
-module("luci.http.protocol", package.seeall)
-
-local ltn12 = require("luci.ltn12")
-
-HTTP_MAX_CONTENT = 1024*8 -- 8 kB maximum content size
-
---- Decode an urlencoded string - optionally without decoding
--- the "+" sign to " " - and return the decoded string.
--- @param str Input string in x-www-urlencoded format
--- @param no_plus Don't decode "+" signs to spaces
--- @return The decoded string
--- @see urlencode
-function urldecode( str, no_plus )
-
- local function __chrdec( hex )
- return string.char( tonumber( hex, 16 ) )
- end
-
- if type(str) == "string" then
- if not no_plus then
- str = str:gsub( "+", " " )
- end
-
- str = str:gsub( "%%([a-fA-F0-9][a-fA-F0-9])", __chrdec )
- end
-
- return str
-end
-
---- Extract and split urlencoded data pairs, separated bei either "&" or ";"
--- from given url or string. Returns a table with urldecoded values.
--- Simple parameters are stored as string values associated with the parameter
--- name within the table. Parameters with multiple values are stored as array
--- containing the corresponding values.
--- @param url The url or string which contains x-www-urlencoded form data
--- @param tbl Use the given table for storing values (optional)
--- @return Table containing the urldecoded parameters
--- @see urlencode_params
-function urldecode_params( url, tbl )
-
- local params = tbl or { }
-
- if url:find("?") then
- url = url:gsub( "^.+%?([^?]+)", "%1" )
- end
-
- for pair in url:gmatch( "[^&;]+" ) do
-
- -- find key and value
- local key = urldecode( pair:match("^([^=]+)") )
- local val = urldecode( pair:match("^[^=]+=(.+)$") )
-
- -- store
- if type(key) == "string" and key:len() > 0 then
- if type(val) ~= "string" then val = "" end
-
- if not params[key] then
- params[key] = val
- elseif type(params[key]) ~= "table" then
- params[key] = { params[key], val }
- else
- table.insert( params[key], val )
- end
- end
- end
-
- return params
-end
-
---- Encode given string to x-www-urlencoded format.
--- @param str String to encode
--- @return String containing the encoded data
--- @see urldecode
-function urlencode( str )
-
- local function __chrenc( chr )
- return string.format(
- "%%%02x", string.byte( chr )
- )
- end
-
- if type(str) == "string" then
- str = str:gsub(
- "([^a-zA-Z0-9$_%-%.%+!*'(),])",
- __chrenc
- )
- end
-
- return str
-end
-
---- Encode each key-value-pair in given table to x-www-urlencoded format,
--- separated by "&". Tables are encoded as parameters with multiple values by
--- repeating the parameter name with each value.
--- @param tbl Table with the values
--- @return String containing encoded values
--- @see urldecode_params
-function urlencode_params( tbl )
- local enc = ""
-
- for k, v in pairs(tbl) do
- if type(v) == "table" then
- for i, v2 in ipairs(v) do
- enc = enc .. ( #enc > 0 and "&" or "" ) ..
- urlencode(k) .. "=" .. urlencode(v2)
- end
- else
- enc = enc .. ( #enc > 0 and "&" or "" ) ..
- urlencode(k) .. "=" .. urlencode(v)
- end
- end
-
- return enc
-end
-
--- (Internal function)
--- Initialize given parameter and coerce string into table when the parameter
--- already exists.
--- @param tbl Table where parameter should be created
--- @param key Parameter name
--- @return Always nil
-local function __initval( tbl, key )
- if tbl[key] == nil then
- tbl[key] = ""
- elseif type(tbl[key]) == "string" then
- tbl[key] = { tbl[key], "" }
- else
- table.insert( tbl[key], "" )
- end
-end
-
--- (Internal function)
--- Append given data to given parameter, either by extending the string value
--- or by appending it to the last string in the parameter's value table.
--- @param tbl Table containing the previously initialized parameter value
--- @param key Parameter name
--- @param chunk String containing the data to append
--- @return Always nil
--- @see __initval
-local function __appendval( tbl, key, chunk )
- if type(tbl[key]) == "table" then
- tbl[key][#tbl[key]] = tbl[key][#tbl[key]] .. chunk
- else
- tbl[key] = tbl[key] .. chunk
- end
-end
-
--- (Internal function)
--- Finish the value of given parameter, either by transforming the string value
--- or - in the case of multi value parameters - the last element in the
--- associated values table.
--- @param tbl Table containing the previously initialized parameter value
--- @param key Parameter name
--- @param handler Function which transforms the parameter value
--- @return Always nil
--- @see __initval
--- @see __appendval
-local function __finishval( tbl, key, handler )
- if handler then
- if type(tbl[key]) == "table" then
- tbl[key][#tbl[key]] = handler( tbl[key][#tbl[key]] )
- else
- tbl[key] = handler( tbl[key] )
- end
- end
-end
-
-
--- Table of our process states
-local process_states = { }
-
--- Extract "magic", the first line of a http message.
--- Extracts the message type ("get", "post" or "response"), the requested uri
--- or the status code if the line descripes a http response.
-process_states['magic'] = function( msg, chunk, err )
-
- if chunk ~= nil then
- -- ignore empty lines before request
- if #chunk == 0 then
- return true, nil
- end
-
- -- Is it a request?
- local method, uri, http_ver = chunk:match("^([A-Z]+) ([^ ]+) HTTP/([01]%.[019])$")
-
- -- Yup, it is
- if method then
-
- msg.type = "request"
- msg.request_method = method:lower()
- msg.request_uri = uri
- msg.http_version = tonumber( http_ver )
- msg.headers = { }
-
- -- We're done, next state is header parsing
- return true, function( chunk )
- return process_states['headers']( msg, chunk )
- end
-
- -- Is it a response?
- else
-
- local http_ver, code, message = chunk:match("^HTTP/([01]%.[019]) ([0-9]+) ([^\r\n]+)$")
-
- -- Is a response
- if code then
-
- msg.type = "response"
- msg.status_code = code
- msg.status_message = message
- msg.http_version = tonumber( http_ver )
- msg.headers = { }
-
- -- We're done, next state is header parsing
- return true, function( chunk )
- return process_states['headers']( msg, chunk )
- end
- end
- end
- end
-
- -- Can't handle it
- return nil, "Invalid HTTP message magic"
-end
-
-
--- Extract headers from given string.
-process_states['headers'] = function( msg, chunk )
-
- if chunk ~= nil then
-
- -- Look for a valid header format
- local hdr, val = chunk:match( "^([A-Za-z][A-Za-z0-9%-_]+): +(.+)$" )
-
- if type(hdr) == "string" and hdr:len() > 0 and
- type(val) == "string" and val:len() > 0
- then
- msg.headers[hdr] = val
-
- -- Valid header line, proceed
- return true, nil
-
- elseif #chunk == 0 then
- -- Empty line, we won't accept data anymore
- return false, nil
- else
- -- Junk data
- return nil, "Invalid HTTP header received"
- end
- else
- return nil, "Unexpected EOF"
- end
-end
-
-
---- Creates a ltn12 source from the given socket. The source will return it's
--- data line by line with the trailing \r\n stripped of.
--- @param sock Readable network socket
--- @return Ltn12 source function
-function header_source( sock )
- return ltn12.source.simplify( function()
-
- local chunk, err, part = sock:receive("*l")
-
- -- Line too long
- if chunk == nil then
- if err ~= "timeout" then
- return nil, part
- and "Line exceeds maximum allowed length"
- or "Unexpected EOF"
- else
- return nil, err
- end
-
- -- Line ok
- elseif chunk ~= nil then
-
- -- Strip trailing CR
- chunk = chunk:gsub("\r$","")
-
- return chunk, nil
- end
- end )
-end
-
---- Decode a mime encoded http message body with multipart/form-data
--- Content-Type. Stores all extracted data associated with its parameter name
--- in the params table withing the given message object. Multiple parameter
--- values are stored as tables, ordinary ones as strings.
--- If an optional file callback function is given then it is feeded with the
--- file contents chunk by chunk and only the extracted file name is stored
--- within the params table. The callback function will be called subsequently
--- with three arguments:
--- o Table containing decoded (name, file) and raw (headers) mime header data
--- o String value containing a chunk of the file data
--- o Boolean which indicates wheather the current chunk is the last one (eof)
--- @param src Ltn12 source function
--- @param msg HTTP message object
--- @param filecb File callback function (optional)
--- @return Value indicating successful operation (not nil means "ok")
--- @return String containing the error if unsuccessful
--- @see parse_message_header
-function mimedecode_message_body( src, msg, filecb )
-
- if msg and msg.env.CONTENT_TYPE then
- msg.mime_boundary = msg.env.CONTENT_TYPE:match("^multipart/form%-data; boundary=(.+)$")
- end
-
- if not msg.mime_boundary then
- return nil, "Invalid Content-Type found"
- end
-
-
- local tlen = 0
- local inhdr = false
- local field = nil
- local store = nil
- local lchunk = nil
-
- local function parse_headers( chunk, field )
-
- local stat
- repeat
- chunk, stat = chunk:gsub(
- "^([A-Z][A-Za-z0-9%-_]+): +([^\r\n]+)\r\n",
- function(k,v)
- field.headers[k] = v
- return ""
- end
- )
- until stat == 0
-
- chunk, stat = chunk:gsub("^\r\n","")
-
- -- End of headers
- if stat > 0 then
- if field.headers["Content-Disposition"] then
- if field.headers["Content-Disposition"]:match("^form%-data; ") then
- field.name = field.headers["Content-Disposition"]:match('name="(.-)"')
- field.file = field.headers["Content-Disposition"]:match('filename="(.+)"$')
- end
- end
-
- if not field.headers["Content-Type"] then
- field.headers["Content-Type"] = "text/plain"
- end
-
- if field.name and field.file and filecb then
- __initval( msg.params, field.name )
- __appendval( msg.params, field.name, field.file )
-
- store = filecb
- elseif field.name then
- __initval( msg.params, field.name )
-
- store = function( hdr, buf, eof )
- __appendval( msg.params, field.name, buf )
- end
- else
- store = nil
- end
-
- return chunk, true
- end
-
- return chunk, false
- end
-
- local function snk( chunk )
-
- tlen = tlen + ( chunk and #chunk or 0 )
-
- if msg.env.CONTENT_LENGTH and tlen > tonumber(msg.env.CONTENT_LENGTH) + 2 then
- return nil, "Message body size exceeds Content-Length"
- end
-
- if chunk and not lchunk then
- lchunk = "\r\n" .. chunk
-
- elseif lchunk then
- local data = lchunk .. ( chunk or "" )
- local spos, epos, found
-
- repeat
- spos, epos = data:find( "\r\n--" .. msg.mime_boundary .. "\r\n", 1, true )
-
- if not spos then
- spos, epos = data:find( "\r\n--" .. msg.mime_boundary .. "--\r\n", 1, true )
- end
-
-
- if spos then
- local predata = data:sub( 1, spos - 1 )
-
- if inhdr then
- predata, eof = parse_headers( predata, field )
-
- if not eof then
- return nil, "Invalid MIME section header"
- elseif not field.name then
- return nil, "Invalid Content-Disposition header"
- end
- end
-
- if store then
- store( field, predata, true )
- end
-
-
- field = { headers = { } }
- found = found or true
-
- data, eof = parse_headers( data:sub( epos + 1, #data ), field )
- inhdr = not eof
- end
- until not spos
-
- if found then
- -- We found at least some boundary. Save
- -- the unparsed remaining data for the
- -- next chunk.
- lchunk, data = data, nil
- else
- -- There was a complete chunk without a boundary. Parse it as headers or
- -- append it as data, depending on our current state.
- if inhdr then
- lchunk, eof = parse_headers( data, field )
- inhdr = not eof
- else
- -- We're inside data, so append the data. Note that we only append
- -- lchunk, not all of data, since there is a chance that chunk
- -- contains half a boundary. Assuming that each chunk is at least the
- -- boundary in size, this should prevent problems
- store( field, lchunk, false )
- lchunk, chunk = chunk, nil
- end
- end
- end
-
- return true
- end
-
- return ltn12.pump.all( src, snk )
-end
-
---- Decode an urlencoded http message body with application/x-www-urlencoded
--- Content-Type. Stores all extracted data associated with its parameter name
--- in the params table withing the given message object. Multiple parameter
--- values are stored as tables, ordinary ones as strings.
--- @param src Ltn12 source function
--- @param msg HTTP message object
--- @return Value indicating successful operation (not nil means "ok")
--- @return String containing the error if unsuccessful
--- @see parse_message_header
-function urldecode_message_body( src, msg )
-
- local tlen = 0
- local lchunk = nil
-
- local function snk( chunk )
-
- tlen = tlen + ( chunk and #chunk or 0 )
-
- if msg.env.CONTENT_LENGTH and tlen > tonumber(msg.env.CONTENT_LENGTH) + 2 then
- return nil, "Message body size exceeds Content-Length"
- elseif tlen > HTTP_MAX_CONTENT then
- return nil, "Message body size exceeds maximum allowed length"
- end
-
- if not lchunk and chunk then
- lchunk = chunk
-
- elseif lchunk then
- local data = lchunk .. ( chunk or "&" )
- local spos, epos
-
- repeat
- spos, epos = data:find("^.-[;&]")
-
- if spos then
- local pair = data:sub( spos, epos - 1 )
- local key = pair:match("^(.-)=")
- local val = pair:match("=([^%s]*)%s*$")
-
- if key and #key > 0 then
- __initval( msg.params, key )
- __appendval( msg.params, key, val )
- __finishval( msg.params, key, urldecode )
- end
-
- data = data:sub( epos + 1, #data )
- end
- until not spos
-
- lchunk = data
- end
-
- return true
- end
-
- return ltn12.pump.all( src, snk )
-end
-
---- Try to extract an http message header including information like protocol
--- version, message headers and resulting CGI environment variables from the
--- given ltn12 source.
--- @param src Ltn12 source function
--- @return HTTP message object
--- @see parse_message_body
-function parse_message_header( src )
-
- local ok = true
- local msg = { }
-
- local sink = ltn12.sink.simplify(
- function( chunk )
- return process_states['magic']( msg, chunk )
- end
- )
-
- -- Pump input data...
- while ok do
-
- -- get data
- ok, err = ltn12.pump.step( src, sink )
-
- -- error
- if not ok and err then
- return nil, err
-
- -- eof
- elseif not ok then
-
- -- Process get parameters
- if ( msg.request_method == "get" or msg.request_method == "post" ) and
- msg.request_uri:match("?")
- then
- msg.params = urldecode_params( msg.request_uri )
- else
- msg.params = { }
- end
-
- -- Populate common environment variables
- msg.env = {
- CONTENT_LENGTH = msg.headers['Content-Length'];
- CONTENT_TYPE = msg.headers['Content-Type'] or msg.headers['Content-type'];
- REQUEST_METHOD = msg.request_method:upper();
- REQUEST_URI = msg.request_uri;
- SCRIPT_NAME = msg.request_uri:gsub("?.+$","");
- SCRIPT_FILENAME = ""; -- XXX implement me
- SERVER_PROTOCOL = "HTTP/" .. string.format("%.1f", msg.http_version);
- QUERY_STRING = msg.request_uri:match("?")
- and msg.request_uri:gsub("^.+?","") or ""
- }
-
- -- Populate HTTP_* environment variables
- for i, hdr in ipairs( {
- 'Accept',
- 'Accept-Charset',
- 'Accept-Encoding',
- 'Accept-Language',
- 'Connection',
- 'Cookie',
- 'Host',
- 'Referer',
- 'User-Agent',
- } ) do
- local var = 'HTTP_' .. hdr:upper():gsub("%-","_")
- local val = msg.headers[hdr]
-
- msg.env[var] = val
- end
- end
- end
-
- return msg
-end
-
---- Try to extract and decode a http message body from the given ltn12 source.
--- This function will examine the Content-Type within the given message object
--- to select the appropriate content decoder.
--- Currently the application/x-www-urlencoded and application/form-data
--- mime types are supported. If the encountered content encoding can't be
--- handled then the whole message body will be stored unaltered as "content"
--- property within the given message object.
--- @param src Ltn12 source function
--- @param msg HTTP message object
--- @param filecb File data callback (optional, see mimedecode_message_body())
--- @return Value indicating successful operation (not nil means "ok")
--- @return String containing the error if unsuccessful
--- @see parse_message_header
-function parse_message_body( src, msg, filecb )
- -- Is it multipart/mime ?
- if msg.env.REQUEST_METHOD == "POST" and msg.env.CONTENT_TYPE and
- msg.env.CONTENT_TYPE:match("^multipart/form%-data")
- then
-
- return mimedecode_message_body( src, msg, filecb )
-
- -- Is it application/x-www-form-urlencoded ?
- elseif msg.env.REQUEST_METHOD == "POST" and msg.env.CONTENT_TYPE and
- msg.env.CONTENT_TYPE:match("^application/x%-www%-form%-urlencoded")
- then
- return urldecode_message_body( src, msg, filecb )
-
-
- -- Unhandled encoding
- -- If a file callback is given then feed it chunk by chunk, else
- -- store whole buffer in message.content
- else
-
- local sink
-
- -- If we have a file callback then feed it
- if type(filecb) == "function" then
- sink = filecb
-
- -- ... else append to .content
- else
- msg.content = ""
- msg.content_length = 0
-
- sink = function( chunk, err )
- if chunk then
- if ( msg.content_length + #chunk ) <= HTTP_MAX_CONTENT then
- msg.content = msg.content .. chunk
- msg.content_length = msg.content_length + #chunk
- return true
- else
- return nil, "POST data exceeds maximum allowed length"
- end
- end
- return true
- end
- end
-
- -- Pump data...
- while true do
- local ok, err = ltn12.pump.step( src, sink )
-
- if not ok and err then
- return nil, err
- elseif not err then
- return true
- end
- end
-
- return true
- end
-end
-
---- Table containing human readable messages for several http status codes.
--- @class table
-statusmsg = {
- [200] = "OK",
- [206] = "Partial Content",
- [301] = "Moved Permanently",
- [302] = "Found",
- [304] = "Not Modified",
- [400] = "Bad Request",
- [403] = "Forbidden",
- [404] = "Not Found",
- [405] = "Method Not Allowed",
- [408] = "Request Time-out",
- [411] = "Length Required",
- [412] = "Precondition Failed",
- [416] = "Requested range not satisfiable",
- [500] = "Internal Server Error",
- [503] = "Server Unavailable",
-}
+++ /dev/null
---[[
-
-HTTP protocol implementation for LuCI - RFC2616 / 14.19, 14.24 - 14.28
-(c) 2008 Freifunk Leipzig / Jo-Philipp Wich <xm@leipzig.freifunk.net>
-
-Licensed under the Apache License, Version 2.0 (the "License");
-you may not use this file except in compliance with the License.
-You may obtain a copy of the License at
-
- http://www.apache.org/licenses/LICENSE-2.0
-
-$Id$
-
-]]--
-
---- LuCI http protocol implementation - HTTP/1.1 bits.
--- This class provides basic ETag handling and implements most of the
--- conditional HTTP/1.1 headers specified in RFC2616 Sct. 14.24 - 14.28 .
-module("luci.http.protocol.conditionals", package.seeall)
-
-local date = require("luci.http.protocol.date")
-
-
---- Implement 14.19 / ETag.
--- @param stat A file.stat structure
--- @return String containing the generated tag suitable for ETag headers
-function mk_etag( stat )
- if stat ~= nil then
- return string.format( '"%x-%x-%x"', stat.ino, stat.size, stat.mtime )
- end
-end
-
---- 14.24 / If-Match
--- Test whether the given message object contains an "If-Match" header and
--- compare it against the given stat object.
--- @param req HTTP request message object
--- @param stat A file.stat object
--- @return Boolean indicating whether the precondition is ok
--- @return Alternative status code if the precondition failed
-function if_match( req, stat )
- local h = req.headers
- local etag = mk_etag( stat )
-
- -- Check for matching resource
- if type(h['If-Match']) == "string" then
- for ent in h['If-Match']:gmatch("([^, ]+)") do
- if ( ent == '*' or ent == etag ) and stat ~= nil then
- return true
- end
- end
-
- return false, 412
- end
-
- return true
-end
-
---- 14.25 / If-Modified-Since
--- Test whether the given message object contains an "If-Modified-Since" header
--- and compare it against the given stat object.
--- @param req HTTP request message object
--- @param stat A file.stat object
--- @return Boolean indicating whether the precondition is ok
--- @return Alternative status code if the precondition failed
--- @return Table containing extra HTTP headers if the precondition failed
-function if_modified_since( req, stat )
- local h = req.headers
-
- -- Compare mtimes
- if type(h['If-Modified-Since']) == "string" then
- local since = date.to_unix( h['If-Modified-Since'] )
-
- if stat == nil or since < stat.mtime then
- return true
- end
-
- return false, 304, {
- ["ETag"] = mk_etag( stat );
- ["Date"] = date.to_http( os.time() );
- ["Last-Modified"] = date.to_http( stat.mtime )
- }
- end
-
- return true
-end
-
---- 14.26 / If-None-Match
--- Test whether the given message object contains an "If-None-Match" header and
--- compare it against the given stat object.
--- @param req HTTP request message object
--- @param stat A file.stat object
--- @return Boolean indicating whether the precondition is ok
--- @return Alternative status code if the precondition failed
--- @return Table containing extra HTTP headers if the precondition failed
-function if_none_match( req, stat )
- local h = req.headers
- local etag = mk_etag( stat )
- local method = req.env and req.env.REQUEST_METHOD or "GET"
-
- -- Check for matching resource
- if type(h['If-None-Match']) == "string" then
- for ent in h['If-None-Match']:gmatch("([^, ]+)") do
- if ( ent == '*' or ent == etag ) and stat ~= nil then
- if method == "GET" or method == "HEAD" then
- return false, 304, {
- ["ETag"] = etag;
- ["Date"] = date.to_http( os.time() );
- ["Last-Modified"] = date.to_http( stat.mtime )
- }
- else
- return false, 412
- end
- end
- end
- end
-
- return true
-end
-
---- 14.27 / If-Range
--- The If-Range header is currently not implemented due to the lack of general
--- byte range stuff in luci.http.protocol . This function will always return
--- false, 412 to indicate a failed precondition.
--- @param req HTTP request message object
--- @param stat A file.stat object
--- @return Boolean indicating whether the precondition is ok
--- @return Alternative status code if the precondition failed
-function if_range( req, stat )
- -- Sorry, no subranges (yet)
- return false, 412
-end
-
---- 14.28 / If-Unmodified-Since
--- Test whether the given message object contains an "If-Unmodified-Since"
--- header and compare it against the given stat object.
--- @param req HTTP request message object
--- @param stat A file.stat object
--- @return Boolean indicating whether the precondition is ok
--- @return Alternative status code if the precondition failed
-function if_unmodified_since( req, stat )
- local h = req.headers
-
- -- Compare mtimes
- if type(h['If-Unmodified-Since']) == "string" then
- local since = date.to_unix( h['If-Unmodified-Since'] )
-
- if stat ~= nil and since <= stat.mtime then
- return false, 412
- end
- end
-
- return true
-end
+++ /dev/null
---[[
-
-HTTP protocol implementation for LuCI - date handling
-(c) 2008 Freifunk Leipzig / Jo-Philipp Wich <xm@leipzig.freifunk.net>
-
-Licensed under the Apache License, Version 2.0 (the "License");
-you may not use this file except in compliance with the License.
-You may obtain a copy of the License at
-
- http://www.apache.org/licenses/LICENSE-2.0
-
-$Id$
-
-]]--
-
---- LuCI http protocol implementation - date helper class.
--- This class contains functions to parse, compare and format http dates.
-module("luci.http.protocol.date", package.seeall)
-
-require("luci.sys.zoneinfo")
-
-
-MONTHS = {
- "Jan", "Feb", "Mar", "Apr", "May", "Jun", "Jul", "Aug",
- "Sep", "Oct", "Nov", "Dec"
-}
-
---- Return the time offset in seconds between the UTC and given time zone.
--- @param tz Symbolic or numeric timezone specifier
--- @return Time offset to UTC in seconds
-function tz_offset(tz)
-
- if type(tz) == "string" then
-
- -- check for a numeric identifier
- local s, v = tz:match("([%+%-])([0-9]+)")
- if s == '+' then s = 1 else s = -1 end
- if v then v = tonumber(v) end
-
- if s and v then
- return s * 60 * ( math.floor( v / 100 ) * 60 + ( v % 100 ) )
-
- -- lookup symbolic tz
- elseif luci.sys.zoneinfo.OFFSET[tz:lower()] then
- return luci.sys.zoneinfo.OFFSET[tz:lower()]
- end
-
- end
-
- -- bad luck
- return 0
-end
-
---- Parse given HTTP date string and convert it to unix epoch time.
--- @param data String containing the date
--- @return Unix epoch time
-function to_unix(date)
-
- local wd, day, mon, yr, hr, min, sec, tz = date:match(
- "([A-Z][a-z][a-z]), ([0-9]+) " ..
- "([A-Z][a-z][a-z]) ([0-9]+) " ..
- "([0-9]+):([0-9]+):([0-9]+) " ..
- "([A-Z0-9%+%-]+)"
- )
-
- if day and mon and yr and hr and min and sec then
- -- find month
- local month = 1
- for i = 1, 12 do
- if MONTHS[i] == mon then
- month = i
- break
- end
- end
-
- -- convert to epoch time
- return tz_offset(tz) + os.time( {
- year = yr,
- month = month,
- day = day,
- hour = hr,
- min = min,
- sec = sec
- } )
- end
-
- return 0
-end
-
---- Convert the given unix epoch time to valid HTTP date string.
--- @param time Unix epoch time
--- @return String containing the formatted date
-function to_http(time)
- return os.date( "%a, %d %b %Y %H:%M:%S GMT", time )
-end
-
---- Compare two dates which can either be unix epoch times or HTTP date strings.
--- @param d1 The first date or epoch time to compare
--- @param d2 The first date or epoch time to compare
--- @return -1 - if d1 is lower then d2
--- @return 0 - if both dates are equal
--- @return 1 - if d1 is higher then d2
-function compare(d1, d2)
-
- if d1:match("[^0-9]") then d1 = to_unix(d1) end
- if d2:match("[^0-9]") then d2 = to_unix(d2) end
-
- if d1 == d2 then
- return 0
- elseif d1 < d2 then
- return -1
- else
- return 1
- end
-end
+++ /dev/null
---[[
-
-HTTP protocol implementation for LuCI - mime handling
-(c) 2008 Freifunk Leipzig / Jo-Philipp Wich <xm@leipzig.freifunk.net>
-
-Licensed under the Apache License, Version 2.0 (the "License");
-you may not use this file except in compliance with the License.
-You may obtain a copy of the License at
-
- http://www.apache.org/licenses/LICENSE-2.0
-
-$Id$
-
-]]--
-
---- LuCI http protocol implementation - mime helper class.
--- This class provides functions to guess mime types from file extensions and
--- vice versa.
-module("luci.http.protocol.mime", package.seeall)
-
-require("luci.util")
-
---- MIME mapping table containg extension - mimetype relations.
--- @class table
-MIME_TYPES = {
- ["txt"] = "text/plain";
- ["js"] = "text/javascript";
- ["css"] = "text/css";
- ["htm"] = "text/html";
- ["html"] = "text/html";
- ["patch"] = "text/x-patch";
- ["c"] = "text/x-csrc";
- ["h"] = "text/x-chdr";
- ["o"] = "text/x-object";
- ["ko"] = "text/x-object";
-
- ["bmp"] = "image/bmp";
- ["gif"] = "image/gif";
- ["png"] = "image/png";
- ["jpg"] = "image/jpeg";
- ["jpeg"] = "image/jpeg";
- ["svg"] = "image/svg+xml";
-
- ["zip"] = "application/zip";
- ["pdf"] = "application/pdf";
- ["xml"] = "application/xml";
- ["xsl"] = "application/xml";
- ["doc"] = "application/msword";
- ["ppt"] = "application/vnd.ms-powerpoint";
- ["xls"] = "application/vnd.ms-excel";
- ["odt"] = "application/vnd.oasis.opendocument.text";
- ["odp"] = "application/vnd.oasis.opendocument.presentation";
- ["pl"] = "application/x-perl";
- ["sh"] = "application/x-shellscript";
- ["php"] = "application/x-php";
- ["deb"] = "application/x-deb";
- ["iso"] = "application/x-cd-image";
- ["tgz"] = "application/x-compressed-tar";
-
- ["mp3"] = "audio/mpeg";
- ["ogg"] = "audio/x-vorbis+ogg";
- ["wav"] = "audio/x-wav";
-
- ["mpg"] = "video/mpeg";
- ["mpeg"] = "video/mpeg";
- ["avi"] = "video/x-msvideo";
-}
-
---- Extract extension from a filename and return corresponding mime-type or
--- "application/octet-stream" if the extension is unknown.
--- @param filename The filename for which the mime type is guessed
--- @return String containign the determined mime type
-function to_mime(filename)
- if type(filename) == "string" then
- local ext = filename:match("[^%.]+$")
-
- if ext and MIME_TYPES[ext:lower()] then
- return MIME_TYPES[ext:lower()]
- end
- end
-
- return "application/octet-stream"
-end
-
---- Return corresponding extension for a given mime type or nil if the
--- given mime-type is unknown.
--- @param mimetype The mimetype to retrieve the extension from
--- @return String with the extension or nil for unknown type
-function to_ext(mimetype)
- if type(mimetype) == "string" then
- for ext, type in luci.util.kspairs( MIME_TYPES ) do
- if type == mimetype then
- return ext
- end
- end
- end
-
- return nil
-end
+++ /dev/null
---[[
-LuCI - Internationalisation
-
-Description:
-A very minimalistic but yet effective internationalisation module
-
-FileId:
-$Id$
-
-License:
-Copyright 2008 Steven Barth <steven@midlink.org>
-
-Licensed under the Apache License, Version 2.0 (the "License");
-you may not use this file except in compliance with the License.
-You may obtain a copy of the License at
-
- http://www.apache.org/licenses/LICENSE-2.0
-
-Unless required by applicable law or agreed to in writing, software
-distributed under the License is distributed on an "AS IS" BASIS,
-WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
-See the License for the specific language governing permissions and
-limitations under the License.
-
-]]--
-
---- LuCI translation library.
-module("luci.i18n", package.seeall)
-require("luci.util")
-
-local tparser = require "luci.template.parser"
-
-table = {}
-i18ndir = luci.util.libpath() .. "/i18n/"
-loaded = {}
-context = luci.util.threadlocal()
-default = "en"
-
---- Clear the translation table.
-function clear()
-end
-
---- Load a translation and copy its data into the translation table.
--- @param file Language file
--- @param lang Two-letter language code
--- @param force Force reload even if already loaded (optional)
--- @return Success status
-function load(file, lang, force)
-end
-
---- Load a translation file using the default translation language.
--- Alternatively load the translation of the fallback language.
--- @param file Language file
--- @param force Force reload even if already loaded (optional)
-function loadc(file, force)
-end
-
---- Set the context default translation language.
--- @param lang Two-letter language code
-function setlanguage(lang)
- context.lang = lang:gsub("_", "-")
- context.parent = (context.lang:match("^([a-z][a-z])_"))
- if not tparser.load_catalog(context.lang, i18ndir) then
- if context.parent then
- tparser.load_catalog(context.parent, i18ndir)
- return context.parent
- end
- end
- return context.lang
-end
-
---- Return the translated value for a specific translation key.
--- @param key Default translation text
--- @return Translated string
-function translate(key)
- return tparser.translate(key) or key
-end
-
---- Return the translated value for a specific translation key and use it as sprintf pattern.
--- @param key Default translation text
--- @param ... Format parameters
--- @return Translated and formatted string
-function translatef(key, ...)
- return tostring(translate(key)):format(...)
-end
-
---- Return the translated value for a specific translation key
--- and ensure that the returned value is a Lua string value.
--- This is the same as calling <code>tostring(translate(...))</code>
--- @param key Default translation text
--- @return Translated string
-function string(key)
- return tostring(translate(key))
-end
-
---- Return the translated value for a specific translation key and use it as sprintf pattern.
--- Ensure that the returned value is a Lua string value.
--- This is the same as calling <code>tostring(translatef(...))</code>
--- @param key Default translation text
--- @param ... Format parameters
--- @return Translated and formatted string
-function stringf(key, ...)
- return tostring(translate(key)):format(...)
-end
+++ /dev/null
---[[
-
-Session authentication
-(c) 2008 Steven Barth <steven@midlink.org>
-
-Licensed under the Apache License, Version 2.0 (the "License");
-you may not use this file except in compliance with the License.
-You may obtain a copy of the License at
-
- http://www.apache.org/licenses/LICENSE-2.0
-
-$Id$
-
-]]--
-
---- LuCI session library.
-module("luci.sauth", package.seeall)
-require("luci.util")
-require("luci.sys")
-require("luci.config")
-local nixio = require "nixio", require "nixio.util"
-local fs = require "nixio.fs"
-
-
-luci.config.sauth = luci.config.sauth or {}
-sessionpath = luci.config.sauth.sessionpath
-sessiontime = tonumber(luci.config.sauth.sessiontime) or 15 * 60
-
---- Prepare session storage by creating the session directory.
-function prepare()
- fs.mkdir(sessionpath, 700)
- if not sane() then
- error("Security Exception: Session path is not sane!")
- end
-end
-
-local function _read(id)
- local blob = fs.readfile(sessionpath .. "/" .. id)
- return blob
-end
-
-local function _write(id, data)
- local f = nixio.open(sessionpath .. "/" .. id, "w", 600)
- f:writeall(data)
- f:close()
-end
-
-local function _checkid(id)
- return not not (id and #id == 32 and id:match("^[a-fA-F0-9]+$"))
-end
-
---- Write session data to a session file.
--- @param id Session identifier
--- @param data Session data table
-function write(id, data)
- if not sane() then
- prepare()
- end
-
- assert(_checkid(id), "Security Exception: Session ID is invalid!")
- assert(type(data) == "table", "Security Exception: Session data invalid!")
-
- data.atime = luci.sys.uptime()
-
- _write(id, luci.util.get_bytecode(data))
-end
-
---- Read a session and return its content.
--- @param id Session identifier
--- @return Session data table or nil if the given id is not found
-function read(id)
- if not id or #id == 0 then
- return nil
- end
-
- assert(_checkid(id), "Security Exception: Session ID is invalid!")
-
- if not sane(sessionpath .. "/" .. id) then
- return nil
- end
-
- local blob = _read(id)
- local func = loadstring(blob)
- setfenv(func, {})
-
- local sess = func()
- assert(type(sess) == "table", "Session data invalid!")
-
- if sess.atime and sess.atime + sessiontime < luci.sys.uptime() then
- kill(id)
- return nil
- end
-
- -- refresh atime in session
- write(id, sess)
-
- return sess
-end
-
---- Check whether Session environment is sane.
--- @return Boolean status
-function sane(file)
- return luci.sys.process.info("uid")
- == fs.stat(file or sessionpath, "uid")
- and fs.stat(file or sessionpath, "modestr")
- == (file and "rw-------" or "rwx------")
-end
-
---- Kills a session
--- @param id Session identifier
-function kill(id)
- assert(_checkid(id), "Security Exception: Session ID is invalid!")
- fs.unlink(sessionpath .. "/" .. id)
-end
-
---- Remove all expired session data files
-function reap()
- if sane() then
- local id
- for id in nixio.fs.dir(sessionpath) do
- if _checkid(id) then
- -- reading the session will kill it if it is expired
- read(id)
- end
- end
- end
-end
+++ /dev/null
---[[
-LuCI - Template Parser
-
-Description:
-A template parser supporting includes, translations, Lua code blocks
-and more. It can be used either as a compiler or as an interpreter.
-
-FileId: $Id$
-
-License:
-Copyright 2008 Steven Barth <steven@midlink.org>
-
-Licensed under the Apache License, Version 2.0 (the "License");
-you may not use this file except in compliance with the License.
-You may obtain a copy of the License at
-
- http://www.apache.org/licenses/LICENSE-2.0
-
-Unless required by applicable law or agreed to in writing, software
-distributed under the License is distributed on an "AS IS" BASIS,
-WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
-See the License for the specific language governing permissions and
-limitations under the License.
-
-]]--
-
-local util = require "luci.util"
-local config = require "luci.config"
-local tparser = require "luci.template.parser"
-
-local tostring, pairs, loadstring = tostring, pairs, loadstring
-local setmetatable, loadfile = setmetatable, loadfile
-local getfenv, setfenv, rawget = getfenv, setfenv, rawget
-local assert, type, error = assert, type, error
-
---- LuCI template library.
-module "luci.template"
-
-config.template = config.template or {}
-viewdir = config.template.viewdir or util.libpath() .. "/view"
-
-
--- Define the namespace for template modules
-context = util.threadlocal()
-
---- Render a certain template.
--- @param name Template name
--- @param scope Scope to assign to template (optional)
-function render(name, scope)
- return Template(name):render(scope or getfenv(2))
-end
-
-
--- Template class
-Template = util.class()
-
--- Shared template cache to store templates in to avoid unnecessary reloading
-Template.cache = setmetatable({}, {__mode = "v"})
-
-
--- Constructor - Reads and compiles the template on-demand
-function Template.__init__(self, name)
-
- self.template = self.cache[name]
- self.name = name
-
- -- Create a new namespace for this template
- self.viewns = context.viewns
-
- -- If we have a cached template, skip compiling and loading
- if not self.template then
-
- -- Compile template
- local err
- local sourcefile = viewdir .. "/" .. name .. ".htm"
-
- self.template, _, err = tparser.parse(sourcefile)
-
- -- If we have no valid template throw error, otherwise cache the template
- if not self.template then
- error("Failed to load template '" .. name .. "'.\n" ..
- "Error while parsing template '" .. sourcefile .. "':\n" ..
- (err or "Unknown syntax error"))
- else
- self.cache[name] = self.template
- end
- end
-end
-
-
--- Renders a template
-function Template.render(self, scope)
- scope = scope or getfenv(2)
-
- -- Put our predefined objects in the scope of the template
- setfenv(self.template, setmetatable({}, {__index =
- function(tbl, key)
- return rawget(tbl, key) or self.viewns[key] or scope[key]
- end}))
-
- -- Now finally render the thing
- local stat, err = util.copcall(self.template)
- if not stat then
- error("Failed to execute template '" .. self.name .. "'.\n" ..
- "A runtime error occured: " .. tostring(err or "(nil)"))
- end
-end
+++ /dev/null
-<% export("cbi_apply_xhr", function(id, configs, redirect) -%>
-<fieldset class="cbi-section" id="cbi-apply-<%=id%>">
- <legend><%:Applying changes%></legend>
- <script type="text/javascript">//<![CDATA[
- var apply_xhr = new XHR();
-
- apply_xhr.get('<%=luci.dispatcher.build_url("servicectl", "restart", table.concat(configs, ","))%>', null,
- function() {
- var checkfinish = function() {
- apply_xhr.get('<%=luci.dispatcher.build_url("servicectl", "status")%>', null,
- function(x) {
- if( x.responseText == 'finish' )
- {
- var e = document.getElementById('cbi-apply-<%=id%>-status');
- if( e )
- {
- e.innerHTML = '<%:Configuration applied.%>';
- window.setTimeout(function() {
- e.parentNode.style.display = 'none';
- <% if redirect then %>location.href='<%=redirect%>';<% end %>
- }, 1000);
- }
- }
- else
- {
- var e = document.getElementById('cbi-apply-<%=id%>-status');
- if( e && x.responseText ) e.innerHTML = x.responseText;
-
- window.setTimeout(checkfinish, 1000);
- }
- }
- );
- }
-
- window.setTimeout(checkfinish, 1000);
- }
- );
- //]]></script>
-
- <img src="<%=resource%>/icons/loading.gif" alt="<%:Loading%>" style="vertical-align:middle" />
- <span id="cbi-apply-<%=id%>-status"><%:Waiting for changes to be applied...%></span>
-</fieldset>
-<%- end) %>
+++ /dev/null
-<% local v = self:cfgvalue(section) -%>
-<%+cbi/valueheader%>
- <input class="cbi-input-text" type="text"<%= attr("value", v) .. attr("name", cbid) .. attr("id", cbid) %> />
- <script type="text/javascript">
-cbi_browser_init('<%=cbid%>', '<%=resource%>', '<%=luci.dispatcher.build_url("admin", "filebrowser")%>'<%=self.default_path and ", '"..self.default_path.."'"%>);
- </script>
-<%+cbi/valuefooter%>
+++ /dev/null
-<%+cbi/valueheader%>
- <% if self:cfgvalue(section) ~= false then %>
- <input class="cbi-button cbi-input-<%=self.inputstyle or "button" %>" type="submit"<%= attr("name", cbid) .. attr("id", cbid) .. attr("value", self.inputtitle or self.title)%> />
- <% else %>
- -
- <% end %>
-<%+cbi/valuefooter%>
+++ /dev/null
-</div>
-<div id="cbip-<%=self.config.."-"..section.."-"..self.option%>"></div>
-</td>
-
-<% if #self.deps > 0 then -%>
- <script type="text/javascript">
- <% for j, d in ipairs(self.deps) do -%>
- cbi_d_add("cbi-<%=self.config.."-"..section.."-"..self.option..d.add%>", {
- <%-
- for k,v in pairs(d.deps) do
- -%>
- <%-=string.format('"cbid.%s.%s.%s"', self.config, section, k) .. ":" .. string.format("%q", v)-%>
- <%-if next(d.deps, k) then-%>,<%-end-%>
- <%-
- end
- -%>
- }, "cbip-<%=self.config.."-"..section.."-"..self.option%>");
- <%- end %>
- </script>
-<%- end %>
+++ /dev/null
-<td class="cbi-value-field<% if self.error and self.error[section] then %> cbi-value-error<% end %>">
-<div id="cbi-<%=self.config.."-"..section.."-"..self.option%>">
+++ /dev/null
-<%- self:render_children() %>
+++ /dev/null
-<%- self.active:render() %>
- <div class="cbi-page-actions">
- <input type="hidden" name="cbi.delg.current" value="<%=self.current%>" />
-<% for _, x in ipairs(self.chain) do %>
- <input type="hidden" name="cbi.delg.path" value="<%=x%>" />
-<% end %>
-<% if not self.disallow_pageactions then %>
-<% if self.allow_finish and not self:get_next(self.current) then %>
- <input class="cbi-button cbi-button-finish" type="submit" value="<%:Finish%>" />
-<% elseif self:get_next(self.current) then %>
- <input class="cbi-button cbi-button-next" type="submit" value="<%:Next »%>" />
-<% end %>
-<% if self.allow_cancel then %>
- <input class="cbi-button cbi-button-cancel" type="submit" name="cbi.cancel" value="<%:Cancel%>" />
-<% end %>
-<% if self.allow_reset then %>
- <input class="cbi-button cbi-button-reset" type="reset" value="<%:Reset%>" />
-<% end %>
-<% if self.allow_back and self:get_prev(self.current) then %>
- <input class="cbi-button cbi-button-back" type="submit" name="cbi.delg.back" value="<%:« Back%>" />
-<% end %>
-<% end %>
- <script type="text/javascript">cbi_d_update();</script>
- </div>
+++ /dev/null
-<%+cbi/valueheader%>
-<% if self.href then %><a href="<%=self.href%>"><% end -%>
- <%
- local val = self:cfgvalue(section) or self.default or ""
- if not self.rawhtml then
- write(pcdata(val))
- else
- write(val)
- end
- %>
-<%- if self.href then %></a><%end%>
-<input type="hidden" id="<%=cbid%>" value="<%=pcdata(self:cfgvalue(section) or self.default or "")%>" />
-<%+cbi/valuefooter%>
+++ /dev/null
-<%+cbi/valueheader%>
-<div>
-<%
- local vals = self:cfgvalue(section) or {}
- for i=1, #vals + 1 do
- local val = vals[i]
- if (val and #val > 0) or (i == 1) then
-%>
- <input class="cbi-input-text" value="<%=pcdata(val)%>" onchange="cbi_d_update(this.id)" type="text"<%=
- attr("id", cbid .. "." .. i) .. attr("name", cbid) .. ifattr(self.size, "size") ..
- ifattr(i == 1 and self.placeholder, "placeholder", self.placeholder)
- %> /><br />
-<% end end %>
-</div>
-<script type="text/javascript">
-cbi_dynlist_init(
- '<%=cbid%>', '<%=resource%>', '<%=self.datatype%>',
- <%=tostring(self.optional or self.rmempty)%>
- <%- if #self.keylist > 0 then -%>, [{
- <%- for i, k in ipairs(self.keylist) do -%>
- <%-=string.format("%q", k) .. ":" .. string.format("%q", self.vallist[i])-%>
- <%-if i<#self.keylist then-%>,<%-end-%>
- <%- end -%>
- }, '<%: -- custom -- %>']<% end -%>);
-</script>
-<%+cbi/valuefooter%>
+++ /dev/null
-<?xml version="1.0" encoding="UTF-8"?>
-<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Strict//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-strict.dtd">
-<html xmlns="http://www.w3.org/1999/xhtml" xml:lang="en" lang="en">
-<head>
- <title>Filebrowser - LuCI</title>
- <style type="text/css">
- #path, #listing {
- font-size: 85%;
- }
-
- ul {
- padding-left: 0;
- list-style-type: none;
- }
-
- li img {
- vertical-align: bottom;
- margin-right: 0.2em;
- }
- </style>
-
- <script type="text/javascript">
- function callback(path) {
- if( window.opener ) {
- var input = window.opener.document.getElementById('<%=luci.http.formvalue('field')%>');
- if( input ) {
- input.value = path;
- window.close();
- }
- }
- }
- </script>
-</head>
-<body>
- <%
- require("nixio.fs")
- require("nixio.util")
- require("luci.http")
- require("luci.dispatcher")
-
- local field = luci.http.formvalue('field')
- local request = luci.dispatcher.context.args
- local path = { '' }
-
- for i = 1, #request do
- if request[i] ~= '..' and #request[i] > 0 then
- path[#path+1] = request[i]
- end
- end
-
- local filepath = table.concat( path, '/' )
- local filestat = nixio.fs.stat( filepath )
- local baseurl = luci.dispatcher.build_url('admin', 'filebrowser')
-
- if filestat and filestat.type == "reg" then
- table.remove( path, #path )
- filepath = table.concat( path, '/' ) .. '/'
- elseif not ( filestat and filestat.type == "dir" ) then
- path = { '' }
- filepath = '/'
- else
- filepath = filepath .. '/'
- end
-
- local entries = nixio.util.consume((nixio.fs.dir(filepath)))
- -%>
- <div id="path">
- Location:
- <% for i, dir in ipairs(path) do %>
- <% if i == 1 then %>
- <a href="<%=baseurl%>?field=<%=field%>">(root)</a>
- <% elseif next(path, i) then %>
- <% baseurl = baseurl .. '/' .. dir %>
- / <a href="<%=baseurl%>?field=<%=field%>"><%=dir%></a>
- <% else %>
- <% baseurl = baseurl .. '/' .. dir %>
- / <%=dir%>
- <% end %>
- <% end %>
- </div>
-
- <hr />
-
- <div id="listing">
- <ul>
- <% for _, e in luci.util.vspairs(entries) do
- local stat = nixio.fs.stat(filepath..e)
- if stat and stat.type == 'dir' then
- -%>
- <li class="dir">
- <img src="<%=resource%>/cbi/folder.gif" alt="<%:Directory%>" />
- <a href="<%=baseurl%>/<%=e%>?field=<%=field%>"><%=e%>/</a>
- </li>
- <% end end -%>
-
- <% for _, e in luci.util.vspairs(entries) do
- local stat = nixio.fs.stat(filepath..e)
- if stat and stat.type ~= 'dir' then
- -%>
- <li class="file">
- <img src="<%=resource%>/cbi/file.gif" alt="<%:File%>" />
- <a href="#" onclick="callback('<%=filepath..e%>')"><%=e%></a>
- </li>
- <% end end -%>
- </ul>
- </div>
-</body>
-</html>
+++ /dev/null
-<%+cbi/valueheader%>
-
-<%-
- local utl = require "luci.util"
- local fwm = require "luci.model.firewall".init()
- local nwm = require "luci.model.network".init()
-
- local zone, fwd, fz
- local value = self:formvalue(section)
- if not value or value == "-" then
- value = self:cfgvalue(section) or self.default
- end
-
- local def = fwm:get_defaults()
- local zone = fwm:get_zone(value)
- local empty = true
--%>
-
-<% if zone then %>
-<div style="white-space:nowrap">
- <label class="zonebadge" style="background-color:<%=zone:get_color()%>">
- <strong><%=zone:name()%>:</strong>
- <%-
- local zempty = true
- for _, net in ipairs(zone:get_networks()) do
- net = nwm:get_network(net)
- if net then
- zempty = false
- -%>
- <span class="ifacebadge<% if net:name() == self.network then %> ifacebadge-active<% end %>"><%=net:name()%>:
- <%
- local nempty = true
- for _, iface in ipairs(net:is_bridge() and net:get_interfaces() or { net:get_interface() }) do
- nempty = false
- %>
- <img<%=attr("title", iface:get_i18n())%> style="width:16px; height:16px; vertical-align:middle" src="<%=resource%>/icons/<%=iface:type()%><%=iface:is_up() and "" or "_disabled"%>.png" />
- <% end %>
- <% if nempty then %><em><%:(empty)%></em><% end %>
- </span>
- <%- end end -%>
- <%- if zempty then %><em><%:(empty)%></em><% end -%>
- </label>
-  ⇒ 
- <% for _, fwd in ipairs(zone:get_forwardings_by("src")) do
- fz = fwd:dest_zone()
- empty = false %>
- <label class="zonebadge" style="background-color:<%=fz:get_color()%>">
- <strong><%=fz:name()%></strong>
- </label> 
- <% end %>
- <% if empty then %>
- <label class="zonebadge zonebadge-empty">
- <strong><%=zone:forward():upper()%></strong>
- </label>
- <% end %>
-</div>
-<% end %>
-
-<%+cbi/valuefooter%>
+++ /dev/null
-<%+cbi/valueheader%>
-
-<%-
- local utl = require "luci.util"
- local fwm = require "luci.model.firewall".init()
- local nwm = require "luci.model.network".init()
-
- local zone, net, iface
- local zones = fwm:get_zones()
- local value = self:formvalue(section)
- if not value or value == "-" then
- value = self:cfgvalue(section) or self.default
- end
-
- local selected = false
- local checked = { }
-
- for value in utl.imatch(value) do
- checked[value] = true
- end
-
- if not next(checked) then
- checked[""] = true
- end
--%>
-
-<ul style="margin:0; list-style-type:none; text-align:left">
- <% if self.allowlocal then %>
- <li style="padding:0.5em">
- <input class="cbi-input-radio" onclick="cbi_d_update(this.id)" onchange="cbi_d_update(this.id)"<%=attr("type", self.widget or "radio") .. attr("id", cbid .. "_empty") .. attr("name", cbid) .. attr("value", "") .. ifattr(checked[""], "checked", "checked")%> />  
- <label<%=attr("for", cbid .. "_empty")%> style="background-color:<%=fwm.zone.get_color()%>" class="zonebadge">
- <strong><%:Device%></strong>
- <% if self.allowany and self.allowlocal then %>(<%:input%>)<% end %>
- </label>
- </li>
- <% end %>
- <% if self.allowany then %>
- <li style="padding:0.5em">
- <input class="cbi-input-radio" onclick="cbi_d_update(this.id)" onchange="cbi_d_update(this.id)"<%=attr("type", self.widget or "radio") .. attr("id", cbid .. "_any") .. attr("name", cbid) .. attr("value", "*") .. ifattr(checked["*"], "checked", "checked")%> />  
- <label<%=attr("for", cbid .. "_any")%> style="background-color:<%=fwm.zone.get_color()%>" class="zonebadge">
- <strong><%:Any zone%></strong>
- <% if self.allowany and self.allowlocal then %>(<%:forward%>)<% end %>
- </label>
- </li>
- <% end %>
- <%
- for _, zone in utl.spairs(zones, function(a,b) return (zones[a]:name() < zones[b]:name()) end) do
- if zone:name() ~= self.exclude then
- selected = selected or (value == zone:name())
- %>
- <li style="padding:0.5em">
- <input class="cbi-input-radio" onclick="cbi_d_update(this.id)" onchange="cbi_d_update(this.id)"<%=attr("type", self.widget or "radio") .. attr("id", cbid .. "." .. zone:name()) .. attr("name", cbid) .. attr("value", zone:name()) .. ifattr(checked[zone:name()], "checked", "checked")%> />  
- <label<%=attr("for", cbid .. "." .. zone:name())%> style="background-color:<%=zone:get_color()%>" class="zonebadge">
- <strong><%=zone:name()%>:</strong>
- <%
- local zempty = true
- for _, net in ipairs(zone:get_networks()) do
- net = nwm:get_network(net)
- if net then
- zempty = false
- %>
- <span class="ifacebadge<% if net:name() == self.network then %> ifacebadge-active<% end %>"><%=net:name()%>:
- <%
- local nempty = true
- for _, iface in ipairs(net:is_bridge() and net:get_interfaces() or { net:get_interface() }) do
- nempty = false
- %>
- <img<%=attr("title", iface:get_i18n())%> style="width:16px; height:16px; vertical-align:middle" src="<%=resource%>/icons/<%=iface:type()%><%=iface:is_up() and "" or "_disabled"%>.png" />
- <% end %>
- <% if nempty then %><em><%:(empty)%></em><% end %>
- </span>
- <% end end %>
- <% if zempty then %><em><%:(empty)%></em><% end %>
- </label>
- </li>
- <% end end %>
-
- <% if self.widget ~= "checkbox" and not self.nocreate then %>
- <li style="padding:0.5em">
- <input class="cbi-input-radio" onclick="cbi_d_update(this.id)" onchange="cbi_d_update(this.id)" type="radio"<%=attr("id", cbid .. "_new") .. attr("name", cbid) .. attr("value", "-") .. ifattr(not selected, "checked", "checked")%> />  
- <div onclick="document.getElementById('<%=cbid%>_new').checked=true" class="zonebadge" style="background-color:<%=fwm.zone.get_color()%>">
- <em><%:unspecified -or- create:%> </em>
- <input type="text"<%=attr("name", cbid .. ".newzone") .. ifattr(not selected, "value", luci.http.formvalue(cbid .. ".newzone") or self.default)%> onfocus="document.getElementById('<%=cbid%>_new').checked=true" />
- </div>
- </li>
- <% end %>
-</ul>
-
-<%+cbi/valuefooter%>
+++ /dev/null
- <%- if pageaction then -%>
- <div class="cbi-page-actions">
- <% if redirect then %>
- <div style="float:left">
- <input class="cbi-button cbi-button-link" type="button" value="<%:Back to Overview%>" onclick="location.href='<%=pcdata(redirect)%>'" />
- </div>
- <% end %>
-
- <% if flow.skip then %>
- <input class="cbi-button cbi-button-skip" type="submit" name="cbi.skip" value="<%:Skip%>" />
- <% end %>
- <% if not autoapply and not flow.hideapplybtn then %>
- <input class="cbi-button cbi-button-apply" type="submit" name="cbi.apply" value="<%:Save & Apply%>" />
- <% end %>
- <% if not flow.hidesavebtn then %>
- <input class="cbi-button cbi-button-save" type="submit" value="<%:Save%>" />
- <% end %>
- <% if not flow.hideresetbtn then %>
- <input class="cbi-button cbi-button-reset" type="reset" value="<%:Reset%>" />
- <% end %>
-
- <script type="text/javascript">cbi_d_update();</script>
- </div>
- <%- end -%>
-</form>
-<%+footer%>
+++ /dev/null
- <% if self.description and #self.description > 0 then -%>
- <% if not luci.util.instanceof(self, luci.cbi.DynamicList) and (not luci.util.instanceof(self, luci.cbi.Flag) or self.orientation == "horizontal") then -%>
- <br />
- <%- end %>
- <div class="cbi-value-description">
- <span class="cbi-value-helpicon"><img src="<%=resource%>/cbi/help.gif" alt="<%:help%>" /></span>
- <%=self.description%>
- </div>
- <%- end %>
- <%- if self.title and #self.title > 0 then -%>
- </div>
- <%- end -%>
-</div>
-
-
-<% if #self.deps > 0 or #self.subdeps > 0 then -%>
- <script type="text/javascript" id="cbip-<%=self.config.."-"..section.."-"..self.option%>">
- <% for j, d in ipairs(self.subdeps) do -%>
- cbi_d_add("cbi-<%=self.config.."-"..section.."-"..self.option..d.add%>", {
- <%-
- for k,v in pairs(d.deps) do
- local depk
- if k:find("!", 1, true) then
- depk = string.format('"%s"', k)
- elseif k:find(".", 1, true) then
- depk = string.format('"cbid.%s"', k)
- else
- depk = string.format('"cbid.%s.%s.%s"', self.config, section, k)
- end
- -%>
- <%-= depk .. ":" .. string.format("%q", v)-%>
- <%-if next(d.deps, k) then-%>,<%-end-%>
- <%-
- end
- -%>
- }, "cbip-<%=self.config.."-"..section.."-"..self.option..d.add%>");
- <%- end %>
- <% for j, d in ipairs(self.deps) do -%>
- cbi_d_add("cbi-<%=self.config.."-"..section.."-"..self.option..d.add%>", {
- <%-
- for k,v in pairs(d.deps) do
- local depk
- if k:find("!", 1, true) then
- depk = string.format('"%s"', k)
- elseif k:find(".", 1, true) then
- depk = string.format('"cbid.%s"', k)
- else
- depk = string.format('"cbid.%s.%s.%s"', self.config, section, k)
- end
- -%>
- <%-= depk .. ":" .. string.format("%q", v)-%>
- <%-if next(d.deps, k) then-%>,<%-end-%>
- <%-
- end
- -%>
- }, "cbip-<%=self.config.."-"..section.."-"..self.option..d.add%>");
- <%- end %>
- </script>
-<%- end %>
+++ /dev/null
-<div class="cbi-value<% if self.error and self.error[section] then %> cbi-value-error<% end %><% if self.last_child then %> cbi-value-last<% end %>" id="cbi-<%=self.config.."-"..section.."-"..self.option%>">
- <%- if self.title and #self.title > 0 then -%>
- <label class="cbi-value-title"<%= attr("for", cbid) %>>
- <%- if self.titleref then -%><a title="<%=self.titledesc or translate('Go to relevant configuration page')%>" class="cbi-title-ref" href="<%=self.titleref%>"><%- end -%>
- <%-=self.title-%>
- <%- if self.titleref then -%></a><%- end -%>
- </label>
- <div class="cbi-value-field">
- <%- end -%>
+++ /dev/null
-<%+cbi/valueheader%>
- <input type="hidden" value="1"<%=
- attr("name", "cbi.cbe." .. self.config .. "." .. section .. "." .. self.option)
- %> />
- <input class="cbi-input-checkbox" onclick="cbi_d_update(this.id)" onchange="cbi_d_update(this.id)" type="checkbox"<%=
- attr("id", cbid) .. attr("name", cbid) .. attr("value", self.enabled or 1) ..
- ifattr((self:cfgvalue(section) or self.default) == self.enabled, "checked", "checked")
- %> />
-<%+cbi/valuefooter%>
+++ /dev/null
-<%+header%>
-<form method="post" name="cbi" action="<%=REQUEST_URI%>" enctype="multipart/form-data" onreset="return cbi_validate_reset(this)" onsubmit="return cbi_validate_form(this, '<%:Some fields are invalid, cannot save values!%>')">
- <div>
- <script type="text/javascript" src="<%=resource%>/cbi.js"></script>
- <input type="hidden" name="cbi.submit" value="1" />
- <input type="submit" value="<%:Save%>" class="hidden" />
- </div>
+++ /dev/null
-<%+cbi/valueheader%>
-<% if self.widget == "select" then %>
- <select class="cbi-input-select" onchange="cbi_d_update(this.id)"<%= attr("id", cbid) .. attr("name", cbid) .. ifattr(self.size, "size") %>>
- <% for i, key in pairs(self.keylist) do -%>
- <option id="cbi-<%=self.config.."-"..section.."-"..self.option.."-"..key%>"<%= attr("value", key) .. ifattr(tostring(self:cfgvalue(section) or self.default) == key, "selected", "selected") %>><%=striptags(self.vallist[i])%></option>
- <%- end %>
- </select>
-<% elseif self.widget == "radio" then
- local c = 0
- for i, key in pairs(self.keylist) do
- c = c + 1
-%>
- <input class="cbi-input-radio" onclick="cbi_d_update(this.id)" onchange="cbi_d_update(this.id)" type="radio"<%= attr("id", cbid..c) .. attr("name", cbid) .. attr("value", key) .. ifattr((self:cfgvalue(section) or self.default) == key, "checked", "checked") %> />
- <label<%= attr("for", cbid..c) %>><%=self.vallist[i]%></label>
-<% if c == self.size then c = 0 %><% if self.orientation == "horizontal" then %> <% else %><br /><% end %>
-<% end end %>
-<% end %>
-<%+cbi/valuefooter%>
+++ /dev/null
-<%- if firstmap and messages then local msg; for _, msg in ipairs(messages) do -%>
- <div class="errorbox"><%=pcdata(msg)%></div>
-<%- end end -%>
-
-<%-+cbi/apply_xhr-%>
-
-<div class="cbi-map" id="cbi-<%=self.config%>">
- <% if self.title and #self.title > 0 then %><h2><a id="content" name="content"><%=self.title%></a></h2><% end %>
- <% if self.description and #self.description > 0 then %><div class="cbi-map-descr"><%=self.description%></div><% end %>
- <%- if firstmap and applymap then cbi_apply_xhr(self.config, parsechain, redirect) end -%>
- <%- self:render_children() %>
- <br />
-</div>
+++ /dev/null
-<% local v = self:valuelist(section) or {} -%>
-<%+cbi/valueheader%>
-<% if self.widget == "select" then %>
- <select class="cbi-input-select" multiple="multiple" onclick="cbi_d_update(this.id)" onchange="cbi_d_update(this.id)"<%= attr("name", cbid) .. ifattr(self.size, "size") %>>
- <% for i, key in pairs(self.keylist) do -%>
- <option<%= attr("value", key) .. ifattr(luci.util.contains(v, key), "selected", "selected") %>><%=striptags(self.vallist[i])%></option>
- <%- end %>
- </select>
-<% elseif self.widget == "checkbox" then
- local c = 0;
- for i, key in pairs(self.keylist) do
- c = c + 1
-%>
- <input class="cbi-input-checkbox" type="checkbox" onclick="cbi_d_update(this.id)" onchange="cbi_d_update(this.id)"<%= attr("id", cbid..c) .. attr("name", cbid) .. attr("value", key) .. ifattr(luci.util.contains(v, key), "checked", "checked") %> />
- <label<%= attr("for", cbid..c) %>><%=self.vallist[i]%></label><br />
-<% if c == self.size then c = 0 %><br />
-<% end end %>
-<% end %>
-<%+cbi/valuefooter%>
+++ /dev/null
-<%+cbi/valueheader%>
-
-<%-
- local utl = require "luci.util"
- local net = require "luci.model.network".init()
- local cbeid = luci.cbi.FEXIST_PREFIX .. self.config .. "." .. section .. "." .. self.option
-
- local iface
- local ifaces = net:get_interfaces()
- local value
-
- if self.map:formvalue(cbeid) == "1" then
- value = self:formvalue(section) or self.default or ""
- else
- value = self:cfgvalue(section) or self.default
- end
-
- local checked = { }
-
- if value then
- for value in utl.imatch(value) do
- checked[value] = true
- end
- else
- local n = self.network and net:get_network(self.network)
- if n then
- local i
- for _, i in ipairs(n:get_interfaces() or { n:get_interface() }) do
- checked[i:name()] = true
- end
- end
- end
--%>
-
-<input type="hidden" name="<%=cbeid%>" value="1" />
-<ul style="margin:0; list-style-type:none">
- <% for _, iface in ipairs(ifaces) do
- local link = iface:adminlink()
- if (not self.nobridges or not iface:is_bridge()) and
- (not self.noinactive or iface:is_up()) and
- iface:name() ~= self.exclude
- then %>
- <li>
- <input class="cbi-input-<%=self.widget or "radio"%>" onclick="cbi_d_update(this.id)" onchange="cbi_d_update(this.id)"<%=
- attr("type", self.widget or "radio") ..
- attr("id", cbid .. "." .. iface:name()) ..
- attr("name", cbid) .. attr("value", iface:name()) ..
- ifattr(checked[iface:name()], "checked", "checked")
- %> />  
- <label<%=attr("for", cbid .. "." .. iface:name())%>>
- <% if link then -%><a href="<%=link%>"><% end -%>
- <img<%=attr("title", iface:get_i18n())%> style="width:16px; height:16px; vertical-align:middle" src="<%=resource%>/icons/<%=iface:type()%><%=iface:is_up() and "" or "_disabled"%>.png" />
- <% if link then -%></a><% end -%>
- <%=pcdata(iface:get_i18n())%>
- <% local ns = iface:get_networks(); if #ns > 0 then %>(
- <%- local i, n; for i, n in ipairs(ns) do -%>
- <%-= (i>1) and ', ' -%>
- <a href="<%=n:adminlink()%>"><%=n:name()%></a>
- <%- end -%>
- )<% end %>
- </label>
- </li>
- <% end end %>
- <% if not self.nocreate then %>
- <li>
- <input class="cbi-input-<%=self.widget or "radio"%>" onclick="cbi_d_update(this.id)" onchange="cbi_d_update(this.id)"<%=
- attr("type", self.widget or "radio") ..
- attr("id", cbid .. "_custom") ..
- attr("name", cbid) ..
- attr("value", " ")
- %> />  
- <label<%=attr("for", cbid .. "_custom")%>>
- <img title="<%:Custom Interface%>" style="width:16px; height:16px; vertical-align:middle" src="<%=resource%>/icons/ethernet_disabled.png" />
- <%:Custom Interface%>:
- </label>
- <input type="text" style="width:50px" onfocus="document.getElementById('<%=cbid%>_custom').checked=true" onblur="var x=document.getElementById('<%=cbid%>_custom'); x.value=this.value; x.checked=true" />
- </li>
- <% end %>
-</ul>
-
-<%+cbi/valuefooter%>
+++ /dev/null
-<%+cbi/valueheader%>
-
-<%-
- local value = self:formvalue(section)
- if not value or value == "-" then
- value = self:cfgvalue(section) or self.default
- end
-
- local nwm = require "luci.model.network".init()
- local net = nwm:get_network(value)
--%>
-
-<% if net then %>
-<span class="ifacebadge"><%=net:name()%>:
- <%
- local empty = true
- for _, iface in ipairs(net:get_interfaces() or { net:get_interface() }) do
- if not iface:is_bridge() then
- empty = false
- %>
- <img<%=attr("title", iface:get_i18n())%> style="width:16px; height:16px; vertical-align:middle" src="<%=resource%>/icons/<%=iface:type()%><%=iface:is_up() and "" or "_disabled"%>.png" />
- <% end end %>
- <% if empty then %><em><%:(no interfaces attached)%></em><% end %>
-</span>
-<% end %>
-
-<%+cbi/valuefooter%>
+++ /dev/null
-<%+cbi/valueheader%>
-
-<%-
- local utl = require "luci.util"
- local nwm = require "luci.model.network".init()
-
- local net, iface
- local networks = nwm:get_networks()
- local value = self:formvalue(section)
-
- self.cast = nil
-
- if not value or value == "-" then
- value = self:cfgvalue(section) or self.default
- end
-
- local checked = { }
- for value in utl.imatch(value) do
- checked[value] = true
- end
--%>
-
-<ul style="margin:0; list-style-type:none; text-align:left">
- <% for _, net in ipairs(networks) do
- if (net:name() ~= "loopback") and
- (net:name() ~= self.exclude) and
- (not self.novirtual or not net:is_virtual())
- then %>
- <li style="padding:0.25em 0">
- <input class="cbi-input-<%=self.widget or "radio"%>" onclick="cbi_d_update(this.id)" onchange="cbi_d_update(this.id)"<%=
- attr("type", self.widget or "radio") ..
- attr("id", cbid .. "." .. net:name()) ..
- attr("name", cbid) .. attr("value", net:name()) ..
- ifattr(checked[net:name()], "checked", "checked")
- %> />  
- <label<%=attr("for", cbid .. "." .. net:name())%>>
- <span class="ifacebadge"><%=net:name()%>:
- <%
- local empty = true
- for _, iface in ipairs(net:is_bridge() and net:get_interfaces() or { net:get_interface() }) do
- if not iface:is_bridge() then
- empty = false
- %>
- <img<%=attr("title", iface:get_i18n())%> style="width:16px; height:16px; vertical-align:middle" src="<%=resource%>/icons/<%=iface:type()%><%=iface:is_up() and "" or "_disabled"%>.png" />
- <% end end %>
- <% if empty then %><em><%:(no interfaces attached)%></em><% end %>
- </span>
- </label>
- </li>
- <% end end %>
-
- <% if not self.nocreate then %>
- <li style="padding:0.25em 0">
- <input class="cbi-input-<%=self.widget or "radio"%>" onclick="cbi_d_update(this.id)" onchange="cbi_d_update(this.id)"<%=attr("type", self.widget or "radio") .. attr("id", cbid .. "_new") .. attr("name", cbid) .. attr("value", "-") .. ifattr(not value and self.widget ~= "checkbox", "checked", "checked")%> />  
- <div style="padding:0.5em; display:inline">
- <label<%=attr("for", cbid .. "_new")%>><em>
- <%- if self.widget == "checkbox" then -%>
- <%:create:%>
- <%- else -%>
- <%:unspecified -or- create:%>
- <%- end -%> </em></label>
- <input style="width:6em" type="text"<%=attr("name", cbid .. ".newnet")%> onfocus="document.getElementById('<%=cbid%>_new').checked=true" />
- </div>
- </li>
- <% elseif self.widget ~= "checkbox" and self.unspecified then %>
- <li style="padding:0.25em 0">
- <input class="cbi-input-<%=self.widget or "radio"%>" onclick="cbi_d_update(this.id)" onchange="cbi_d_update(this.id)"<%=
- attr("type", self.widget or "radio") ..
- attr("id", cbid .. "_uns") ..
- attr("name", cbid) ..
- attr("value", "") ..
- ifattr(not value or #value == 0, "checked", "checked")
- %> />  
- <div style="padding:0.5em; display:inline">
- <label<%=attr("for", cbid .. "_uns")%>><em><%:unspecified%></em></label>
- </div>
- </li>
- <% end %>
-</ul>
-
-<%+cbi/valuefooter%>
+++ /dev/null
-<% if self:cfgvalue(self.section) then section = self.section %>
- <fieldset class="cbi-section" id="cbi-<%=self.config%>-<%=section%>">
- <% if self.title and #self.title > 0 then -%>
- <legend><%=self.title%></legend>
- <%- end %>
- <% if self.description and #self.description > 0 then -%>
- <div class="cbi-section-descr"><%=self.description%></div>
- <%- end %>
- <% if self.addremove then -%>
- <div class="cbi-section-remove right">
- <input type="submit" name="cbi.rns.<%=self.config%>.<%=section%>" value="<%:Delete%>" />
- </div>
- <%- end %>
- <%+cbi/tabmenu%>
- <div class="cbi-section-node<% if self.tabs then %> cbi-section-node-tabbed<% end %>" id="cbi-<%=self.config%>-<%=section%>">
- <%+cbi/ucisection%>
- </div>
- <br />
- </fieldset>
-<% elseif self.addremove then %>
- <% if self.template_addremove then include(self.template_addremove) else -%>
- <fieldset class="cbi-section" id="cbi-<%=self.config%>-<%=self.section%>">
- <% if self.title and #self.title > 0 then -%>
- <legend><%=self.title%></legend>
- <%- end %>
- <div class="cbi-section-descr"><%=self.description%></div>
- <input type="submit" class="cbi-button-add" name="cbi.cns.<%=self.config%>.<%=self.section%>" value="<%:Add%>" />
- </fieldset>
- <%- end %>
-<% end %>
-<!-- /nsection -->
+++ /dev/null
-<fieldset class="cbi-section">
- <% if self.title and #self.title > 0 then -%>
- <legend><%=self.title%></legend>
- <%- end %>
- <% if self.description and #self.description > 0 then -%>
- <div class="cbi-section-descr"><%=self.description%></div>
- <%- end %>
- <div class="cbi-section-node" id="cbi-<%=self.config%>-<%=tostring(self):sub(8)%>">
- <div>
- <% self:render_children(1, scope or {}) %>
- </div>
- <% if self.error and self.error[1] then -%>
- <div class="cbi-section-error">
- <ul><% for _, e in ipairs(self.error[1]) do -%>
- <li>
- <%- if e == "invalid" then -%>
- <%:One or more fields contain invalid values!%>
- <%- elseif e == "missing" then -%>
- <%:One or more required fields have no value!%>
- <%- else -%>
- <%=pcdata(e)%>
- <%- end -%>
- </li>
- <%- end %></ul>
- </div>
- <%- end %>
- </div>
- <br />
-</fieldset>
-<%-
- if type(self.hidden) == "table" then
- for k, v in pairs(self.hidden) do
--%>
- <input type="hidden" id="<%=k%>" name="<%=k%>" value="<%=pcdata(v)%>" />
-<%-
- end
- end
-%>
+++ /dev/null
-<% if not self.embedded then %>
-<form method="post" enctype="multipart/form-data" action="<%=REQUEST_URI%>">
- <div>
- <script type="text/javascript" src="<%=resource%>/cbi.js"></script>
- <input type="hidden" name="cbi.submit" value="1" />
- </div>
-<% end %>
- <div class="cbi-map" id="cbi-<%=self.config%>">
- <% if self.title and #self.title > 0 then %><h2><a id="content" name="content"><%=self.title%></a></h2><% end %>
- <% if self.description and #self.description > 0 then %><div class="cbi-map-descr"><%=self.description%></div><% end %>
- <% self:render_children() %>
- <br />
- </div>
-<%- if self.message then %>
- <div><%=self.message%></div>
-<%- end %>
-<%- if self.errmessage then %>
- <div class="error"><%=self.errmessage%></div>
-<%- end %>
-<% if not self.embedded then %>
- <div class="cbi-page-actions">
-<%-
- if type(self.hidden) == "table" then
- for k, v in pairs(self.hidden) do
--%>
- <input type="hidden" id="<%=k%>" name="<%=k%>" value="<%=pcdata(v)%>" />
-<%-
- end
- end
-%>
-<% if redirect then %>
- <div style="float:left">
- <input class="cbi-button cbi-button-link" type="button" value="<%:Back to Overview%>" onclick="location.href='<%=pcdata(redirect)%>'" />
- </div>
-<% end %>
-<%- if self.flow and self.flow.skip then %>
- <input class="cbi-button cbi-button-skip" type="submit" name="cbi.skip" value="<%:Skip%>" />
-<% end %>
-<%- if self.submit ~= false then %>
- <input class="cbi-button cbi-button-save" type="submit" value="
- <%- if not self.submit then -%><%-:Submit-%><%-else-%><%=self.submit%><%end-%>
- " />
-<% end %>
-<%- if self.reset ~= false then %>
- <input class="cbi-button cbi-button-reset" type="reset" value="
- <%- if not self.reset then -%><%-:Reset-%><%-else-%><%=self.reset%><%end-%>
- " />
-<% end %>
-<%- if self.cancel ~= false and self.on_cancel then %>
- <input class="cbi-button cbi-button-reset" type="submit" name="cbi.cancel" value="
- <%- if not self.cancel then -%><%-:Cancel-%><%-else-%><%=self.cancel%><%end-%>
- " />
-<% end %>
- <script type="text/javascript">cbi_d_update();</script>
- </div>
-</form>
-<% end %>
+++ /dev/null
-<% for tab, data in pairs(self.tabs) do %>
- <div class="cbi-tabcontainer" id="container.<%=self.config%>.<%=section%>.<%=tab%>"<% if tab ~= self.selected_tab then %> style="display:none"<% end %>>
- <% if data.description then %><div class="cbi-tab-descr"><%=data.description%></div><% end %>
- <% self:render_tab(tab, section, scope or {}) %>
- </div>
- <script type="text/javascript">cbi_t_add('<%=self.config%>.<%=section%>', '<%=tab%>')</script>
-<% end %>
+++ /dev/null
-<%- if self.tabs then %>
- <ul class="cbi-tabmenu">
- <%- self.selected_tab = luci.http.formvalue("tab." .. self.config .. "." .. section) %>
- <%- for _, tab in ipairs(self.tab_names) do if #self.tabs[tab].childs > 0 then %>
- <script type="text/javascript">cbi_c['container.<%=self.config%>.<%=section%>.<%=tab%>'] = <%=#self.tabs[tab].childs%>;</script>
- <%- if not self.selected_tab then self.selected_tab = tab end %>
- <li id="tab.<%=self.config%>.<%=section%>.<%=tab%>" class="cbi-tab<%=(tab == self.selected_tab) and '' or '-disabled'%>">
- <a onclick="this.blur(); return cbi_t_switch('<%=self.config%>.<%=section%>', '<%=tab%>')" href="<%=REQUEST_URI%>?tab.<%=self.config%>.<%=section%>=<%=tab%>"><%=self.tabs[tab].title%></a>
- <% if tab == self.selected_tab then %><input type="hidden" id="tab.<%=self.config%>.<%=section%>" name="tab.<%=self.config%>.<%=section%>" value="<%=tab%>" /><% end %>
- </li>
- <% end end -%>
- </ul>
-<% end -%>
+++ /dev/null
-<%-
-local rowcnt = 1
-function rowstyle()
- rowcnt = rowcnt + 1
- return (rowcnt % 2) + 1
-end
-
-function width(o)
- if o.width then
- if type(o.width) == 'number' then
- return ' style="width:%dpx"' % o.width
- end
- return ' style="width:%s"' % o.width
- end
- return ''
-end
--%>
-
-<!-- tblsection -->
-<fieldset class="cbi-section" id="cbi-<%=self.config%>-<%=self.sectiontype%>">
- <% if self.title and #self.title > 0 then -%>
- <legend><%=self.title%></legend>
- <%- end %>
- <%- if self.sortable then -%>
- <input type="hidden" id="cbi.sts.<%=self.config%>.<%=self.sectiontype%>" name="cbi.sts.<%=self.config%>.<%=self.sectiontype%>" value="" />
- <%- end -%>
- <div class="cbi-section-descr"><%=self.description%></div>
- <div class="cbi-section-node">
- <%- local count = 0 -%>
- <table class="cbi-section-table">
- <tr class="cbi-section-table-titles">
- <%- if not self.anonymous then -%>
- <%- if self.sectionhead then -%>
- <th class="cbi-section-table-cell"><%=self.sectionhead%></th>
- <%- else -%>
- <th> </th>
- <%- end -%>
- <%- end -%>
- <%- for i, k in pairs(self.children) do if not k.optional then -%>
- <th class="cbi-section-table-cell"<%=width(k)%>>
- <%- if k.titleref then -%><a title="<%=self.titledesc or translate('Go to relevant configuration page')%>" class="cbi-title-ref" href="<%=k.titleref%>"><%- end -%>
- <%-=k.title-%>
- <%- if k.titleref then -%></a><%- end -%>
- </th>
- <%- count = count + 1; end; end; if self.sortable then -%>
- <th class="cbi-section-table-cell"><%:Sort%></th>
- <%- end; if self.extedit or self.addremove then -%>
- <th class="cbi-section-table-cell"> </th>
- <%- count = count + 1; end -%>
- </tr>
- <tr class="cbi-section-table-descr">
- <%- if not self.anonymous then -%>
- <%- if self.sectiondesc then -%>
- <th class="cbi-section-table-cell"><%=self.sectiondesc%></th>
- <%- else -%>
- <th></th>
- <%- end -%>
- <%- end -%>
- <%- for i, k in pairs(self.children) do if not k.optional then -%>
- <th class="cbi-section-table-cell"<%=width(k)%>><%=k.description%></th>
- <%- end; end; if self.sortable then -%>
- <th class="cbi-section-table-cell"></th>
- <%- end; if self.extedit or self.addremove then -%>
- <th class="cbi-section-table-cell"></th>
- <%- end -%>
- </tr>
- <%- local isempty = true
- for i, k in ipairs(self:cfgsections()) do
- section = k
- isempty = false
- scope = { valueheader = "cbi/cell_valueheader", valuefooter = "cbi/cell_valuefooter" }
- -%>
- <tr class="cbi-section-table-row<% if self.extedit or self.rowcolors then %> cbi-rowstyle-<%=rowstyle()%><% end %>" id="cbi-<%=self.config%>-<%=section%>">
- <% if not self.anonymous then -%>
- <th><h3><%=(type(self.sectiontitle) == "function") and self:sectiontitle(section) or k%></h3></th>
- <%- end %>
-
-
- <%-
- for k, node in ipairs(self.children) do
- if not node.optional then
- node:render(section, scope or {})
- end
- end
- -%>
-
- <%- if self.sortable then -%>
- <td class="cbi-section-table-cell">
- <input class="cbi-button cbi-button-up" type="button" value="" onclick="return cbi_row_swap(this, true, 'cbi.sts.<%=self.config%>.<%=self.sectiontype%>')" alt="<%:Move up%>" title="<%:Move up%>" />
- <input class="cbi-button cbi-button-down" type="button" value="" onclick="return cbi_row_swap(this, false, 'cbi.sts.<%=self.config%>.<%=self.sectiontype%>')" alt="<%:Move down%>" title="<%:Move down%>" />
- </td>
- <%- end -%>
-
- <%- if self.extedit or self.addremove then -%>
- <td class="cbi-section-table-cell">
- <%- if self.extedit then -%>
- <input class="cbi-button cbi-button-edit" type="button" value="<%:Edit%>"
- <%- if type(self.extedit) == "string" then
- %> onclick="location.href='<%=self.extedit:format(section)%>'"
- <%- elseif type(self.extedit) == "function" then
- %> onclick="location.href='<%=self:extedit(section)%>'"
- <%- end
- %> alt="<%:Edit%>" title="<%:Edit%>" />
- <%- end; if self.addremove then %>
- <input class="cbi-button cbi-button-remove" type="submit" value="<%:Delete%>" onclick="this.form.cbi_state='del-section'; return true" name="cbi.rts.<%=self.config%>.<%=k%>" alt="<%:Delete%>" title="<%:Delete%>" />
- <%- end -%>
- </td>
- <%- end -%>
- </tr>
- <%- end -%>
-
- <%- if isempty then -%>
- <tr class="cbi-section-table-row">
- <td colspan="<%=count%>"><em><br /><%:This section contains no values yet%></em></td>
- </tr>
- <%- end -%>
- </table>
-
- <% if self.error then %>
- <div class="cbi-section-error">
- <ul><% for _, c in pairs(self.error) do for _, e in ipairs(c) do -%>
- <li><%=pcdata(e):gsub("\n","<br />")%></li>
- <%- end end %></ul>
- </div>
- <% end %>
-
- <%- if self.addremove then -%>
- <% if self.template_addremove then include(self.template_addremove) else -%>
- <div class="cbi-section-create cbi-tblsection-create">
- <% if self.anonymous then %>
- <input class="cbi-button cbi-button-add" type="submit" value="<%:Add%>" name="cbi.cts.<%=self.config%>.<%=self.sectiontype%>.<%=section%>" title="<%:Add%>" />
- <% else %>
- <% if self.invalid_cts then -%><div class="cbi-section-error"><% end %>
- <input type="text" class="cbi-section-create-name" id="cbi.cts.<%=self.config%>.<%=self.sectiontype%>.<%=section%>" name="cbi.cts.<%=self.config%>.<%=self.sectiontype%>.<%=section%>" />
- <script type="text/javascript">cbi_validate_field('cbi.cts.<%=self.config%>.<%=self.sectiontype%>.<%=section%>', true, 'uciname');</script>
- <input class="cbi-button cbi-button-add" type="submit" onclick="this.form.cbi_state='add-section'; return true" value="<%:Add%>" title="<%:Add%>" />
- <% if self.invalid_cts then -%>
- <br /><%:Invalid%></div>
- <%- end %>
- <% end %>
- </div>
- <%- end %>
- <%- end -%>
- </div>
-</fieldset>
-<!-- /tblsection -->
+++ /dev/null
-<fieldset class="cbi-section" id="cbi-<%=self.config%>-<%=self.sectiontype%>">
- <% if self.title and #self.title > 0 then -%>
- <legend><%=self.title%></legend>
- <%- end %>
- <div class="cbi-section-descr"><%=self.description%></div>
- <% local isempty = true for i, k in ipairs(self:cfgsections()) do -%>
- <% if self.addremove then -%>
- <div class="cbi-section-remove right">
- <input type="submit" name="cbi.rts.<%=self.config%>.<%=k%>" onclick="this.form.cbi_state='del-section'; return true" value="<%:Delete%>" class="cbi-button" />
- </div>
- <%- end %>
-
- <%- section = k; isempty = false -%>
-
- <% if not self.anonymous then -%>
- <h3><%=section:upper()%></h3>
- <%- end %>
-
- <%+cbi/tabmenu%>
-
- <fieldset class="cbi-section-node<% if self.tabs then %> cbi-section-node-tabbed<% end %>" id="cbi-<%=self.config%>-<%=section%>">
- <%+cbi/ucisection%>
- </fieldset>
- <br />
- <%- end %>
-
- <% if isempty then -%>
- <em><%:This section contains no values yet%><br /><br /></em>
- <%- end %>
-
- <% if self.addremove then -%>
- <% if self.template_addremove then include(self.template_addremove) else -%>
- <div class="cbi-section-create">
- <% if self.anonymous then -%>
- <input type="submit" class="cbi-button cbi-button-add" name="cbi.cts.<%=self.config%>.<%=self.sectiontype%>.<%=section%>" value="<%:Add%>" />
- <%- else -%>
- <% if self.invalid_cts then -%><div class="cbi-section-error"><% end %>
- <input type="text" class="cbi-section-create-name" id="cbi.cts.<%=self.config%>.<%=self.sectiontype%>.<%=section%>" name="cbi.cts.<%=self.config%>.<%=self.sectiontype%>.<%=section%>" />
- <script type="text/javascript">cbi_validate_field('cbi.cts.<%=self.config%>.<%=self.sectiontype%>.<%=section%>', true, 'uciname');</script>
- <input type="submit" class="cbi-button cbi-button-add" onclick="this.form.cbi_state='add-section'; return true" value="<%:Add%>" />
- <% if self.invalid_cts then -%>
- <br /><%:Invalid%></div>
- <%- end %>
- <%- end %>
- </div>
- <%- end %>
- <%- end %>
-</fieldset>
+++ /dev/null
-<%+cbi/valueheader%>
- <textarea class="cbi-input-textarea" <% if not self.size then %> style="width: 100%"<% else %> cols="<%=self.size%>"<% end %> onchange="cbi_d_update(this.id)"<%= attr("name", cbid) .. attr("id", cbid) .. ifattr(self.rows, "rows") .. ifattr(self.wrap, "wrap") %>>
- <%-=pcdata(self:cfgvalue(section))-%>
- </textarea>
-<%+cbi/valuefooter%>
+++ /dev/null
-<%-
- if type(self.hidden) == "table" then
- for k, v in pairs(self.hidden) do
--%>
- <input type="hidden" id="<%=k%>" name="<%=k%>" value="<%=pcdata(v)%>" />
-<%-
- end
- end
-%>
-
-<% if self.tabs then %>
- <%+cbi/tabcontainer%>
-<% else %>
- <% self:render_children(section, scope or {}) %>
-<% end %>
-
-<% if self.error and self.error[section] then -%>
- <div class="cbi-section-error">
- <ul><% for _, e in ipairs(self.error[section]) do -%>
- <li>
- <%- if e == "invalid" then -%>
- <%:One or more fields contain invalid values!%>
- <%- elseif e == "missing" then -%>
- <%:One or more required fields have no value!%>
- <%- else -%>
- <%=pcdata(e)%>
- <%- end -%>
- </li>
- <%- end %></ul>
- </div>
-<%- end %>
-
-<% if self.optionals[section] and #self.optionals[section] > 0 or self.dynamic then %>
- <div class="cbi-optionals">
- <% if self.dynamic then %>
- <input type="text" id="cbi.opt.<%=self.config%>.<%=section%>" name="cbi.opt.<%=self.config%>.<%=section%>" />
- <% if self.optionals[section] and #self.optionals[section] > 0 then %>
- <script type="text/javascript">
- cbi_combobox_init('cbi.opt.<%=self.config%>.<%=section%>', {
- <%-
- for i, val in pairs(self.optionals[section]) do
- -%>
- <%-=string.format("%q", val.option) .. ":" .. string.format("%q", striptags(val.title))-%>
- <%-if next(self.optionals[section], i) then-%>,<%-end-%>
- <%-
- end
- -%>
- }, '', '<%-: -- custom -- -%>');
- </script>
- <% end %>
- <% else %>
- <select id="cbi.opt.<%=self.config%>.<%=section%>" name="cbi.opt.<%=self.config%>.<%=section%>">
- <option><%: -- Additional Field -- %></option>
- <% for key, val in pairs(self.optionals[section]) do -%>
- <option id="cbi-<%=self.config.."-"..section.."-"..val.option%>" value="<%=val.option%>"><%=striptags(val.title)%></option>
- <%- end %>
- </select>
- <script type="text/javascript"><% for key, val in pairs(self.optionals[section]) do %>
- <% if #val.deps > 0 then %><% for j, d in ipairs(val.deps) do -%>
- cbi_d_add("cbi-<%=self.config.."-"..section.."-"..val.option..d.add%>", {
- <%-
- for k,v in pairs(d.deps) do
- -%>
- <%-=string.format('"cbid.%s.%s.%s"', self.config, section, k) .. ":" .. string.format("%q", v)-%>
- <%-if next(d.deps, k) then-%>,<%-end-%>
- <%-
- end
- -%>
- });
- <%- end %><% end %>
- <% end %></script>
- <% end %>
- <input type="submit" class="cbi-button cbi-button-fieldadd" value="<%:Add%>" />
- </div>
-<% end %>
+++ /dev/null
-<%
- local t = require("luci.tools.webadmin")
- local v = self:cfgvalue(section)
- local s = v and nixio.fs.stat(v)
--%>
-<%+cbi/valueheader%>
- <% if s then %>
- <%:Uploaded File%> (<%=t.byte_format(s.size)%>)
- <input type="hidden"<%= attr("value", v) .. attr("name", cbid) .. attr("id", cbid) %> />
- <input class="cbi-button cbi-input-image" type="image" value="<%:Replace entry%>" name="cbi.rlf.<%=section .. "." .. self.option%>" alt="<%:Replace entry%>" title="<%:Replace entry%>" src="<%=resource%>/cbi/reload.gif" />
- <% else %>
- <input class="cbi-input-file" type="file"<%= attr("name", cbid) .. attr("id", cbid) %> />
- <% end %>
-<%+cbi/valuefooter%>
+++ /dev/null
-<%+cbi/valueheader%>
- <input type="<%=self.password and 'password" class="cbi-input-password' or 'text" class="cbi-input-text' %>" onchange="cbi_d_update(this.id)"<%=
- attr("name", cbid) .. attr("id", cbid) .. attr("value", self:cfgvalue(section) or self.default) ..
- ifattr(self.size, "size") .. ifattr(self.placeholder, "placeholder")
- %> />
- <% if self.password then %><img src="<%=resource%>/cbi/reload.gif" style="vertical-align:middle" title="<%:Reveal/hide password%>" onclick="var e = document.getElementById('<%=cbid%>'); e.type = (e.type=='password') ? 'text' : 'password';" /><% end %>
- <% if #self.keylist > 0 or self.datatype then -%>
- <script type="text/javascript">//<![CDATA[
- <% if #self.keylist > 0 then -%>
- cbi_combobox_init('<%=cbid%>', {
- <%-
- for i, k in ipairs(self.keylist) do
- -%>
- <%-=string.format("%q", k) .. ":" .. string.format("%q", self.vallist[i])-%>
- <%-if i<#self.keylist then-%>,<%-end-%>
- <%-
- end
- -%>
- }, '<%- if not self.rmempty and not self.optional then -%>
- <%-: -- Please choose -- -%>
- <%- elseif self.placeholder then -%>
- <%-= pcdata(self.placeholder) -%>
- <%- end -%>', '
- <%- if self.combobox_manual then -%>
- <%-=self.combobox_manual-%>
- <%- else -%>
- <%-: -- custom -- -%>
- <%- end -%>');
- <%- end %>
- <% if self.datatype then -%>
- cbi_validate_field('<%=cbid%>', <%=tostring((self.optional or self.rmempty) == true)%>, '<%=self.datatype:gsub("'", "\\'")%>');
- <%- end %>
- //]]></script>
- <% end -%>
-<%+cbi/valuefooter%>
+++ /dev/null
-<% include( valuefooter or "cbi/full_valuefooter" ) %>
+++ /dev/null
-<% include( valueheader or "cbi/full_valueheader" ) %>
+++ /dev/null
-config core main
- option lang auto
- option mediaurlbase /luci-static/openwrt.org
- option resourcebase /luci-static/resources
-
-config extern flash_keep
- option uci "/etc/config/"
- option dropbear "/etc/dropbear/"
- option openvpn "/etc/openvpn/"
- option passwd "/etc/passwd"
- option opkg "/etc/opkg.conf"
- option firewall "/etc/firewall.user"
- option uploads "/lib/uci/upload/"
-
-config internal languages
-
-config internal sauth
- option sessionpath "/tmp/luci-sessions"
- option sessiontime 3600
-
-config internal ccache
- option enable 1
-
-config internal themes
+++ /dev/null
-/*
- * lmo - Lua Machine Objects - PO to LMO conversion tool
- *
- * Copyright (C) 2009-2012 Jo-Philipp Wich <xm@subsignal.org>
- *
- * Licensed under the Apache License, Version 2.0 (the "License");
- * you may not use this file except in compliance with the License.
- * You may obtain a copy of the License at
- *
- * http://www.apache.org/licenses/LICENSE-2.0
- *
- * Unless required by applicable law or agreed to in writing, software
- * distributed under the License is distributed on an "AS IS" BASIS,
- * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
- * See the License for the specific language governing permissions and
- * limitations under the License.
- */
-
-#include "template_lmo.h"
-
-static void die(const char *msg)
-{
- fprintf(stderr, "Error: %s\n", msg);
- exit(1);
-}
-
-static void usage(const char *name)
-{
- fprintf(stderr, "Usage: %s input.po output.lmo\n", name);
- exit(1);
-}
-
-static void print(const void *ptr, size_t size, size_t nmemb, FILE *stream)
-{
- if( fwrite(ptr, size, nmemb, stream) == 0 )
- die("Failed to write stdout");
-}
-
-static int extract_string(const char *src, char *dest, int len)
-{
- int pos = 0;
- int esc = 0;
- int off = -1;
-
- for( pos = 0; (pos < strlen(src)) && (pos < len); pos++ )
- {
- if( (off == -1) && (src[pos] == '"') )
- {
- off = pos + 1;
- }
- else if( off >= 0 )
- {
- if( esc == 1 )
- {
- switch (src[pos])
- {
- case '"':
- case '\\':
- off++;
- break;
- }
- dest[pos-off] = src[pos];
- esc = 0;
- }
- else if( src[pos] == '\\' )
- {
- dest[pos-off] = src[pos];
- esc = 1;
- }
- else if( src[pos] != '"' )
- {
- dest[pos-off] = src[pos];
- }
- else
- {
- dest[pos-off] = '\0';
- break;
- }
- }
- }
-
- return (off > -1) ? strlen(dest) : -1;
-}
-
-static int cmp_index(const void *a, const void *b)
-{
- uint32_t x = ((const lmo_entry_t *)a)->key_id;
- uint32_t y = ((const lmo_entry_t *)b)->key_id;
-
- if (x < y)
- return -1;
- else if (x > y)
- return 1;
-
- return 0;
-}
-
-static void print_uint32(uint32_t x, FILE *out)
-{
- uint32_t y = htonl(x);
- print(&y, sizeof(uint32_t), 1, out);
-}
-
-static void print_index(void *array, int n, FILE *out)
-{
- lmo_entry_t *e;
-
- qsort(array, n, sizeof(*e), cmp_index);
-
- for (e = array; n > 0; n--, e++)
- {
- print_uint32(e->key_id, out);
- print_uint32(e->val_id, out);
- print_uint32(e->offset, out);
- print_uint32(e->length, out);
- }
-}
-
-int main(int argc, char *argv[])
-{
- char line[4096];
- char key[4096];
- char val[4096];
- char tmp[4096];
- int state = 0;
- int offset = 0;
- int length = 0;
- int n_entries = 0;
- void *array = NULL;
- lmo_entry_t *entry = NULL;
- uint32_t key_id, val_id;
-
- FILE *in;
- FILE *out;
-
- if( (argc != 3) || ((in = fopen(argv[1], "r")) == NULL) || ((out = fopen(argv[2], "w")) == NULL) )
- usage(argv[0]);
-
- memset(line, 0, sizeof(key));
- memset(key, 0, sizeof(val));
- memset(val, 0, sizeof(val));
-
- while( (NULL != fgets(line, sizeof(line), in)) || (state >= 2 && feof(in)) )
- {
- if( state == 0 && strstr(line, "msgid \"") == line )
- {
- switch(extract_string(line, key, sizeof(key)))
- {
- case -1:
- die("Syntax error in msgid");
- case 0:
- state = 1;
- break;
- default:
- state = 2;
- }
- }
- else if( state == 1 || state == 2 )
- {
- if( strstr(line, "msgstr \"") == line || state == 2 )
- {
- switch(extract_string(line, val, sizeof(val)))
- {
- case -1:
- state = 4;
- break;
- default:
- state = 3;
- }
- }
- else
- {
- switch(extract_string(line, tmp, sizeof(tmp)))
- {
- case -1:
- state = 2;
- break;
- default:
- strcat(key, tmp);
- }
- }
- }
- else if( state == 3 )
- {
- switch(extract_string(line, tmp, sizeof(tmp)))
- {
- case -1:
- state = 4;
- break;
- default:
- strcat(val, tmp);
- }
- }
-
- if( state == 4 )
- {
- if( strlen(key) > 0 && strlen(val) > 0 )
- {
- key_id = sfh_hash(key, strlen(key));
- val_id = sfh_hash(val, strlen(val));
-
- if( key_id != val_id )
- {
- n_entries++;
- array = realloc(array, n_entries * sizeof(lmo_entry_t));
- entry = (lmo_entry_t *)array + n_entries - 1;
-
- if (!array)
- die("Out of memory");
-
- entry->key_id = key_id;
- entry->val_id = val_id;
- entry->offset = offset;
- entry->length = strlen(val);
-
- length = strlen(val) + ((4 - (strlen(val) % 4)) % 4);
-
- print(val, length, 1, out);
- offset += length;
- }
- }
-
- state = 0;
- memset(key, 0, sizeof(key));
- memset(val, 0, sizeof(val));
- }
-
- memset(line, 0, sizeof(line));
- }
-
- print_index(array, n_entries, out);
-
- if( offset > 0 )
- {
- print_uint32(offset, out);
- fsync(fileno(out));
- fclose(out);
- }
- else
- {
- fclose(out);
- unlink(argv[2]);
- }
-
- fclose(in);
- return(0);
-}
+++ /dev/null
-/*
- * lmo - Lua Machine Objects - Base functions
- *
- * Copyright (C) 2009-2010 Jo-Philipp Wich <xm@subsignal.org>
- *
- * Licensed under the Apache License, Version 2.0 (the "License");
- * you may not use this file except in compliance with the License.
- * You may obtain a copy of the License at
- *
- * http://www.apache.org/licenses/LICENSE-2.0
- *
- * Unless required by applicable law or agreed to in writing, software
- * distributed under the License is distributed on an "AS IS" BASIS,
- * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
- * See the License for the specific language governing permissions and
- * limitations under the License.
- */
-
-#include "template_lmo.h"
-
-/*
- * Hash function from http://www.azillionmonkeys.com/qed/hash.html
- * Copyright (C) 2004-2008 by Paul Hsieh
- */
-
-uint32_t sfh_hash(const char *data, int len)
-{
- uint32_t hash = len, tmp;
- int rem;
-
- if (len <= 0 || data == NULL) return 0;
-
- rem = len & 3;
- len >>= 2;
-
- /* Main loop */
- for (;len > 0; len--) {
- hash += sfh_get16(data);
- tmp = (sfh_get16(data+2) << 11) ^ hash;
- hash = (hash << 16) ^ tmp;
- data += 2*sizeof(uint16_t);
- hash += hash >> 11;
- }
-
- /* Handle end cases */
- switch (rem) {
- case 3: hash += sfh_get16(data);
- hash ^= hash << 16;
- hash ^= data[sizeof(uint16_t)] << 18;
- hash += hash >> 11;
- break;
- case 2: hash += sfh_get16(data);
- hash ^= hash << 11;
- hash += hash >> 17;
- break;
- case 1: hash += *data;
- hash ^= hash << 10;
- hash += hash >> 1;
- }
-
- /* Force "avalanching" of final 127 bits */
- hash ^= hash << 3;
- hash += hash >> 5;
- hash ^= hash << 4;
- hash += hash >> 17;
- hash ^= hash << 25;
- hash += hash >> 6;
-
- return hash;
-}
-
-uint32_t lmo_canon_hash(const char *str, int len)
-{
- char res[4096];
- char *ptr, prev;
- int off;
-
- if (!str || len >= sizeof(res))
- return 0;
-
- for (prev = ' ', ptr = res, off = 0; off < len; prev = *str, off++, str++)
- {
- if (isspace(*str))
- {
- if (!isspace(prev))
- *ptr++ = ' ';
- }
- else
- {
- *ptr++ = *str;
- }
- }
-
- if ((ptr > res) && isspace(*(ptr-1)))
- ptr--;
-
- return sfh_hash(res, ptr - res);
-}
-
-lmo_archive_t * lmo_open(const char *file)
-{
- int in = -1;
- uint32_t idx_offset = 0;
- struct stat s;
-
- lmo_archive_t *ar = NULL;
-
- if (stat(file, &s) == -1)
- goto err;
-
- if ((in = open(file, O_RDONLY)) == -1)
- goto err;
-
- if ((ar = (lmo_archive_t *)malloc(sizeof(*ar))) != NULL)
- {
- memset(ar, 0, sizeof(*ar));
-
- ar->fd = in;
- ar->size = s.st_size;
-
- fcntl(ar->fd, F_SETFD, fcntl(ar->fd, F_GETFD) | FD_CLOEXEC);
-
- if ((ar->mmap = mmap(NULL, ar->size, PROT_READ, MAP_SHARED, ar->fd, 0)) == MAP_FAILED)
- goto err;
-
- idx_offset = ntohl(*((const uint32_t *)
- (ar->mmap + ar->size - sizeof(uint32_t))));
-
- if (idx_offset >= ar->size)
- goto err;
-
- ar->index = (lmo_entry_t *)(ar->mmap + idx_offset);
- ar->length = (ar->size - idx_offset - sizeof(uint32_t)) / sizeof(lmo_entry_t);
- ar->end = ar->mmap + ar->size;
-
- return ar;
- }
-
-err:
- if (in > -1)
- close(in);
-
- if (ar != NULL)
- {
- if ((ar->mmap != NULL) && (ar->mmap != MAP_FAILED))
- munmap(ar->mmap, ar->size);
-
- free(ar);
- }
-
- return NULL;
-}
-
-void lmo_close(lmo_archive_t *ar)
-{
- if (ar != NULL)
- {
- if ((ar->mmap != NULL) && (ar->mmap != MAP_FAILED))
- munmap(ar->mmap, ar->size);
-
- close(ar->fd);
- free(ar);
-
- ar = NULL;
- }
-}
-
-
-lmo_catalog_t *_lmo_catalogs = NULL;
-lmo_catalog_t *_lmo_active_catalog = NULL;
-
-int lmo_load_catalog(const char *lang, const char *dir)
-{
- DIR *dh = NULL;
- char pattern[16];
- char path[PATH_MAX];
- struct dirent *de = NULL;
-
- lmo_archive_t *ar = NULL;
- lmo_catalog_t *cat = NULL;
-
- if (!lmo_change_catalog(lang))
- return 0;
-
- if (!dir || !(dh = opendir(dir)))
- goto err;
-
- if (!(cat = malloc(sizeof(*cat))))
- goto err;
-
- memset(cat, 0, sizeof(*cat));
-
- snprintf(cat->lang, sizeof(cat->lang), "%s", lang);
- snprintf(pattern, sizeof(pattern), "*.%s.lmo", lang);
-
- while ((de = readdir(dh)) != NULL)
- {
- if (!fnmatch(pattern, de->d_name, 0))
- {
- snprintf(path, sizeof(path), "%s/%s", dir, de->d_name);
- ar = lmo_open(path);
-
- if (ar)
- {
- ar->next = cat->archives;
- cat->archives = ar;
- }
- }
- }
-
- closedir(dh);
-
- cat->next = _lmo_catalogs;
- _lmo_catalogs = cat;
-
- if (!_lmo_active_catalog)
- _lmo_active_catalog = cat;
-
- return 0;
-
-err:
- if (dh) closedir(dh);
- if (cat) free(cat);
-
- return -1;
-}
-
-int lmo_change_catalog(const char *lang)
-{
- lmo_catalog_t *cat;
-
- for (cat = _lmo_catalogs; cat; cat = cat->next)
- {
- if (!strncmp(cat->lang, lang, sizeof(cat->lang)))
- {
- _lmo_active_catalog = cat;
- return 0;
- }
- }
-
- return -1;
-}
-
-static lmo_entry_t * lmo_find_entry(lmo_archive_t *ar, uint32_t hash)
-{
- unsigned int m, l, r;
- uint32_t k;
-
- l = 0;
- r = ar->length - 1;
-
- while (1)
- {
- m = l + ((r - l) / 2);
-
- if (r < l)
- break;
-
- k = ntohl(ar->index[m].key_id);
-
- if (k == hash)
- return &ar->index[m];
-
- if (k > hash)
- {
- if (!m)
- break;
-
- r = m - 1;
- }
- else
- {
- l = m + 1;
- }
- }
-
- return NULL;
-}
-
-int lmo_translate(const char *key, int keylen, char **out, int *outlen)
-{
- uint32_t hash;
- lmo_entry_t *e;
- lmo_archive_t *ar;
-
- if (!key || !_lmo_active_catalog)
- return -2;
-
- hash = lmo_canon_hash(key, keylen);
-
- for (ar = _lmo_active_catalog->archives; ar; ar = ar->next)
- {
- if ((e = lmo_find_entry(ar, hash)) != NULL)
- {
- *out = ar->mmap + ntohl(e->offset);
- *outlen = ntohl(e->length);
- return 0;
- }
- }
-
- return -1;
-}
-
-void lmo_close_catalog(const char *lang)
-{
- lmo_archive_t *ar, *next;
- lmo_catalog_t *cat, *prev;
-
- for (prev = NULL, cat = _lmo_catalogs; cat; prev = cat, cat = cat->next)
- {
- if (!strncmp(cat->lang, lang, sizeof(cat->lang)))
- {
- if (prev)
- prev->next = cat->next;
- else
- _lmo_catalogs = cat->next;
-
- for (ar = cat->archives; ar; ar = next)
- {
- next = ar->next;
- lmo_close(ar);
- }
-
- free(cat);
- break;
- }
- }
-}
+++ /dev/null
-/*
- * lmo - Lua Machine Objects - General header
- *
- * Copyright (C) 2009-2012 Jo-Philipp Wich <xm@subsignal.org>
- *
- * Licensed under the Apache License, Version 2.0 (the "License");
- * you may not use this file except in compliance with the License.
- * You may obtain a copy of the License at
- *
- * http://www.apache.org/licenses/LICENSE-2.0
- *
- * Unless required by applicable law or agreed to in writing, software
- * distributed under the License is distributed on an "AS IS" BASIS,
- * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
- * See the License for the specific language governing permissions and
- * limitations under the License.
- */
-
-#ifndef _TEMPLATE_LMO_H_
-#define _TEMPLATE_LMO_H_
-
-#include <stdlib.h>
-#include <stdio.h>
-#include <stdint.h>
-#include <string.h>
-#include <fcntl.h>
-#include <sys/stat.h>
-#include <sys/mman.h>
-#include <arpa/inet.h>
-#include <unistd.h>
-#include <errno.h>
-#include <fnmatch.h>
-#include <dirent.h>
-#include <ctype.h>
-#include <limits.h>
-
-#if (defined(__GNUC__) && defined(__i386__))
-#define sfh_get16(d) (*((const uint16_t *) (d)))
-#else
-#define sfh_get16(d) ((((uint32_t)(((const uint8_t *)(d))[1])) << 8)\
- +(uint32_t)(((const uint8_t *)(d))[0]) )
-#endif
-
-
-struct lmo_entry {
- uint32_t key_id;
- uint32_t val_id;
- uint32_t offset;
- uint32_t length;
-} __attribute__((packed));
-
-typedef struct lmo_entry lmo_entry_t;
-
-
-struct lmo_archive {
- int fd;
- int length;
- uint32_t size;
- lmo_entry_t *index;
- char *mmap;
- char *end;
- struct lmo_archive *next;
-};
-
-typedef struct lmo_archive lmo_archive_t;
-
-
-struct lmo_catalog {
- char lang[6];
- struct lmo_archive *archives;
- struct lmo_catalog *next;
-};
-
-typedef struct lmo_catalog lmo_catalog_t;
-
-
-uint32_t sfh_hash(const char *data, int len);
-uint32_t lmo_canon_hash(const char *data, int len);
-
-lmo_archive_t * lmo_open(const char *file);
-void lmo_close(lmo_archive_t *ar);
-
-
-extern lmo_catalog_t *_lmo_catalogs;
-extern lmo_catalog_t *_lmo_active_catalog;
-
-int lmo_load_catalog(const char *lang, const char *dir);
-int lmo_change_catalog(const char *lang);
-int lmo_translate(const char *key, int keylen, char **out, int *outlen);
-void lmo_close_catalog(const char *lang);
-
-#endif
+++ /dev/null
-/*
- * LuCI Template - Lua binding
- *
- * Copyright (C) 2009 Jo-Philipp Wich <xm@subsignal.org>
- *
- * Licensed under the Apache License, Version 2.0 (the "License");
- * you may not use this file except in compliance with the License.
- * You may obtain a copy of the License at
- *
- * http://www.apache.org/licenses/LICENSE-2.0
- *
- * Unless required by applicable law or agreed to in writing, software
- * distributed under the License is distributed on an "AS IS" BASIS,
- * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
- * See the License for the specific language governing permissions and
- * limitations under the License.
- */
-
-#include "template_lualib.h"
-
-int template_L_parse(lua_State *L)
-{
- const char *file = luaL_checkstring(L, 1);
- struct template_parser *parser = template_open(file);
- int lua_status, rv;
-
- if (!parser)
- {
- lua_pushnil(L);
- lua_pushinteger(L, errno);
- lua_pushstring(L, strerror(errno));
- return 3;
- }
-
- lua_status = lua_load(L, template_reader, parser, file);
-
- if (lua_status == 0)
- rv = 1;
- else
- rv = template_error(L, parser);
-
- template_close(parser);
-
- return rv;
-}
-
-int template_L_utf8(lua_State *L)
-{
- size_t len = 0;
- const char *str = luaL_checklstring(L, 1, &len);
- char *res = utf8(str, len);
-
- if (res != NULL)
- {
- lua_pushstring(L, res);
- free(res);
-
- return 1;
- }
-
- return 0;
-}
-
-int template_L_pcdata(lua_State *L)
-{
- size_t len = 0;
- const char *str = luaL_checklstring(L, 1, &len);
- char *res = pcdata(str, len);
-
- if (res != NULL)
- {
- lua_pushstring(L, res);
- free(res);
-
- return 1;
- }
-
- return 0;
-}
-
-int template_L_striptags(lua_State *L)
-{
- size_t len = 0;
- const char *str = luaL_checklstring(L, 1, &len);
- char *res = striptags(str, len);
-
- if (res != NULL)
- {
- lua_pushstring(L, res);
- free(res);
-
- return 1;
- }
-
- return 0;
-}
-
-static int template_L_load_catalog(lua_State *L) {
- const char *lang = luaL_optstring(L, 1, "en");
- const char *dir = luaL_optstring(L, 2, NULL);
- lua_pushboolean(L, !lmo_load_catalog(lang, dir));
- return 1;
-}
-
-static int template_L_close_catalog(lua_State *L) {
- const char *lang = luaL_optstring(L, 1, "en");
- lmo_close_catalog(lang);
- return 0;
-}
-
-static int template_L_change_catalog(lua_State *L) {
- const char *lang = luaL_optstring(L, 1, "en");
- lua_pushboolean(L, !lmo_change_catalog(lang));
- return 1;
-}
-
-static int template_L_translate(lua_State *L) {
- size_t len;
- char *tr;
- int trlen;
- const char *key = luaL_checklstring(L, 1, &len);
-
- switch (lmo_translate(key, len, &tr, &trlen))
- {
- case 0:
- lua_pushlstring(L, tr, trlen);
- return 1;
-
- case -1:
- return 0;
- }
-
- lua_pushnil(L);
- lua_pushstring(L, "no catalog loaded");
- return 2;
-}
-
-static int template_L_hash(lua_State *L) {
- size_t len;
- const char *key = luaL_checklstring(L, 1, &len);
- lua_pushinteger(L, sfh_hash(key, len));
- return 1;
-}
-
-
-/* module table */
-static const luaL_reg R[] = {
- { "parse", template_L_parse },
- { "utf8", template_L_utf8 },
- { "pcdata", template_L_pcdata },
- { "striptags", template_L_striptags },
- { "load_catalog", template_L_load_catalog },
- { "close_catalog", template_L_close_catalog },
- { "change_catalog", template_L_change_catalog },
- { "translate", template_L_translate },
- { "hash", template_L_hash },
- { NULL, NULL }
-};
-
-LUALIB_API int luaopen_luci_template_parser(lua_State *L) {
- luaL_register(L, TEMPLATE_LUALIB_META, R);
- return 1;
-}
+++ /dev/null
-/*
- * LuCI Template - Lua library header
- *
- * Copyright (C) 2009 Jo-Philipp Wich <xm@subsignal.org>
- *
- * Licensed under the Apache License, Version 2.0 (the "License");
- * you may not use this file except in compliance with the License.
- * You may obtain a copy of the License at
- *
- * http://www.apache.org/licenses/LICENSE-2.0
- *
- * Unless required by applicable law or agreed to in writing, software
- * distributed under the License is distributed on an "AS IS" BASIS,
- * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
- * See the License for the specific language governing permissions and
- * limitations under the License.
- */
-
-#ifndef _TEMPLATE_LUALIB_H_
-#define _TEMPLATE_LUALIB_H_
-
-#include "template_parser.h"
-#include "template_utils.h"
-#include "template_lmo.h"
-
-#define TEMPLATE_LUALIB_META "template.parser"
-
-LUALIB_API int luaopen_luci_template_parser(lua_State *L);
-
-#endif
+++ /dev/null
-/*
- * LuCI Template - Parser implementation
- *
- * Copyright (C) 2009-2012 Jo-Philipp Wich <xm@subsignal.org>
- *
- * Licensed under the Apache License, Version 2.0 (the "License");
- * you may not use this file except in compliance with the License.
- * You may obtain a copy of the License at
- *
- * http://www.apache.org/licenses/LICENSE-2.0
- *
- * Unless required by applicable law or agreed to in writing, software
- * distributed under the License is distributed on an "AS IS" BASIS,
- * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
- * See the License for the specific language governing permissions and
- * limitations under the License.
- */
-
-#include "template_parser.h"
-#include "template_utils.h"
-#include "template_lmo.h"
-
-
-/* leading and trailing code for different types */
-const char *gen_code[9][2] = {
- { NULL, NULL },
- { "write(\"", "\")" },
- { NULL, NULL },
- { "write(tostring(", " or \"\"))" },
- { "include(\"", "\")" },
- { "write(\"", "\")" },
- { "write(\"", "\")" },
- { NULL, " " },
- { NULL, NULL },
-};
-
-/* Simple strstr() like function that takes len arguments for both haystack and needle. */
-static char *strfind(char *haystack, int hslen, const char *needle, int ndlen)
-{
- int match = 0;
- int i, j;
-
- for( i = 0; i < hslen; i++ )
- {
- if( haystack[i] == needle[0] )
- {
- match = ((ndlen == 1) || ((i + ndlen) <= hslen));
-
- for( j = 1; (j < ndlen) && ((i + j) < hslen); j++ )
- {
- if( haystack[i+j] != needle[j] )
- {
- match = 0;
- break;
- }
- }
-
- if( match )
- return &haystack[i];
- }
- }
-
- return NULL;
-}
-
-struct template_parser * template_open(const char *file)
-{
- struct stat s;
- static struct template_parser *parser;
-
- if (!(parser = malloc(sizeof(*parser))))
- goto err;
-
- memset(parser, 0, sizeof(*parser));
- parser->fd = -1;
- parser->file = file;
-
- if (stat(file, &s))
- goto err;
-
- if ((parser->fd = open(file, O_RDONLY)) < 0)
- goto err;
-
- parser->size = s.st_size;
- parser->mmap = mmap(NULL, parser->size, PROT_READ, MAP_PRIVATE,
- parser->fd, 0);
-
- if (parser->mmap != MAP_FAILED)
- {
- parser->off = parser->mmap;
- parser->cur_chunk.type = T_TYPE_INIT;
- parser->cur_chunk.s = parser->mmap;
- parser->cur_chunk.e = parser->mmap;
-
- return parser;
- }
-
-err:
- template_close(parser);
- return NULL;
-}
-
-void template_close(struct template_parser *parser)
-{
- if (!parser)
- return;
-
- if (parser->gc != NULL)
- free(parser->gc);
-
- if ((parser->mmap != NULL) && (parser->mmap != MAP_FAILED))
- munmap(parser->mmap, parser->size);
-
- if (parser->fd >= 0)
- close(parser->fd);
-
- free(parser);
-}
-
-void template_text(struct template_parser *parser, const char *e)
-{
- const char *s = parser->off;
-
- if (s < (parser->mmap + parser->size))
- {
- if (parser->strip_after)
- {
- while ((s <= e) && isspace(*s))
- s++;
- }
-
- parser->cur_chunk.type = T_TYPE_TEXT;
- }
- else
- {
- parser->cur_chunk.type = T_TYPE_EOF;
- }
-
- parser->cur_chunk.line = parser->line;
- parser->cur_chunk.s = s;
- parser->cur_chunk.e = e;
-}
-
-void template_code(struct template_parser *parser, const char *e)
-{
- const char *s = parser->off;
-
- parser->strip_before = 0;
- parser->strip_after = 0;
-
- if (*s == '-')
- {
- parser->strip_before = 1;
- for (s++; (s <= e) && (*s == ' ' || *s == '\t'); s++);
- }
-
- if (*(e-1) == '-')
- {
- parser->strip_after = 1;
- for (e--; (e >= s) && (*e == ' ' || *e == '\t'); e--);
- }
-
- switch (*s)
- {
- /* comment */
- case '#':
- s++;
- parser->cur_chunk.type = T_TYPE_COMMENT;
- break;
-
- /* include */
- case '+':
- s++;
- parser->cur_chunk.type = T_TYPE_INCLUDE;
- break;
-
- /* translate */
- case ':':
- s++;
- parser->cur_chunk.type = T_TYPE_I18N;
- break;
-
- /* translate raw */
- case '_':
- s++;
- parser->cur_chunk.type = T_TYPE_I18N_RAW;
- break;
-
- /* expr */
- case '=':
- s++;
- parser->cur_chunk.type = T_TYPE_EXPR;
- break;
-
- /* code */
- default:
- parser->cur_chunk.type = T_TYPE_CODE;
- break;
- }
-
- parser->cur_chunk.line = parser->line;
- parser->cur_chunk.s = s;
- parser->cur_chunk.e = e;
-}
-
-static const char *
-template_format_chunk(struct template_parser *parser, size_t *sz)
-{
- const char *s, *p;
- const char *head, *tail;
- struct template_chunk *c = &parser->prv_chunk;
- struct template_buffer *buf;
-
- *sz = 0;
- s = parser->gc = NULL;
-
- if (parser->strip_before && c->type == T_TYPE_TEXT)
- {
- while ((c->e > c->s) && isspace(*(c->e - 1)))
- c->e--;
- }
-
- /* empty chunk */
- if (c->s == c->e)
- {
- if (c->type == T_TYPE_EOF)
- {
- *sz = 0;
- s = NULL;
- }
- else
- {
- *sz = 1;
- s = " ";
- }
- }
-
- /* format chunk */
- else if ((buf = buf_init(c->e - c->s)) != NULL)
- {
- if ((head = gen_code[c->type][0]) != NULL)
- buf_append(buf, head, strlen(head));
-
- switch (c->type)
- {
- case T_TYPE_TEXT:
- luastr_escape(buf, c->s, c->e - c->s, 0);
- break;
-
- case T_TYPE_EXPR:
- buf_append(buf, c->s, c->e - c->s);
- for (p = c->s; p < c->e; p++)
- parser->line += (*p == '\n');
- break;
-
- case T_TYPE_INCLUDE:
- luastr_escape(buf, c->s, c->e - c->s, 0);
- break;
-
- case T_TYPE_I18N:
- luastr_translate(buf, c->s, c->e - c->s, 1);
- break;
-
- case T_TYPE_I18N_RAW:
- luastr_translate(buf, c->s, c->e - c->s, 0);
- break;
-
- case T_TYPE_CODE:
- buf_append(buf, c->s, c->e - c->s);
- for (p = c->s; p < c->e; p++)
- parser->line += (*p == '\n');
- break;
- }
-
- if ((tail = gen_code[c->type][1]) != NULL)
- buf_append(buf, tail, strlen(tail));
-
- *sz = buf_length(buf);
- s = parser->gc = buf_destroy(buf);
-
- if (!*sz)
- {
- *sz = 1;
- s = " ";
- }
- }
-
- return s;
-}
-
-const char *template_reader(lua_State *L, void *ud, size_t *sz)
-{
- struct template_parser *parser = ud;
- int rem = parser->size - (parser->off - parser->mmap);
- char *tag;
-
- parser->prv_chunk = parser->cur_chunk;
-
- /* free previous string */
- if (parser->gc)
- {
- free(parser->gc);
- parser->gc = NULL;
- }
-
- /* before tag */
- if (!parser->in_expr)
- {
- if ((tag = strfind(parser->off, rem, "<%", 2)) != NULL)
- {
- template_text(parser, tag);
- parser->off = tag + 2;
- parser->in_expr = 1;
- }
- else
- {
- template_text(parser, parser->mmap + parser->size);
- parser->off = parser->mmap + parser->size;
- }
- }
-
- /* inside tag */
- else
- {
- if ((tag = strfind(parser->off, rem, "%>", 2)) != NULL)
- {
- template_code(parser, tag);
- parser->off = tag + 2;
- parser->in_expr = 0;
- }
- else
- {
- /* unexpected EOF */
- template_code(parser, parser->mmap + parser->size);
-
- *sz = 1;
- return "\033";
- }
- }
-
- return template_format_chunk(parser, sz);
-}
-
-int template_error(lua_State *L, struct template_parser *parser)
-{
- const char *err = luaL_checkstring(L, -1);
- const char *off = parser->prv_chunk.s;
- const char *ptr;
- char msg[1024];
- int line = 0;
- int chunkline = 0;
-
- if ((ptr = strfind((char *)err, strlen(err), "]:", 2)) != NULL)
- {
- chunkline = atoi(ptr + 2) - parser->prv_chunk.line;
-
- while (*ptr)
- {
- if (*ptr++ == ' ')
- {
- err = ptr;
- break;
- }
- }
- }
-
- if (strfind((char *)err, strlen(err), "'char(27)'", 10) != NULL)
- {
- off = parser->mmap + parser->size;
- err = "'%>' expected before end of file";
- chunkline = 0;
- }
-
- for (ptr = parser->mmap; ptr < off; ptr++)
- if (*ptr == '\n')
- line++;
-
- snprintf(msg, sizeof(msg), "Syntax error in %s:%d: %s",
- parser->file, line + chunkline, err ? err : "(unknown error)");
-
- lua_pushnil(L);
- lua_pushinteger(L, line + chunkline);
- lua_pushstring(L, msg);
-
- return 3;
-}
+++ /dev/null
-/*
- * LuCI Template - Parser header
- *
- * Copyright (C) 2009 Jo-Philipp Wich <xm@subsignal.org>
- *
- * Licensed under the Apache License, Version 2.0 (the "License");
- * you may not use this file except in compliance with the License.
- * You may obtain a copy of the License at
- *
- * http://www.apache.org/licenses/LICENSE-2.0
- *
- * Unless required by applicable law or agreed to in writing, software
- * distributed under the License is distributed on an "AS IS" BASIS,
- * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
- * See the License for the specific language governing permissions and
- * limitations under the License.
- */
-
-#ifndef _TEMPLATE_PARSER_H_
-#define _TEMPLATE_PARSER_H_
-
-#include <stdlib.h>
-#include <stdio.h>
-#include <stdint.h>
-#include <unistd.h>
-#include <fcntl.h>
-#include <sys/stat.h>
-#include <sys/mman.h>
-#include <string.h>
-#include <ctype.h>
-#include <errno.h>
-
-#include <lua.h>
-#include <lualib.h>
-#include <lauxlib.h>
-
-
-/* code types */
-#define T_TYPE_INIT 0
-#define T_TYPE_TEXT 1
-#define T_TYPE_COMMENT 2
-#define T_TYPE_EXPR 3
-#define T_TYPE_INCLUDE 4
-#define T_TYPE_I18N 5
-#define T_TYPE_I18N_RAW 6
-#define T_TYPE_CODE 7
-#define T_TYPE_EOF 8
-
-
-struct template_chunk {
- const char *s;
- const char *e;
- int type;
- int line;
-};
-
-/* parser state */
-struct template_parser {
- int fd;
- uint32_t size;
- char *mmap;
- char *off;
- char *gc;
- int line;
- int in_expr;
- int strip_before;
- int strip_after;
- struct template_chunk prv_chunk;
- struct template_chunk cur_chunk;
- const char *file;
-};
-
-struct template_parser * template_open(const char *file);
-void template_close(struct template_parser *parser);
-
-const char *template_reader(lua_State *L, void *ud, size_t *sz);
-int template_error(lua_State *L, struct template_parser *parser);
-
-#endif
+++ /dev/null
-/*
- * LuCI Template - Utility functions
- *
- * Copyright (C) 2010 Jo-Philipp Wich <xm@subsignal.org>
- *
- * Licensed under the Apache License, Version 2.0 (the "License");
- * you may not use this file except in compliance with the License.
- * You may obtain a copy of the License at
- *
- * http://www.apache.org/licenses/LICENSE-2.0
- *
- * Unless required by applicable law or agreed to in writing, software
- * distributed under the License is distributed on an "AS IS" BASIS,
- * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
- * See the License for the specific language governing permissions and
- * limitations under the License.
- */
-
-#include "template_utils.h"
-#include "template_lmo.h"
-
-/* initialize a buffer object */
-struct template_buffer * buf_init(int size)
-{
- struct template_buffer *buf;
-
- if (size <= 0)
- size = 1024;
-
- buf = (struct template_buffer *)malloc(sizeof(struct template_buffer));
-
- if (buf != NULL)
- {
- buf->fill = 0;
- buf->size = size;
- buf->data = malloc(buf->size);
-
- if (buf->data != NULL)
- {
- buf->dptr = buf->data;
- buf->data[0] = 0;
-
- return buf;
- }
-
- free(buf);
- }
-
- return NULL;
-}
-
-/* grow buffer */
-int buf_grow(struct template_buffer *buf, int size)
-{
- unsigned int off = (buf->dptr - buf->data);
- char *data;
-
- if (size <= 0)
- size = 1024;
-
- data = realloc(buf->data, buf->size + size);
-
- if (data != NULL)
- {
- buf->data = data;
- buf->dptr = data + off;
- buf->size += size;
-
- return buf->size;
- }
-
- return 0;
-}
-
-/* put one char into buffer object */
-int buf_putchar(struct template_buffer *buf, char c)
-{
- if( ((buf->fill + 1) >= buf->size) && !buf_grow(buf, 0) )
- return 0;
-
- *(buf->dptr++) = c;
- *(buf->dptr) = 0;
-
- buf->fill++;
- return 1;
-}
-
-/* append data to buffer */
-int buf_append(struct template_buffer *buf, const char *s, int len)
-{
- if ((buf->fill + len + 1) >= buf->size)
- {
- if (!buf_grow(buf, len + 1))
- return 0;
- }
-
- memcpy(buf->dptr, s, len);
- buf->fill += len;
- buf->dptr += len;
-
- *(buf->dptr) = 0;
-
- return len;
-}
-
-/* read buffer length */
-int buf_length(struct template_buffer *buf)
-{
- return buf->fill;
-}
-
-/* destroy buffer object and return pointer to data */
-char * buf_destroy(struct template_buffer *buf)
-{
- char *data = buf->data;
-
- free(buf);
- return data;
-}
-
-
-/* calculate the number of expected continuation chars */
-static inline int mb_num_chars(unsigned char c)
-{
- if ((c & 0xE0) == 0xC0)
- return 2;
- else if ((c & 0xF0) == 0xE0)
- return 3;
- else if ((c & 0xF8) == 0xF0)
- return 4;
- else if ((c & 0xFC) == 0xF8)
- return 5;
- else if ((c & 0xFE) == 0xFC)
- return 6;
-
- return 1;
-}
-
-/* test whether the given byte is a valid continuation char */
-static inline int mb_is_cont(unsigned char c)
-{
- return ((c >= 0x80) && (c <= 0xBF));
-}
-
-/* test whether the byte sequence at the given pointer with the given
- * length is the shortest possible representation of the code point */
-static inline int mb_is_shortest(unsigned char *s, int n)
-{
- switch (n)
- {
- case 2:
- /* 1100000x (10xxxxxx) */
- return !(((*s >> 1) == 0x60) &&
- ((*(s+1) >> 6) == 0x02));
-
- case 3:
- /* 11100000 100xxxxx (10xxxxxx) */
- return !((*s == 0xE0) &&
- ((*(s+1) >> 5) == 0x04) &&
- ((*(s+2) >> 6) == 0x02));
-
- case 4:
- /* 11110000 1000xxxx (10xxxxxx 10xxxxxx) */
- return !((*s == 0xF0) &&
- ((*(s+1) >> 4) == 0x08) &&
- ((*(s+2) >> 6) == 0x02) &&
- ((*(s+3) >> 6) == 0x02));
-
- case 5:
- /* 11111000 10000xxx (10xxxxxx 10xxxxxx 10xxxxxx) */
- return !((*s == 0xF8) &&
- ((*(s+1) >> 3) == 0x10) &&
- ((*(s+2) >> 6) == 0x02) &&
- ((*(s+3) >> 6) == 0x02) &&
- ((*(s+4) >> 6) == 0x02));
-
- case 6:
- /* 11111100 100000xx (10xxxxxx 10xxxxxx 10xxxxxx 10xxxxxx) */
- return !((*s == 0xF8) &&
- ((*(s+1) >> 2) == 0x20) &&
- ((*(s+2) >> 6) == 0x02) &&
- ((*(s+3) >> 6) == 0x02) &&
- ((*(s+4) >> 6) == 0x02) &&
- ((*(s+5) >> 6) == 0x02));
- }
-
- return 1;
-}
-
-/* test whether the byte sequence at the given pointer with the given
- * length is an UTF-16 surrogate */
-static inline int mb_is_surrogate(unsigned char *s, int n)
-{
- return ((n == 3) && (*s == 0xED) && (*(s+1) >= 0xA0) && (*(s+1) <= 0xBF));
-}
-
-/* test whether the byte sequence at the given pointer with the given
- * length is an illegal UTF-8 code point */
-static inline int mb_is_illegal(unsigned char *s, int n)
-{
- return ((n == 3) && (*s == 0xEF) && (*(s+1) == 0xBF) &&
- (*(s+2) >= 0xBE) && (*(s+2) <= 0xBF));
-}
-
-
-/* scan given source string, validate UTF-8 sequence and store result
- * in given buffer object */
-static int _validate_utf8(unsigned char **s, int l, struct template_buffer *buf)
-{
- unsigned char *ptr = *s;
- unsigned int o = 0, v, n;
-
- /* ascii byte without null */
- if ((*(ptr+0) >= 0x01) && (*(ptr+0) <= 0x7F))
- {
- if (!buf_putchar(buf, *ptr++))
- return 0;
-
- o = 1;
- }
-
- /* multi byte sequence */
- else if ((n = mb_num_chars(*ptr)) > 1)
- {
- /* count valid chars */
- for (v = 1; (v <= n) && ((o+v) < l) && mb_is_cont(*(ptr+v)); v++);
-
- switch (n)
- {
- case 6:
- case 5:
- /* five and six byte sequences are always invalid */
- if (!buf_putchar(buf, '?'))
- return 0;
-
- break;
-
- default:
- /* if the number of valid continuation bytes matches the
- * expected number and if the sequence is legal, copy
- * the bytes to the destination buffer */
- if ((v == n) && mb_is_shortest(ptr, n) &&
- !mb_is_surrogate(ptr, n) && !mb_is_illegal(ptr, n))
- {
- /* copy sequence */
- if (!buf_append(buf, (char *)ptr, n))
- return 0;
- }
-
- /* the found sequence is illegal, skip it */
- else
- {
- /* invalid sequence */
- if (!buf_putchar(buf, '?'))
- return 0;
- }
-
- break;
- }
-
- /* advance beyound the last found valid continuation char */
- o = v;
- ptr += v;
- }
-
- /* invalid byte (0x00) */
- else
- {
- if (!buf_putchar(buf, '?')) /* or 0xEF, 0xBF, 0xBD */
- return 0;
-
- o = 1;
- ptr++;
- }
-
- *s = ptr;
- return o;
-}
-
-/* sanitize given string and replace all invalid UTF-8 sequences with "?" */
-char * utf8(const char *s, unsigned int l)
-{
- struct template_buffer *buf = buf_init(l);
- unsigned char *ptr = (unsigned char *)s;
- unsigned int v, o;
-
- if (!buf)
- return NULL;
-
- for (o = 0; o < l; o++)
- {
- /* ascii char */
- if ((*ptr >= 0x01) && (*ptr <= 0x7F))
- {
- if (!buf_putchar(buf, (char)*ptr++))
- break;
- }
-
- /* invalid byte or multi byte sequence */
- else
- {
- if (!(v = _validate_utf8(&ptr, l - o, buf)))
- break;
-
- o += (v - 1);
- }
- }
-
- return buf_destroy(buf);
-}
-
-/* Sanitize given string and strip all invalid XML bytes
- * Validate UTF-8 sequences
- * Escape XML control chars */
-char * pcdata(const char *s, unsigned int l)
-{
- struct template_buffer *buf = buf_init(l);
- unsigned char *ptr = (unsigned char *)s;
- unsigned int o, v;
- char esq[8];
- int esl;
-
- if (!buf)
- return NULL;
-
- for (o = 0; o < l; o++)
- {
- /* Invalid XML bytes */
- if (((*ptr >= 0x00) && (*ptr <= 0x08)) ||
- ((*ptr >= 0x0B) && (*ptr <= 0x0C)) ||
- ((*ptr >= 0x0E) && (*ptr <= 0x1F)) ||
- (*ptr == 0x7F))
- {
- ptr++;
- }
-
- /* Escapes */
- else if ((*ptr == 0x26) ||
- (*ptr == 0x27) ||
- (*ptr == 0x22) ||
- (*ptr == 0x3C) ||
- (*ptr == 0x3E))
- {
- esl = snprintf(esq, sizeof(esq), "&#%i;", *ptr);
-
- if (!buf_append(buf, esq, esl))
- break;
-
- ptr++;
- }
-
- /* ascii char */
- else if (*ptr <= 0x7F)
- {
- buf_putchar(buf, (char)*ptr++);
- }
-
- /* multi byte sequence */
- else
- {
- if (!(v = _validate_utf8(&ptr, l - o, buf)))
- break;
-
- o += (v - 1);
- }
- }
-
- return buf_destroy(buf);
-}
-
-char * striptags(const char *s, unsigned int l)
-{
- struct template_buffer *buf = buf_init(l);
- unsigned char *ptr = (unsigned char *)s;
- unsigned char *end = ptr + l;
- unsigned char *tag;
- unsigned char prev;
- char esq[8];
- int esl;
-
- for (prev = ' '; ptr < end; ptr++)
- {
- if ((*ptr == '<') && ((ptr + 2) < end) &&
- ((*(ptr + 1) == '/') || isalpha(*(ptr + 1))))
- {
- for (tag = ptr; tag < end; tag++)
- {
- if (*tag == '>')
- {
- if (!isspace(prev))
- buf_putchar(buf, ' ');
-
- ptr = tag;
- prev = ' ';
- break;
- }
- }
- }
- else if (isspace(*ptr))
- {
- if (!isspace(prev))
- buf_putchar(buf, *ptr);
-
- prev = *ptr;
- }
- else
- {
- switch(*ptr)
- {
- case '"':
- case '\'':
- case '<':
- case '>':
- case '&':
- esl = snprintf(esq, sizeof(esq), "&#%i;", *ptr);
- buf_append(buf, esq, esl);
- break;
-
- default:
- buf_putchar(buf, *ptr);
- break;
- }
-
- prev = *ptr;
- }
- }
-
- return buf_destroy(buf);
-}
-
-void luastr_escape(struct template_buffer *out, const char *s, unsigned int l,
- int escape_xml)
-{
- int esl;
- char esq[8];
- char *ptr;
-
- for (ptr = (char *)s; ptr < (s + l); ptr++)
- {
- switch (*ptr)
- {
- case '\\':
- buf_append(out, "\\\\", 2);
- break;
-
- case '"':
- if (escape_xml)
- buf_append(out, """, 5);
- else
- buf_append(out, "\\\"", 2);
- break;
-
- case '\n':
- buf_append(out, "\\n", 2);
- break;
-
- case '\'':
- case '&':
- case '<':
- case '>':
- if (escape_xml)
- {
- esl = snprintf(esq, sizeof(esq), "&#%i;", *ptr);
- buf_append(out, esq, esl);
- break;
- }
-
- default:
- buf_putchar(out, *ptr);
- }
- }
-}
-
-void luastr_translate(struct template_buffer *out, const char *s, unsigned int l,
- int escape_xml)
-{
- char *tr;
- int trlen;
-
- switch (lmo_translate(s, l, &tr, &trlen))
- {
- case 0:
- luastr_escape(out, tr, trlen, escape_xml);
- break;
-
- case -1:
- luastr_escape(out, s, l, escape_xml);
- break;
-
- default:
- /* no catalog loaded */
- break;
- }
-}
+++ /dev/null
-/*
- * LuCI Template - Utility header
- *
- * Copyright (C) 2010-2012 Jo-Philipp Wich <xm@subsignal.org>
- *
- * Licensed under the Apache License, Version 2.0 (the "License");
- * you may not use this file except in compliance with the License.
- * You may obtain a copy of the License at
- *
- * http://www.apache.org/licenses/LICENSE-2.0
- *
- * Unless required by applicable law or agreed to in writing, software
- * distributed under the License is distributed on an "AS IS" BASIS,
- * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
- * See the License for the specific language governing permissions and
- * limitations under the License.
- */
-
-#ifndef _TEMPLATE_UTILS_H_
-#define _TEMPLATE_UTILS_H_
-
-#include <stdlib.h>
-#include <stdio.h>
-#include <string.h>
-
-
-/* buffer object */
-struct template_buffer {
- char *data;
- char *dptr;
- unsigned int size;
- unsigned int fill;
-};
-
-struct template_buffer * buf_init(int size);
-int buf_grow(struct template_buffer *buf, int size);
-int buf_putchar(struct template_buffer *buf, char c);
-int buf_append(struct template_buffer *buf, const char *s, int len);
-int buf_length(struct template_buffer *buf);
-char * buf_destroy(struct template_buffer *buf);
-
-char * utf8(const char *s, unsigned int l);
-char * pcdata(const char *s, unsigned int l);
-char * striptags(const char *s, unsigned int l);
-
-void luastr_escape(struct template_buffer *out, const char *s, unsigned int l, int escape_xml);
-void luastr_translate(struct template_buffer *out, const char *s, unsigned int l, int escape_xml);
-
-#endif
+++ /dev/null
-LUAC = luac
-LUAC_OPTIONS = -s
-LUA_TARGET ?= source
-
-LUA_MODULEDIR = /usr/local/share/lua/5.1
-LUA_LIBRARYDIR = /usr/local/lib/lua/5.1
-
-OS ?= $(shell uname)
-
-LUA_SHLIBS = $(shell pkg-config --silence-errors --libs lua5.1 || pkg-config --silence-errors --libs lua-5.1 || pkg-config --silence-errors --libs lua)
-LUA_LIBS = $(if $(LUA_SHLIBS),$(LUA_SHLIBS),$(firstword $(wildcard /usr/lib/liblua.a /usr/local/lib/liblua.a /opt/local/lib/liblua.a)))
-LUA_CFLAGS = $(shell pkg-config --silence-errors --cflags lua5.1 || pkg-config --silence-errors --cflags lua-5.1 || pkg-config --silence-errors --cflags lua)
-
-CC = gcc
-AR = ar
-RANLIB = ranlib
-CFLAGS = -O2
-FPIC = -fPIC
-EXTRA_CFLAGS = --std=gnu99
-WFLAGS = -Wall -Werror -pedantic
-CPPFLAGS =
-COMPILE = $(CC) $(CPPFLAGS) $(CFLAGS) $(EXTRA_CFLAGS) $(WFLAGS)
-ifeq ($(OS),Darwin)
- SHLIB_FLAGS = -bundle -undefined dynamic_lookup
-else
- SHLIB_FLAGS = -shared
-endif
-LINK = $(CC) $(LDFLAGS)
-
-.PHONY: all build compile luacompile luasource clean luaclean
-
-all: build
-
-build: luabuild gccbuild
-
-luabuild: lua$(LUA_TARGET)
-
-gccbuild: compile
-compile:
-
-clean: luaclean
-
-luasource:
- mkdir -p dist$(LUA_MODULEDIR)
- cp -pR root/* dist 2>/dev/null || true
- cp -pR lua/* dist$(LUA_MODULEDIR) 2>/dev/null || true
- for i in $$(find dist -name .svn); do rm -rf $$i || true; done
-
-luastrip: luasource
- for i in $$(find dist -type f -name '*.lua'); do perl -e 'undef $$/; open( F, "< $$ARGV[0]" ) || die $$!; $$src = <F>; close F; $$src =~ s/--\[\[.*?\]\](--)?//gs; $$src =~ s/^\s*--.*?\n//gm; open( F, "> $$ARGV[0]" ) || die $$!; print F $$src; close F' $$i; done
-
-luacompile: luasource
- for i in $$(find dist -name *.lua -not -name debug.lua); do $(LUAC) $(LUAC_OPTIONS) -o $$i $$i; done
-
-luaclean:
- rm -rf dist
+++ /dev/null
-include ../../build/config.mk
-include ../../build/module.mk
\ No newline at end of file
+++ /dev/null
-#!/bin/sh
-
-[ -n "${IPKG_INSTROOT}" ] || {
- /etc/init.d/luci_fixtime enabled || /etc/init.d/luci_fixtime enable
- /etc/init.d/luci_dhcp_migrate enabled || /etc/init.d/luci_dhcp_migrate enable
- exit 0
-}
+++ /dev/null
---[[
-LuCI - Lua Configuration Interface
-
-Copyright 2010 Jo-Philipp Wich <xm@subsignal.org>
-
-Licensed under the Apache License, Version 2.0 (the "License");
-you may not use this file except in compliance with the License.
-You may obtain a copy of the License at
-
- http://www.apache.org/licenses/LICENSE-2.0
-
-$Id$
-]]--
-
-module("luci.controller.admin.servicectl", package.seeall)
-
-function index()
- entry({"servicectl"}, alias("servicectl", "status")).sysauth = "root"
- entry({"servicectl", "status"}, call("action_status")).leaf = true
- entry({"servicectl", "restart"}, call("action_restart")).leaf = true
-end
-
-function action_status()
- local data = nixio.fs.readfile("/var/run/luci-reload-status")
- if data then
- luci.http.write("/etc/config/")
- luci.http.write(data)
- else
- luci.http.write("finish")
- end
-end
-
-function action_restart(args)
- local uci = require "luci.model.uci".cursor()
- if args then
- local service
- local services = { }
-
- for service in args:gmatch("[%w_-]+") do
- services[#services+1] = service
- end
-
- local command = uci:apply(services, true)
- if nixio.fork() == 0 then
- local i = nixio.open("/dev/null", "r")
- local o = nixio.open("/dev/null", "w")
-
- nixio.dup(i, nixio.stdin)
- nixio.dup(o, nixio.stdout)
-
- i:close()
- o:close()
-
- nixio.exec("/bin/sh", unpack(command))
- else
- luci.http.write("OK")
- os.exit(0)
- end
- end
-end
+++ /dev/null
---[[
-LuCI - Lua Configuration Interface
-
-Copyright 2011 Jo-Philipp Wich <xm@subsignal.org>
-
-Licensed under the Apache License, Version 2.0 (the "License");
-you may not use this file except in compliance with the License.
-You may obtain a copy of the License at
-
- http://www.apache.org/licenses/LICENSE-2.0
-
-]]--
-
-module("luci.tools.status", package.seeall)
-
-local uci = require "luci.model.uci".cursor()
-
-local function dhcp_leases_common(family)
- local rv = { }
- local nfs = require "nixio.fs"
- local leasefile = "/var/dhcp.leases"
-
- uci:foreach("dhcp", "dnsmasq",
- function(s)
- if s.leasefile and nfs.access(s.leasefile) then
- leasefile = s.leasefile
- return false
- end
- end)
-
- local fd = io.open(leasefile, "r")
- if fd then
- while true do
- local ln = fd:read("*l")
- if not ln then
- break
- else
- local ts, mac, ip, name, duid = ln:match("^(%d+) (%S+) (%S+) (%S+) (%S+)")
- if ts and mac and ip and name and duid then
- if family == 4 and not ip:match(":") then
- rv[#rv+1] = {
- expires = os.difftime(tonumber(ts) or 0, os.time()),
- macaddr = mac,
- ipaddr = ip,
- hostname = (name ~= "*") and name
- }
- elseif family == 6 and ip:match(":") then
- rv[#rv+1] = {
- expires = os.difftime(tonumber(ts) or 0, os.time()),
- ip6addr = ip,
- duid = (duid ~= "*") and duid,
- hostname = (name ~= "*") and name
- }
- end
- end
- end
- end
- fd:close()
- end
-
- local fd = io.open("/tmp/hosts/odhcpd", "r")
- if fd then
- while true do
- local ln = fd:read("*l")
- if not ln then
- break
- else
- local iface, duid, iaid, name, ts, id, length, ip = ln:match("^# (%S+) (%S+) (%S+) (%S+) (%d+) (%S+) (%S+) (.*)")
- if ip and iaid ~= "ipv4" and family == 6 then
- rv[#rv+1] = {
- expires = os.difftime(tonumber(ts) or 0, os.time()),
- duid = duid,
- ip6addr = ip,
- hostname = (name ~= "-") and name
- }
- elseif ip and iaid == "ipv4" and family == 4 then
- rv[#rv+1] = {
- expires = os.difftime(tonumber(ts) or 0, os.time()),
- macaddr = duid,
- ipaddr = ip,
- hostname = (name ~= "-") and name
- }
- end
- end
- end
- fd:close()
- end
-
- return rv
-end
-
-function dhcp_leases()
- return dhcp_leases_common(4)
-end
-
-function dhcp6_leases()
- return dhcp_leases_common(6)
-end
-
-function wifi_networks()
- local rv = { }
- local ntm = require "luci.model.network".init()
-
- local dev
- for _, dev in ipairs(ntm:get_wifidevs()) do
- local rd = {
- up = dev:is_up(),
- device = dev:name(),
- name = dev:get_i18n(),
- networks = { }
- }
-
- local net
- for _, net in ipairs(dev:get_wifinets()) do
- rd.networks[#rd.networks+1] = {
- name = net:shortname(),
- link = net:adminlink(),
- up = net:is_up(),
- mode = net:active_mode(),
- ssid = net:active_ssid(),
- bssid = net:active_bssid(),
- encryption = net:active_encryption(),
- frequency = net:frequency(),
- channel = net:channel(),
- signal = net:signal(),
- quality = net:signal_percent(),
- noise = net:noise(),
- bitrate = net:bitrate(),
- ifname = net:ifname(),
- assoclist = net:assoclist(),
- country = net:country(),
- txpower = net:txpower(),
- txpoweroff = net:txpower_offset()
- }
- end
-
- rv[#rv+1] = rd
- end
-
- return rv
-end
-
-function wifi_network(id)
- local ntm = require "luci.model.network".init()
- local net = ntm:get_wifinet(id)
- if net then
- local dev = net:get_device()
- if dev then
- return {
- id = id,
- name = net:shortname(),
- link = net:adminlink(),
- up = net:is_up(),
- mode = net:active_mode(),
- ssid = net:active_ssid(),
- bssid = net:active_bssid(),
- encryption = net:active_encryption(),
- frequency = net:frequency(),
- channel = net:channel(),
- signal = net:signal(),
- quality = net:signal_percent(),
- noise = net:noise(),
- bitrate = net:bitrate(),
- ifname = net:ifname(),
- assoclist = net:assoclist(),
- country = net:country(),
- txpower = net:txpower(),
- txpoweroff = net:txpower_offset(),
- device = {
- up = dev:is_up(),
- device = dev:name(),
- name = dev:get_i18n()
- }
- }
- end
- end
- return { }
-end
-
-function switch_status(devs)
- local dev
- local switches = { }
- for dev in devs:gmatch("[^%s,]+") do
- local ports = { }
- local swc = io.popen("swconfig dev %q show" % dev, "r")
- if swc then
- local l
- repeat
- l = swc:read("*l")
- if l then
- local port, up = l:match("port:(%d+) link:(%w+)")
- if port then
- local speed = l:match(" speed:(%d+)")
- local duplex = l:match(" (%w+)-duplex")
- local txflow = l:match(" (txflow)")
- local rxflow = l:match(" (rxflow)")
- local auto = l:match(" (auto)")
-
- ports[#ports+1] = {
- port = tonumber(port) or 0,
- speed = tonumber(speed) or 0,
- link = (up == "up"),
- duplex = (duplex == "full"),
- rxflow = (not not rxflow),
- txflow = (not not txflow),
- auto = (not not auto)
- }
- end
- end
- until not l
- swc:close()
- end
- switches[dev] = ports
- end
- return switches
-end
+++ /dev/null
---[[
-LuCI - Lua Configuration Interface
-
-Copyright 2008 Steven Barth <steven@midlink.org>
-Copyright 2008 Jo-Philipp Wich <xm@leipzig.freifunk.net>
-
-Licensed under the Apache License, Version 2.0 (the "License");
-you may not use this file except in compliance with the License.
-You may obtain a copy of the License at
-
- http://www.apache.org/licenses/LICENSE-2.0
-
-$Id$
-]]--
-
-module("luci.tools.webadmin", package.seeall)
-local uci = require("luci.model.uci")
-require("luci.sys")
-require("luci.ip")
-
-function byte_format(byte)
- local suff = {"B", "KB", "MB", "GB", "TB"}
- for i=1, 5 do
- if byte > 1024 and i < 5 then
- byte = byte / 1024
- else
- return string.format("%.2f %s", byte, suff[i])
- end
- end
-end
-
-function date_format(secs)
- local suff = {"min", "h", "d"}
- local mins = 0
- local hour = 0
- local days = 0
-
- secs = math.floor(secs)
- if secs > 60 then
- mins = math.floor(secs / 60)
- secs = secs % 60
- end
-
- if mins > 60 then
- hour = math.floor(mins / 60)
- mins = mins % 60
- end
-
- if hour > 24 then
- days = math.floor(hour / 24)
- hour = hour % 24
- end
-
- if days > 0 then
- return string.format("%.0fd %02.0fh %02.0fmin %02.0fs", days, hour, mins, secs)
- else
- return string.format("%02.0fh %02.0fmin %02.0fs", hour, mins, secs)
- end
-end
-
-function network_get_addresses(net)
- local state = uci.cursor_state()
- state:load("network")
- local addr = {}
- local ipv4 = state:get("network", net, "ipaddr")
- local mav4 = state:get("network", net, "netmask")
- local ipv6 = state:get("network", net, "ip6addr")
-
- if ipv4 and #ipv4 > 0 then
- if mav4 and #mav4 == 0 then mav4 = nil end
-
- ipv4 = luci.ip.IPv4(ipv4, mav4)
-
- if ipv4 then
- table.insert(addr, ipv4:string())
- end
- end
-
- if ipv6 then
- table.insert(addr, ipv6)
- end
-
- state:foreach("network", "alias",
- function (section)
- if section.interface == net then
- if section.ipaddr and section.netmask then
- local ipv4 = luci.ip.IPv4(section.ipaddr, section.netmask)
-
- if ipv4 then
- table.insert(addr, ipv4:string())
- end
- end
-
- if section.ip6addr then
- table.insert(addr, section.ip6addr)
- end
- end
- end
- )
-
- return addr
-end
-
-function cbi_add_networks(field)
- uci.cursor():foreach("network", "interface",
- function (section)
- if section[".name"] ~= "loopback" then
- field:value(section[".name"])
- end
- end
- )
- field.titleref = luci.dispatcher.build_url("admin", "network", "network")
-end
-
-function cbi_add_knownips(field)
- for i, dataset in ipairs(luci.sys.net.arptable()) do
- field:value(dataset["IP address"])
- end
-end
-
-function network_get_zones(net)
- local state = uci.cursor_state()
- if not state:load("firewall") then
- return nil
- end
-
- local zones = {}
-
- state:foreach("firewall", "zone",
- function (section)
- local znet = section.network or section.name
- if luci.util.contains(luci.util.split(znet, " "), net) then
- table.insert(zones, section.name)
- end
- end
- )
-
- return zones
-end
-
-function firewall_find_zone(name)
- local find
-
- luci.model.uci.cursor():foreach("firewall", "zone",
- function (section)
- if section.name == name then
- find = section[".name"]
- end
- end
- )
-
- return find
-end
-
-function iface_get_network(iface)
- local state = uci.cursor_state()
- state:load("network")
- local net
-
- state:foreach("network", "interface",
- function (section)
- local ifname = state:get(
- "network", section[".name"], "ifname"
- )
-
- if iface == ifname then
- net = section[".name"]
- end
- end
- )
-
- return net
-end
+++ /dev/null
-<%#
-LuCI - Lua Configuration Interface
-Copyright 2008 Steven Barth <steven@midlink.org>
-Copyright 2008 Jo-Philipp Wich <xm@leipzig.freifunk.net>
-
-Licensed under the Apache License, Version 2.0 (the "License");
-you may not use this file except in compliance with the License.
-You may obtain a copy of the License at
-
- http://www.apache.org/licenses/LICENSE-2.0
-
-$Id$
-
--%>
-<%+header%>
-<h2><a id="content" name="content">404 <%:Not Found%></a></h2>
-<p><%:Sorry, the object you requested was not found.%></p>
-<tt><%:Unable to dispatch%>: <%=luci.http.request.env.PATH_INFO%></tt>
-<%+footer%>
+++ /dev/null
-<%#
-LuCI - Lua Configuration Interface
-Copyright 2008 Steven Barth <steven@midlink.org>
-Copyright 2008 Jo-Philipp Wich <xm@leipzig.freifunk.net>
-
-Licensed under the Apache License, Version 2.0 (the "License");
-you may not use this file except in compliance with the License.
-You may obtain a copy of the License at
-
- http://www.apache.org/licenses/LICENSE-2.0
-
-$Id$
-
--%>
-<%+header%>
-<h2><a id="content" name="content">500 <%:Internal Server Error%></a></h2>
-<p><%:Sorry, the server encountered an unexpected error.%></p>
-<pre class="error500"><%=message%></pre>
-<%+footer%>
+++ /dev/null
-<%#
-LuCI - Lua Configuration Interface
-Copyright 2008 Steven Barth <steven@midlink.org>
-Copyright 2008 Jo-Philipp Wich <xm@leipzig.freifunk.net>
-
-Licensed under the Apache License, Version 2.0 (the "License");
-you may not use this file except in compliance with the License.
-You may obtain a copy of the License at
-
- http://www.apache.org/licenses/LICENSE-2.0
-
-$Id$
-
--%>
-<% include("themes/" .. theme .. "/footer") %>
\ No newline at end of file
+++ /dev/null
-<%#
-LuCI - Lua Configuration Interface
-Copyright 2008 Steven Barth <steven@midlink.org>
-Copyright 2008 Jo-Philipp Wich <xm@leipzig.freifunk.net>
-
-Licensed under the Apache License, Version 2.0 (the "License");
-you may not use this file except in compliance with the License.
-You may obtain a copy of the License at
-
- http://www.apache.org/licenses/LICENSE-2.0
-
-$Id$
-
--%>
-
-<%
- if not luci.dispatcher.context.template_header_sent then
- include("themes/" .. theme .. "/header")
- luci.dispatcher.context.template_header_sent = true
- end
-%>
+++ /dev/null
-<%#
-LuCI - Lua Configuration Interface
-Copyright 2008 Steven Barth <steven@midlink.org>
-Copyright 2008 Jo-Philipp Wich <xm@leipzig.freifunk.net>
-
-Licensed under the Apache License, Version 2.0 (the "License");
-you may not use this file except in compliance with the License.
-You may obtain a copy of the License at
-
- http://www.apache.org/licenses/LICENSE-2.0
-
-$Id$
-
--%>
-<% include("themes/" .. theme .. "/indexer") %>
\ No newline at end of file
+++ /dev/null
-<%#
-LuCI - Lua Configuration Interface
-Copyright 2008 Steven Barth <steven@midlink.org>
-Copyright 2008-2012 Jo-Philipp Wich <xm@subsignal.org>
-
-Licensed under the Apache License, Version 2.0 (the "License");
-you may not use this file except in compliance with the License.
-You may obtain a copy of the License at
-
- http://www.apache.org/licenses/LICENSE-2.0
-
--%>
-
-<%+header%>
-
-<form method="post" action="<%=pcdata(luci.http.getenv("REQUEST_URI"))%>">
- <div class="cbi-map">
- <h2><a id="content" name="content"><%:Authorization Required%></a></h2>
- <div class="cbi-map-descr">
- <%:Please enter your username and password.%>
- <%- if fuser then %>
- <div class="error"><%:Invalid username and/or password! Please try again.%></div>
- <br />
- <% end -%>
- </div>
- <fieldset class="cbi-section"><fieldset class="cbi-section-node">
- <div class="cbi-value">
- <label class="cbi-value-title"><%:Username%></label>
- <div class="cbi-value-field">
- <input class="cbi-input-user" type="text" name="username" value="<%=duser%>" />
- </div>
- </div>
- <div class="cbi-value cbi-value-last">
- <label class="cbi-value-title"><%:Password%></label>
- <div class="cbi-value-field">
- <input id="focus_password" class="cbi-input-password" type="password" name="password" />
- </div>
- </div>
- </fieldset></fieldset>
- </div>
-
- <div>
- <input type="submit" value="<%:Login%>" class="cbi-button cbi-button-apply" />
- <input type="reset" value="<%:Reset%>" class="cbi-button cbi-button-reset" />
- </div>
-</form>
-<script type="text/javascript">//<![CDATA[
- var input = document.getElementById('focus_password');
- if (input)
- input.focus();
-//]]></script>
-
-<%
-local uci = require "luci.model.uci".cursor()
-local fs = require "nixio.fs"
-local https_key = uci:get("uhttpd", "main", "key")
-local https_port = uci:get("uhttpd", "main", "listen_https")
-if type(https_port) == "table" then
- https_port = https_port[1]
-end
-
-if https_port and fs.access(https_key) then
- https_port = https_port:match("(%d+)$")
-%>
-
-<script type="text/javascript">//<![CDATA[
- if (document.location.protocol != 'https:') {
- var url = 'https://' + window.location.hostname + ':' + '<%=https_port%>' + window.location.pathname;
- var img=new Image;
- img.onload=function(){window.location = url};
- img.src='https://' + window.location.hostname + ':' + '<%=https_port%>' + '<%=resource%>/cbi/up.gif?' + Math.random();;
- setTimeout(function(){
- img.src=''
- }, 5000);
- }
-//]]></script>
-
-<% end %>
-
-<%+footer%>
+++ /dev/null
-#!/bin/sh /etc/rc.common
-
-START=59
-
-boot() {
- if [ -f /etc/config/luci_ethers ]; then
- logger -t luci_dhcp_migrate "Migrating luci_ethers configuration ..."
-
- lua -lluci.model.uci -e '
- x=luci.model.uci.cursor()
- x:foreach("luci_ethers", "static_lease",
- function(s)
- x:section("dhcp", "host", nil, {mac=s.macaddr, ip=s.ipaddr})
- end)
- x:save("dhcp")
- x:commit("dhcp")
- '
-
- rm -f /etc/config/luci_ethers
- fi
-
- if [ -f /etc/config/luci_hosts ]; then
- logger -t luci_dhcp_migrate "Migrating luci_hosts configuration ..."
-
- lua -lluci.model.uci -e '
- x=luci.model.uci.cursor()
- x:foreach("luci_hosts", "host",
- function(s)
- x:section("dhcp", "domain", nil, {name=s.hostname, ip=s.ipaddr})
- end)
- x:save("dhcp")
- x:commit("dhcp")
- '
-
- rm -f /etc/config/luci_hosts
- fi
-}
-
-start() { :; }
-stop() { :; }
-
+++ /dev/null
-#!/bin/sh /etc/rc.common
-
-START=05
-STOP=95
-
-start() {
- cat <<' EOF' | lua -l luci.fs -l luci.util -
- if (os.time() < 1000000000) then
- os.execute('date -s ' .. os.date('%Y%m%d%H%M', luci.fs.mtime("/etc/init.d/luci_fixtime")))
- end
- EOF
-}
-
-stop() {
- [[ -w /etc/init.d/luci_fixtime ]] && cat /dev/null >> /etc/init.d/luci_fixtime && touch /etc/init.d/luci_fixtime
-}
+++ /dev/null
-<?xml version="1.0" encoding="utf-8"?>
-<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.1//EN" "http://www.w3.org/TR/xhtml11/DTD/xhtml11.dtd">
-<html xmlns="http://www.w3.org/1999/xhtml">
-<head>
-<meta http-equiv="refresh" content="0; URL=/cgi-bin/luci" />
-</head>
-<body style="background-color: black">
-<a style="color: white; text-decoration: none" href="/cgi-bin/luci">LuCI - Lua Configuration Interface</a>
-</body>
-</html>
--- /dev/null
+ifneq (,$(wildcard ../../build/config.mk))
+include ../../build/config.mk
+include ../../build/module.mk
+include ../../build/gccconfig.mk
+else
+include standalone.mk
+endif
+
+TPL_LDFLAGS =
+TPL_CFLAGS =
+TPL_SO = parser.so
+TPL_PO2LMO = po2lmo
+TPL_PO2LMO_OBJ = src/po2lmo.o
+TPL_LMO_OBJ = src/template_lmo.o
+TPL_COMMON_OBJ = src/template_parser.o src/template_utils.o
+TPL_LUALIB_OBJ = src/template_lualib.o
+
+%.o: %.c
+ $(COMPILE) $(TPL_CFLAGS) $(LUA_CFLAGS) $(FPIC) -c -o $@ $<
+
+compile: build-clean $(TPL_COMMON_OBJ) $(TPL_LUALIB_OBJ) $(TPL_LMO_OBJ) $(TPL_PO2LMO_OBJ)
+ $(LINK) $(SHLIB_FLAGS) $(TPL_LDFLAGS) -o src/$(TPL_SO) \
+ $(TPL_COMMON_OBJ) $(TPL_LMO_OBJ) $(TPL_LUALIB_OBJ)
+ $(LINK) -o src/$(TPL_PO2LMO) \
+ $(TPL_LMO_OBJ) $(TPL_PO2LMO_OBJ)
+ mkdir -p dist$(LUCI_LIBRARYDIR)/template
+ cp src/$(TPL_SO) dist$(LUCI_LIBRARYDIR)/template/$(TPL_SO)
+
+install: build
+ cp -pR dist$(LUA_LIBRARYDIR)/* $(LUA_LIBRARYDIR)
+
+clean: build-clean
+
+build-clean:
+ rm -f src/*.o src/$(TPL_SO)
+
+host-compile: build-clean host-clean $(TPL_LMO_OBJ) $(TPL_PO2LMO_OBJ)
+ $(LINK) -o src/$(TPL_PO2LMO) $(TPL_LMO_OBJ) $(TPL_PO2LMO_OBJ)
+
+host-install: host-compile
+ cp src/$(TPL_PO2LMO) ../../build/$(TPL_PO2LMO)
+
+host-clean:
+ rm -f src/$(TPL_PO2LMO)
+ rm -f ../../build/$(TPL_PO2LMO)
--- /dev/null
+#!/usr/bin/lua
+require "luci.cacheloader"
+require "luci.sgi.cgi"
+luci.dispatcher.indexcache = "/tmp/luci-indexcache"
+luci.sgi.cgi.run()
\ No newline at end of file
--- /dev/null
+/*
+ LuCI - Lua Configuration Interface
+
+ Copyright 2008 Steven Barth <steven@midlink.org>
+ Copyright 2008-2012 Jo-Philipp Wich <xm@subsignal.org>
+
+ Licensed under the Apache License, Version 2.0 (the "License");
+ you may not use this file except in compliance with the License.
+ You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+*/
+
+var cbi_d = [];
+var cbi_t = [];
+var cbi_c = [];
+
+var cbi_validators = {
+
+ 'integer': function()
+ {
+ return (this.match(/^-?[0-9]+$/) != null);
+ },
+
+ 'uinteger': function()
+ {
+ return (cbi_validators.integer.apply(this) && (this >= 0));
+ },
+
+ 'float': function()
+ {
+ return !isNaN(parseFloat(this));
+ },
+
+ 'ufloat': function()
+ {
+ return (cbi_validators['float'].apply(this) && (this >= 0));
+ },
+
+ 'ipaddr': function()
+ {
+ return cbi_validators.ip4addr.apply(this) ||
+ cbi_validators.ip6addr.apply(this);
+ },
+
+ 'ip4addr': function()
+ {
+ if (this.match(/^(\d{1,3})\.(\d{1,3})\.(\d{1,3})\.(\d{1,3})(\/(\S+))?$/))
+ {
+ return (RegExp.$1 >= 0) && (RegExp.$1 <= 255) &&
+ (RegExp.$2 >= 0) && (RegExp.$2 <= 255) &&
+ (RegExp.$3 >= 0) && (RegExp.$3 <= 255) &&
+ (RegExp.$4 >= 0) && (RegExp.$4 <= 255) &&
+ ((RegExp.$6.indexOf('.') < 0)
+ ? ((RegExp.$6 >= 0) && (RegExp.$6 <= 32))
+ : (cbi_validators.ip4addr.apply(RegExp.$6)))
+ ;
+ }
+
+ return false;
+ },
+
+ 'ip6addr': function()
+ {
+ if( this.match(/^([a-fA-F0-9:.]+)(\/(\d+))?$/) )
+ {
+ if( !RegExp.$2 || ((RegExp.$3 >= 0) && (RegExp.$3 <= 128)) )
+ {
+ var addr = RegExp.$1;
+
+ if( addr == '::' )
+ {
+ return true;
+ }
+
+ if( addr.indexOf('.') > 0 )
+ {
+ var off = addr.lastIndexOf(':');
+
+ if( !(off && cbi_validators.ip4addr.apply(addr.substr(off+1))) )
+ return false;
+
+ addr = addr.substr(0, off) + ':0:0';
+ }
+
+ if( addr.indexOf('::') >= 0 )
+ {
+ var colons = 0;
+ var fill = '0';
+
+ for( var i = 1; i < (addr.length-1); i++ )
+ if( addr.charAt(i) == ':' )
+ colons++;
+
+ if( colons > 7 )
+ return false;
+
+ for( var i = 0; i < (7 - colons); i++ )
+ fill += ':0';
+
+ if (addr.match(/^(.*?)::(.*?)$/))
+ addr = (RegExp.$1 ? RegExp.$1 + ':' : '') + fill +
+ (RegExp.$2 ? ':' + RegExp.$2 : '');
+ }
+
+ return (addr.match(/^(?:[a-fA-F0-9]{1,4}:){7}[a-fA-F0-9]{1,4}$/) != null);
+ }
+ }
+
+ return false;
+ },
+
+ 'port': function()
+ {
+ return cbi_validators.integer.apply(this) &&
+ (this >= 0) && (this <= 65535);
+ },
+
+ 'portrange': function()
+ {
+ if (this.match(/^(\d+)-(\d+)$/))
+ {
+ var p1 = RegExp.$1;
+ var p2 = RegExp.$2;
+
+ return cbi_validators.port.apply(p1) &&
+ cbi_validators.port.apply(p2) &&
+ (parseInt(p1) <= parseInt(p2))
+ ;
+ }
+ else
+ {
+ return cbi_validators.port.apply(this);
+ }
+ },
+
+ 'macaddr': function()
+ {
+ return (this.match(/^([a-fA-F0-9]{2}:){5}[a-fA-F0-9]{2}$/) != null);
+ },
+
+ 'host': function()
+ {
+ return cbi_validators.hostname.apply(this) ||
+ cbi_validators.ipaddr.apply(this);
+ },
+
+ 'hostname': function()
+ {
+ if (this.length <= 253)
+ return (this.match(/^[a-zA-Z0-9]+$/) != null ||
+ (this.match(/^[a-zA-Z0-9_][a-zA-Z0-9_\-.]*[a-zA-Z0-9]$/) &&
+ this.match(/[^0-9.]/)));
+
+ return false;
+ },
+
+ 'network': function()
+ {
+ return cbi_validators.uciname.apply(this) ||
+ cbi_validators.host.apply(this);
+ },
+
+ 'wpakey': function()
+ {
+ var v = this;
+
+ if( v.length == 64 )
+ return (v.match(/^[a-fA-F0-9]{64}$/) != null);
+ else
+ return (v.length >= 8) && (v.length <= 63);
+ },
+
+ 'wepkey': function()
+ {
+ var v = this;
+
+ if ( v.substr(0,2) == 's:' )
+ v = v.substr(2);
+
+ if( (v.length == 10) || (v.length == 26) )
+ return (v.match(/^[a-fA-F0-9]{10,26}$/) != null);
+ else
+ return (v.length == 5) || (v.length == 13);
+ },
+
+ 'uciname': function()
+ {
+ return (this.match(/^[a-zA-Z0-9_]+$/) != null);
+ },
+
+ 'range': function(min, max)
+ {
+ var val = parseFloat(this);
+ if (!isNaN(min) && !isNaN(max) && !isNaN(val))
+ return ((val >= min) && (val <= max));
+
+ return false;
+ },
+
+ 'min': function(min)
+ {
+ var val = parseFloat(this);
+ if (!isNaN(min) && !isNaN(val))
+ return (val >= min);
+
+ return false;
+ },
+
+ 'max': function(max)
+ {
+ var val = parseFloat(this);
+ if (!isNaN(max) && !isNaN(val))
+ return (val <= max);
+
+ return false;
+ },
+
+ 'rangelength': function(min, max)
+ {
+ var val = '' + this;
+ if (!isNaN(min) && !isNaN(max))
+ return ((val.length >= min) && (val.length <= max));
+
+ return false;
+ },
+
+ 'minlength': function(min)
+ {
+ var val = '' + this;
+ if (!isNaN(min))
+ return (val.length >= min);
+
+ return false;
+ },
+
+ 'maxlength': function(max)
+ {
+ var val = '' + this;
+ if (!isNaN(max))
+ return (val.length <= max);
+
+ return false;
+ },
+
+ 'or': function()
+ {
+ for (var i = 0; i < arguments.length; i += 2)
+ {
+ if (typeof arguments[i] != 'function')
+ {
+ if (arguments[i] == this)
+ return true;
+ i--;
+ }
+ else if (arguments[i].apply(this, arguments[i+1]))
+ {
+ return true;
+ }
+ }
+ return false;
+ },
+
+ 'and': function()
+ {
+ for (var i = 0; i < arguments.length; i += 2)
+ {
+ if (typeof arguments[i] != 'function')
+ {
+ if (arguments[i] != this)
+ return false;
+ i--;
+ }
+ else if (!arguments[i].apply(this, arguments[i+1]))
+ {
+ return false;
+ }
+ }
+ return true;
+ },
+
+ 'neg': function()
+ {
+ return cbi_validators.or.apply(
+ this.replace(/^[ \t]*![ \t]*/, ''), arguments);
+ },
+
+ 'list': function(subvalidator, subargs)
+ {
+ if (typeof subvalidator != 'function')
+ return false;
+
+ var tokens = this.match(/[^ \t]+/g);
+ for (var i = 0; i < tokens.length; i++)
+ if (!subvalidator.apply(tokens[i], subargs))
+ return false;
+
+ return true;
+ },
+ 'phonedigit': function()
+ {
+ return (this.match(/^[0-9\*#!\.]+$/) != null);
+ }
+};
+
+
+function cbi_d_add(field, dep, next) {
+ var obj = document.getElementById(field);
+ if (obj) {
+ var entry
+ for (var i=0; i<cbi_d.length; i++) {
+ if (cbi_d[i].id == field) {
+ entry = cbi_d[i];
+ break;
+ }
+ }
+ if (!entry) {
+ entry = {
+ "node": obj,
+ "id": field,
+ "parent": obj.parentNode.id,
+ "next": next,
+ "deps": []
+ };
+ cbi_d.unshift(entry);
+ }
+ entry.deps.push(dep)
+ }
+}
+
+function cbi_d_checkvalue(target, ref) {
+ var t = document.getElementById(target);
+ var value;
+
+ if (!t) {
+ var tl = document.getElementsByName(target);
+
+ if( tl.length > 0 && (tl[0].type == 'radio' || tl[0].type == 'checkbox'))
+ for( var i = 0; i < tl.length; i++ )
+ if( tl[i].checked ) {
+ value = tl[i].value;
+ break;
+ }
+
+ value = value ? value : "";
+ } else if (!t.value) {
+ value = "";
+ } else {
+ value = t.value;
+
+ if (t.type == "checkbox") {
+ value = t.checked ? value : "";
+ }
+ }
+
+ return (value == ref)
+}
+
+function cbi_d_check(deps) {
+ var reverse;
+ var def = false;
+ for (var i=0; i<deps.length; i++) {
+ var istat = true;
+ reverse = false;
+ for (var j in deps[i]) {
+ if (j == "!reverse") {
+ reverse = true;
+ } else if (j == "!default") {
+ def = true;
+ istat = false;
+ } else {
+ istat = (istat && cbi_d_checkvalue(j, deps[i][j]))
+ }
+ }
+ if (istat) {
+ return !reverse;
+ }
+ }
+ return def;
+}
+
+function cbi_d_update() {
+ var state = false;
+ for (var i=0; i<cbi_d.length; i++) {
+ var entry = cbi_d[i];
+ var next = document.getElementById(entry.next)
+ var node = document.getElementById(entry.id)
+ var parent = document.getElementById(entry.parent)
+
+ if (node && node.parentNode && !cbi_d_check(entry.deps)) {
+ node.parentNode.removeChild(node);
+ state = true;
+ if( entry.parent )
+ cbi_c[entry.parent]--;
+ } else if ((!node || !node.parentNode) && cbi_d_check(entry.deps)) {
+ if (!next) {
+ parent.appendChild(entry.node);
+ } else {
+ next.parentNode.insertBefore(entry.node, next);
+ }
+ state = true;
+ if( entry.parent )
+ cbi_c[entry.parent]++;
+ }
+ }
+
+ if (entry && entry.parent) {
+ if (!cbi_t_update())
+ cbi_tag_last(parent);
+ }
+
+ if (state) {
+ cbi_d_update();
+ }
+}
+
+function cbi_bind(obj, type, callback, mode) {
+ if (!obj.addEventListener) {
+ obj.attachEvent('on' + type,
+ function(){
+ var e = window.event;
+
+ if (!e.target && e.srcElement)
+ e.target = e.srcElement;
+
+ return !!callback(e);
+ }
+ );
+ } else {
+ obj.addEventListener(type, callback, !!mode);
+ }
+ return obj;
+}
+
+function cbi_combobox(id, values, def, man) {
+ var selid = "cbi.combobox." + id;
+ if (document.getElementById(selid)) {
+ return
+ }
+
+ var obj = document.getElementById(id)
+ var sel = document.createElement("select");
+ sel.id = selid;
+ sel.className = obj.className.replace(/cbi-input-text/, 'cbi-input-select');
+
+ if (obj.nextSibling) {
+ obj.parentNode.insertBefore(sel, obj.nextSibling);
+ } else {
+ obj.parentNode.appendChild(sel);
+ }
+
+ var dt = obj.getAttribute('cbi_datatype');
+ var op = obj.getAttribute('cbi_optional');
+
+ if (dt)
+ cbi_validate_field(sel, op == 'true', dt);
+
+ if (!values[obj.value]) {
+ if (obj.value == "") {
+ var optdef = document.createElement("option");
+ optdef.value = "";
+ optdef.appendChild(document.createTextNode(def));
+ sel.appendChild(optdef);
+ } else {
+ var opt = document.createElement("option");
+ opt.value = obj.value;
+ opt.selected = "selected";
+ opt.appendChild(document.createTextNode(obj.value));
+ sel.appendChild(opt);
+ }
+ }
+
+ for (var i in values) {
+ var opt = document.createElement("option");
+ opt.value = i;
+
+ if (obj.value == i) {
+ opt.selected = "selected";
+ }
+
+ opt.appendChild(document.createTextNode(values[i]));
+ sel.appendChild(opt);
+ }
+
+ var optman = document.createElement("option");
+ optman.value = "";
+ optman.appendChild(document.createTextNode(man));
+ sel.appendChild(optman);
+
+ obj.style.display = "none";
+
+ cbi_bind(sel, "change", function() {
+ if (sel.selectedIndex == sel.options.length - 1) {
+ obj.style.display = "inline";
+ sel.parentNode.removeChild(sel);
+ obj.focus();
+ } else {
+ obj.value = sel.options[sel.selectedIndex].value;
+ }
+
+ try {
+ cbi_d_update();
+ } catch (e) {
+ //Do nothing
+ }
+ })
+
+ // Retrigger validation in select
+ sel.focus();
+ sel.blur();
+}
+
+function cbi_combobox_init(id, values, def, man) {
+ var obj = document.getElementById(id);
+ cbi_bind(obj, "blur", function() {
+ cbi_combobox(id, values, def, man)
+ });
+ cbi_combobox(id, values, def, man);
+}
+
+function cbi_filebrowser(id, url, defpath) {
+ var field = document.getElementById(id);
+ var browser = window.open(
+ url + ( field.value || defpath || '' ) + '?field=' + id,
+ "luci_filebrowser", "width=300,height=400,left=100,top=200,scrollbars=yes"
+ );
+
+ browser.focus();
+}
+
+function cbi_browser_init(id, respath, url, defpath)
+{
+ function cbi_browser_btnclick(e) {
+ cbi_filebrowser(id, url, defpath);
+ return false;
+ }
+
+ var field = document.getElementById(id);
+
+ var btn = document.createElement('img');
+ btn.className = 'cbi-image-button';
+ btn.src = respath + '/cbi/folder.gif';
+ field.parentNode.insertBefore(btn, field.nextSibling);
+
+ cbi_bind(btn, 'click', cbi_browser_btnclick);
+}
+
+function cbi_dynlist_init(name, respath, datatype, optional, choices)
+{
+ var input0 = document.getElementsByName(name)[0];
+ var prefix = input0.name;
+ var parent = input0.parentNode;
+ var holder = input0.placeholder;
+
+ var values;
+
+ function cbi_dynlist_redraw(focus, add, del)
+ {
+ values = [ ];
+
+ while (parent.firstChild)
+ {
+ var n = parent.firstChild;
+ var i = parseInt(n.index);
+
+ if (i != del)
+ {
+ if (n.nodeName.toLowerCase() == 'input')
+ values.push(n.value || '');
+ else if (n.nodeName.toLowerCase() == 'select')
+ values[values.length-1] = n.options[n.selectedIndex].value;
+ }
+
+ parent.removeChild(n);
+ }
+
+ if (add >= 0)
+ {
+ focus = add+1;
+ values.splice(focus, 0, '');
+ }
+ else if (values.length == 0)
+ {
+ focus = 0;
+ values.push('');
+ }
+
+ for (var i = 0; i < values.length; i++)
+ {
+ var t = document.createElement('input');
+ t.id = prefix + '.' + (i+1);
+ t.name = prefix;
+ t.value = values[i];
+ t.type = 'text';
+ t.index = i;
+ t.className = 'cbi-input-text';
+
+ if (i == 0 && holder)
+ {
+ t.placeholder = holder;
+ }
+
+ var b = document.createElement('img');
+ b.src = respath + ((i+1) < values.length ? '/cbi/remove.gif' : '/cbi/add.gif');
+ b.className = 'cbi-image-button';
+
+ parent.appendChild(t);
+ parent.appendChild(b);
+ parent.appendChild(document.createElement('br'));
+
+ if (datatype)
+ {
+ cbi_validate_field(t.id, ((i+1) == values.length) || optional, datatype);
+ }
+
+ if (choices)
+ {
+ cbi_combobox_init(t.id, choices[0], '', choices[1]);
+ t.nextSibling.index = i;
+
+ cbi_bind(t.nextSibling, 'keydown', cbi_dynlist_keydown);
+ cbi_bind(t.nextSibling, 'keypress', cbi_dynlist_keypress);
+
+ if (i == focus || -i == focus)
+ t.nextSibling.focus();
+ }
+ else
+ {
+ cbi_bind(t, 'keydown', cbi_dynlist_keydown);
+ cbi_bind(t, 'keypress', cbi_dynlist_keypress);
+
+ if (i == focus)
+ {
+ t.focus();
+ }
+ else if (-i == focus)
+ {
+ t.focus();
+
+ /* force cursor to end */
+ var v = t.value;
+ t.value = ' '
+ t.value = v;
+ }
+ }
+
+ cbi_bind(b, 'click', cbi_dynlist_btnclick);
+ }
+ }
+
+ function cbi_dynlist_keypress(ev)
+ {
+ ev = ev ? ev : window.event;
+
+ var se = ev.target ? ev.target : ev.srcElement;
+
+ if (se.nodeType == 3)
+ se = se.parentNode;
+
+ switch (ev.keyCode)
+ {
+ /* backspace, delete */
+ case 8:
+ case 46:
+ if (se.value.length == 0)
+ {
+ if (ev.preventDefault)
+ ev.preventDefault();
+
+ return false;
+ }
+
+ return true;
+
+ /* enter, arrow up, arrow down */
+ case 13:
+ case 38:
+ case 40:
+ if (ev.preventDefault)
+ ev.preventDefault();
+
+ return false;
+ }
+
+ return true;
+ }
+
+ function cbi_dynlist_keydown(ev)
+ {
+ ev = ev ? ev : window.event;
+
+ var se = ev.target ? ev.target : ev.srcElement;
+
+ if (se.nodeType == 3)
+ se = se.parentNode;
+
+ var prev = se.previousSibling;
+ while (prev && prev.name != name)
+ prev = prev.previousSibling;
+
+ var next = se.nextSibling;
+ while (next && next.name != name)
+ next = next.nextSibling;
+
+ /* advance one further in combobox case */
+ if (next && next.nextSibling.name == name)
+ next = next.nextSibling;
+
+ switch (ev.keyCode)
+ {
+ /* backspace, delete */
+ case 8:
+ case 46:
+ var del = (se.nodeName.toLowerCase() == 'select')
+ ? true : (se.value.length == 0);
+
+ if (del)
+ {
+ if (ev.preventDefault)
+ ev.preventDefault();
+
+ var focus = se.index;
+ if (ev.keyCode == 8)
+ focus = -focus+1;
+
+ cbi_dynlist_redraw(focus, -1, se.index);
+
+ return false;
+ }
+
+ break;
+
+ /* enter */
+ case 13:
+ cbi_dynlist_redraw(-1, se.index, -1);
+ break;
+
+ /* arrow up */
+ case 38:
+ if (prev)
+ prev.focus();
+
+ break;
+
+ /* arrow down */
+ case 40:
+ if (next)
+ next.focus();
+
+ break;
+ }
+
+ return true;
+ }
+
+ function cbi_dynlist_btnclick(ev)
+ {
+ ev = ev ? ev : window.event;
+
+ var se = ev.target ? ev.target : ev.srcElement;
+
+ if (se.src.indexOf('remove') > -1)
+ {
+ se.previousSibling.value = '';
+
+ cbi_dynlist_keydown({
+ target: se.previousSibling,
+ keyCode: 8
+ });
+ }
+ else
+ {
+ cbi_dynlist_keydown({
+ target: se.previousSibling,
+ keyCode: 13
+ });
+ }
+
+ return false;
+ }
+
+ cbi_dynlist_redraw(NaN, -1, -1);
+}
+
+//Hijacks the CBI form to send via XHR (requires Prototype)
+function cbi_hijack_forms(layer, win, fail, load) {
+ var forms = layer.getElementsByTagName('form');
+ for (var i=0; i<forms.length; i++) {
+ $(forms[i]).observe('submit', function(event) {
+ // Prevent the form from also submitting the regular way
+ event.stop();
+
+ // Submit via XHR
+ event.element().request({
+ onSuccess: win,
+ onFailure: fail
+ });
+
+ if (load) {
+ load();
+ }
+ });
+ }
+}
+
+
+function cbi_t_add(section, tab) {
+ var t = document.getElementById('tab.' + section + '.' + tab);
+ var c = document.getElementById('container.' + section + '.' + tab);
+
+ if( t && c ) {
+ cbi_t[section] = (cbi_t[section] || [ ]);
+ cbi_t[section][tab] = { 'tab': t, 'container': c, 'cid': c.id };
+ }
+}
+
+function cbi_t_switch(section, tab) {
+ if( cbi_t[section] && cbi_t[section][tab] ) {
+ var o = cbi_t[section][tab];
+ var h = document.getElementById('tab.' + section);
+ for( var tid in cbi_t[section] ) {
+ var o2 = cbi_t[section][tid];
+ if( o.tab.id != o2.tab.id ) {
+ o2.tab.className = o2.tab.className.replace(/(^| )cbi-tab( |$)/, " cbi-tab-disabled ");
+ o2.container.style.display = 'none';
+ }
+ else {
+ if(h) h.value = tab;
+ o2.tab.className = o2.tab.className.replace(/(^| )cbi-tab-disabled( |$)/, " cbi-tab ");
+ o2.container.style.display = 'block';
+ }
+ }
+ }
+ return false
+}
+
+function cbi_t_update() {
+ var hl_tabs = [ ];
+ var updated = false;
+
+ for( var sid in cbi_t )
+ for( var tid in cbi_t[sid] )
+ {
+ if( cbi_c[cbi_t[sid][tid].cid] == 0 ) {
+ cbi_t[sid][tid].tab.style.display = 'none';
+ }
+ else if( cbi_t[sid][tid].tab && cbi_t[sid][tid].tab.style.display == 'none' ) {
+ cbi_t[sid][tid].tab.style.display = '';
+
+ var t = cbi_t[sid][tid].tab;
+ t.className += ' cbi-tab-highlighted';
+ hl_tabs.push(t);
+ }
+
+ cbi_tag_last(cbi_t[sid][tid].container);
+ updated = true;
+ }
+
+ if( hl_tabs.length > 0 )
+ window.setTimeout(function() {
+ for( var i = 0; i < hl_tabs.length; i++ )
+ hl_tabs[i].className = hl_tabs[i].className.replace(/ cbi-tab-highlighted/g, '');
+ }, 750);
+
+ return updated;
+}
+
+
+function cbi_validate_form(form, errmsg)
+{
+ /* if triggered by a section removal or addition, don't validate */
+ if( form.cbi_state == 'add-section' || form.cbi_state == 'del-section' )
+ return true;
+
+ if( form.cbi_validators )
+ {
+ for( var i = 0; i < form.cbi_validators.length; i++ )
+ {
+ var validator = form.cbi_validators[i];
+ if( !validator() && errmsg )
+ {
+ alert(errmsg);
+ return false;
+ }
+ }
+ }
+
+ return true;
+}
+
+function cbi_validate_reset(form)
+{
+ window.setTimeout(
+ function() { cbi_validate_form(form, null) }, 100
+ );
+
+ return true;
+}
+
+function cbi_validate_compile(code)
+{
+ var pos = 0;
+ var esc = false;
+ var depth = 0;
+ var stack = [ ];
+
+ code += ',';
+
+ for (var i = 0; i < code.length; i++)
+ {
+ if (esc)
+ {
+ esc = false;
+ continue;
+ }
+
+ switch (code.charCodeAt(i))
+ {
+ case 92:
+ esc = true;
+ break;
+
+ case 40:
+ case 44:
+ if (depth <= 0)
+ {
+ if (pos < i)
+ {
+ var label = code.substring(pos, i);
+ label = label.replace(/\\(.)/g, '$1');
+ label = label.replace(/^[ \t]+/g, '');
+ label = label.replace(/[ \t]+$/g, '');
+
+ if (label && !isNaN(label))
+ {
+ stack.push(parseFloat(label));
+ }
+ else if (label.match(/^(['"]).*\1$/))
+ {
+ stack.push(label.replace(/^(['"])(.*)\1$/, '$2'));
+ }
+ else if (typeof cbi_validators[label] == 'function')
+ {
+ stack.push(cbi_validators[label]);
+ stack.push(null);
+ }
+ else
+ {
+ throw "Syntax error, unhandled token '"+label+"'";
+ }
+ }
+ pos = i+1;
+ }
+ depth += (code.charCodeAt(i) == 40);
+ break;
+
+ case 41:
+ if (--depth <= 0)
+ {
+ if (typeof stack[stack.length-2] != 'function')
+ throw "Syntax error, argument list follows non-function";
+
+ stack[stack.length-1] =
+ arguments.callee(code.substring(pos, i));
+
+ pos = i+1;
+ }
+ break;
+ }
+ }
+
+ return stack;
+}
+
+function cbi_validate_field(cbid, optional, type)
+{
+ var field = (typeof cbid == "string") ? document.getElementById(cbid) : cbid;
+ var vstack; try { vstack = cbi_validate_compile(type); } catch(e) { };
+
+ if (field && vstack && typeof vstack[0] == "function")
+ {
+ var validator = function()
+ {
+ // is not detached
+ if( field.form )
+ {
+ field.className = field.className.replace(/ cbi-input-invalid/g, '');
+
+ // validate value
+ var value = (field.options && field.options.selectedIndex > -1)
+ ? field.options[field.options.selectedIndex].value : field.value;
+
+ if (!(((value.length == 0) && optional) || vstack[0].apply(value, vstack[1])))
+ {
+ // invalid
+ field.className += ' cbi-input-invalid';
+ return false;
+ }
+ }
+
+ return true;
+ };
+
+ if( ! field.form.cbi_validators )
+ field.form.cbi_validators = [ ];
+
+ field.form.cbi_validators.push(validator);
+
+ cbi_bind(field, "blur", validator);
+ cbi_bind(field, "keyup", validator);
+
+ if (field.nodeName == 'SELECT')
+ {
+ cbi_bind(field, "change", validator);
+ cbi_bind(field, "click", validator);
+ }
+
+ field.setAttribute("cbi_validate", validator);
+ field.setAttribute("cbi_datatype", type);
+ field.setAttribute("cbi_optional", (!!optional).toString());
+
+ validator();
+
+ var fcbox = document.getElementById('cbi.combobox.' + field.id);
+ if (fcbox)
+ cbi_validate_field(fcbox, optional, type);
+ }
+}
+
+function cbi_row_swap(elem, up, store)
+{
+ var tr = elem.parentNode;
+ while (tr && tr.nodeName.toLowerCase() != 'tr')
+ tr = tr.parentNode;
+
+ if (!tr)
+ return false;
+
+ var table = tr.parentNode;
+ while (table && table.nodeName.toLowerCase() != 'table')
+ table = table.parentNode;
+
+ if (!table)
+ return false;
+
+ var s = up ? 3 : 2;
+ var e = up ? table.rows.length : table.rows.length - 1;
+
+ for (var idx = s; idx < e; idx++)
+ {
+ if (table.rows[idx] == tr)
+ {
+ if (up)
+ tr.parentNode.insertBefore(table.rows[idx], table.rows[idx-1]);
+ else
+ tr.parentNode.insertBefore(table.rows[idx+1], table.rows[idx]);
+
+ break;
+ }
+ }
+
+ var ids = [ ];
+ for (idx = 2; idx < table.rows.length; idx++)
+ {
+ table.rows[idx].className = table.rows[idx].className.replace(
+ /cbi-rowstyle-[12]/, 'cbi-rowstyle-' + (1 + (idx % 2))
+ );
+
+ if (table.rows[idx].id && table.rows[idx].id.match(/-([^\-]+)$/) )
+ ids.push(RegExp.$1);
+ }
+
+ var input = document.getElementById(store);
+ if (input)
+ input.value = ids.join(' ');
+
+ return false;
+}
+
+function cbi_tag_last(container)
+{
+ var last;
+
+ for (var i = 0; i < container.childNodes.length; i++)
+ {
+ var c = container.childNodes[i];
+ if (c.nodeType == 1 && c.nodeName.toLowerCase() == 'div')
+ {
+ c.className = c.className.replace(/ cbi-value-last$/, '');
+ last = c;
+ }
+ }
+
+ if (last)
+ {
+ last.className += ' cbi-value-last';
+ }
+}
+
+String.prototype.serialize = function()
+{
+ var o = this;
+ switch(typeof(o))
+ {
+ case 'object':
+ // null
+ if( o == null )
+ {
+ return 'null';
+ }
+
+ // array
+ else if( o.length )
+ {
+ var i, s = '';
+
+ for( var i = 0; i < o.length; i++ )
+ s += (s ? ', ' : '') + String.serialize(o[i]);
+
+ return '[ ' + s + ' ]';
+ }
+
+ // object
+ else
+ {
+ var k, s = '';
+
+ for( k in o )
+ s += (s ? ', ' : '') + k + ': ' + String.serialize(o[k]);
+
+ return '{ ' + s + ' }';
+ }
+
+ break;
+
+ case 'string':
+ // complex string
+ if( o.match(/[^a-zA-Z0-9_,.: -]/) )
+ return 'decodeURIComponent("' + encodeURIComponent(o) + '")';
+
+ // simple string
+ else
+ return '"' + o + '"';
+
+ break;
+
+ default:
+ return o.toString();
+ }
+}
+
+String.prototype.format = function()
+{
+ if (!RegExp)
+ return;
+
+ var html_esc = [/&/g, '&', /"/g, '"', /'/g, ''', /</g, '<', />/g, '>'];
+ var quot_esc = [/"/g, '"', /'/g, '''];
+
+ function esc(s, r) {
+ for( var i = 0; i < r.length; i += 2 )
+ s = s.replace(r[i], r[i+1]);
+ return s;
+ }
+
+ var str = this;
+ var out = '';
+ var re = /^(([^%]*)%('.|0|\x20)?(-)?(\d+)?(\.\d+)?(%|b|c|d|u|f|o|s|x|X|q|h|j|t|m))/;
+ var a = b = [], numSubstitutions = 0, numMatches = 0;
+
+ while( a = re.exec(str) )
+ {
+ var m = a[1];
+ var leftpart = a[2], pPad = a[3], pJustify = a[4], pMinLength = a[5];
+ var pPrecision = a[6], pType = a[7];
+
+ numMatches++;
+
+ if (pType == '%')
+ {
+ subst = '%';
+ }
+ else
+ {
+ if (numSubstitutions < arguments.length)
+ {
+ var param = arguments[numSubstitutions++];
+
+ var pad = '';
+ if (pPad && pPad.substr(0,1) == "'")
+ pad = leftpart.substr(1,1);
+ else if (pPad)
+ pad = pPad;
+
+ var justifyRight = true;
+ if (pJustify && pJustify === "-")
+ justifyRight = false;
+
+ var minLength = -1;
+ if (pMinLength)
+ minLength = parseInt(pMinLength);
+
+ var precision = -1;
+ if (pPrecision && pType == 'f')
+ precision = parseInt(pPrecision.substring(1));
+
+ var subst = param;
+
+ switch(pType)
+ {
+ case 'b':
+ subst = (parseInt(param) || 0).toString(2);
+ break;
+
+ case 'c':
+ subst = String.fromCharCode(parseInt(param) || 0);
+ break;
+
+ case 'd':
+ subst = (parseInt(param) || 0);
+ break;
+
+ case 'u':
+ subst = Math.abs(parseInt(param) || 0);
+ break;
+
+ case 'f':
+ subst = (precision > -1)
+ ? ((parseFloat(param) || 0.0)).toFixed(precision)
+ : (parseFloat(param) || 0.0);
+ break;
+
+ case 'o':
+ subst = (parseInt(param) || 0).toString(8);
+ break;
+
+ case 's':
+ subst = param;
+ break;
+
+ case 'x':
+ subst = ('' + (parseInt(param) || 0).toString(16)).toLowerCase();
+ break;
+
+ case 'X':
+ subst = ('' + (parseInt(param) || 0).toString(16)).toUpperCase();
+ break;
+
+ case 'h':
+ subst = esc(param, html_esc);
+ break;
+
+ case 'q':
+ subst = esc(param, quot_esc);
+ break;
+
+ case 'j':
+ subst = String.serialize(param);
+ break;
+
+ case 't':
+ var td = 0;
+ var th = 0;
+ var tm = 0;
+ var ts = (param || 0);
+
+ if (ts > 60) {
+ tm = Math.floor(ts / 60);
+ ts = (ts % 60);
+ }
+
+ if (tm > 60) {
+ th = Math.floor(tm / 60);
+ tm = (tm % 60);
+ }
+
+ if (th > 24) {
+ td = Math.floor(th / 24);
+ th = (th % 24);
+ }
+
+ subst = (td > 0)
+ ? String.format('%dd %dh %dm %ds', td, th, tm, ts)
+ : String.format('%dh %dm %ds', th, tm, ts);
+
+ break;
+
+ case 'm':
+ var mf = pMinLength ? parseInt(pMinLength) : 1000;
+ var pr = pPrecision ? Math.floor(10*parseFloat('0'+pPrecision)) : 2;
+
+ var i = 0;
+ var val = parseFloat(param || 0);
+ var units = [ '', 'K', 'M', 'G', 'T', 'P', 'E' ];
+
+ for (i = 0; (i < units.length) && (val > mf); i++)
+ val /= mf;
+
+ subst = val.toFixed(pr) + ' ' + units[i];
+ break;
+ }
+ }
+ }
+
+ out += leftpart + subst;
+ str = str.substr(m.length);
+ }
+
+ return out + str;
+}
+
+String.prototype.nobr = function()
+{
+ return this.replace(/[\s\n]+/g, ' ');
+}
+
+String.serialize = function()
+{
+ var a = [ ];
+ for (var i = 1; i < arguments.length; i++)
+ a.push(arguments[i]);
+ return ''.serialize.apply(arguments[0], a);
+}
+
+String.format = function()
+{
+ var a = [ ];
+ for (var i = 1; i < arguments.length; i++)
+ a.push(arguments[i]);
+ return ''.format.apply(arguments[0], a);
+}
+
+String.nobr = function()
+{
+ var a = [ ];
+ for (var i = 1; i < arguments.length; i++)
+ a.push(arguments[i]);
+ return ''.nobr.apply(arguments[0], a);
+}
--- /dev/null
+/*
+ * xhr.js - XMLHttpRequest helper class
+ * (c) 2008-2010 Jo-Philipp Wich
+ */
+
+XHR = function()
+{
+ this.reinit = function()
+ {
+ if (window.XMLHttpRequest) {
+ this._xmlHttp = new XMLHttpRequest();
+ }
+ else if (window.ActiveXObject) {
+ this._xmlHttp = new ActiveXObject("Microsoft.XMLHTTP");
+ }
+ else {
+ alert("xhr.js: XMLHttpRequest is not supported by this browser!");
+ }
+ }
+
+ this.busy = function() {
+ if (!this._xmlHttp)
+ return false;
+
+ switch (this._xmlHttp.readyState)
+ {
+ case 1:
+ case 2:
+ case 3:
+ return true;
+
+ default:
+ return false;
+ }
+ }
+
+ this.abort = function() {
+ if (this.busy())
+ this._xmlHttp.abort();
+ }
+
+ this.get = function(url,data,callback)
+ {
+ this.reinit();
+
+ var xhr = this._xmlHttp;
+ var code = this._encode(data);
+
+ url = location.protocol + '//' + location.host + url;
+
+ if (code)
+ if (url.substr(url.length-1,1) == '&')
+ url += code;
+ else
+ url += '?' + code;
+
+ xhr.open('GET', url, true);
+
+ xhr.onreadystatechange = function()
+ {
+ if (xhr.readyState == 4) {
+ var json = null;
+ if (xhr.getResponseHeader("Content-Type") == "application/json") {
+ try {
+ json = eval('(' + xhr.responseText + ')');
+ }
+ catch(e) {
+ json = null;
+ }
+ }
+
+ callback(xhr, json);
+ }
+ }
+
+ xhr.send(null);
+ }
+
+ this.post = function(url,data,callback)
+ {
+ this.reinit();
+
+ var xhr = this._xmlHttp;
+ var code = this._encode(data);
+
+ xhr.onreadystatechange = function()
+ {
+ if (xhr.readyState == 4)
+ callback(xhr);
+ }
+
+ xhr.open('POST', url, true);
+ xhr.setRequestHeader('Content-type', 'application/x-www-form-urlencoded');
+ xhr.setRequestHeader('Content-length', code.length);
+ xhr.setRequestHeader('Connection', 'close');
+ xhr.send(code);
+ }
+
+ this.cancel = function()
+ {
+ this._xmlHttp.onreadystatechange = function(){};
+ this._xmlHttp.abort();
+ }
+
+ this.send_form = function(form,callback,extra_values)
+ {
+ var code = '';
+
+ for (var i = 0; i < form.elements.length; i++)
+ {
+ var e = form.elements[i];
+
+ if (e.options)
+ {
+ code += (code ? '&' : '') +
+ form.elements[i].name + '=' + encodeURIComponent(
+ e.options[e.selectedIndex].value
+ );
+ }
+ else if (e.length)
+ {
+ for (var j = 0; j < e.length; j++)
+ if (e[j].name) {
+ code += (code ? '&' : '') +
+ e[j].name + '=' + encodeURIComponent(e[j].value);
+ }
+ }
+ else
+ {
+ code += (code ? '&' : '') +
+ e.name + '=' + encodeURIComponent(e.value);
+ }
+ }
+
+ if (typeof extra_values == 'object')
+ for (var key in extra_values)
+ code += (code ? '&' : '') +
+ key + '=' + encodeURIComponent(extra_values[key]);
+
+ return(
+ (form.method == 'get')
+ ? this.get(form.getAttribute('action'), code, callback)
+ : this.post(form.getAttribute('action'), code, callback)
+ );
+ }
+
+ this._encode = function(obj)
+ {
+ obj = obj ? obj : { };
+ obj['_'] = Math.random();
+
+ if (typeof obj == 'object')
+ {
+ var code = '';
+ var self = this;
+
+ for (var k in obj)
+ code += (code ? '&' : '') +
+ k + '=' + encodeURIComponent(obj[k]);
+
+ return code;
+ }
+
+ return obj;
+ }
+}
+
+XHR.get = function(url, data, callback)
+{
+ (new XHR()).get(url, data, callback);
+}
+
+XHR.poll = function(interval, url, data, callback)
+{
+ if (isNaN(interval) || interval < 1)
+ interval = 5;
+
+ if (!XHR._q)
+ {
+ XHR._t = 0;
+ XHR._q = [ ];
+ XHR._r = function() {
+ for (var i = 0, e = XHR._q[0]; i < XHR._q.length; e = XHR._q[++i])
+ {
+ if (!(XHR._t % e.interval) && !e.xhr.busy())
+ e.xhr.get(e.url, e.data, e.callback);
+ }
+
+ XHR._t++;
+ };
+ }
+
+ XHR._q.push({
+ interval: interval,
+ callback: callback,
+ url: url,
+ data: data,
+ xhr: new XHR()
+ });
+
+ XHR.run();
+}
+
+XHR.halt = function()
+{
+ if (XHR._i)
+ {
+ /* show & set poll indicator */
+ try {
+ document.getElementById('xhr_poll_status').style.display = '';
+ document.getElementById('xhr_poll_status_on').style.display = 'none';
+ document.getElementById('xhr_poll_status_off').style.display = '';
+ } catch(e) { }
+
+ window.clearInterval(XHR._i);
+ XHR._i = null;
+ }
+}
+
+XHR.run = function()
+{
+ if (XHR._r && !XHR._i)
+ {
+ /* show & set poll indicator */
+ try {
+ document.getElementById('xhr_poll_status').style.display = '';
+ document.getElementById('xhr_poll_status_on').style.display = '';
+ document.getElementById('xhr_poll_status_off').style.display = 'none';
+ } catch(e) { }
+
+ /* kick first round manually to prevent one second lag when setting up
+ * the poll interval */
+ XHR._r();
+ XHR._i = window.setInterval(XHR._r, 1000);
+ }
+}
+
+XHR.running = function()
+{
+ return !!(XHR._r && XHR._i);
+}
--- /dev/null
+--[[
+LuCI - Lua Configuration Interface
+
+Copyright 2008 Steven Barth <steven@midlink.org>
+Copyright 2008 Jo-Philipp Wich <xm@leipzig.freifunk.net>
+
+Licensed under the Apache License, Version 2.0 (the "License");
+you may not use this file except in compliance with the License.
+You may obtain a copy of the License at
+
+http://www.apache.org/licenses/LICENSE-2.0
+
+$Id$
+]]--
+
+local io = require "io"
+local fs = require "nixio.fs"
+local util = require "luci.util"
+local nixio = require "nixio"
+local debug = require "debug"
+local string = require "string"
+local package = require "package"
+
+local type, loadfile = type, loadfile
+
+
+module "luci.ccache"
+
+function cache_ondemand(...)
+ if debug.getinfo(1, 'S').source ~= "=?" then
+ cache_enable(...)
+ end
+end
+
+function cache_enable(cachepath, mode)
+ cachepath = cachepath or "/tmp/luci-modulecache"
+ mode = mode or "r--r--r--"
+
+ local loader = package.loaders[2]
+ local uid = nixio.getuid()
+
+ if not fs.stat(cachepath) then
+ fs.mkdir(cachepath)
+ end
+
+ local function _encode_filename(name)
+ local encoded = ""
+ for i=1, #name do
+ encoded = encoded .. ("%2X" % string.byte(name, i))
+ end
+ return encoded
+ end
+
+ local function _load_sane(file)
+ local stat = fs.stat(file)
+ if stat and stat.uid == uid and stat.modestr == mode then
+ return loadfile(file)
+ end
+ end
+
+ local function _write_sane(file, func)
+ if nixio.getuid() == uid then
+ local fp = io.open(file, "w")
+ if fp then
+ fp:write(util.get_bytecode(func))
+ fp:close()
+ fs.chmod(file, mode)
+ end
+ end
+ end
+
+ package.loaders[2] = function(mod)
+ local encoded = cachepath .. "/" .. _encode_filename(mod)
+ local modcons = _load_sane(encoded)
+
+ if modcons then
+ return modcons
+ end
+
+ -- No cachefile
+ modcons = loader(mod)
+ if type(modcons) == "function" then
+ _write_sane(encoded, modcons)
+ end
+ return modcons
+ end
+end
--- /dev/null
+--[[
+LuCI - Lua Configuration Interface
+
+Copyright 2010 Jo-Philipp Wich <xm@subsignal.org>
+
+Licensed under the Apache License, Version 2.0 (the "License");
+you may not use this file except in compliance with the License.
+You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+$Id$
+]]--
+
+module("luci.controller.admin.servicectl", package.seeall)
+
+function index()
+ entry({"servicectl"}, alias("servicectl", "status")).sysauth = "root"
+ entry({"servicectl", "status"}, call("action_status")).leaf = true
+ entry({"servicectl", "restart"}, call("action_restart")).leaf = true
+end
+
+function action_status()
+ local data = nixio.fs.readfile("/var/run/luci-reload-status")
+ if data then
+ luci.http.write("/etc/config/")
+ luci.http.write(data)
+ else
+ luci.http.write("finish")
+ end
+end
+
+function action_restart(args)
+ local uci = require "luci.model.uci".cursor()
+ if args then
+ local service
+ local services = { }
+
+ for service in args:gmatch("[%w_-]+") do
+ services[#services+1] = service
+ end
+
+ local command = uci:apply(services, true)
+ if nixio.fork() == 0 then
+ local i = nixio.open("/dev/null", "r")
+ local o = nixio.open("/dev/null", "w")
+
+ nixio.dup(i, nixio.stdin)
+ nixio.dup(o, nixio.stdout)
+
+ i:close()
+ o:close()
+
+ nixio.exec("/bin/sh", unpack(command))
+ else
+ luci.http.write("OK")
+ os.exit(0)
+ end
+ end
+end
--- /dev/null
+local debug = require "debug"
+local io = require "io"
+local collectgarbage, floor = collectgarbage, math.floor
+
+module "luci.debug"
+__file__ = debug.getinfo(1, 'S').source:sub(2)
+
+-- Enables the memory tracer with given flags and returns a function to disable the tracer again
+function trap_memtrace(flags, dest)
+ flags = flags or "clr"
+ local tracefile = io.open(dest or "/tmp/memtrace", "w")
+ local peak = 0
+
+ local function trap(what, line)
+ local info = debug.getinfo(2, "Sn")
+ local size = floor(collectgarbage("count"))
+ if size > peak then
+ peak = size
+ end
+ if tracefile then
+ tracefile:write(
+ "[", what, "] ", info.source, ":", (line or "?"), "\t",
+ (info.namewhat or ""), "\t",
+ (info.name or ""), "\t",
+ size, " (", peak, ")\n"
+ )
+ end
+ end
+
+ debug.sethook(trap, flags)
+
+ return function()
+ debug.sethook()
+ tracefile:close()
+ end
+end
+
--- /dev/null
+--[[
+LuCI - Filesystem tools
+
+Description:
+A module offering often needed filesystem manipulation functions
+
+FileId:
+$Id$
+
+License:
+Copyright 2008 Steven Barth <steven@midlink.org>
+
+Licensed under the Apache License, Version 2.0 (the "License");
+you may not use this file except in compliance with the License.
+You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+Unless required by applicable law or agreed to in writing, software
+distributed under the License is distributed on an "AS IS" BASIS,
+WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+See the License for the specific language governing permissions and
+limitations under the License.
+
+]]--
+
+local io = require "io"
+local os = require "os"
+local ltn12 = require "luci.ltn12"
+local fs = require "nixio.fs"
+local nutil = require "nixio.util"
+
+local type = type
+
+--- LuCI filesystem library.
+module "luci.fs"
+
+--- Test for file access permission on given path.
+-- @class function
+-- @name access
+-- @param str String value containing the path
+-- @return Number containing the return code, 0 on sucess or nil on error
+-- @return String containing the error description (if any)
+-- @return Number containing the os specific errno (if any)
+access = fs.access
+
+--- Evaluate given shell glob pattern and return a table containing all matching
+-- file and directory entries.
+-- @class function
+-- @name glob
+-- @param filename String containing the path of the file to read
+-- @return Table containing file and directory entries or nil if no matches
+-- @return String containing the error description (if no matches)
+-- @return Number containing the os specific errno (if no matches)
+function glob(...)
+ local iter, code, msg = fs.glob(...)
+ if iter then
+ return nutil.consume(iter)
+ else
+ return nil, code, msg
+ end
+end
+
+--- Checks wheather the given path exists and points to a regular file.
+-- @param filename String containing the path of the file to test
+-- @return Boolean indicating wheather given path points to regular file
+function isfile(filename)
+ return fs.stat(filename, "type") == "reg"
+end
+
+--- Checks wheather the given path exists and points to a directory.
+-- @param dirname String containing the path of the directory to test
+-- @return Boolean indicating wheather given path points to directory
+function isdirectory(dirname)
+ return fs.stat(dirname, "type") == "dir"
+end
+
+--- Read the whole content of the given file into memory.
+-- @param filename String containing the path of the file to read
+-- @return String containing the file contents or nil on error
+-- @return String containing the error message on error
+readfile = fs.readfile
+
+--- Write the contents of given string to given file.
+-- @param filename String containing the path of the file to read
+-- @param data String containing the data to write
+-- @return Boolean containing true on success or nil on error
+-- @return String containing the error message on error
+writefile = fs.writefile
+
+--- Copies a file.
+-- @param source Source file
+-- @param dest Destination
+-- @return Boolean containing true on success or nil on error
+copy = fs.datacopy
+
+--- Renames a file.
+-- @param source Source file
+-- @param dest Destination
+-- @return Boolean containing true on success or nil on error
+rename = fs.move
+
+--- Get the last modification time of given file path in Unix epoch format.
+-- @param path String containing the path of the file or directory to read
+-- @return Number containing the epoch time or nil on error
+-- @return String containing the error description (if any)
+-- @return Number containing the os specific errno (if any)
+function mtime(path)
+ return fs.stat(path, "mtime")
+end
+
+--- Set the last modification time of given file path in Unix epoch format.
+-- @param path String containing the path of the file or directory to read
+-- @param mtime Last modification timestamp
+-- @param atime Last accessed timestamp
+-- @return 0 in case of success nil on error
+-- @return String containing the error description (if any)
+-- @return Number containing the os specific errno (if any)
+function utime(path, mtime, atime)
+ return fs.utimes(path, atime, mtime)
+end
+
+--- Return the last element - usually the filename - from the given path with
+-- the directory component stripped.
+-- @class function
+-- @name basename
+-- @param path String containing the path to strip
+-- @return String containing the base name of given path
+-- @see dirname
+basename = fs.basename
+
+--- Return the directory component of the given path with the last element
+-- stripped of.
+-- @class function
+-- @name dirname
+-- @param path String containing the path to strip
+-- @return String containing the directory component of given path
+-- @see basename
+dirname = fs.dirname
+
+--- Return a table containing all entries of the specified directory.
+-- @class function
+-- @name dir
+-- @param path String containing the path of the directory to scan
+-- @return Table containing file and directory entries or nil on error
+-- @return String containing the error description on error
+-- @return Number containing the os specific errno on error
+function dir(...)
+ local iter, code, msg = fs.dir(...)
+ if iter then
+ local t = nutil.consume(iter)
+ t[#t+1] = "."
+ t[#t+1] = ".."
+ return t
+ else
+ return nil, code, msg
+ end
+end
+
+--- Create a new directory, recursively on demand.
+-- @param path String with the name or path of the directory to create
+-- @param recursive Create multiple directory levels (optional, default is true)
+-- @return Number with the return code, 0 on sucess or nil on error
+-- @return String containing the error description on error
+-- @return Number containing the os specific errno on error
+function mkdir(path, recursive)
+ return recursive and fs.mkdirr(path) or fs.mkdir(path)
+end
+
+--- Remove the given empty directory.
+-- @class function
+-- @name rmdir
+-- @param path String containing the path of the directory to remove
+-- @return Number with the return code, 0 on sucess or nil on error
+-- @return String containing the error description on error
+-- @return Number containing the os specific errno on error
+rmdir = fs.rmdir
+
+local stat_tr = {
+ reg = "regular",
+ dir = "directory",
+ lnk = "link",
+ chr = "character device",
+ blk = "block device",
+ fifo = "fifo",
+ sock = "socket"
+}
+--- Get information about given file or directory.
+-- @class function
+-- @name stat
+-- @param path String containing the path of the directory to query
+-- @return Table containing file or directory properties or nil on error
+-- @return String containing the error description on error
+-- @return Number containing the os specific errno on error
+function stat(path, key)
+ local data, code, msg = fs.stat(path)
+ if data then
+ data.mode = data.modestr
+ data.type = stat_tr[data.type] or "?"
+ end
+ return key and data and data[key] or data, code, msg
+end
+
+--- Set permissions on given file or directory.
+-- @class function
+-- @name chmod
+-- @param path String containing the path of the directory
+-- @param perm String containing the permissions to set ([ugoa][+-][rwx])
+-- @return Number with the return code, 0 on sucess or nil on error
+-- @return String containing the error description on error
+-- @return Number containing the os specific errno on error
+chmod = fs.chmod
+
+--- Create a hard- or symlink from given file (or directory) to specified target
+-- file (or directory) path.
+-- @class function
+-- @name link
+-- @param path1 String containing the source path to link
+-- @param path2 String containing the destination path for the link
+-- @param symlink Boolean indicating wheather to create a symlink (optional)
+-- @return Number with the return code, 0 on sucess or nil on error
+-- @return String containing the error description on error
+-- @return Number containing the os specific errno on error
+function link(src, dest, sym)
+ return sym and fs.symlink(src, dest) or fs.link(src, dest)
+end
+
+--- Remove the given file.
+-- @class function
+-- @name unlink
+-- @param path String containing the path of the file to remove
+-- @return Number with the return code, 0 on sucess or nil on error
+-- @return String containing the error description on error
+-- @return Number containing the os specific errno on error
+unlink = fs.unlink
+
+--- Retrieve target of given symlink.
+-- @class function
+-- @name readlink
+-- @param path String containing the path of the symlink to read
+-- @return String containing the link target or nil on error
+-- @return String containing the error description on error
+-- @return Number containing the os specific errno on error
+readlink = fs.readlink
--- /dev/null
+--[[
+LuCI - Lua Configuration Interface
+
+Description:
+Main class
+
+FileId:
+$Id$
+
+License:
+Copyright 2008 Steven Barth <steven@midlink.org>
+
+Licensed under the Apache License, Version 2.0 (the "License");
+you may not use this file except in compliance with the License.
+You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+Unless required by applicable law or agreed to in writing, software
+distributed under the License is distributed on an "AS IS" BASIS,
+WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+See the License for the specific language governing permissions and
+limitations under the License.
+
+]]--
+
+local require = require
+
+-- Make sure that bitlib is loaded
+if not _G.bit then
+ _G.bit = require "bit"
+end
+
+module "luci"
+
+local v = require "luci.version"
+
+__version__ = v.luciversion or "trunk"
+__appname__ = v.luciname or "LuCI"
--- /dev/null
+--[[
+
+LuCI ip calculation libarary
+(c) 2008 Jo-Philipp Wich <xm@leipzig.freifunk.net>
+(c) 2008 Steven Barth <steven@midlink.org>
+
+Licensed under the Apache License, Version 2.0 (the "License");
+you may not use this file except in compliance with the License.
+You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+$Id$
+
+]]--
+
+--- LuCI IP calculation library.
+module( "luci.ip", package.seeall )
+
+require "nixio"
+local bit = nixio.bit
+local util = require "luci.util"
+
+--- Boolean; true if system is little endian
+LITTLE_ENDIAN = not util.bigendian()
+
+--- Boolean; true if system is big endian
+BIG_ENDIAN = not LITTLE_ENDIAN
+
+--- Specifier for IPv4 address family
+FAMILY_INET4 = 0x04
+
+--- Specifier for IPv6 address family
+FAMILY_INET6 = 0x06
+
+
+local function __bless(x)
+ return setmetatable( x, {
+ __index = luci.ip.cidr,
+ __add = luci.ip.cidr.add,
+ __sub = luci.ip.cidr.sub,
+ __lt = luci.ip.cidr.lower,
+ __eq = luci.ip.cidr.equal,
+ __le =
+ function(...)
+ return luci.ip.cidr.equal(...) or luci.ip.cidr.lower(...)
+ end
+ } )
+end
+
+local function __array16( x, family )
+ local list
+
+ if type(x) == "number" then
+ list = { bit.rshift(x, 16), bit.band(x, 0xFFFF) }
+
+ elseif type(x) == "string" then
+ if x:find(":") then x = IPv6(x) else x = IPv4(x) end
+ if x then
+ assert( x[1] == family, "Can't mix IPv4 and IPv6 addresses" )
+ list = { unpack(x[2]) }
+ end
+
+ elseif type(x) == "table" and type(x[2]) == "table" then
+ assert( x[1] == family, "Can't mix IPv4 and IPv6 addresses" )
+ list = { unpack(x[2]) }
+
+ elseif type(x) == "table" then
+ list = { unpack(x) }
+ end
+
+ assert( list, "Invalid operand" )
+
+ return list
+end
+
+local function __mask16(bits)
+ return bit.lshift( bit.rshift( 0xFFFF, 16 - bits % 16 ), 16 - bits % 16 )
+end
+
+local function __not16(bits)
+ return bit.band( bit.bnot( __mask16(bits) ), 0xFFFF )
+end
+
+local function __maxlen(family)
+ return ( family == FAMILY_INET4 ) and 32 or 128
+end
+
+local function __sublen(family)
+ return ( family == FAMILY_INET4 ) and 30 or 127
+end
+
+
+--- Convert given short value to network byte order on little endian hosts
+-- @param x Unsigned integer value between 0x0000 and 0xFFFF
+-- @return Byte-swapped value
+-- @see htonl
+-- @see ntohs
+function htons(x)
+ if LITTLE_ENDIAN then
+ return bit.bor(
+ bit.rshift( x, 8 ),
+ bit.band( bit.lshift( x, 8 ), 0xFF00 )
+ )
+ else
+ return x
+ end
+end
+
+--- Convert given long value to network byte order on little endian hosts
+-- @param x Unsigned integer value between 0x00000000 and 0xFFFFFFFF
+-- @return Byte-swapped value
+-- @see htons
+-- @see ntohl
+function htonl(x)
+ if LITTLE_ENDIAN then
+ return bit.bor(
+ bit.lshift( htons( bit.band( x, 0xFFFF ) ), 16 ),
+ htons( bit.rshift( x, 16 ) )
+ )
+ else
+ return x
+ end
+end
+
+--- Convert given short value to host byte order on little endian hosts
+-- @class function
+-- @name ntohs
+-- @param x Unsigned integer value between 0x0000 and 0xFFFF
+-- @return Byte-swapped value
+-- @see htonl
+-- @see ntohs
+ntohs = htons
+
+--- Convert given short value to host byte order on little endian hosts
+-- @class function
+-- @name ntohl
+-- @param x Unsigned integer value between 0x00000000 and 0xFFFFFFFF
+-- @return Byte-swapped value
+-- @see htons
+-- @see ntohl
+ntohl = htonl
+
+
+--- Parse given IPv4 address in dotted quad or CIDR notation. If an optional
+-- netmask is given as second argument and the IP address is encoded in CIDR
+-- notation then the netmask parameter takes precedence. If neither a CIDR
+-- encoded prefix nor a netmask parameter is given, then a prefix length of
+-- 32 bit is assumed.
+-- @param address IPv4 address in dotted quad or CIDR notation
+-- @param netmask IPv4 netmask in dotted quad notation (optional)
+-- @return luci.ip.cidr instance or nil if given address was invalid
+-- @see IPv6
+-- @see Hex
+function IPv4(address, netmask)
+ address = address or "0.0.0.0/0"
+
+ local obj = __bless({ FAMILY_INET4 })
+
+ local data = {}
+ local prefix = address:match("/(.+)")
+ address = address:gsub("/.+","")
+ address = address:gsub("^%[(.*)%]$", "%1"):upper():gsub("^::FFFF:", "")
+
+ if netmask then
+ prefix = obj:prefix(netmask)
+ elseif prefix then
+ prefix = tonumber(prefix)
+ if not prefix or prefix < 0 or prefix > 32 then return nil end
+ else
+ prefix = 32
+ end
+
+ local b1, b2, b3, b4 = address:match("^(%d+)%.(%d+)%.(%d+)%.(%d+)$")
+
+ b1 = tonumber(b1)
+ b2 = tonumber(b2)
+ b3 = tonumber(b3)
+ b4 = tonumber(b4)
+
+ if b1 and b1 <= 255 and
+ b2 and b2 <= 255 and
+ b3 and b3 <= 255 and
+ b4 and b4 <= 255 and
+ prefix
+ then
+ table.insert(obj, { b1 * 256 + b2, b3 * 256 + b4 })
+ table.insert(obj, prefix)
+ return obj
+ end
+end
+
+--- Parse given IPv6 address in full, compressed, mixed or CIDR notation.
+-- If an optional netmask is given as second argument and the IP address is
+-- encoded in CIDR notation then the netmask parameter takes precedence.
+-- If neither a CIDR encoded prefix nor a netmask parameter is given, then a
+-- prefix length of 128 bit is assumed.
+-- @param address IPv6 address in full/compressed/mixed or CIDR notation
+-- @param netmask IPv6 netmask in full/compressed/mixed notation (optional)
+-- @return luci.ip.cidr instance or nil if given address was invalid
+-- @see IPv4
+-- @see Hex
+function IPv6(address, netmask)
+ address = address or "::/0"
+
+ local obj = __bless({ FAMILY_INET6 })
+
+ local data = {}
+ local prefix = address:match("/(.+)")
+ address = address:gsub("/.+","")
+ address = address:gsub("^%[(.*)%]$", "%1")
+
+ if netmask then
+ prefix = obj:prefix(netmask)
+ elseif prefix then
+ prefix = tonumber(prefix)
+ if not prefix or prefix < 0 or prefix > 128 then return nil end
+ else
+ prefix = 128
+ end
+
+ local borderl = address:sub(1, 1) == ":" and 2 or 1
+ local borderh, zeroh, chunk, block, i
+
+ if #address > 45 then return nil end
+
+ repeat
+ borderh = address:find(":", borderl, true)
+ if not borderh then break end
+
+ block = tonumber(address:sub(borderl, borderh - 1), 16)
+ if block and block <= 0xFFFF then
+ data[#data+1] = block
+ else
+ if zeroh or borderh - borderl > 1 then return nil end
+ zeroh = #data + 1
+ end
+
+ borderl = borderh + 1
+ until #data == 7
+
+ chunk = address:sub(borderl)
+ if #chunk > 0 and #chunk <= 4 then
+ block = tonumber(chunk, 16)
+ if not block or block > 0xFFFF then return nil end
+
+ data[#data+1] = block
+ elseif #chunk > 4 then
+ if #data == 7 or #chunk > 15 then return nil end
+ borderl = 1
+ for i=1, 4 do
+ borderh = chunk:find(".", borderl, true)
+ if not borderh and i < 4 then return nil end
+ borderh = borderh and borderh - 1
+
+ block = tonumber(chunk:sub(borderl, borderh))
+ if not block or block > 255 then return nil end
+
+ if i == 1 or i == 3 then
+ data[#data+1] = block * 256
+ else
+ data[#data] = data[#data] + block
+ end
+
+ borderl = borderh and borderh + 2
+ end
+ end
+
+ if zeroh then
+ if #data == 8 then return nil end
+ while #data < 8 do
+ table.insert(data, zeroh, 0)
+ end
+ end
+
+ if #data == 8 and prefix then
+ table.insert(obj, data)
+ table.insert(obj, prefix)
+ return obj
+ end
+end
+
+--- Transform given hex-encoded value to luci.ip.cidr instance of specified
+-- address family.
+-- @param hex String containing hex encoded value
+-- @param prefix Prefix length of CIDR instance (optional, default is 32/128)
+-- @param family Address family, either luci.ip.FAMILY_INET4 or FAMILY_INET6
+-- @param swap Bool indicating whether to swap byteorder on low endian host
+-- @return luci.ip.cidr instance or nil if given value was invalid
+-- @see IPv4
+-- @see IPv6
+function Hex( hex, prefix, family, swap )
+ family = ( family ~= nil ) and family or FAMILY_INET4
+ swap = ( swap == nil ) and true or swap
+ prefix = prefix or __maxlen(family)
+
+ local len = __maxlen(family)
+ local tmp = ""
+ local data = { }
+ local i
+
+ for i = 1, (len/4) - #hex do tmp = tmp .. '0' end
+
+ if swap and LITTLE_ENDIAN then
+ for i = #hex, 1, -2 do tmp = tmp .. hex:sub( i - 1, i ) end
+ else
+ tmp = tmp .. hex
+ end
+
+ hex = tmp
+
+ for i = 1, ( len / 4 ), 4 do
+ local n = tonumber( hex:sub( i, i+3 ), 16 )
+ if n then
+ data[#data+1] = n
+ else
+ return nil
+ end
+ end
+
+ return __bless({ family, data, prefix })
+end
+
+
+--- LuCI IP Library / CIDR instances
+-- @class module
+-- @cstyle instance
+-- @name luci.ip.cidr
+cidr = util.class()
+
+--- Test whether the instance is a IPv4 address.
+-- @return Boolean indicating a IPv4 address type
+-- @see cidr.is6
+function cidr.is4( self )
+ return self[1] == FAMILY_INET4
+end
+
+--- Test whether this instance is an IPv4 RFC1918 private address
+-- @return Boolean indicating whether this instance is an RFC1918 address
+function cidr.is4rfc1918( self )
+ if self[1] == FAMILY_INET4 then
+ return ((self[2][1] >= 0x0A00) and (self[2][1] <= 0x0AFF)) or
+ ((self[2][1] >= 0xAC10) and (self[2][1] <= 0xAC1F)) or
+ (self[2][1] == 0xC0A8)
+ end
+ return false
+end
+
+--- Test whether this instance is an IPv4 link-local address (Zeroconf)
+-- @return Boolean indicating whether this instance is IPv4 link-local
+function cidr.is4linklocal( self )
+ if self[1] == FAMILY_INET4 then
+ return (self[2][1] == 0xA9FE)
+ end
+ return false
+end
+
+--- Test whether the instance is a IPv6 address.
+-- @return Boolean indicating a IPv6 address type
+-- @see cidr.is4
+function cidr.is6( self )
+ return self[1] == FAMILY_INET6
+end
+
+--- Test whether this instance is an IPv6 link-local address
+-- @return Boolean indicating whether this instance is IPv6 link-local
+function cidr.is6linklocal( self )
+ if self[1] == FAMILY_INET6 then
+ return (self[2][1] >= 0xFE80) and (self[2][1] <= 0xFEBF)
+ end
+ return false
+end
+
+--- Return a corresponding string representation of the instance.
+-- If the prefix length is lower then the maximum possible prefix length for the
+-- corresponding address type then the address is returned in CIDR notation,
+-- otherwise the prefix will be left out.
+function cidr.string( self )
+ local str
+ if self:is4() then
+ str = string.format(
+ "%d.%d.%d.%d",
+ bit.rshift(self[2][1], 8), bit.band(self[2][1], 0xFF),
+ bit.rshift(self[2][2], 8), bit.band(self[2][2], 0xFF)
+ )
+ if self[3] < 32 then
+ str = str .. "/" .. self[3]
+ end
+ elseif self:is6() then
+ str = string.format( "%X:%X:%X:%X:%X:%X:%X:%X", unpack(self[2]) )
+ if self[3] < 128 then
+ str = str .. "/" .. self[3]
+ end
+ end
+ return str
+end
+
+--- Test whether the value of the instance is lower then the given address.
+-- This function will throw an exception if the given address has a different
+-- family than this instance.
+-- @param addr A luci.ip.cidr instance to compare against
+-- @return Boolean indicating whether this instance is lower
+-- @see cidr.higher
+-- @see cidr.equal
+function cidr.lower( self, addr )
+ assert( self[1] == addr[1], "Can't compare IPv4 and IPv6 addresses" )
+ local i
+ for i = 1, #self[2] do
+ if self[2][i] ~= addr[2][i] then
+ return self[2][i] < addr[2][i]
+ end
+ end
+ return false
+end
+
+--- Test whether the value of the instance is higher then the given address.
+-- This function will throw an exception if the given address has a different
+-- family than this instance.
+-- @param addr A luci.ip.cidr instance to compare against
+-- @return Boolean indicating whether this instance is higher
+-- @see cidr.lower
+-- @see cidr.equal
+function cidr.higher( self, addr )
+ assert( self[1] == addr[1], "Can't compare IPv4 and IPv6 addresses" )
+ local i
+ for i = 1, #self[2] do
+ if self[2][i] ~= addr[2][i] then
+ return self[2][i] > addr[2][i]
+ end
+ end
+ return false
+end
+
+--- Test whether the value of the instance is equal to the given address.
+-- This function will throw an exception if the given address is a different
+-- family than this instance.
+-- @param addr A luci.ip.cidr instance to compare against
+-- @return Boolean indicating whether this instance is equal
+-- @see cidr.lower
+-- @see cidr.higher
+function cidr.equal( self, addr )
+ assert( self[1] == addr[1], "Can't compare IPv4 and IPv6 addresses" )
+ local i
+ for i = 1, #self[2] do
+ if self[2][i] ~= addr[2][i] then
+ return false
+ end
+ end
+ return true
+end
+
+--- Return the prefix length of this CIDR instance.
+-- @param mask Override instance prefix with given netmask (optional)
+-- @return Prefix length in bit
+function cidr.prefix( self, mask )
+ local prefix = self[3]
+
+ if mask then
+ prefix = 0
+
+ local stop = false
+ local obj = type(mask) ~= "table"
+ and ( self:is4() and IPv4(mask) or IPv6(mask) ) or mask
+
+ if not obj then return nil end
+
+ local _, word
+ for _, word in ipairs(obj[2]) do
+ if word == 0xFFFF then
+ prefix = prefix + 16
+ else
+ local bitmask = bit.lshift(1, 15)
+ while bit.band(word, bitmask) == bitmask do
+ prefix = prefix + 1
+ bitmask = bit.lshift(1, 15 - (prefix % 16))
+ end
+
+ break
+ end
+ end
+ end
+
+ return prefix
+end
+
+--- Return a corresponding CIDR representing the network address of this
+-- instance.
+-- @param bits Override prefix length of this instance (optional)
+-- @return CIDR instance containing the network address
+-- @see cidr.host
+-- @see cidr.broadcast
+-- @see cidr.mask
+function cidr.network( self, bits )
+ local data = { }
+ bits = bits or self[3]
+
+ local i
+ for i = 1, math.floor( bits / 16 ) do
+ data[#data+1] = self[2][i]
+ end
+
+ if #data < #self[2] then
+ data[#data+1] = bit.band( self[2][1+#data], __mask16(bits) )
+
+ for i = #data + 1, #self[2] do
+ data[#data+1] = 0
+ end
+ end
+
+ return __bless({ self[1], data, __maxlen(self[1]) })
+end
+
+--- Return a corresponding CIDR representing the host address of this
+-- instance. This is intended to extract the host address from larger subnet.
+-- @return CIDR instance containing the network address
+-- @see cidr.network
+-- @see cidr.broadcast
+-- @see cidr.mask
+function cidr.host( self )
+ return __bless({ self[1], self[2], __maxlen(self[1]) })
+end
+
+--- Return a corresponding CIDR representing the netmask of this instance.
+-- @param bits Override prefix length of this instance (optional)
+-- @return CIDR instance containing the netmask
+-- @see cidr.network
+-- @see cidr.host
+-- @see cidr.broadcast
+function cidr.mask( self, bits )
+ local data = { }
+ bits = bits or self[3]
+
+ for i = 1, math.floor( bits / 16 ) do
+ data[#data+1] = 0xFFFF
+ end
+
+ if #data < #self[2] then
+ data[#data+1] = __mask16(bits)
+
+ for i = #data + 1, #self[2] do
+ data[#data+1] = 0
+ end
+ end
+
+ return __bless({ self[1], data, __maxlen(self[1]) })
+end
+
+--- Return CIDR containing the broadcast address of this instance.
+-- @return CIDR instance containing the netmask, always nil for IPv6
+-- @see cidr.network
+-- @see cidr.host
+-- @see cidr.mask
+function cidr.broadcast( self )
+ -- IPv6 has no broadcast addresses (XXX: assert() instead?)
+ if self[1] == FAMILY_INET4 then
+ local data = { unpack(self[2]) }
+ local offset = math.floor( self[3] / 16 ) + 1
+
+ if offset <= #data then
+ data[offset] = bit.bor( data[offset], __not16(self[3]) )
+ for i = offset + 1, #data do data[i] = 0xFFFF end
+
+ return __bless({ self[1], data, __maxlen(self[1]) })
+ end
+ end
+end
+
+--- Test whether this instance fully contains the given CIDR instance.
+-- @param addr CIDR instance to test against
+-- @return Boolean indicating whether this instance contains the given CIDR
+function cidr.contains( self, addr )
+ assert( self[1] == addr[1], "Can't compare IPv4 and IPv6 addresses" )
+
+ if self:prefix() <= addr:prefix() then
+ return self:network() == addr:network(self:prefix())
+ end
+
+ return false
+end
+
+--- Add specified amount of hosts to this instance.
+-- @param amount Number of hosts to add to this instance
+-- @param inplace Boolen indicating whether to alter values inplace (optional)
+-- @return CIDR representing the new address or nil on overflow error
+-- @see cidr.sub
+function cidr.add( self, amount, inplace )
+ local pos
+ local data = { unpack(self[2]) }
+ local shorts = __array16( amount, self[1] )
+
+ for pos = #data, 1, -1 do
+ local add = ( #shorts > 0 ) and table.remove( shorts, #shorts ) or 0
+ if ( data[pos] + add ) > 0xFFFF then
+ data[pos] = ( data[pos] + add ) % 0xFFFF
+ if pos > 1 then
+ data[pos-1] = data[pos-1] + ( add - data[pos] )
+ else
+ return nil
+ end
+ else
+ data[pos] = data[pos] + add
+ end
+ end
+
+ if inplace then
+ self[2] = data
+ return self
+ else
+ return __bless({ self[1], data, self[3] })
+ end
+end
+
+--- Substract specified amount of hosts from this instance.
+-- @param amount Number of hosts to substract from this instance
+-- @param inplace Boolen indicating whether to alter values inplace (optional)
+-- @return CIDR representing the new address or nil on underflow error
+-- @see cidr.add
+function cidr.sub( self, amount, inplace )
+ local pos
+ local data = { unpack(self[2]) }
+ local shorts = __array16( amount, self[1] )
+
+ for pos = #data, 1, -1 do
+ local sub = ( #shorts > 0 ) and table.remove( shorts, #shorts ) or 0
+ if ( data[pos] - sub ) < 0 then
+ data[pos] = ( sub - data[pos] ) % 0xFFFF
+ if pos > 1 then
+ data[pos-1] = data[pos-1] - ( sub + data[pos] )
+ else
+ return nil
+ end
+ else
+ data[pos] = data[pos] - sub
+ end
+ end
+
+ if inplace then
+ self[2] = data
+ return self
+ else
+ return __bless({ self[1], data, self[3] })
+ end
+end
+
+--- Return CIDR containing the lowest available host address within this subnet.
+-- @return CIDR containing the host address, nil if subnet is too small
+-- @see cidr.maxhost
+function cidr.minhost( self )
+ if self[3] <= __sublen(self[1]) then
+ -- 1st is Network Address in IPv4 and Subnet-Router Anycast Adresse in IPv6
+ return self:network():add(1, true)
+ end
+end
+
+--- Return CIDR containing the highest available host address within the subnet.
+-- @return CIDR containing the host address, nil if subnet is too small
+-- @see cidr.minhost
+function cidr.maxhost( self )
+ if self[3] <= __sublen(self[1]) then
+ local i
+ local data = { unpack(self[2]) }
+ local offset = math.floor( self[3] / 16 ) + 1
+
+ data[offset] = bit.bor( data[offset], __not16(self[3]) )
+ for i = offset + 1, #data do data[i] = 0xFFFF end
+ data = __bless({ self[1], data, __maxlen(self[1]) })
+
+ -- Last address in reserved for Broadcast Address in IPv4
+ if data[1] == FAMILY_INET4 then data:sub(1, true) end
+
+ return data
+ end
+end
--- /dev/null
+--[[
+LuaSocket 2.0.2 license
+Copyright � 2004-2007 Diego Nehab
+
+Permission is hereby granted, free of charge, to any person obtaining a
+copy of this software and associated documentation files (the "Software"),
+to deal in the Software without restriction, including without limitation
+the rights to use, copy, modify, merge, publish, distribute, sublicense,
+and/or sell copies of the Software, and to permit persons to whom the
+Software is furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in
+all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING
+FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER
+DEALINGS IN THE SOFTWARE.
+]]--
+--[[
+ Changes made by LuCI project:
+ * Renamed to luci.ltn12 to avoid collisions with luasocket
+ * Added inline documentation
+]]--
+-----------------------------------------------------------------------------
+-- LTN12 - Filters, sources, sinks and pumps.
+-- LuaSocket toolkit.
+-- Author: Diego Nehab
+-- RCS ID: $Id$
+-----------------------------------------------------------------------------
+
+-----------------------------------------------------------------------------
+-- Declare module
+-----------------------------------------------------------------------------
+local string = require("string")
+local table = require("table")
+local base = _G
+
+--- Diego Nehab's LTN12 - Filters, sources, sinks and pumps.
+-- See http://lua-users.org/wiki/FiltersSourcesAndSinks for design concepts
+module("luci.ltn12")
+
+filter = {}
+source = {}
+sink = {}
+pump = {}
+
+-- 2048 seems to be better in windows...
+BLOCKSIZE = 2048
+_VERSION = "LTN12 1.0.1"
+
+-----------------------------------------------------------------------------
+-- Filter stuff
+-----------------------------------------------------------------------------
+
+--- LTN12 Filter constructors
+-- @class module
+-- @name luci.ltn12.filter
+
+--- Return a high level filter that cycles a low-level filter
+-- by passing it each chunk and updating a context between calls.
+-- @param low Low-level filter
+-- @param ctx Context
+-- @param extra Extra argument passed to the low-level filter
+-- @return LTN12 filter
+function filter.cycle(low, ctx, extra)
+ base.assert(low)
+ return function(chunk)
+ local ret
+ ret, ctx = low(ctx, chunk, extra)
+ return ret
+ end
+end
+
+--- Chain a bunch of filters together.
+-- (thanks to Wim Couwenberg)
+-- @param ... filters to be chained
+-- @return LTN12 filter
+function filter.chain(...)
+ local n = table.getn(arg)
+ local top, index = 1, 1
+ local retry = ""
+ return function(chunk)
+ retry = chunk and retry
+ while true do
+ if index == top then
+ chunk = arg[index](chunk)
+ if chunk == "" or top == n then return chunk
+ elseif chunk then index = index + 1
+ else
+ top = top+1
+ index = top
+ end
+ else
+ chunk = arg[index](chunk or "")
+ if chunk == "" then
+ index = index - 1
+ chunk = retry
+ elseif chunk then
+ if index == n then return chunk
+ else index = index + 1 end
+ else base.error("filter returned inappropriate nil") end
+ end
+ end
+ end
+end
+
+-----------------------------------------------------------------------------
+-- Source stuff
+-----------------------------------------------------------------------------
+
+--- LTN12 Source constructors
+-- @class module
+-- @name luci.ltn12.source
+
+-- create an empty source
+local function empty()
+ return nil
+end
+
+--- Create an empty source.
+-- @return LTN12 source
+function source.empty()
+ return empty
+end
+
+--- Return a source that just outputs an error.
+-- @param err Error object
+-- @return LTN12 source
+function source.error(err)
+ return function()
+ return nil, err
+ end
+end
+
+--- Create a file source.
+-- @param handle File handle ready for reading
+-- @param io_err IO error object
+-- @return LTN12 source
+function source.file(handle, io_err)
+ if handle then
+ return function()
+ local chunk = handle:read(BLOCKSIZE)
+ if not chunk then handle:close() end
+ return chunk
+ end
+ else return source.error(io_err or "unable to open file") end
+end
+
+--- Turn a fancy source into a simple source.
+-- @param src fancy source
+-- @return LTN12 source
+function source.simplify(src)
+ base.assert(src)
+ return function()
+ local chunk, err_or_new = src()
+ src = err_or_new or src
+ if not chunk then return nil, err_or_new
+ else return chunk end
+ end
+end
+
+--- Create a string source.
+-- @param s Data
+-- @return LTN12 source
+function source.string(s)
+ if s then
+ local i = 1
+ return function()
+ local chunk = string.sub(s, i, i+BLOCKSIZE-1)
+ i = i + BLOCKSIZE
+ if chunk ~= "" then return chunk
+ else return nil end
+ end
+ else return source.empty() end
+end
+
+--- Creates rewindable source.
+-- @param src LTN12 source to be made rewindable
+-- @return LTN12 source
+function source.rewind(src)
+ base.assert(src)
+ local t = {}
+ return function(chunk)
+ if not chunk then
+ chunk = table.remove(t)
+ if not chunk then return src()
+ else return chunk end
+ else
+ t[#t+1] = chunk
+ end
+ end
+end
+
+--- Chain a source and a filter together.
+-- @param src LTN12 source
+-- @param f LTN12 filter
+-- @return LTN12 source
+function source.chain(src, f)
+ base.assert(src and f)
+ local last_in, last_out = "", ""
+ local state = "feeding"
+ local err
+ return function()
+ if not last_out then
+ base.error('source is empty!', 2)
+ end
+ while true do
+ if state == "feeding" then
+ last_in, err = src()
+ if err then return nil, err end
+ last_out = f(last_in)
+ if not last_out then
+ if last_in then
+ base.error('filter returned inappropriate nil')
+ else
+ return nil
+ end
+ elseif last_out ~= "" then
+ state = "eating"
+ if last_in then last_in = "" end
+ return last_out
+ end
+ else
+ last_out = f(last_in)
+ if last_out == "" then
+ if last_in == "" then
+ state = "feeding"
+ else
+ base.error('filter returned ""')
+ end
+ elseif not last_out then
+ if last_in then
+ base.error('filter returned inappropriate nil')
+ else
+ return nil
+ end
+ else
+ return last_out
+ end
+ end
+ end
+ end
+end
+
+--- Create a source that produces contents of several sources.
+-- Sources will be used one after the other, as if they were concatenated
+-- (thanks to Wim Couwenberg)
+-- @param ... LTN12 sources
+-- @return LTN12 source
+function source.cat(...)
+ local src = table.remove(arg, 1)
+ return function()
+ while src do
+ local chunk, err = src()
+ if chunk then return chunk end
+ if err then return nil, err end
+ src = table.remove(arg, 1)
+ end
+ end
+end
+
+-----------------------------------------------------------------------------
+-- Sink stuff
+-----------------------------------------------------------------------------
+
+--- LTN12 sink constructors
+-- @class module
+-- @name luci.ltn12.sink
+
+--- Create a sink that stores into a table.
+-- @param t output table to store into
+-- @return LTN12 sink
+function sink.table(t)
+ t = t or {}
+ local f = function(chunk, err)
+ if chunk then t[#t+1] = chunk end
+ return 1
+ end
+ return f, t
+end
+
+--- Turn a fancy sink into a simple sink.
+-- @param snk fancy sink
+-- @return LTN12 sink
+function sink.simplify(snk)
+ base.assert(snk)
+ return function(chunk, err)
+ local ret, err_or_new = snk(chunk, err)
+ if not ret then return nil, err_or_new end
+ snk = err_or_new or snk
+ return 1
+ end
+end
+
+--- Create a file sink.
+-- @param handle file handle to write to
+-- @param io_err IO error
+-- @return LTN12 sink
+function sink.file(handle, io_err)
+ if handle then
+ return function(chunk, err)
+ if not chunk then
+ handle:close()
+ return 1
+ else return handle:write(chunk) end
+ end
+ else return sink.error(io_err or "unable to open file") end
+end
+
+-- creates a sink that discards data
+local function null()
+ return 1
+end
+
+--- Create a sink that discards data.
+-- @return LTN12 sink
+function sink.null()
+ return null
+end
+
+--- Create a sink that just returns an error.
+-- @param err Error object
+-- @return LTN12 sink
+function sink.error(err)
+ return function()
+ return nil, err
+ end
+end
+
+--- Chain a sink with a filter.
+-- @param f LTN12 filter
+-- @param snk LTN12 sink
+-- @return LTN12 sink
+function sink.chain(f, snk)
+ base.assert(f and snk)
+ return function(chunk, err)
+ if chunk ~= "" then
+ local filtered = f(chunk)
+ local done = chunk and ""
+ while true do
+ local ret, snkerr = snk(filtered, err)
+ if not ret then return nil, snkerr end
+ if filtered == done then return 1 end
+ filtered = f(done)
+ end
+ else return 1 end
+ end
+end
+
+-----------------------------------------------------------------------------
+-- Pump stuff
+-----------------------------------------------------------------------------
+
+--- LTN12 pump functions
+-- @class module
+-- @name luci.ltn12.pump
+
+--- Pump one chunk from the source to the sink.
+-- @param src LTN12 source
+-- @param snk LTN12 sink
+-- @return Chunk of data or nil if an error occured
+-- @return Error object
+function pump.step(src, snk)
+ local chunk, src_err = src()
+ local ret, snk_err = snk(chunk, src_err)
+ if chunk and ret then return 1
+ else return nil, src_err or snk_err end
+end
+
+--- Pump all data from a source to a sink, using a step function.
+-- @param src LTN12 source
+-- @param snk LTN12 sink
+-- @param step step function (optional)
+-- @return 1 if the operation succeeded otherwise nil
+-- @return Error object
+function pump.all(src, snk, step)
+ base.assert(src and snk)
+ step = step or pump.step
+ while true do
+ local ret, err = step(src, snk)
+ if not ret then
+ if err then return nil, err
+ else return 1 end
+ end
+ end
+end
+
--- /dev/null
+--[[
+LuCI - Lua Configuration Interface
+
+Copyright 2008 Steven Barth <steven@midlink.org>
+Copyright 2008 Jo-Philipp Wich <xm@leipzig.freifunk.net>
+
+Licensed under the Apache License, Version 2.0 (the "License");
+you may not use this file except in compliance with the License.
+You may obtain a copy of the License at
+
+http://www.apache.org/licenses/LICENSE-2.0
+
+$Id$
+]]--
+
+local config = require "luci.config"
+local ccache = require "luci.ccache"
+
+module "luci.cacheloader"
+
+if config.ccache and config.ccache.enable == "1" then
+ ccache.cache_ondemand()
+end
\ No newline at end of file
--- /dev/null
+--[[
+LuCI - Configuration Bind Interface
+
+Description:
+Offers an interface for binding configuration values to certain
+data types. Supports value and range validation and basic dependencies.
+
+FileId:
+$Id$
+
+License:
+Copyright 2008 Steven Barth <steven@midlink.org>
+
+Licensed under the Apache License, Version 2.0 (the "License");
+you may not use this file except in compliance with the License.
+You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+Unless required by applicable law or agreed to in writing, software
+distributed under the License is distributed on an "AS IS" BASIS,
+WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+See the License for the specific language governing permissions and
+limitations under the License.
+
+]]--
+module("luci.cbi", package.seeall)
+
+require("luci.template")
+local util = require("luci.util")
+require("luci.http")
+
+
+--local event = require "luci.sys.event"
+local fs = require("nixio.fs")
+local uci = require("luci.model.uci")
+local datatypes = require("luci.cbi.datatypes")
+local class = util.class
+local instanceof = util.instanceof
+
+FORM_NODATA = 0
+FORM_PROCEED = 0
+FORM_VALID = 1
+FORM_DONE = 1
+FORM_INVALID = -1
+FORM_CHANGED = 2
+FORM_SKIP = 4
+
+AUTO = true
+
+CREATE_PREFIX = "cbi.cts."
+REMOVE_PREFIX = "cbi.rts."
+RESORT_PREFIX = "cbi.sts."
+FEXIST_PREFIX = "cbi.cbe."
+
+-- Loads a CBI map from given file, creating an environment and returns it
+function load(cbimap, ...)
+ local fs = require "nixio.fs"
+ local i18n = require "luci.i18n"
+ require("luci.config")
+ require("luci.util")
+
+ local upldir = "/lib/uci/upload/"
+ local cbidir = luci.util.libpath() .. "/model/cbi/"
+ local func, err
+
+ if fs.access(cbidir..cbimap..".lua") then
+ func, err = loadfile(cbidir..cbimap..".lua")
+ elseif fs.access(cbimap) then
+ func, err = loadfile(cbimap)
+ else
+ func, err = nil, "Model '" .. cbimap .. "' not found!"
+ end
+
+ assert(func, err)
+
+ local env = {
+ translate=i18n.translate,
+ translatef=i18n.translatef,
+ arg={...}
+ }
+
+ setfenv(func, setmetatable(env, {__index =
+ function(tbl, key)
+ return rawget(tbl, key) or _M[key] or _G[key]
+ end}))
+
+ local maps = { func() }
+ local uploads = { }
+ local has_upload = false
+
+ for i, map in ipairs(maps) do
+ if not instanceof(map, Node) then
+ error("CBI map returns no valid map object!")
+ return nil
+ else
+ map:prepare()
+ if map.upload_fields then
+ has_upload = true
+ for _, field in ipairs(map.upload_fields) do
+ uploads[
+ field.config .. '.' ..
+ (field.section.sectiontype or '1') .. '.' ..
+ field.option
+ ] = true
+ end
+ end
+ end
+ end
+
+ if has_upload then
+ local uci = luci.model.uci.cursor()
+ local prm = luci.http.context.request.message.params
+ local fd, cbid
+
+ luci.http.setfilehandler(
+ function( field, chunk, eof )
+ if not field then return end
+ if field.name and not cbid then
+ local c, s, o = field.name:gmatch(
+ "cbid%.([^%.]+)%.([^%.]+)%.([^%.]+)"
+ )()
+
+ if c and s and o then
+ local t = uci:get( c, s ) or s
+ if uploads[c.."."..t.."."..o] then
+ local path = upldir .. field.name
+ fd = io.open(path, "w")
+ if fd then
+ cbid = field.name
+ prm[cbid] = path
+ end
+ end
+ end
+ end
+
+ if field.name == cbid and fd then
+ fd:write(chunk)
+ end
+
+ if eof and fd then
+ fd:close()
+ fd = nil
+ cbid = nil
+ end
+ end
+ )
+ end
+
+ return maps
+end
+
+--
+-- Compile a datatype specification into a parse tree for evaluation later on
+--
+local cdt_cache = { }
+
+function compile_datatype(code)
+ local i
+ local pos = 0
+ local esc = false
+ local depth = 0
+ local stack = { }
+
+ for i = 1, #code+1 do
+ local byte = code:byte(i) or 44
+ if esc then
+ esc = false
+ elseif byte == 92 then
+ esc = true
+ elseif byte == 40 or byte == 44 then
+ if depth <= 0 then
+ if pos < i then
+ local label = code:sub(pos, i-1)
+ :gsub("\\(.)", "%1")
+ :gsub("^%s+", "")
+ :gsub("%s+$", "")
+
+ if #label > 0 and tonumber(label) then
+ stack[#stack+1] = tonumber(label)
+ elseif label:match("^'.*'$") or label:match('^".*"$') then
+ stack[#stack+1] = label:gsub("[\"'](.*)[\"']", "%1")
+ elseif type(datatypes[label]) == "function" then
+ stack[#stack+1] = datatypes[label]
+ stack[#stack+1] = { }
+ else
+ error("Datatype error, bad token %q" % label)
+ end
+ end
+ pos = i + 1
+ end
+ depth = depth + (byte == 40 and 1 or 0)
+ elseif byte == 41 then
+ depth = depth - 1
+ if depth <= 0 then
+ if type(stack[#stack-1]) ~= "function" then
+ error("Datatype error, argument list follows non-function")
+ end
+ stack[#stack] = compile_datatype(code:sub(pos, i-1))
+ pos = i + 1
+ end
+ end
+ end
+
+ return stack
+end
+
+function verify_datatype(dt, value)
+ if dt and #dt > 0 then
+ if not cdt_cache[dt] then
+ local c = compile_datatype(dt)
+ if c and type(c[1]) == "function" then
+ cdt_cache[dt] = c
+ else
+ error("Datatype error, not a function expression")
+ end
+ end
+ if cdt_cache[dt] then
+ return cdt_cache[dt][1](value, unpack(cdt_cache[dt][2]))
+ end
+ end
+ return true
+end
+
+
+-- Node pseudo abstract class
+Node = class()
+
+function Node.__init__(self, title, description)
+ self.children = {}
+ self.title = title or ""
+ self.description = description or ""
+ self.template = "cbi/node"
+end
+
+-- hook helper
+function Node._run_hook(self, hook)
+ if type(self[hook]) == "function" then
+ return self[hook](self)
+ end
+end
+
+function Node._run_hooks(self, ...)
+ local f
+ local r = false
+ for _, f in ipairs(arg) do
+ if type(self[f]) == "function" then
+ self[f](self)
+ r = true
+ end
+ end
+ return r
+end
+
+-- Prepare nodes
+function Node.prepare(self, ...)
+ for k, child in ipairs(self.children) do
+ child:prepare(...)
+ end
+end
+
+-- Append child nodes
+function Node.append(self, obj)
+ table.insert(self.children, obj)
+end
+
+-- Parse this node and its children
+function Node.parse(self, ...)
+ for k, child in ipairs(self.children) do
+ child:parse(...)
+ end
+end
+
+-- Render this node
+function Node.render(self, scope)
+ scope = scope or {}
+ scope.self = self
+
+ luci.template.render(self.template, scope)
+end
+
+-- Render the children
+function Node.render_children(self, ...)
+ local k, node
+ for k, node in ipairs(self.children) do
+ node.last_child = (k == #self.children)
+ node:render(...)
+ end
+end
+
+
+--[[
+A simple template element
+]]--
+Template = class(Node)
+
+function Template.__init__(self, template)
+ Node.__init__(self)
+ self.template = template
+end
+
+function Template.render(self)
+ luci.template.render(self.template, {self=self})
+end
+
+function Template.parse(self, readinput)
+ self.readinput = (readinput ~= false)
+ return Map.formvalue(self, "cbi.submit") and FORM_DONE or FORM_NODATA
+end
+
+
+--[[
+Map - A map describing a configuration file
+]]--
+Map = class(Node)
+
+function Map.__init__(self, config, ...)
+ Node.__init__(self, ...)
+
+ self.config = config
+ self.parsechain = {self.config}
+ self.template = "cbi/map"
+ self.apply_on_parse = nil
+ self.readinput = true
+ self.proceed = false
+ self.flow = {}
+
+ self.uci = uci.cursor()
+ self.save = true
+
+ self.changed = false
+
+ if not self.uci:load(self.config) then
+ error("Unable to read UCI data: " .. self.config)
+ end
+end
+
+function Map.formvalue(self, key)
+ return self.readinput and luci.http.formvalue(key)
+end
+
+function Map.formvaluetable(self, key)
+ return self.readinput and luci.http.formvaluetable(key) or {}
+end
+
+function Map.get_scheme(self, sectiontype, option)
+ if not option then
+ return self.scheme and self.scheme.sections[sectiontype]
+ else
+ return self.scheme and self.scheme.variables[sectiontype]
+ and self.scheme.variables[sectiontype][option]
+ end
+end
+
+function Map.submitstate(self)
+ return self:formvalue("cbi.submit")
+end
+
+-- Chain foreign config
+function Map.chain(self, config)
+ table.insert(self.parsechain, config)
+end
+
+function Map.state_handler(self, state)
+ return state
+end
+
+-- Use optimized UCI writing
+function Map.parse(self, readinput, ...)
+ self.readinput = (readinput ~= false)
+ self:_run_hooks("on_parse")
+
+ if self:formvalue("cbi.skip") then
+ self.state = FORM_SKIP
+ return self:state_handler(self.state)
+ end
+
+ Node.parse(self, ...)
+
+ if self.save then
+ self:_run_hooks("on_save", "on_before_save")
+ for i, config in ipairs(self.parsechain) do
+ self.uci:save(config)
+ end
+ self:_run_hooks("on_after_save")
+ if self:submitstate() and ((not self.proceed and self.flow.autoapply) or luci.http.formvalue("cbi.apply")) then
+ self:_run_hooks("on_before_commit")
+ for i, config in ipairs(self.parsechain) do
+ self.uci:commit(config)
+
+ -- Refresh data because commit changes section names
+ self.uci:load(config)
+ end
+ self:_run_hooks("on_commit", "on_after_commit", "on_before_apply")
+ if self.apply_on_parse then
+ self.uci:apply(self.parsechain)
+ self:_run_hooks("on_apply", "on_after_apply")
+ else
+ -- This is evaluated by the dispatcher and delegated to the
+ -- template which in turn fires XHR to perform the actual
+ -- apply actions.
+ self.apply_needed = true
+ end
+
+ -- Reparse sections
+ Node.parse(self, true)
+
+ end
+ for i, config in ipairs(self.parsechain) do
+ self.uci:unload(config)
+ end
+ if type(self.commit_handler) == "function" then
+ self:commit_handler(self:submitstate())
+ end
+ end
+
+ if self:submitstate() then
+ if not self.save then
+ self.state = FORM_INVALID
+ elseif self.proceed then
+ self.state = FORM_PROCEED
+ else
+ self.state = self.changed and FORM_CHANGED or FORM_VALID
+ end
+ else
+ self.state = FORM_NODATA
+ end
+
+ return self:state_handler(self.state)
+end
+
+function Map.render(self, ...)
+ self:_run_hooks("on_init")
+ Node.render(self, ...)
+end
+
+-- Creates a child section
+function Map.section(self, class, ...)
+ if instanceof(class, AbstractSection) then
+ local obj = class(self, ...)
+ self:append(obj)
+ return obj
+ else
+ error("class must be a descendent of AbstractSection")
+ end
+end
+
+-- UCI add
+function Map.add(self, sectiontype)
+ return self.uci:add(self.config, sectiontype)
+end
+
+-- UCI set
+function Map.set(self, section, option, value)
+ if type(value) ~= "table" or #value > 0 then
+ if option then
+ return self.uci:set(self.config, section, option, value)
+ else
+ return self.uci:set(self.config, section, value)
+ end
+ else
+ return Map.del(self, section, option)
+ end
+end
+
+-- UCI del
+function Map.del(self, section, option)
+ if option then
+ return self.uci:delete(self.config, section, option)
+ else
+ return self.uci:delete(self.config, section)
+ end
+end
+
+-- UCI get
+function Map.get(self, section, option)
+ if not section then
+ return self.uci:get_all(self.config)
+ elseif option then
+ return self.uci:get(self.config, section, option)
+ else
+ return self.uci:get_all(self.config, section)
+ end
+end
+
+--[[
+Compound - Container
+]]--
+Compound = class(Node)
+
+function Compound.__init__(self, ...)
+ Node.__init__(self)
+ self.template = "cbi/compound"
+ self.children = {...}
+end
+
+function Compound.populate_delegator(self, delegator)
+ for _, v in ipairs(self.children) do
+ v.delegator = delegator
+ end
+end
+
+function Compound.parse(self, ...)
+ local cstate, state = 0
+
+ for k, child in ipairs(self.children) do
+ cstate = child:parse(...)
+ state = (not state or cstate < state) and cstate or state
+ end
+
+ return state
+end
+
+
+--[[
+Delegator - Node controller
+]]--
+Delegator = class(Node)
+function Delegator.__init__(self, ...)
+ Node.__init__(self, ...)
+ self.nodes = {}
+ self.defaultpath = {}
+ self.pageaction = false
+ self.readinput = true
+ self.allow_reset = false
+ self.allow_cancel = false
+ self.allow_back = false
+ self.allow_finish = false
+ self.template = "cbi/delegator"
+end
+
+function Delegator.set(self, name, node)
+ assert(not self.nodes[name], "Duplicate entry")
+
+ self.nodes[name] = node
+end
+
+function Delegator.add(self, name, node)
+ node = self:set(name, node)
+ self.defaultpath[#self.defaultpath+1] = name
+end
+
+function Delegator.insert_after(self, name, after)
+ local n = #self.chain + 1
+ for k, v in ipairs(self.chain) do
+ if v == after then
+ n = k + 1
+ break
+ end
+ end
+ table.insert(self.chain, n, name)
+end
+
+function Delegator.set_route(self, ...)
+ local n, chain, route = 0, self.chain, {...}
+ for i = 1, #chain do
+ if chain[i] == self.current then
+ n = i
+ break
+ end
+ end
+ for i = 1, #route do
+ n = n + 1
+ chain[n] = route[i]
+ end
+ for i = n + 1, #chain do
+ chain[i] = nil
+ end
+end
+
+function Delegator.get(self, name)
+ local node = self.nodes[name]
+
+ if type(node) == "string" then
+ node = load(node, name)
+ end
+
+ if type(node) == "table" and getmetatable(node) == nil then
+ node = Compound(unpack(node))
+ end
+
+ return node
+end
+
+function Delegator.parse(self, ...)
+ if self.allow_cancel and Map.formvalue(self, "cbi.cancel") then
+ if self:_run_hooks("on_cancel") then
+ return FORM_DONE
+ end
+ end
+
+ if not Map.formvalue(self, "cbi.delg.current") then
+ self:_run_hooks("on_init")
+ end
+
+ local newcurrent
+ self.chain = self.chain or self:get_chain()
+ self.current = self.current or self:get_active()
+ self.active = self.active or self:get(self.current)
+ assert(self.active, "Invalid state")
+
+ local stat = FORM_DONE
+ if type(self.active) ~= "function" then
+ self.active:populate_delegator(self)
+ stat = self.active:parse()
+ else
+ self:active()
+ end
+
+ if stat > FORM_PROCEED then
+ if Map.formvalue(self, "cbi.delg.back") then
+ newcurrent = self:get_prev(self.current)
+ else
+ newcurrent = self:get_next(self.current)
+ end
+ elseif stat < FORM_PROCEED then
+ return stat
+ end
+
+
+ if not Map.formvalue(self, "cbi.submit") then
+ return FORM_NODATA
+ elseif stat > FORM_PROCEED
+ and (not newcurrent or not self:get(newcurrent)) then
+ return self:_run_hook("on_done") or FORM_DONE
+ else
+ self.current = newcurrent or self.current
+ self.active = self:get(self.current)
+ if type(self.active) ~= "function" then
+ self.active:populate_delegator(self)
+ local stat = self.active:parse(false)
+ if stat == FORM_SKIP then
+ return self:parse(...)
+ else
+ return FORM_PROCEED
+ end
+ else
+ return self:parse(...)
+ end
+ end
+end
+
+function Delegator.get_next(self, state)
+ for k, v in ipairs(self.chain) do
+ if v == state then
+ return self.chain[k+1]
+ end
+ end
+end
+
+function Delegator.get_prev(self, state)
+ for k, v in ipairs(self.chain) do
+ if v == state then
+ return self.chain[k-1]
+ end
+ end
+end
+
+function Delegator.get_chain(self)
+ local x = Map.formvalue(self, "cbi.delg.path") or self.defaultpath
+ return type(x) == "table" and x or {x}
+end
+
+function Delegator.get_active(self)
+ return Map.formvalue(self, "cbi.delg.current") or self.chain[1]
+end
+
+--[[
+Page - A simple node
+]]--
+
+Page = class(Node)
+Page.__init__ = Node.__init__
+Page.parse = function() end
+
+
+--[[
+SimpleForm - A Simple non-UCI form
+]]--
+SimpleForm = class(Node)
+
+function SimpleForm.__init__(self, config, title, description, data)
+ Node.__init__(self, title, description)
+ self.config = config
+ self.data = data or {}
+ self.template = "cbi/simpleform"
+ self.dorender = true
+ self.pageaction = false
+ self.readinput = true
+end
+
+SimpleForm.formvalue = Map.formvalue
+SimpleForm.formvaluetable = Map.formvaluetable
+
+function SimpleForm.parse(self, readinput, ...)
+ self.readinput = (readinput ~= false)
+
+ if self:formvalue("cbi.skip") then
+ return FORM_SKIP
+ end
+
+ if self:formvalue("cbi.cancel") and self:_run_hooks("on_cancel") then
+ return FORM_DONE
+ end
+
+ if self:submitstate() then
+ Node.parse(self, 1, ...)
+ end
+
+ local valid = true
+ for k, j in ipairs(self.children) do
+ for i, v in ipairs(j.children) do
+ valid = valid
+ and (not v.tag_missing or not v.tag_missing[1])
+ and (not v.tag_invalid or not v.tag_invalid[1])
+ and (not v.error)
+ end
+ end
+
+ local state =
+ not self:submitstate() and FORM_NODATA
+ or valid and FORM_VALID
+ or FORM_INVALID
+
+ self.dorender = not self.handle
+ if self.handle then
+ local nrender, nstate = self:handle(state, self.data)
+ self.dorender = self.dorender or (nrender ~= false)
+ state = nstate or state
+ end
+ return state
+end
+
+function SimpleForm.render(self, ...)
+ if self.dorender then
+ Node.render(self, ...)
+ end
+end
+
+function SimpleForm.submitstate(self)
+ return self:formvalue("cbi.submit")
+end
+
+function SimpleForm.section(self, class, ...)
+ if instanceof(class, AbstractSection) then
+ local obj = class(self, ...)
+ self:append(obj)
+ return obj
+ else
+ error("class must be a descendent of AbstractSection")
+ end
+end
+
+-- Creates a child field
+function SimpleForm.field(self, class, ...)
+ local section
+ for k, v in ipairs(self.children) do
+ if instanceof(v, SimpleSection) then
+ section = v
+ break
+ end
+ end
+ if not section then
+ section = self:section(SimpleSection)
+ end
+
+ if instanceof(class, AbstractValue) then
+ local obj = class(self, section, ...)
+ obj.track_missing = true
+ section:append(obj)
+ return obj
+ else
+ error("class must be a descendent of AbstractValue")
+ end
+end
+
+function SimpleForm.set(self, section, option, value)
+ self.data[option] = value
+end
+
+
+function SimpleForm.del(self, section, option)
+ self.data[option] = nil
+end
+
+
+function SimpleForm.get(self, section, option)
+ return self.data[option]
+end
+
+
+function SimpleForm.get_scheme()
+ return nil
+end
+
+
+Form = class(SimpleForm)
+
+function Form.__init__(self, ...)
+ SimpleForm.__init__(self, ...)
+ self.embedded = true
+end
+
+
+--[[
+AbstractSection
+]]--
+AbstractSection = class(Node)
+
+function AbstractSection.__init__(self, map, sectiontype, ...)
+ Node.__init__(self, ...)
+ self.sectiontype = sectiontype
+ self.map = map
+ self.config = map.config
+ self.optionals = {}
+ self.defaults = {}
+ self.fields = {}
+ self.tag_error = {}
+ self.tag_invalid = {}
+ self.tag_deperror = {}
+ self.changed = false
+
+ self.optional = true
+ self.addremove = false
+ self.dynamic = false
+end
+
+-- Define a tab for the section
+function AbstractSection.tab(self, tab, title, desc)
+ self.tabs = self.tabs or { }
+ self.tab_names = self.tab_names or { }
+
+ self.tab_names[#self.tab_names+1] = tab
+ self.tabs[tab] = {
+ title = title,
+ description = desc,
+ childs = { }
+ }
+end
+
+-- Check whether the section has tabs
+function AbstractSection.has_tabs(self)
+ return (self.tabs ~= nil) and (next(self.tabs) ~= nil)
+end
+
+-- Appends a new option
+function AbstractSection.option(self, class, option, ...)
+ if instanceof(class, AbstractValue) then
+ local obj = class(self.map, self, option, ...)
+ self:append(obj)
+ self.fields[option] = obj
+ return obj
+ elseif class == true then
+ error("No valid class was given and autodetection failed.")
+ else
+ error("class must be a descendant of AbstractValue")
+ end
+end
+
+-- Appends a new tabbed option
+function AbstractSection.taboption(self, tab, ...)
+
+ assert(tab and self.tabs and self.tabs[tab],
+ "Cannot assign option to not existing tab %q" % tostring(tab))
+
+ local l = self.tabs[tab].childs
+ local o = AbstractSection.option(self, ...)
+
+ if o then l[#l+1] = o end
+
+ return o
+end
+
+-- Render a single tab
+function AbstractSection.render_tab(self, tab, ...)
+
+ assert(tab and self.tabs and self.tabs[tab],
+ "Cannot render not existing tab %q" % tostring(tab))
+
+ local k, node
+ for k, node in ipairs(self.tabs[tab].childs) do
+ node.last_child = (k == #self.tabs[tab].childs)
+ node:render(...)
+ end
+end
+
+-- Parse optional options
+function AbstractSection.parse_optionals(self, section)
+ if not self.optional then
+ return
+ end
+
+ self.optionals[section] = {}
+
+ local field = self.map:formvalue("cbi.opt."..self.config.."."..section)
+ for k,v in ipairs(self.children) do
+ if v.optional and not v:cfgvalue(section) and not self:has_tabs() then
+ if field == v.option then
+ field = nil
+ self.map.proceed = true
+ else
+ table.insert(self.optionals[section], v)
+ end
+ end
+ end
+
+ if field and #field > 0 and self.dynamic then
+ self:add_dynamic(field)
+ end
+end
+
+-- Add a dynamic option
+function AbstractSection.add_dynamic(self, field, optional)
+ local o = self:option(Value, field, field)
+ o.optional = optional
+end
+
+-- Parse all dynamic options
+function AbstractSection.parse_dynamic(self, section)
+ if not self.dynamic then
+ return
+ end
+
+ local arr = luci.util.clone(self:cfgvalue(section))
+ local form = self.map:formvaluetable("cbid."..self.config.."."..section)
+ for k, v in pairs(form) do
+ arr[k] = v
+ end
+
+ for key,val in pairs(arr) do
+ local create = true
+
+ for i,c in ipairs(self.children) do
+ if c.option == key then
+ create = false
+ end
+ end
+
+ if create and key:sub(1, 1) ~= "." then
+ self.map.proceed = true
+ self:add_dynamic(key, true)
+ end
+ end
+end
+
+-- Returns the section's UCI table
+function AbstractSection.cfgvalue(self, section)
+ return self.map:get(section)
+end
+
+-- Push events
+function AbstractSection.push_events(self)
+ --luci.util.append(self.map.events, self.events)
+ self.map.changed = true
+end
+
+-- Removes the section
+function AbstractSection.remove(self, section)
+ self.map.proceed = true
+ return self.map:del(section)
+end
+
+-- Creates the section
+function AbstractSection.create(self, section)
+ local stat
+
+ if section then
+ stat = section:match("^[%w_]+$") and self.map:set(section, nil, self.sectiontype)
+ else
+ section = self.map:add(self.sectiontype)
+ stat = section
+ end
+
+ if stat then
+ for k,v in pairs(self.children) do
+ if v.default then
+ self.map:set(section, v.option, v.default)
+ end
+ end
+
+ for k,v in pairs(self.defaults) do
+ self.map:set(section, k, v)
+ end
+ end
+
+ self.map.proceed = true
+
+ return stat
+end
+
+
+SimpleSection = class(AbstractSection)
+
+function SimpleSection.__init__(self, form, ...)
+ AbstractSection.__init__(self, form, nil, ...)
+ self.template = "cbi/nullsection"
+end
+
+
+Table = class(AbstractSection)
+
+function Table.__init__(self, form, data, ...)
+ local datasource = {}
+ local tself = self
+ datasource.config = "table"
+ self.data = data or {}
+
+ datasource.formvalue = Map.formvalue
+ datasource.formvaluetable = Map.formvaluetable
+ datasource.readinput = true
+
+ function datasource.get(self, section, option)
+ return tself.data[section] and tself.data[section][option]
+ end
+
+ function datasource.submitstate(self)
+ return Map.formvalue(self, "cbi.submit")
+ end
+
+ function datasource.del(...)
+ return true
+ end
+
+ function datasource.get_scheme()
+ return nil
+ end
+
+ AbstractSection.__init__(self, datasource, "table", ...)
+ self.template = "cbi/tblsection"
+ self.rowcolors = true
+ self.anonymous = true
+end
+
+function Table.parse(self, readinput)
+ self.map.readinput = (readinput ~= false)
+ for i, k in ipairs(self:cfgsections()) do
+ if self.map:submitstate() then
+ Node.parse(self, k)
+ end
+ end
+end
+
+function Table.cfgsections(self)
+ local sections = {}
+
+ for i, v in luci.util.kspairs(self.data) do
+ table.insert(sections, i)
+ end
+
+ return sections
+end
+
+function Table.update(self, data)
+ self.data = data
+end
+
+
+
+--[[
+NamedSection - A fixed configuration section defined by its name
+]]--
+NamedSection = class(AbstractSection)
+
+function NamedSection.__init__(self, map, section, stype, ...)
+ AbstractSection.__init__(self, map, stype, ...)
+
+ -- Defaults
+ self.addremove = false
+ self.template = "cbi/nsection"
+ self.section = section
+end
+
+function NamedSection.parse(self, novld)
+ local s = self.section
+ local active = self:cfgvalue(s)
+
+ if self.addremove then
+ local path = self.config.."."..s
+ if active then -- Remove the section
+ if self.map:formvalue("cbi.rns."..path) and self:remove(s) then
+ self:push_events()
+ return
+ end
+ else -- Create and apply default values
+ if self.map:formvalue("cbi.cns."..path) then
+ self:create(s)
+ return
+ end
+ end
+ end
+
+ if active then
+ AbstractSection.parse_dynamic(self, s)
+ if self.map:submitstate() then
+ Node.parse(self, s)
+ end
+ AbstractSection.parse_optionals(self, s)
+
+ if self.changed then
+ self:push_events()
+ end
+ end
+end
+
+
+--[[
+TypedSection - A (set of) configuration section(s) defined by the type
+ addremove: Defines whether the user can add/remove sections of this type
+ anonymous: Allow creating anonymous sections
+ validate: a validation function returning nil if the section is invalid
+]]--
+TypedSection = class(AbstractSection)
+
+function TypedSection.__init__(self, map, type, ...)
+ AbstractSection.__init__(self, map, type, ...)
+
+ self.template = "cbi/tsection"
+ self.deps = {}
+ self.anonymous = false
+end
+
+-- Return all matching UCI sections for this TypedSection
+function TypedSection.cfgsections(self)
+ local sections = {}
+ self.map.uci:foreach(self.map.config, self.sectiontype,
+ function (section)
+ if self:checkscope(section[".name"]) then
+ table.insert(sections, section[".name"])
+ end
+ end)
+
+ return sections
+end
+
+-- Limits scope to sections that have certain option => value pairs
+function TypedSection.depends(self, option, value)
+ table.insert(self.deps, {option=option, value=value})
+end
+
+function TypedSection.parse(self, novld)
+ if self.addremove then
+ -- Remove
+ local crval = REMOVE_PREFIX .. self.config
+ local name = self.map:formvaluetable(crval)
+ for k,v in pairs(name) do
+ if k:sub(-2) == ".x" then
+ k = k:sub(1, #k - 2)
+ end
+ if self:cfgvalue(k) and self:checkscope(k) then
+ self:remove(k)
+ end
+ end
+ end
+
+ local co
+ for i, k in ipairs(self:cfgsections()) do
+ AbstractSection.parse_dynamic(self, k)
+ if self.map:submitstate() then
+ Node.parse(self, k, novld)
+ end
+ AbstractSection.parse_optionals(self, k)
+ end
+
+ if self.addremove then
+ -- Create
+ local created
+ local crval = CREATE_PREFIX .. self.config .. "." .. self.sectiontype
+ local origin, name = next(self.map:formvaluetable(crval))
+ if self.anonymous then
+ if name then
+ created = self:create(nil, origin)
+ end
+ else
+ if name then
+ -- Ignore if it already exists
+ if self:cfgvalue(name) then
+ name = nil;
+ end
+
+ name = self:checkscope(name)
+
+ if not name then
+ self.err_invalid = true
+ end
+
+ if name and #name > 0 then
+ created = self:create(name, origin) and name
+ if not created then
+ self.invalid_cts = true
+ end
+ end
+ end
+ end
+
+ if created then
+ AbstractSection.parse_optionals(self, created)
+ end
+ end
+
+ if self.sortable then
+ local stval = RESORT_PREFIX .. self.config .. "." .. self.sectiontype
+ local order = self.map:formvalue(stval)
+ if order and #order > 0 then
+ local sid
+ local num = 0
+ for sid in util.imatch(order) do
+ self.map.uci:reorder(self.config, sid, num)
+ num = num + 1
+ end
+ self.changed = (num > 0)
+ end
+ end
+
+ if created or self.changed then
+ self:push_events()
+ end
+end
+
+-- Verifies scope of sections
+function TypedSection.checkscope(self, section)
+ -- Check if we are not excluded
+ if self.filter and not self:filter(section) then
+ return nil
+ end
+
+ -- Check if at least one dependency is met
+ if #self.deps > 0 and self:cfgvalue(section) then
+ local stat = false
+
+ for k, v in ipairs(self.deps) do
+ if self:cfgvalue(section)[v.option] == v.value then
+ stat = true
+ end
+ end
+
+ if not stat then
+ return nil
+ end
+ end
+
+ return self:validate(section)
+end
+
+
+-- Dummy validate function
+function TypedSection.validate(self, section)
+ return section
+end
+
+
+--[[
+AbstractValue - An abstract Value Type
+ null: Value can be empty
+ valid: A function returning the value if it is valid otherwise nil
+ depends: A table of option => value pairs of which one must be true
+ default: The default value
+ size: The size of the input fields
+ rmempty: Unset value if empty
+ optional: This value is optional (see AbstractSection.optionals)
+]]--
+AbstractValue = class(Node)
+
+function AbstractValue.__init__(self, map, section, option, ...)
+ Node.__init__(self, ...)
+ self.section = section
+ self.option = option
+ self.map = map
+ self.config = map.config
+ self.tag_invalid = {}
+ self.tag_missing = {}
+ self.tag_reqerror = {}
+ self.tag_error = {}
+ self.deps = {}
+ self.subdeps = {}
+ --self.cast = "string"
+
+ self.track_missing = false
+ self.rmempty = true
+ self.default = nil
+ self.size = nil
+ self.optional = false
+end
+
+function AbstractValue.prepare(self)
+ self.cast = self.cast or "string"
+end
+
+-- Add a dependencie to another section field
+function AbstractValue.depends(self, field, value)
+ local deps
+ if type(field) == "string" then
+ deps = {}
+ deps[field] = value
+ else
+ deps = field
+ end
+
+ table.insert(self.deps, {deps=deps, add=""})
+end
+
+-- Generates the unique CBID
+function AbstractValue.cbid(self, section)
+ return "cbid."..self.map.config.."."..section.."."..self.option
+end
+
+-- Return whether this object should be created
+function AbstractValue.formcreated(self, section)
+ local key = "cbi.opt."..self.config.."."..section
+ return (self.map:formvalue(key) == self.option)
+end
+
+-- Returns the formvalue for this object
+function AbstractValue.formvalue(self, section)
+ return self.map:formvalue(self:cbid(section))
+end
+
+function AbstractValue.additional(self, value)
+ self.optional = value
+end
+
+function AbstractValue.mandatory(self, value)
+ self.rmempty = not value
+end
+
+function AbstractValue.add_error(self, section, type, msg)
+ self.error = self.error or { }
+ self.error[section] = msg or type
+
+ self.section.error = self.section.error or { }
+ self.section.error[section] = self.section.error[section] or { }
+ table.insert(self.section.error[section], msg or type)
+
+ if type == "invalid" then
+ self.tag_invalid[section] = true
+ elseif type == "missing" then
+ self.tag_missing[section] = true
+ end
+
+ self.tag_error[section] = true
+ self.map.save = false
+end
+
+function AbstractValue.parse(self, section, novld)
+ local fvalue = self:formvalue(section)
+ local cvalue = self:cfgvalue(section)
+
+ -- If favlue and cvalue are both tables and have the same content
+ -- make them identical
+ if type(fvalue) == "table" and type(cvalue) == "table" then
+ local equal = #fvalue == #cvalue
+ if equal then
+ for i=1, #fvalue do
+ if cvalue[i] ~= fvalue[i] then
+ equal = false
+ end
+ end
+ end
+ if equal then
+ fvalue = cvalue
+ end
+ end
+
+ if fvalue and #fvalue > 0 then -- If we have a form value, write it to UCI
+ local val_err
+ fvalue, val_err = self:validate(fvalue, section)
+ fvalue = self:transform(fvalue)
+
+ if not fvalue and not novld then
+ self:add_error(section, "invalid", val_err)
+ end
+
+ if fvalue and (self.forcewrite or not (fvalue == cvalue)) then
+ if self:write(section, fvalue) then
+ -- Push events
+ self.section.changed = true
+ --luci.util.append(self.map.events, self.events)
+ end
+ end
+ else -- Unset the UCI or error
+ if self.rmempty or self.optional then
+ if self:remove(section) then
+ -- Push events
+ self.section.changed = true
+ --luci.util.append(self.map.events, self.events)
+ end
+ elseif cvalue ~= fvalue and not novld then
+ -- trigger validator with nil value to get custom user error msg.
+ local _, val_err = self:validate(nil, section)
+ self:add_error(section, "missing", val_err)
+ end
+ end
+end
+
+-- Render if this value exists or if it is mandatory
+function AbstractValue.render(self, s, scope)
+ if not self.optional or self.section:has_tabs() or self:cfgvalue(s) or self:formcreated(s) then
+ scope = scope or {}
+ scope.section = s
+ scope.cbid = self:cbid(s)
+ Node.render(self, scope)
+ end
+end
+
+-- Return the UCI value of this object
+function AbstractValue.cfgvalue(self, section)
+ local value
+ if self.tag_error[section] then
+ value = self:formvalue(section)
+ else
+ value = self.map:get(section, self.option)
+ end
+
+ if not value then
+ return nil
+ elseif not self.cast or self.cast == type(value) then
+ return value
+ elseif self.cast == "string" then
+ if type(value) == "table" then
+ return value[1]
+ end
+ elseif self.cast == "table" then
+ return { value }
+ end
+end
+
+-- Validate the form value
+function AbstractValue.validate(self, value)
+ if self.datatype and value then
+ if type(value) == "table" then
+ local v
+ for _, v in ipairs(value) do
+ if v and #v > 0 and not verify_datatype(self.datatype, v) then
+ return nil
+ end
+ end
+ else
+ if not verify_datatype(self.datatype, value) then
+ return nil
+ end
+ end
+ end
+
+ return value
+end
+
+AbstractValue.transform = AbstractValue.validate
+
+
+-- Write to UCI
+function AbstractValue.write(self, section, value)
+ return self.map:set(section, self.option, value)
+end
+
+-- Remove from UCI
+function AbstractValue.remove(self, section)
+ return self.map:del(section, self.option)
+end
+
+
+
+
+--[[
+Value - A one-line value
+ maxlength: The maximum length
+]]--
+Value = class(AbstractValue)
+
+function Value.__init__(self, ...)
+ AbstractValue.__init__(self, ...)
+ self.template = "cbi/value"
+ self.keylist = {}
+ self.vallist = {}
+end
+
+function Value.reset_values(self)
+ self.keylist = {}
+ self.vallist = {}
+end
+
+function Value.value(self, key, val)
+ val = val or key
+ table.insert(self.keylist, tostring(key))
+ table.insert(self.vallist, tostring(val))
+end
+
+
+-- DummyValue - This does nothing except being there
+DummyValue = class(AbstractValue)
+
+function DummyValue.__init__(self, ...)
+ AbstractValue.__init__(self, ...)
+ self.template = "cbi/dvalue"
+ self.value = nil
+end
+
+function DummyValue.cfgvalue(self, section)
+ local value
+ if self.value then
+ if type(self.value) == "function" then
+ value = self:value(section)
+ else
+ value = self.value
+ end
+ else
+ value = AbstractValue.cfgvalue(self, section)
+ end
+ return value
+end
+
+function DummyValue.parse(self)
+
+end
+
+
+--[[
+Flag - A flag being enabled or disabled
+]]--
+Flag = class(AbstractValue)
+
+function Flag.__init__(self, ...)
+ AbstractValue.__init__(self, ...)
+ self.template = "cbi/fvalue"
+
+ self.enabled = "1"
+ self.disabled = "0"
+ self.default = self.disabled
+end
+
+-- A flag can only have two states: set or unset
+function Flag.parse(self, section)
+ local fexists = self.map:formvalue(
+ FEXIST_PREFIX .. self.config .. "." .. section .. "." .. self.option)
+
+ if fexists then
+ local fvalue = self:formvalue(section) and self.enabled or self.disabled
+ if fvalue ~= self.default or (not self.optional and not self.rmempty) then
+ self:write(section, fvalue)
+ else
+ self:remove(section)
+ end
+ else
+ self:remove(section)
+ end
+end
+
+function Flag.cfgvalue(self, section)
+ return AbstractValue.cfgvalue(self, section) or self.default
+end
+
+
+--[[
+ListValue - A one-line value predefined in a list
+ widget: The widget that will be used (select, radio)
+]]--
+ListValue = class(AbstractValue)
+
+function ListValue.__init__(self, ...)
+ AbstractValue.__init__(self, ...)
+ self.template = "cbi/lvalue"
+
+ self.keylist = {}
+ self.vallist = {}
+ self.size = 1
+ self.widget = "select"
+end
+
+function ListValue.reset_values(self)
+ self.keylist = {}
+ self.vallist = {}
+end
+
+function ListValue.value(self, key, val, ...)
+ if luci.util.contains(self.keylist, key) then
+ return
+ end
+
+ val = val or key
+ table.insert(self.keylist, tostring(key))
+ table.insert(self.vallist, tostring(val))
+
+ for i, deps in ipairs({...}) do
+ self.subdeps[#self.subdeps + 1] = {add = "-"..key, deps=deps}
+ end
+end
+
+function ListValue.validate(self, val)
+ if luci.util.contains(self.keylist, val) then
+ return val
+ else
+ return nil
+ end
+end
+
+
+
+--[[
+MultiValue - Multiple delimited values
+ widget: The widget that will be used (select, checkbox)
+ delimiter: The delimiter that will separate the values (default: " ")
+]]--
+MultiValue = class(AbstractValue)
+
+function MultiValue.__init__(self, ...)
+ AbstractValue.__init__(self, ...)
+ self.template = "cbi/mvalue"
+
+ self.keylist = {}
+ self.vallist = {}
+
+ self.widget = "checkbox"
+ self.delimiter = " "
+end
+
+function MultiValue.render(self, ...)
+ if self.widget == "select" and not self.size then
+ self.size = #self.vallist
+ end
+
+ AbstractValue.render(self, ...)
+end
+
+function MultiValue.reset_values(self)
+ self.keylist = {}
+ self.vallist = {}
+end
+
+function MultiValue.value(self, key, val)
+ if luci.util.contains(self.keylist, key) then
+ return
+ end
+
+ val = val or key
+ table.insert(self.keylist, tostring(key))
+ table.insert(self.vallist, tostring(val))
+end
+
+function MultiValue.valuelist(self, section)
+ local val = self:cfgvalue(section)
+
+ if not(type(val) == "string") then
+ return {}
+ end
+
+ return luci.util.split(val, self.delimiter)
+end
+
+function MultiValue.validate(self, val)
+ val = (type(val) == "table") and val or {val}
+
+ local result
+
+ for i, value in ipairs(val) do
+ if luci.util.contains(self.keylist, value) then
+ result = result and (result .. self.delimiter .. value) or value
+ end
+ end
+
+ return result
+end
+
+
+StaticList = class(MultiValue)
+
+function StaticList.__init__(self, ...)
+ MultiValue.__init__(self, ...)
+ self.cast = "table"
+ self.valuelist = self.cfgvalue
+
+ if not self.override_scheme
+ and self.map:get_scheme(self.section.sectiontype, self.option) then
+ local vs = self.map:get_scheme(self.section.sectiontype, self.option)
+ if self.value and vs.values and not self.override_values then
+ for k, v in pairs(vs.values) do
+ self:value(k, v)
+ end
+ end
+ end
+end
+
+function StaticList.validate(self, value)
+ value = (type(value) == "table") and value or {value}
+
+ local valid = {}
+ for i, v in ipairs(value) do
+ if luci.util.contains(self.keylist, v) then
+ table.insert(valid, v)
+ end
+ end
+ return valid
+end
+
+
+DynamicList = class(AbstractValue)
+
+function DynamicList.__init__(self, ...)
+ AbstractValue.__init__(self, ...)
+ self.template = "cbi/dynlist"
+ self.cast = "table"
+ self.keylist = {}
+ self.vallist = {}
+end
+
+function DynamicList.reset_values(self)
+ self.keylist = {}
+ self.vallist = {}
+end
+
+function DynamicList.value(self, key, val)
+ val = val or key
+ table.insert(self.keylist, tostring(key))
+ table.insert(self.vallist, tostring(val))
+end
+
+function DynamicList.write(self, section, value)
+ local t = { }
+
+ if type(value) == "table" then
+ local x
+ for _, x in ipairs(value) do
+ if x and #x > 0 then
+ t[#t+1] = x
+ end
+ end
+ else
+ t = { value }
+ end
+
+ if self.cast == "string" then
+ value = table.concat(t, " ")
+ else
+ value = t
+ end
+
+ return AbstractValue.write(self, section, value)
+end
+
+function DynamicList.cfgvalue(self, section)
+ local value = AbstractValue.cfgvalue(self, section)
+
+ if type(value) == "string" then
+ local x
+ local t = { }
+ for x in value:gmatch("%S+") do
+ if #x > 0 then
+ t[#t+1] = x
+ end
+ end
+ value = t
+ end
+
+ return value
+end
+
+function DynamicList.formvalue(self, section)
+ local value = AbstractValue.formvalue(self, section)
+
+ if type(value) == "string" then
+ if self.cast == "string" then
+ local x
+ local t = { }
+ for x in value:gmatch("%S+") do
+ t[#t+1] = x
+ end
+ value = t
+ else
+ value = { value }
+ end
+ end
+
+ return value
+end
+
+
+--[[
+TextValue - A multi-line value
+ rows: Rows
+]]--
+TextValue = class(AbstractValue)
+
+function TextValue.__init__(self, ...)
+ AbstractValue.__init__(self, ...)
+ self.template = "cbi/tvalue"
+end
+
+--[[
+Button
+]]--
+Button = class(AbstractValue)
+
+function Button.__init__(self, ...)
+ AbstractValue.__init__(self, ...)
+ self.template = "cbi/button"
+ self.inputstyle = nil
+ self.rmempty = true
+end
+
+
+FileUpload = class(AbstractValue)
+
+function FileUpload.__init__(self, ...)
+ AbstractValue.__init__(self, ...)
+ self.template = "cbi/upload"
+ if not self.map.upload_fields then
+ self.map.upload_fields = { self }
+ else
+ self.map.upload_fields[#self.map.upload_fields+1] = self
+ end
+end
+
+function FileUpload.formcreated(self, section)
+ return AbstractValue.formcreated(self, section) or
+ self.map:formvalue("cbi.rlf."..section.."."..self.option) or
+ self.map:formvalue("cbi.rlf."..section.."."..self.option..".x")
+end
+
+function FileUpload.cfgvalue(self, section)
+ local val = AbstractValue.cfgvalue(self, section)
+ if val and fs.access(val) then
+ return val
+ end
+ return nil
+end
+
+function FileUpload.formvalue(self, section)
+ local val = AbstractValue.formvalue(self, section)
+ if val then
+ if not self.map:formvalue("cbi.rlf."..section.."."..self.option) and
+ not self.map:formvalue("cbi.rlf."..section.."."..self.option..".x")
+ then
+ return val
+ end
+ fs.unlink(val)
+ self.value = nil
+ end
+ return nil
+end
+
+function FileUpload.remove(self, section)
+ local val = AbstractValue.formvalue(self, section)
+ if val and fs.access(val) then fs.unlink(val) end
+ return AbstractValue.remove(self, section)
+end
+
+
+FileBrowser = class(AbstractValue)
+
+function FileBrowser.__init__(self, ...)
+ AbstractValue.__init__(self, ...)
+ self.template = "cbi/browser"
+end
--- /dev/null
+--[[
+
+LuCI - Configuration Bind Interface - Datatype Tests
+(c) 2010 Jo-Philipp Wich <xm@subsignal.org>
+
+Licensed under the Apache License, Version 2.0 (the "License");
+you may not use this file except in compliance with the License.
+You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+$Id$
+
+]]--
+
+local fs = require "nixio.fs"
+local ip = require "luci.ip"
+local math = require "math"
+local util = require "luci.util"
+local tonumber, tostring, type, unpack, select = tonumber, tostring, type, unpack, select
+
+
+module "luci.cbi.datatypes"
+
+
+_M['or'] = function(v, ...)
+ local i
+ for i = 1, select('#', ...), 2 do
+ local f = select(i, ...)
+ local a = select(i+1, ...)
+ if type(f) ~= "function" then
+ if f == v then
+ return true
+ end
+ i = i - 1
+ elseif f(v, unpack(a)) then
+ return true
+ end
+ end
+ return false
+end
+
+_M['and'] = function(v, ...)
+ local i
+ for i = 1, select('#', ...), 2 do
+ local f = select(i, ...)
+ local a = select(i+1, ...)
+ if type(f) ~= "function" then
+ if f ~= v then
+ return false
+ end
+ i = i - 1
+ elseif not f(v, unpack(a)) then
+ return false
+ end
+ end
+ return true
+end
+
+function neg(v, ...)
+ return _M['or'](v:gsub("^%s*!%s*", ""), ...)
+end
+
+function list(v, subvalidator, subargs)
+ if type(subvalidator) ~= "function" then
+ return false
+ end
+ local token
+ for token in v:gmatch("%S+") do
+ if not subvalidator(token, unpack(subargs)) then
+ return false
+ end
+ end
+ return true
+end
+
+function bool(val)
+ if val == "1" or val == "yes" or val == "on" or val == "true" then
+ return true
+ elseif val == "0" or val == "no" or val == "off" or val == "false" then
+ return true
+ elseif val == "" or val == nil then
+ return true
+ end
+
+ return false
+end
+
+function uinteger(val)
+ local n = tonumber(val)
+ if n ~= nil and math.floor(n) == n and n >= 0 then
+ return true
+ end
+
+ return false
+end
+
+function integer(val)
+ local n = tonumber(val)
+ if n ~= nil and math.floor(n) == n then
+ return true
+ end
+
+ return false
+end
+
+function ufloat(val)
+ local n = tonumber(val)
+ return ( n ~= nil and n >= 0 )
+end
+
+function float(val)
+ return ( tonumber(val) ~= nil )
+end
+
+function ipaddr(val)
+ return ip4addr(val) or ip6addr(val)
+end
+
+function ip4addr(val)
+ if val then
+ return ip.IPv4(val) and true or false
+ end
+
+ return false
+end
+
+function ip4prefix(val)
+ val = tonumber(val)
+ return ( val and val >= 0 and val <= 32 )
+end
+
+function ip6addr(val)
+ if val then
+ return ip.IPv6(val) and true or false
+ end
+
+ return false
+end
+
+function ip6prefix(val)
+ val = tonumber(val)
+ return ( val and val >= 0 and val <= 128 )
+end
+
+function port(val)
+ val = tonumber(val)
+ return ( val and val >= 0 and val <= 65535 )
+end
+
+function portrange(val)
+ local p1, p2 = val:match("^(%d+)%-(%d+)$")
+ if p1 and p2 and port(p1) and port(p2) then
+ return true
+ else
+ return port(val)
+ end
+end
+
+function macaddr(val)
+ if val and val:match(
+ "^[a-fA-F0-9]+:[a-fA-F0-9]+:[a-fA-F0-9]+:" ..
+ "[a-fA-F0-9]+:[a-fA-F0-9]+:[a-fA-F0-9]+$"
+ ) then
+ local parts = util.split( val, ":" )
+
+ for i = 1,6 do
+ parts[i] = tonumber( parts[i], 16 )
+ if parts[i] < 0 or parts[i] > 255 then
+ return false
+ end
+ end
+
+ return true
+ end
+
+ return false
+end
+
+function hostname(val)
+ if val and (#val < 254) and (
+ val:match("^[a-zA-Z_]+$") or
+ (val:match("^[a-zA-Z0-9_][a-zA-Z0-9_%-%.]*[a-zA-Z0-9]$") and
+ val:match("[^0-9%.]"))
+ ) then
+ return true
+ end
+ return false
+end
+
+function host(val)
+ return hostname(val) or ipaddr(val)
+end
+
+function network(val)
+ return uciname(val) or host(val)
+end
+
+function wpakey(val)
+ if #val == 64 then
+ return (val:match("^[a-fA-F0-9]+$") ~= nil)
+ else
+ return (#val >= 8) and (#val <= 63)
+ end
+end
+
+function wepkey(val)
+ if val:sub(1, 2) == "s:" then
+ val = val:sub(3)
+ end
+
+ if (#val == 10) or (#val == 26) then
+ return (val:match("^[a-fA-F0-9]+$") ~= nil)
+ else
+ return (#val == 5) or (#val == 13)
+ end
+end
+
+function string(val)
+ return true -- Everything qualifies as valid string
+end
+
+function directory( val, seen )
+ local s = fs.stat(val)
+ seen = seen or { }
+
+ if s and not seen[s.ino] then
+ seen[s.ino] = true
+ if s.type == "dir" then
+ return true
+ elseif s.type == "lnk" then
+ return directory( fs.readlink(val), seen )
+ end
+ end
+
+ return false
+end
+
+function file( val, seen )
+ local s = fs.stat(val)
+ seen = seen or { }
+
+ if s and not seen[s.ino] then
+ seen[s.ino] = true
+ if s.type == "reg" then
+ return true
+ elseif s.type == "lnk" then
+ return file( fs.readlink(val), seen )
+ end
+ end
+
+ return false
+end
+
+function device( val, seen )
+ local s = fs.stat(val)
+ seen = seen or { }
+
+ if s and not seen[s.ino] then
+ seen[s.ino] = true
+ if s.type == "chr" or s.type == "blk" then
+ return true
+ elseif s.type == "lnk" then
+ return device( fs.readlink(val), seen )
+ end
+ end
+
+ return false
+end
+
+function uciname(val)
+ return (val:match("^[a-zA-Z0-9_]+$") ~= nil)
+end
+
+function range(val, min, max)
+ val = tonumber(val)
+ min = tonumber(min)
+ max = tonumber(max)
+
+ if val ~= nil and min ~= nil and max ~= nil then
+ return ((val >= min) and (val <= max))
+ end
+
+ return false
+end
+
+function min(val, min)
+ val = tonumber(val)
+ min = tonumber(min)
+
+ if val ~= nil and min ~= nil then
+ return (val >= min)
+ end
+
+ return false
+end
+
+function max(val, max)
+ val = tonumber(val)
+ max = tonumber(max)
+
+ if val ~= nil and max ~= nil then
+ return (val <= max)
+ end
+
+ return false
+end
+
+function rangelength(val, min, max)
+ val = tostring(val)
+ min = tonumber(min)
+ max = tonumber(max)
+
+ if val ~= nil and min ~= nil and max ~= nil then
+ return ((#val >= min) and (#val <= max))
+ end
+
+ return false
+end
+
+function minlength(val, min)
+ val = tostring(val)
+ min = tonumber(min)
+
+ if val ~= nil and min ~= nil then
+ return (#val >= min)
+ end
+
+ return false
+end
+
+function maxlength(val, max)
+ val = tostring(val)
+ max = tonumber(max)
+
+ if val ~= nil and max ~= nil then
+ return (#val <= max)
+ end
+
+ return false
+end
+
+function phonedigit(val)
+ return (val:match("^[0-9\*#!%.]+$") ~= nil)
+end
--- /dev/null
+--[[
+LuCI - Configuration
+
+Description:
+Some LuCI configuration values read from uci file "luci"
+
+
+FileId:
+$Id$
+
+License:
+Copyright 2008 Steven Barth <steven@midlink.org>
+
+Licensed under the Apache License, Version 2.0 (the "License");
+you may not use this file except in compliance with the License.
+You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+Unless required by applicable law or agreed to in writing, software
+distributed under the License is distributed on an "AS IS" BASIS,
+WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+See the License for the specific language governing permissions and
+limitations under the License.
+
+]]--
+
+local util = require "luci.util"
+module("luci.config",
+ function(m)
+ if pcall(require, "luci.model.uci") then
+ local config = util.threadlocal()
+ setmetatable(m, {
+ __index = function(tbl, key)
+ if not config[key] then
+ config[key] = luci.model.uci.cursor():get_all("luci", key)
+ end
+ return config[key]
+ end
+ })
+ end
+ end)
--- /dev/null
+--[[
+LuCI - Dispatcher
+
+Description:
+The request dispatcher and module dispatcher generators
+
+FileId:
+$Id$
+
+License:
+Copyright 2008 Steven Barth <steven@midlink.org>
+
+Licensed under the Apache License, Version 2.0 (the "License");
+you may not use this file except in compliance with the License.
+You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+Unless required by applicable law or agreed to in writing, software
+distributed under the License is distributed on an "AS IS" BASIS,
+WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+See the License for the specific language governing permissions and
+limitations under the License.
+
+]]--
+
+--- LuCI web dispatcher.
+local fs = require "nixio.fs"
+local sys = require "luci.sys"
+local init = require "luci.init"
+local util = require "luci.util"
+local http = require "luci.http"
+local nixio = require "nixio", require "nixio.util"
+
+module("luci.dispatcher", package.seeall)
+context = util.threadlocal()
+uci = require "luci.model.uci"
+i18n = require "luci.i18n"
+_M.fs = fs
+
+authenticator = {}
+
+-- Index table
+local index = nil
+
+-- Fastindex
+local fi
+
+
+--- Build the URL relative to the server webroot from given virtual path.
+-- @param ... Virtual path
+-- @return Relative URL
+function build_url(...)
+ local path = {...}
+ local url = { http.getenv("SCRIPT_NAME") or "" }
+
+ local k, v
+ for k, v in pairs(context.urltoken) do
+ url[#url+1] = "/;"
+ url[#url+1] = http.urlencode(k)
+ url[#url+1] = "="
+ url[#url+1] = http.urlencode(v)
+ end
+
+ local p
+ for _, p in ipairs(path) do
+ if p:match("^[a-zA-Z0-9_%-%.%%/,;]+$") then
+ url[#url+1] = "/"
+ url[#url+1] = p
+ end
+ end
+
+ return table.concat(url, "")
+end
+
+--- Check whether a dispatch node shall be visible
+-- @param node Dispatch node
+-- @return Boolean indicating whether the node should be visible
+function node_visible(node)
+ if node then
+ return not (
+ (not node.title or #node.title == 0) or
+ (not node.target or node.hidden == true) or
+ (type(node.target) == "table" and node.target.type == "firstchild" and
+ (type(node.nodes) ~= "table" or not next(node.nodes)))
+ )
+ end
+ return false
+end
+
+--- Return a sorted table of visible childs within a given node
+-- @param node Dispatch node
+-- @return Ordered table of child node names
+function node_childs(node)
+ local rv = { }
+ if node then
+ local k, v
+ for k, v in util.spairs(node.nodes,
+ function(a, b)
+ return (node.nodes[a].order or 100)
+ < (node.nodes[b].order or 100)
+ end)
+ do
+ if node_visible(v) then
+ rv[#rv+1] = k
+ end
+ end
+ end
+ return rv
+end
+
+
+--- Send a 404 error code and render the "error404" template if available.
+-- @param message Custom error message (optional)
+-- @return false
+function error404(message)
+ luci.http.status(404, "Not Found")
+ message = message or "Not Found"
+
+ require("luci.template")
+ if not luci.util.copcall(luci.template.render, "error404") then
+ luci.http.prepare_content("text/plain")
+ luci.http.write(message)
+ end
+ return false
+end
+
+--- Send a 500 error code and render the "error500" template if available.
+-- @param message Custom error message (optional)#
+-- @return false
+function error500(message)
+ luci.util.perror(message)
+ if not context.template_header_sent then
+ luci.http.status(500, "Internal Server Error")
+ luci.http.prepare_content("text/plain")
+ luci.http.write(message)
+ else
+ require("luci.template")
+ if not luci.util.copcall(luci.template.render, "error500", {message=message}) then
+ luci.http.prepare_content("text/plain")
+ luci.http.write(message)
+ end
+ end
+ return false
+end
+
+function authenticator.htmlauth(validator, accs, default)
+ local user = luci.http.formvalue("username")
+ local pass = luci.http.formvalue("password")
+
+ if user and validator(user, pass) then
+ return user
+ end
+
+ require("luci.i18n")
+ require("luci.template")
+ context.path = {}
+ luci.template.render("sysauth", {duser=default, fuser=user})
+ return false
+
+end
+
+--- Dispatch an HTTP request.
+-- @param request LuCI HTTP Request object
+function httpdispatch(request, prefix)
+ luci.http.context.request = request
+
+ local r = {}
+ context.request = r
+ context.urltoken = {}
+
+ local pathinfo = http.urldecode(request:getenv("PATH_INFO") or "", true)
+
+ if prefix then
+ for _, node in ipairs(prefix) do
+ r[#r+1] = node
+ end
+ end
+
+ local tokensok = true
+ for node in pathinfo:gmatch("[^/]+") do
+ local tkey, tval
+ if tokensok then
+ tkey, tval = node:match(";(%w+)=([a-fA-F0-9]*)")
+ end
+ if tkey then
+ context.urltoken[tkey] = tval
+ else
+ tokensok = false
+ r[#r+1] = node
+ end
+ end
+
+ local stat, err = util.coxpcall(function()
+ dispatch(context.request)
+ end, error500)
+
+ luci.http.close()
+
+ --context._disable_memtrace()
+end
+
+--- Dispatches a LuCI virtual path.
+-- @param request Virtual path
+function dispatch(request)
+ --context._disable_memtrace = require "luci.debug".trap_memtrace("l")
+ local ctx = context
+ ctx.path = request
+
+ local conf = require "luci.config"
+ assert(conf.main,
+ "/etc/config/luci seems to be corrupt, unable to find section 'main'")
+
+ local lang = conf.main.lang or "auto"
+ if lang == "auto" then
+ local aclang = http.getenv("HTTP_ACCEPT_LANGUAGE") or ""
+ for lpat in aclang:gmatch("[%w-]+") do
+ lpat = lpat and lpat:gsub("-", "_")
+ if conf.languages[lpat] then
+ lang = lpat
+ break
+ end
+ end
+ end
+ require "luci.i18n".setlanguage(lang)
+
+ local c = ctx.tree
+ local stat
+ if not c then
+ c = createtree()
+ end
+
+ local track = {}
+ local args = {}
+ ctx.args = args
+ ctx.requestargs = ctx.requestargs or args
+ local n
+ local token = ctx.urltoken
+ local preq = {}
+ local freq = {}
+
+ for i, s in ipairs(request) do
+ preq[#preq+1] = s
+ freq[#freq+1] = s
+ c = c.nodes[s]
+ n = i
+ if not c then
+ break
+ end
+
+ util.update(track, c)
+
+ if c.leaf then
+ break
+ end
+ end
+
+ if c and c.leaf then
+ for j=n+1, #request do
+ args[#args+1] = request[j]
+ freq[#freq+1] = request[j]
+ end
+ end
+
+ ctx.requestpath = ctx.requestpath or freq
+ ctx.path = preq
+
+ if track.i18n then
+ i18n.loadc(track.i18n)
+ end
+
+ -- Init template engine
+ if (c and c.index) or not track.notemplate then
+ local tpl = require("luci.template")
+ local media = track.mediaurlbase or luci.config.main.mediaurlbase
+ if not pcall(tpl.Template, "themes/%s/header" % fs.basename(media)) then
+ media = nil
+ for name, theme in pairs(luci.config.themes) do
+ if name:sub(1,1) ~= "." and pcall(tpl.Template,
+ "themes/%s/header" % fs.basename(theme)) then
+ media = theme
+ end
+ end
+ assert(media, "No valid theme found")
+ end
+
+ local function _ifattr(cond, key, val)
+ if cond then
+ local env = getfenv(3)
+ local scope = (type(env.self) == "table") and env.self
+ return string.format(
+ ' %s="%s"', tostring(key),
+ luci.util.pcdata(tostring( val
+ or (type(env[key]) ~= "function" and env[key])
+ or (scope and type(scope[key]) ~= "function" and scope[key])
+ or "" ))
+ )
+ else
+ return ''
+ end
+ end
+
+ tpl.context.viewns = setmetatable({
+ write = luci.http.write;
+ include = function(name) tpl.Template(name):render(getfenv(2)) end;
+ translate = i18n.translate;
+ translatef = i18n.translatef;
+ export = function(k, v) if tpl.context.viewns[k] == nil then tpl.context.viewns[k] = v end end;
+ striptags = util.striptags;
+ pcdata = util.pcdata;
+ media = media;
+ theme = fs.basename(media);
+ resource = luci.config.main.resourcebase;
+ ifattr = function(...) return _ifattr(...) end;
+ attr = function(...) return _ifattr(true, ...) end;
+ }, {__index=function(table, key)
+ if key == "controller" then
+ return build_url()
+ elseif key == "REQUEST_URI" then
+ return build_url(unpack(ctx.requestpath))
+ else
+ return rawget(table, key) or _G[key]
+ end
+ end})
+ end
+
+ track.dependent = (track.dependent ~= false)
+ assert(not track.dependent or not track.auto,
+ "Access Violation\nThe page at '" .. table.concat(request, "/") .. "/' " ..
+ "has no parent node so the access to this location has been denied.\n" ..
+ "This is a software bug, please report this message at " ..
+ "http://luci.subsignal.org/trac/newticket"
+ )
+
+ if track.sysauth then
+ local sauth = require "luci.sauth"
+
+ local authen = type(track.sysauth_authenticator) == "function"
+ and track.sysauth_authenticator
+ or authenticator[track.sysauth_authenticator]
+
+ local def = (type(track.sysauth) == "string") and track.sysauth
+ local accs = def and {track.sysauth} or track.sysauth
+ local sess = ctx.authsession
+ local verifytoken = false
+ if not sess then
+ sess = luci.http.getcookie("sysauth")
+ sess = sess and sess:match("^[a-f0-9]*$")
+ verifytoken = true
+ end
+
+ local sdat = sauth.read(sess)
+ local user
+
+ if sdat then
+ if not verifytoken or ctx.urltoken.stok == sdat.token then
+ user = sdat.user
+ end
+ else
+ local eu = http.getenv("HTTP_AUTH_USER")
+ local ep = http.getenv("HTTP_AUTH_PASS")
+ if eu and ep and luci.sys.user.checkpasswd(eu, ep) then
+ authen = function() return eu end
+ end
+ end
+
+ if not util.contains(accs, user) then
+ if authen then
+ ctx.urltoken.stok = nil
+ local user, sess = authen(luci.sys.user.checkpasswd, accs, def)
+ if not user or not util.contains(accs, user) then
+ return
+ else
+ local sid = sess or luci.sys.uniqueid(16)
+ if not sess then
+ local token = luci.sys.uniqueid(16)
+ sauth.reap()
+ sauth.write(sid, {
+ user=user,
+ token=token,
+ secret=luci.sys.uniqueid(16)
+ })
+ ctx.urltoken.stok = token
+ end
+ luci.http.header("Set-Cookie", "sysauth=" .. sid.."; path="..build_url())
+ ctx.authsession = sid
+ ctx.authuser = user
+ end
+ else
+ luci.http.status(403, "Forbidden")
+ return
+ end
+ else
+ ctx.authsession = sess
+ ctx.authuser = user
+ end
+ end
+
+ if track.setgroup then
+ luci.sys.process.setgroup(track.setgroup)
+ end
+
+ if track.setuser then
+ luci.sys.process.setuser(track.setuser)
+ end
+
+ local target = nil
+ if c then
+ if type(c.target) == "function" then
+ target = c.target
+ elseif type(c.target) == "table" then
+ target = c.target.target
+ end
+ end
+
+ if c and (c.index or type(target) == "function") then
+ ctx.dispatched = c
+ ctx.requested = ctx.requested or ctx.dispatched
+ end
+
+ if c and c.index then
+ local tpl = require "luci.template"
+
+ if util.copcall(tpl.render, "indexer", {}) then
+ return true
+ end
+ end
+
+ if type(target) == "function" then
+ util.copcall(function()
+ local oldenv = getfenv(target)
+ local module = require(c.module)
+ local env = setmetatable({}, {__index=
+
+ function(tbl, key)
+ return rawget(tbl, key) or module[key] or oldenv[key]
+ end})
+
+ setfenv(target, env)
+ end)
+
+ local ok, err
+ if type(c.target) == "table" then
+ ok, err = util.copcall(target, c.target, unpack(args))
+ else
+ ok, err = util.copcall(target, unpack(args))
+ end
+ assert(ok,
+ "Failed to execute " .. (type(c.target) == "function" and "function" or c.target.type or "unknown") ..
+ " dispatcher target for entry '/" .. table.concat(request, "/") .. "'.\n" ..
+ "The called action terminated with an exception:\n" .. tostring(err or "(unknown)"))
+ else
+ local root = node()
+ if not root or not root.target then
+ error404("No root node was registered, this usually happens if no module was installed.\n" ..
+ "Install luci-mod-admin-full and retry. " ..
+ "If the module is already installed, try removing the /tmp/luci-indexcache file.")
+ else
+ error404("No page is registered at '/" .. table.concat(request, "/") .. "'.\n" ..
+ "If this url belongs to an extension, make sure it is properly installed.\n" ..
+ "If the extension was recently installed, try removing the /tmp/luci-indexcache file.")
+ end
+ end
+end
+
+--- Generate the dispatching index using the best possible strategy.
+function createindex()
+ local path = luci.util.libpath() .. "/controller/"
+ local suff = { ".lua", ".lua.gz" }
+
+ if luci.util.copcall(require, "luci.fastindex") then
+ createindex_fastindex(path, suff)
+ else
+ createindex_plain(path, suff)
+ end
+end
+
+--- Generate the dispatching index using the fastindex C-indexer.
+-- @param path Controller base directory
+-- @param suffixes Controller file suffixes
+function createindex_fastindex(path, suffixes)
+ index = {}
+
+ if not fi then
+ fi = luci.fastindex.new("index")
+ for _, suffix in ipairs(suffixes) do
+ fi.add(path .. "*" .. suffix)
+ fi.add(path .. "*/*" .. suffix)
+ end
+ end
+ fi.scan()
+
+ for k, v in pairs(fi.indexes) do
+ index[v[2]] = v[1]
+ end
+end
+
+--- Generate the dispatching index using the native file-cache based strategy.
+-- @param path Controller base directory
+-- @param suffixes Controller file suffixes
+function createindex_plain(path, suffixes)
+ local controllers = { }
+ for _, suffix in ipairs(suffixes) do
+ nixio.util.consume((fs.glob(path .. "*" .. suffix)), controllers)
+ nixio.util.consume((fs.glob(path .. "*/*" .. suffix)), controllers)
+ end
+
+ if indexcache then
+ local cachedate = fs.stat(indexcache, "mtime")
+ if cachedate then
+ local realdate = 0
+ for _, obj in ipairs(controllers) do
+ local omtime = fs.stat(obj, "mtime")
+ realdate = (omtime and omtime > realdate) and omtime or realdate
+ end
+
+ if cachedate > realdate then
+ assert(
+ sys.process.info("uid") == fs.stat(indexcache, "uid")
+ and fs.stat(indexcache, "modestr") == "rw-------",
+ "Fatal: Indexcache is not sane!"
+ )
+
+ index = loadfile(indexcache)()
+ return index
+ end
+ end
+ end
+
+ index = {}
+
+ for i,c in ipairs(controllers) do
+ local modname = "luci.controller." .. c:sub(#path+1, #c):gsub("/", ".")
+ for _, suffix in ipairs(suffixes) do
+ modname = modname:gsub(suffix.."$", "")
+ end
+
+ local mod = require(modname)
+ assert(mod ~= true,
+ "Invalid controller file found\n" ..
+ "The file '" .. c .. "' contains an invalid module line.\n" ..
+ "Please verify whether the module name is set to '" .. modname ..
+ "' - It must correspond to the file path!")
+
+ local idx = mod.index
+ assert(type(idx) == "function",
+ "Invalid controller file found\n" ..
+ "The file '" .. c .. "' contains no index() function.\n" ..
+ "Please make sure that the controller contains a valid " ..
+ "index function and verify the spelling!")
+
+ index[modname] = idx
+ end
+
+ if indexcache then
+ local f = nixio.open(indexcache, "w", 600)
+ f:writeall(util.get_bytecode(index))
+ f:close()
+ end
+end
+
+--- Create the dispatching tree from the index.
+-- Build the index before if it does not exist yet.
+function createtree()
+ if not index then
+ createindex()
+ end
+
+ local ctx = context
+ local tree = {nodes={}, inreq=true}
+ local modi = {}
+
+ ctx.treecache = setmetatable({}, {__mode="v"})
+ ctx.tree = tree
+ ctx.modifiers = modi
+
+ -- Load default translation
+ require "luci.i18n".loadc("base")
+
+ local scope = setmetatable({}, {__index = luci.dispatcher})
+
+ for k, v in pairs(index) do
+ scope._NAME = k
+ setfenv(v, scope)
+ v()
+ end
+
+ local function modisort(a,b)
+ return modi[a].order < modi[b].order
+ end
+
+ for _, v in util.spairs(modi, modisort) do
+ scope._NAME = v.module
+ setfenv(v.func, scope)
+ v.func()
+ end
+
+ return tree
+end
+
+--- Register a tree modifier.
+-- @param func Modifier function
+-- @param order Modifier order value (optional)
+function modifier(func, order)
+ context.modifiers[#context.modifiers+1] = {
+ func = func,
+ order = order or 0,
+ module
+ = getfenv(2)._NAME
+ }
+end
+
+--- Clone a node of the dispatching tree to another position.
+-- @param path Virtual path destination
+-- @param clone Virtual path source
+-- @param title Destination node title (optional)
+-- @param order Destination node order value (optional)
+-- @return Dispatching tree node
+function assign(path, clone, title, order)
+ local obj = node(unpack(path))
+ obj.nodes = nil
+ obj.module = nil
+
+ obj.title = title
+ obj.order = order
+
+ setmetatable(obj, {__index = _create_node(clone)})
+
+ return obj
+end
+
+--- Create a new dispatching node and define common parameters.
+-- @param path Virtual path
+-- @param target Target function to call when dispatched.
+-- @param title Destination node title
+-- @param order Destination node order value (optional)
+-- @return Dispatching tree node
+function entry(path, target, title, order)
+ local c = node(unpack(path))
+
+ c.target = target
+ c.title = title
+ c.order = order
+ c.module = getfenv(2)._NAME
+
+ return c
+end
+
+--- Fetch or create a dispatching node without setting the target module or
+-- enabling the node.
+-- @param ... Virtual path
+-- @return Dispatching tree node
+function get(...)
+ return _create_node({...})
+end
+
+--- Fetch or create a new dispatching node.
+-- @param ... Virtual path
+-- @return Dispatching tree node
+function node(...)
+ local c = _create_node({...})
+
+ c.module = getfenv(2)._NAME
+ c.auto = nil
+
+ return c
+end
+
+function _create_node(path)
+ if #path == 0 then
+ return context.tree
+ end
+
+ local name = table.concat(path, ".")
+ local c = context.treecache[name]
+
+ if not c then
+ local last = table.remove(path)
+ local parent = _create_node(path)
+
+ c = {nodes={}, auto=true}
+ -- the node is "in request" if the request path matches
+ -- at least up to the length of the node path
+ if parent.inreq and context.path[#path+1] == last then
+ c.inreq = true
+ end
+ parent.nodes[last] = c
+ context.treecache[name] = c
+ end
+ return c
+end
+
+-- Subdispatchers --
+
+function _firstchild()
+ local path = { unpack(context.path) }
+ local name = table.concat(path, ".")
+ local node = context.treecache[name]
+
+ local lowest
+ if node and node.nodes and next(node.nodes) then
+ local k, v
+ for k, v in pairs(node.nodes) do
+ if not lowest or
+ (v.order or 100) < (node.nodes[lowest].order or 100)
+ then
+ lowest = k
+ end
+ end
+ end
+
+ assert(lowest ~= nil,
+ "The requested node contains no childs, unable to redispatch")
+
+ path[#path+1] = lowest
+ dispatch(path)
+end
+
+--- Alias the first (lowest order) page automatically
+function firstchild()
+ return { type = "firstchild", target = _firstchild }
+end
+
+--- Create a redirect to another dispatching node.
+-- @param ... Virtual path destination
+function alias(...)
+ local req = {...}
+ return function(...)
+ for _, r in ipairs({...}) do
+ req[#req+1] = r
+ end
+
+ dispatch(req)
+ end
+end
+
+--- Rewrite the first x path values of the request.
+-- @param n Number of path values to replace
+-- @param ... Virtual path to replace removed path values with
+function rewrite(n, ...)
+ local req = {...}
+ return function(...)
+ local dispatched = util.clone(context.dispatched)
+
+ for i=1,n do
+ table.remove(dispatched, 1)
+ end
+
+ for i, r in ipairs(req) do
+ table.insert(dispatched, i, r)
+ end
+
+ for _, r in ipairs({...}) do
+ dispatched[#dispatched+1] = r
+ end
+
+ dispatch(dispatched)
+ end
+end
+
+
+local function _call(self, ...)
+ local func = getfenv()[self.name]
+ assert(func ~= nil,
+ 'Cannot resolve function "' .. self.name .. '". Is it misspelled or local?')
+
+ assert(type(func) == "function",
+ 'The symbol "' .. self.name .. '" does not refer to a function but data ' ..
+ 'of type "' .. type(func) .. '".')
+
+ if #self.argv > 0 then
+ return func(unpack(self.argv), ...)
+ else
+ return func(...)
+ end
+end
+
+--- Create a function-call dispatching target.
+-- @param name Target function of local controller
+-- @param ... Additional parameters passed to the function
+function call(name, ...)
+ return {type = "call", argv = {...}, name = name, target = _call}
+end
+
+
+local _template = function(self, ...)
+ require "luci.template".render(self.view)
+end
+
+--- Create a template render dispatching target.
+-- @param name Template to be rendered
+function template(name)
+ return {type = "template", view = name, target = _template}
+end
+
+
+local function _cbi(self, ...)
+ local cbi = require "luci.cbi"
+ local tpl = require "luci.template"
+ local http = require "luci.http"
+
+ local config = self.config or {}
+ local maps = cbi.load(self.model, ...)
+
+ local state = nil
+
+ for i, res in ipairs(maps) do
+ res.flow = config
+ local cstate = res:parse()
+ if cstate and (not state or cstate < state) then
+ state = cstate
+ end
+ end
+
+ local function _resolve_path(path)
+ return type(path) == "table" and build_url(unpack(path)) or path
+ end
+
+ if config.on_valid_to and state and state > 0 and state < 2 then
+ http.redirect(_resolve_path(config.on_valid_to))
+ return
+ end
+
+ if config.on_changed_to and state and state > 1 then
+ http.redirect(_resolve_path(config.on_changed_to))
+ return
+ end
+
+ if config.on_success_to and state and state > 0 then
+ http.redirect(_resolve_path(config.on_success_to))
+ return
+ end
+
+ if config.state_handler then
+ if not config.state_handler(state, maps) then
+ return
+ end
+ end
+
+ http.header("X-CBI-State", state or 0)
+
+ if not config.noheader then
+ tpl.render("cbi/header", {state = state})
+ end
+
+ local redirect
+ local messages
+ local applymap = false
+ local pageaction = true
+ local parsechain = { }
+
+ for i, res in ipairs(maps) do
+ if res.apply_needed and res.parsechain then
+ local c
+ for _, c in ipairs(res.parsechain) do
+ parsechain[#parsechain+1] = c
+ end
+ applymap = true
+ end
+
+ if res.redirect then
+ redirect = redirect or res.redirect
+ end
+
+ if res.pageaction == false then
+ pageaction = false
+ end
+
+ if res.message then
+ messages = messages or { }
+ messages[#messages+1] = res.message
+ end
+ end
+
+ for i, res in ipairs(maps) do
+ res:render({
+ firstmap = (i == 1),
+ applymap = applymap,
+ redirect = redirect,
+ messages = messages,
+ pageaction = pageaction,
+ parsechain = parsechain
+ })
+ end
+
+ if not config.nofooter then
+ tpl.render("cbi/footer", {
+ flow = config,
+ pageaction = pageaction,
+ redirect = redirect,
+ state = state,
+ autoapply = config.autoapply
+ })
+ end
+end
+
+--- Create a CBI model dispatching target.
+-- @param model CBI model to be rendered
+function cbi(model, config)
+ return {type = "cbi", config = config, model = model, target = _cbi}
+end
+
+
+local function _arcombine(self, ...)
+ local argv = {...}
+ local target = #argv > 0 and self.targets[2] or self.targets[1]
+ setfenv(target.target, self.env)
+ target:target(unpack(argv))
+end
+
+--- Create a combined dispatching target for non argv and argv requests.
+-- @param trg1 Overview Target
+-- @param trg2 Detail Target
+function arcombine(trg1, trg2)
+ return {type = "arcombine", env = getfenv(), target = _arcombine, targets = {trg1, trg2}}
+end
+
+
+local function _form(self, ...)
+ local cbi = require "luci.cbi"
+ local tpl = require "luci.template"
+ local http = require "luci.http"
+
+ local maps = luci.cbi.load(self.model, ...)
+ local state = nil
+
+ for i, res in ipairs(maps) do
+ local cstate = res:parse()
+ if cstate and (not state or cstate < state) then
+ state = cstate
+ end
+ end
+
+ http.header("X-CBI-State", state or 0)
+ tpl.render("header")
+ for i, res in ipairs(maps) do
+ res:render()
+ end
+ tpl.render("footer")
+end
+
+--- Create a CBI form model dispatching target.
+-- @param model CBI form model tpo be rendered
+function form(model)
+ return {type = "cbi", model = model, target = _form}
+end
+
+--- Access the luci.i18n translate() api.
+-- @class function
+-- @name translate
+-- @param text Text to translate
+translate = i18n.translate
+
+--- No-op function used to mark translation entries for menu labels.
+-- This function does not actually translate the given argument but
+-- is used by build/i18n-scan.pl to find translatable entries.
+function _(text)
+ return text
+end
--- /dev/null
+--[[
+LuCI - HTTP-Interaction
+
+Description:
+HTTP-Header manipulator and form variable preprocessor
+
+License:
+Copyright 2008 Steven Barth <steven@midlink.org>
+
+Licensed under the Apache License, Version 2.0 (the "License");
+you may not use this file except in compliance with the License.
+You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+Unless required by applicable law or agreed to in writing, software
+distributed under the License is distributed on an "AS IS" BASIS,
+WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+See the License for the specific language governing permissions and
+limitations under the License.
+
+]]--
+
+local ltn12 = require "luci.ltn12"
+local protocol = require "luci.http.protocol"
+local util = require "luci.util"
+local string = require "string"
+local coroutine = require "coroutine"
+local table = require "table"
+
+local ipairs, pairs, next, type, tostring, error =
+ ipairs, pairs, next, type, tostring, error
+
+--- LuCI Web Framework high-level HTTP functions.
+module "luci.http"
+
+context = util.threadlocal()
+
+Request = util.class()
+function Request.__init__(self, env, sourcein, sinkerr)
+ self.input = sourcein
+ self.error = sinkerr
+
+
+ -- File handler
+ self.filehandler = function() end
+
+ -- HTTP-Message table
+ self.message = {
+ env = env,
+ headers = {},
+ params = protocol.urldecode_params(env.QUERY_STRING or ""),
+ }
+
+ self.parsed_input = false
+end
+
+function Request.formvalue(self, name, noparse)
+ if not noparse and not self.parsed_input then
+ self:_parse_input()
+ end
+
+ if name then
+ return self.message.params[name]
+ else
+ return self.message.params
+ end
+end
+
+function Request.formvaluetable(self, prefix)
+ local vals = {}
+ prefix = prefix and prefix .. "." or "."
+
+ if not self.parsed_input then
+ self:_parse_input()
+ end
+
+ local void = self.message.params[nil]
+ for k, v in pairs(self.message.params) do
+ if k:find(prefix, 1, true) == 1 then
+ vals[k:sub(#prefix + 1)] = tostring(v)
+ end
+ end
+
+ return vals
+end
+
+function Request.content(self)
+ if not self.parsed_input then
+ self:_parse_input()
+ end
+
+ return self.message.content, self.message.content_length
+end
+
+function Request.getcookie(self, name)
+ local c = string.gsub(";" .. (self:getenv("HTTP_COOKIE") or "") .. ";", "%s*;%s*", ";")
+ local p = ";" .. name .. "=(.-);"
+ local i, j, value = c:find(p)
+ return value and urldecode(value)
+end
+
+function Request.getenv(self, name)
+ if name then
+ return self.message.env[name]
+ else
+ return self.message.env
+ end
+end
+
+function Request.setfilehandler(self, callback)
+ self.filehandler = callback
+end
+
+function Request._parse_input(self)
+ protocol.parse_message_body(
+ self.input,
+ self.message,
+ self.filehandler
+ )
+ self.parsed_input = true
+end
+
+--- Close the HTTP-Connection.
+function close()
+ if not context.eoh then
+ context.eoh = true
+ coroutine.yield(3)
+ end
+
+ if not context.closed then
+ context.closed = true
+ coroutine.yield(5)
+ end
+end
+
+--- Return the request content if the request was of unknown type.
+-- @return HTTP request body
+-- @return HTTP request body length
+function content()
+ return context.request:content()
+end
+
+--- Get a certain HTTP input value or a table of all input values.
+-- @param name Name of the GET or POST variable to fetch
+-- @param noparse Don't parse POST data before getting the value
+-- @return HTTP input value or table of all input value
+function formvalue(name, noparse)
+ return context.request:formvalue(name, noparse)
+end
+
+--- Get a table of all HTTP input values with a certain prefix.
+-- @param prefix Prefix
+-- @return Table of all HTTP input values with given prefix
+function formvaluetable(prefix)
+ return context.request:formvaluetable(prefix)
+end
+
+--- Get the value of a certain HTTP-Cookie.
+-- @param name Cookie Name
+-- @return String containing cookie data
+function getcookie(name)
+ return context.request:getcookie(name)
+end
+
+--- Get the value of a certain HTTP environment variable
+-- or the environment table itself.
+-- @param name Environment variable
+-- @return HTTP environment value or environment table
+function getenv(name)
+ return context.request:getenv(name)
+end
+
+--- Set a handler function for incoming user file uploads.
+-- @param callback Handler function
+function setfilehandler(callback)
+ return context.request:setfilehandler(callback)
+end
+
+--- Send a HTTP-Header.
+-- @param key Header key
+-- @param value Header value
+function header(key, value)
+ if not context.headers then
+ context.headers = {}
+ end
+ context.headers[key:lower()] = value
+ coroutine.yield(2, key, value)
+end
+
+--- Set the mime type of following content data.
+-- @param mime Mimetype of following content
+function prepare_content(mime)
+ if not context.headers or not context.headers["content-type"] then
+ if mime == "application/xhtml+xml" then
+ if not getenv("HTTP_ACCEPT") or
+ not getenv("HTTP_ACCEPT"):find("application/xhtml+xml", nil, true) then
+ mime = "text/html; charset=UTF-8"
+ end
+ header("Vary", "Accept")
+ end
+ header("Content-Type", mime)
+ end
+end
+
+--- Get the RAW HTTP input source
+-- @return HTTP LTN12 source
+function source()
+ return context.request.input
+end
+
+--- Set the HTTP status code and status message.
+-- @param code Status code
+-- @param message Status message
+function status(code, message)
+ code = code or 200
+ message = message or "OK"
+ context.status = code
+ coroutine.yield(1, code, message)
+end
+
+--- Send a chunk of content data to the client.
+-- This function is as a valid LTN12 sink.
+-- If the content chunk is nil this function will automatically invoke close.
+-- @param content Content chunk
+-- @param src_err Error object from source (optional)
+-- @see close
+function write(content, src_err)
+ if not content then
+ if src_err then
+ error(src_err)
+ else
+ close()
+ end
+ return true
+ elseif #content == 0 then
+ return true
+ else
+ if not context.eoh then
+ if not context.status then
+ status()
+ end
+ if not context.headers or not context.headers["content-type"] then
+ header("Content-Type", "text/html; charset=utf-8")
+ end
+ if not context.headers["cache-control"] then
+ header("Cache-Control", "no-cache")
+ header("Expires", "0")
+ end
+
+
+ context.eoh = true
+ coroutine.yield(3)
+ end
+ coroutine.yield(4, content)
+ return true
+ end
+end
+
+--- Splice data from a filedescriptor to the client.
+-- @param fp File descriptor
+-- @param size Bytes to splice (optional)
+function splice(fd, size)
+ coroutine.yield(6, fd, size)
+end
+
+--- Redirects the client to a new URL and closes the connection.
+-- @param url Target URL
+function redirect(url)
+ status(302, "Found")
+ header("Location", url)
+ close()
+end
+
+--- Create a querystring out of a table of key - value pairs.
+-- @param table Query string source table
+-- @return Encoded HTTP query string
+function build_querystring(q)
+ local s = { "?" }
+
+ for k, v in pairs(q) do
+ if #s > 1 then s[#s+1] = "&" end
+
+ s[#s+1] = urldecode(k)
+ s[#s+1] = "="
+ s[#s+1] = urldecode(v)
+ end
+
+ return table.concat(s, "")
+end
+
+--- Return the URL-decoded equivalent of a string.
+-- @param str URL-encoded string
+-- @param no_plus Don't decode + to " "
+-- @return URL-decoded string
+-- @see urlencode
+urldecode = protocol.urldecode
+
+--- Return the URL-encoded equivalent of a string.
+-- @param str Source string
+-- @return URL-encoded string
+-- @see urldecode
+urlencode = protocol.urlencode
+
+--- Send the given data as JSON encoded string.
+-- @param data Data to send
+function write_json(x)
+ if x == nil then
+ write("null")
+ elseif type(x) == "table" then
+ local k, v
+ if type(next(x)) == "number" then
+ write("[ ")
+ for k, v in ipairs(x) do
+ write_json(v)
+ if next(x, k) then
+ write(", ")
+ end
+ end
+ write(" ]")
+ else
+ write("{ ")
+ for k, v in pairs(x) do
+ write("%q: " % k)
+ write_json(v)
+ if next(x, k) then
+ write(", ")
+ end
+ end
+ write(" }")
+ end
+ elseif type(x) == "number" or type(x) == "boolean" then
+ if (x ~= x) then
+ -- NaN is the only value that doesn't equal to itself.
+ write("Number.NaN")
+ else
+ write(tostring(x))
+ end
+ else
+ write('"%s"' % tostring(x):gsub('["%z\1-\31]', function(c)
+ return '\\u%04x' % c:byte(1)
+ end))
+ end
+end
--- /dev/null
+--[[
+
+HTTP protocol implementation for LuCI
+(c) 2008 Freifunk Leipzig / Jo-Philipp Wich <xm@leipzig.freifunk.net>
+
+Licensed under the Apache License, Version 2.0 (the "License");
+you may not use this file except in compliance with the License.
+You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+$Id$
+
+]]--
+
+--- LuCI http protocol class.
+-- This class contains several functions useful for http message- and content
+-- decoding and to retrive form data from raw http messages.
+module("luci.http.protocol", package.seeall)
+
+local ltn12 = require("luci.ltn12")
+
+HTTP_MAX_CONTENT = 1024*8 -- 8 kB maximum content size
+
+--- Decode an urlencoded string - optionally without decoding
+-- the "+" sign to " " - and return the decoded string.
+-- @param str Input string in x-www-urlencoded format
+-- @param no_plus Don't decode "+" signs to spaces
+-- @return The decoded string
+-- @see urlencode
+function urldecode( str, no_plus )
+
+ local function __chrdec( hex )
+ return string.char( tonumber( hex, 16 ) )
+ end
+
+ if type(str) == "string" then
+ if not no_plus then
+ str = str:gsub( "+", " " )
+ end
+
+ str = str:gsub( "%%([a-fA-F0-9][a-fA-F0-9])", __chrdec )
+ end
+
+ return str
+end
+
+--- Extract and split urlencoded data pairs, separated bei either "&" or ";"
+-- from given url or string. Returns a table with urldecoded values.
+-- Simple parameters are stored as string values associated with the parameter
+-- name within the table. Parameters with multiple values are stored as array
+-- containing the corresponding values.
+-- @param url The url or string which contains x-www-urlencoded form data
+-- @param tbl Use the given table for storing values (optional)
+-- @return Table containing the urldecoded parameters
+-- @see urlencode_params
+function urldecode_params( url, tbl )
+
+ local params = tbl or { }
+
+ if url:find("?") then
+ url = url:gsub( "^.+%?([^?]+)", "%1" )
+ end
+
+ for pair in url:gmatch( "[^&;]+" ) do
+
+ -- find key and value
+ local key = urldecode( pair:match("^([^=]+)") )
+ local val = urldecode( pair:match("^[^=]+=(.+)$") )
+
+ -- store
+ if type(key) == "string" and key:len() > 0 then
+ if type(val) ~= "string" then val = "" end
+
+ if not params[key] then
+ params[key] = val
+ elseif type(params[key]) ~= "table" then
+ params[key] = { params[key], val }
+ else
+ table.insert( params[key], val )
+ end
+ end
+ end
+
+ return params
+end
+
+--- Encode given string to x-www-urlencoded format.
+-- @param str String to encode
+-- @return String containing the encoded data
+-- @see urldecode
+function urlencode( str )
+
+ local function __chrenc( chr )
+ return string.format(
+ "%%%02x", string.byte( chr )
+ )
+ end
+
+ if type(str) == "string" then
+ str = str:gsub(
+ "([^a-zA-Z0-9$_%-%.%+!*'(),])",
+ __chrenc
+ )
+ end
+
+ return str
+end
+
+--- Encode each key-value-pair in given table to x-www-urlencoded format,
+-- separated by "&". Tables are encoded as parameters with multiple values by
+-- repeating the parameter name with each value.
+-- @param tbl Table with the values
+-- @return String containing encoded values
+-- @see urldecode_params
+function urlencode_params( tbl )
+ local enc = ""
+
+ for k, v in pairs(tbl) do
+ if type(v) == "table" then
+ for i, v2 in ipairs(v) do
+ enc = enc .. ( #enc > 0 and "&" or "" ) ..
+ urlencode(k) .. "=" .. urlencode(v2)
+ end
+ else
+ enc = enc .. ( #enc > 0 and "&" or "" ) ..
+ urlencode(k) .. "=" .. urlencode(v)
+ end
+ end
+
+ return enc
+end
+
+-- (Internal function)
+-- Initialize given parameter and coerce string into table when the parameter
+-- already exists.
+-- @param tbl Table where parameter should be created
+-- @param key Parameter name
+-- @return Always nil
+local function __initval( tbl, key )
+ if tbl[key] == nil then
+ tbl[key] = ""
+ elseif type(tbl[key]) == "string" then
+ tbl[key] = { tbl[key], "" }
+ else
+ table.insert( tbl[key], "" )
+ end
+end
+
+-- (Internal function)
+-- Append given data to given parameter, either by extending the string value
+-- or by appending it to the last string in the parameter's value table.
+-- @param tbl Table containing the previously initialized parameter value
+-- @param key Parameter name
+-- @param chunk String containing the data to append
+-- @return Always nil
+-- @see __initval
+local function __appendval( tbl, key, chunk )
+ if type(tbl[key]) == "table" then
+ tbl[key][#tbl[key]] = tbl[key][#tbl[key]] .. chunk
+ else
+ tbl[key] = tbl[key] .. chunk
+ end
+end
+
+-- (Internal function)
+-- Finish the value of given parameter, either by transforming the string value
+-- or - in the case of multi value parameters - the last element in the
+-- associated values table.
+-- @param tbl Table containing the previously initialized parameter value
+-- @param key Parameter name
+-- @param handler Function which transforms the parameter value
+-- @return Always nil
+-- @see __initval
+-- @see __appendval
+local function __finishval( tbl, key, handler )
+ if handler then
+ if type(tbl[key]) == "table" then
+ tbl[key][#tbl[key]] = handler( tbl[key][#tbl[key]] )
+ else
+ tbl[key] = handler( tbl[key] )
+ end
+ end
+end
+
+
+-- Table of our process states
+local process_states = { }
+
+-- Extract "magic", the first line of a http message.
+-- Extracts the message type ("get", "post" or "response"), the requested uri
+-- or the status code if the line descripes a http response.
+process_states['magic'] = function( msg, chunk, err )
+
+ if chunk ~= nil then
+ -- ignore empty lines before request
+ if #chunk == 0 then
+ return true, nil
+ end
+
+ -- Is it a request?
+ local method, uri, http_ver = chunk:match("^([A-Z]+) ([^ ]+) HTTP/([01]%.[019])$")
+
+ -- Yup, it is
+ if method then
+
+ msg.type = "request"
+ msg.request_method = method:lower()
+ msg.request_uri = uri
+ msg.http_version = tonumber( http_ver )
+ msg.headers = { }
+
+ -- We're done, next state is header parsing
+ return true, function( chunk )
+ return process_states['headers']( msg, chunk )
+ end
+
+ -- Is it a response?
+ else
+
+ local http_ver, code, message = chunk:match("^HTTP/([01]%.[019]) ([0-9]+) ([^\r\n]+)$")
+
+ -- Is a response
+ if code then
+
+ msg.type = "response"
+ msg.status_code = code
+ msg.status_message = message
+ msg.http_version = tonumber( http_ver )
+ msg.headers = { }
+
+ -- We're done, next state is header parsing
+ return true, function( chunk )
+ return process_states['headers']( msg, chunk )
+ end
+ end
+ end
+ end
+
+ -- Can't handle it
+ return nil, "Invalid HTTP message magic"
+end
+
+
+-- Extract headers from given string.
+process_states['headers'] = function( msg, chunk )
+
+ if chunk ~= nil then
+
+ -- Look for a valid header format
+ local hdr, val = chunk:match( "^([A-Za-z][A-Za-z0-9%-_]+): +(.+)$" )
+
+ if type(hdr) == "string" and hdr:len() > 0 and
+ type(val) == "string" and val:len() > 0
+ then
+ msg.headers[hdr] = val
+
+ -- Valid header line, proceed
+ return true, nil
+
+ elseif #chunk == 0 then
+ -- Empty line, we won't accept data anymore
+ return false, nil
+ else
+ -- Junk data
+ return nil, "Invalid HTTP header received"
+ end
+ else
+ return nil, "Unexpected EOF"
+ end
+end
+
+
+--- Creates a ltn12 source from the given socket. The source will return it's
+-- data line by line with the trailing \r\n stripped of.
+-- @param sock Readable network socket
+-- @return Ltn12 source function
+function header_source( sock )
+ return ltn12.source.simplify( function()
+
+ local chunk, err, part = sock:receive("*l")
+
+ -- Line too long
+ if chunk == nil then
+ if err ~= "timeout" then
+ return nil, part
+ and "Line exceeds maximum allowed length"
+ or "Unexpected EOF"
+ else
+ return nil, err
+ end
+
+ -- Line ok
+ elseif chunk ~= nil then
+
+ -- Strip trailing CR
+ chunk = chunk:gsub("\r$","")
+
+ return chunk, nil
+ end
+ end )
+end
+
+--- Decode a mime encoded http message body with multipart/form-data
+-- Content-Type. Stores all extracted data associated with its parameter name
+-- in the params table withing the given message object. Multiple parameter
+-- values are stored as tables, ordinary ones as strings.
+-- If an optional file callback function is given then it is feeded with the
+-- file contents chunk by chunk and only the extracted file name is stored
+-- within the params table. The callback function will be called subsequently
+-- with three arguments:
+-- o Table containing decoded (name, file) and raw (headers) mime header data
+-- o String value containing a chunk of the file data
+-- o Boolean which indicates wheather the current chunk is the last one (eof)
+-- @param src Ltn12 source function
+-- @param msg HTTP message object
+-- @param filecb File callback function (optional)
+-- @return Value indicating successful operation (not nil means "ok")
+-- @return String containing the error if unsuccessful
+-- @see parse_message_header
+function mimedecode_message_body( src, msg, filecb )
+
+ if msg and msg.env.CONTENT_TYPE then
+ msg.mime_boundary = msg.env.CONTENT_TYPE:match("^multipart/form%-data; boundary=(.+)$")
+ end
+
+ if not msg.mime_boundary then
+ return nil, "Invalid Content-Type found"
+ end
+
+
+ local tlen = 0
+ local inhdr = false
+ local field = nil
+ local store = nil
+ local lchunk = nil
+
+ local function parse_headers( chunk, field )
+
+ local stat
+ repeat
+ chunk, stat = chunk:gsub(
+ "^([A-Z][A-Za-z0-9%-_]+): +([^\r\n]+)\r\n",
+ function(k,v)
+ field.headers[k] = v
+ return ""
+ end
+ )
+ until stat == 0
+
+ chunk, stat = chunk:gsub("^\r\n","")
+
+ -- End of headers
+ if stat > 0 then
+ if field.headers["Content-Disposition"] then
+ if field.headers["Content-Disposition"]:match("^form%-data; ") then
+ field.name = field.headers["Content-Disposition"]:match('name="(.-)"')
+ field.file = field.headers["Content-Disposition"]:match('filename="(.+)"$')
+ end
+ end
+
+ if not field.headers["Content-Type"] then
+ field.headers["Content-Type"] = "text/plain"
+ end
+
+ if field.name and field.file and filecb then
+ __initval( msg.params, field.name )
+ __appendval( msg.params, field.name, field.file )
+
+ store = filecb
+ elseif field.name then
+ __initval( msg.params, field.name )
+
+ store = function( hdr, buf, eof )
+ __appendval( msg.params, field.name, buf )
+ end
+ else
+ store = nil
+ end
+
+ return chunk, true
+ end
+
+ return chunk, false
+ end
+
+ local function snk( chunk )
+
+ tlen = tlen + ( chunk and #chunk or 0 )
+
+ if msg.env.CONTENT_LENGTH and tlen > tonumber(msg.env.CONTENT_LENGTH) + 2 then
+ return nil, "Message body size exceeds Content-Length"
+ end
+
+ if chunk and not lchunk then
+ lchunk = "\r\n" .. chunk
+
+ elseif lchunk then
+ local data = lchunk .. ( chunk or "" )
+ local spos, epos, found
+
+ repeat
+ spos, epos = data:find( "\r\n--" .. msg.mime_boundary .. "\r\n", 1, true )
+
+ if not spos then
+ spos, epos = data:find( "\r\n--" .. msg.mime_boundary .. "--\r\n", 1, true )
+ end
+
+
+ if spos then
+ local predata = data:sub( 1, spos - 1 )
+
+ if inhdr then
+ predata, eof = parse_headers( predata, field )
+
+ if not eof then
+ return nil, "Invalid MIME section header"
+ elseif not field.name then
+ return nil, "Invalid Content-Disposition header"
+ end
+ end
+
+ if store then
+ store( field, predata, true )
+ end
+
+
+ field = { headers = { } }
+ found = found or true
+
+ data, eof = parse_headers( data:sub( epos + 1, #data ), field )
+ inhdr = not eof
+ end
+ until not spos
+
+ if found then
+ -- We found at least some boundary. Save
+ -- the unparsed remaining data for the
+ -- next chunk.
+ lchunk, data = data, nil
+ else
+ -- There was a complete chunk without a boundary. Parse it as headers or
+ -- append it as data, depending on our current state.
+ if inhdr then
+ lchunk, eof = parse_headers( data, field )
+ inhdr = not eof
+ else
+ -- We're inside data, so append the data. Note that we only append
+ -- lchunk, not all of data, since there is a chance that chunk
+ -- contains half a boundary. Assuming that each chunk is at least the
+ -- boundary in size, this should prevent problems
+ store( field, lchunk, false )
+ lchunk, chunk = chunk, nil
+ end
+ end
+ end
+
+ return true
+ end
+
+ return ltn12.pump.all( src, snk )
+end
+
+--- Decode an urlencoded http message body with application/x-www-urlencoded
+-- Content-Type. Stores all extracted data associated with its parameter name
+-- in the params table withing the given message object. Multiple parameter
+-- values are stored as tables, ordinary ones as strings.
+-- @param src Ltn12 source function
+-- @param msg HTTP message object
+-- @return Value indicating successful operation (not nil means "ok")
+-- @return String containing the error if unsuccessful
+-- @see parse_message_header
+function urldecode_message_body( src, msg )
+
+ local tlen = 0
+ local lchunk = nil
+
+ local function snk( chunk )
+
+ tlen = tlen + ( chunk and #chunk or 0 )
+
+ if msg.env.CONTENT_LENGTH and tlen > tonumber(msg.env.CONTENT_LENGTH) + 2 then
+ return nil, "Message body size exceeds Content-Length"
+ elseif tlen > HTTP_MAX_CONTENT then
+ return nil, "Message body size exceeds maximum allowed length"
+ end
+
+ if not lchunk and chunk then
+ lchunk = chunk
+
+ elseif lchunk then
+ local data = lchunk .. ( chunk or "&" )
+ local spos, epos
+
+ repeat
+ spos, epos = data:find("^.-[;&]")
+
+ if spos then
+ local pair = data:sub( spos, epos - 1 )
+ local key = pair:match("^(.-)=")
+ local val = pair:match("=([^%s]*)%s*$")
+
+ if key and #key > 0 then
+ __initval( msg.params, key )
+ __appendval( msg.params, key, val )
+ __finishval( msg.params, key, urldecode )
+ end
+
+ data = data:sub( epos + 1, #data )
+ end
+ until not spos
+
+ lchunk = data
+ end
+
+ return true
+ end
+
+ return ltn12.pump.all( src, snk )
+end
+
+--- Try to extract an http message header including information like protocol
+-- version, message headers and resulting CGI environment variables from the
+-- given ltn12 source.
+-- @param src Ltn12 source function
+-- @return HTTP message object
+-- @see parse_message_body
+function parse_message_header( src )
+
+ local ok = true
+ local msg = { }
+
+ local sink = ltn12.sink.simplify(
+ function( chunk )
+ return process_states['magic']( msg, chunk )
+ end
+ )
+
+ -- Pump input data...
+ while ok do
+
+ -- get data
+ ok, err = ltn12.pump.step( src, sink )
+
+ -- error
+ if not ok and err then
+ return nil, err
+
+ -- eof
+ elseif not ok then
+
+ -- Process get parameters
+ if ( msg.request_method == "get" or msg.request_method == "post" ) and
+ msg.request_uri:match("?")
+ then
+ msg.params = urldecode_params( msg.request_uri )
+ else
+ msg.params = { }
+ end
+
+ -- Populate common environment variables
+ msg.env = {
+ CONTENT_LENGTH = msg.headers['Content-Length'];
+ CONTENT_TYPE = msg.headers['Content-Type'] or msg.headers['Content-type'];
+ REQUEST_METHOD = msg.request_method:upper();
+ REQUEST_URI = msg.request_uri;
+ SCRIPT_NAME = msg.request_uri:gsub("?.+$","");
+ SCRIPT_FILENAME = ""; -- XXX implement me
+ SERVER_PROTOCOL = "HTTP/" .. string.format("%.1f", msg.http_version);
+ QUERY_STRING = msg.request_uri:match("?")
+ and msg.request_uri:gsub("^.+?","") or ""
+ }
+
+ -- Populate HTTP_* environment variables
+ for i, hdr in ipairs( {
+ 'Accept',
+ 'Accept-Charset',
+ 'Accept-Encoding',
+ 'Accept-Language',
+ 'Connection',
+ 'Cookie',
+ 'Host',
+ 'Referer',
+ 'User-Agent',
+ } ) do
+ local var = 'HTTP_' .. hdr:upper():gsub("%-","_")
+ local val = msg.headers[hdr]
+
+ msg.env[var] = val
+ end
+ end
+ end
+
+ return msg
+end
+
+--- Try to extract and decode a http message body from the given ltn12 source.
+-- This function will examine the Content-Type within the given message object
+-- to select the appropriate content decoder.
+-- Currently the application/x-www-urlencoded and application/form-data
+-- mime types are supported. If the encountered content encoding can't be
+-- handled then the whole message body will be stored unaltered as "content"
+-- property within the given message object.
+-- @param src Ltn12 source function
+-- @param msg HTTP message object
+-- @param filecb File data callback (optional, see mimedecode_message_body())
+-- @return Value indicating successful operation (not nil means "ok")
+-- @return String containing the error if unsuccessful
+-- @see parse_message_header
+function parse_message_body( src, msg, filecb )
+ -- Is it multipart/mime ?
+ if msg.env.REQUEST_METHOD == "POST" and msg.env.CONTENT_TYPE and
+ msg.env.CONTENT_TYPE:match("^multipart/form%-data")
+ then
+
+ return mimedecode_message_body( src, msg, filecb )
+
+ -- Is it application/x-www-form-urlencoded ?
+ elseif msg.env.REQUEST_METHOD == "POST" and msg.env.CONTENT_TYPE and
+ msg.env.CONTENT_TYPE:match("^application/x%-www%-form%-urlencoded")
+ then
+ return urldecode_message_body( src, msg, filecb )
+
+
+ -- Unhandled encoding
+ -- If a file callback is given then feed it chunk by chunk, else
+ -- store whole buffer in message.content
+ else
+
+ local sink
+
+ -- If we have a file callback then feed it
+ if type(filecb) == "function" then
+ sink = filecb
+
+ -- ... else append to .content
+ else
+ msg.content = ""
+ msg.content_length = 0
+
+ sink = function( chunk, err )
+ if chunk then
+ if ( msg.content_length + #chunk ) <= HTTP_MAX_CONTENT then
+ msg.content = msg.content .. chunk
+ msg.content_length = msg.content_length + #chunk
+ return true
+ else
+ return nil, "POST data exceeds maximum allowed length"
+ end
+ end
+ return true
+ end
+ end
+
+ -- Pump data...
+ while true do
+ local ok, err = ltn12.pump.step( src, sink )
+
+ if not ok and err then
+ return nil, err
+ elseif not err then
+ return true
+ end
+ end
+
+ return true
+ end
+end
+
+--- Table containing human readable messages for several http status codes.
+-- @class table
+statusmsg = {
+ [200] = "OK",
+ [206] = "Partial Content",
+ [301] = "Moved Permanently",
+ [302] = "Found",
+ [304] = "Not Modified",
+ [400] = "Bad Request",
+ [403] = "Forbidden",
+ [404] = "Not Found",
+ [405] = "Method Not Allowed",
+ [408] = "Request Time-out",
+ [411] = "Length Required",
+ [412] = "Precondition Failed",
+ [416] = "Requested range not satisfiable",
+ [500] = "Internal Server Error",
+ [503] = "Server Unavailable",
+}
--- /dev/null
+--[[
+
+HTTP protocol implementation for LuCI - RFC2616 / 14.19, 14.24 - 14.28
+(c) 2008 Freifunk Leipzig / Jo-Philipp Wich <xm@leipzig.freifunk.net>
+
+Licensed under the Apache License, Version 2.0 (the "License");
+you may not use this file except in compliance with the License.
+You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+$Id$
+
+]]--
+
+--- LuCI http protocol implementation - HTTP/1.1 bits.
+-- This class provides basic ETag handling and implements most of the
+-- conditional HTTP/1.1 headers specified in RFC2616 Sct. 14.24 - 14.28 .
+module("luci.http.protocol.conditionals", package.seeall)
+
+local date = require("luci.http.protocol.date")
+
+
+--- Implement 14.19 / ETag.
+-- @param stat A file.stat structure
+-- @return String containing the generated tag suitable for ETag headers
+function mk_etag( stat )
+ if stat ~= nil then
+ return string.format( '"%x-%x-%x"', stat.ino, stat.size, stat.mtime )
+ end
+end
+
+--- 14.24 / If-Match
+-- Test whether the given message object contains an "If-Match" header and
+-- compare it against the given stat object.
+-- @param req HTTP request message object
+-- @param stat A file.stat object
+-- @return Boolean indicating whether the precondition is ok
+-- @return Alternative status code if the precondition failed
+function if_match( req, stat )
+ local h = req.headers
+ local etag = mk_etag( stat )
+
+ -- Check for matching resource
+ if type(h['If-Match']) == "string" then
+ for ent in h['If-Match']:gmatch("([^, ]+)") do
+ if ( ent == '*' or ent == etag ) and stat ~= nil then
+ return true
+ end
+ end
+
+ return false, 412
+ end
+
+ return true
+end
+
+--- 14.25 / If-Modified-Since
+-- Test whether the given message object contains an "If-Modified-Since" header
+-- and compare it against the given stat object.
+-- @param req HTTP request message object
+-- @param stat A file.stat object
+-- @return Boolean indicating whether the precondition is ok
+-- @return Alternative status code if the precondition failed
+-- @return Table containing extra HTTP headers if the precondition failed
+function if_modified_since( req, stat )
+ local h = req.headers
+
+ -- Compare mtimes
+ if type(h['If-Modified-Since']) == "string" then
+ local since = date.to_unix( h['If-Modified-Since'] )
+
+ if stat == nil or since < stat.mtime then
+ return true
+ end
+
+ return false, 304, {
+ ["ETag"] = mk_etag( stat );
+ ["Date"] = date.to_http( os.time() );
+ ["Last-Modified"] = date.to_http( stat.mtime )
+ }
+ end
+
+ return true
+end
+
+--- 14.26 / If-None-Match
+-- Test whether the given message object contains an "If-None-Match" header and
+-- compare it against the given stat object.
+-- @param req HTTP request message object
+-- @param stat A file.stat object
+-- @return Boolean indicating whether the precondition is ok
+-- @return Alternative status code if the precondition failed
+-- @return Table containing extra HTTP headers if the precondition failed
+function if_none_match( req, stat )
+ local h = req.headers
+ local etag = mk_etag( stat )
+ local method = req.env and req.env.REQUEST_METHOD or "GET"
+
+ -- Check for matching resource
+ if type(h['If-None-Match']) == "string" then
+ for ent in h['If-None-Match']:gmatch("([^, ]+)") do
+ if ( ent == '*' or ent == etag ) and stat ~= nil then
+ if method == "GET" or method == "HEAD" then
+ return false, 304, {
+ ["ETag"] = etag;
+ ["Date"] = date.to_http( os.time() );
+ ["Last-Modified"] = date.to_http( stat.mtime )
+ }
+ else
+ return false, 412
+ end
+ end
+ end
+ end
+
+ return true
+end
+
+--- 14.27 / If-Range
+-- The If-Range header is currently not implemented due to the lack of general
+-- byte range stuff in luci.http.protocol . This function will always return
+-- false, 412 to indicate a failed precondition.
+-- @param req HTTP request message object
+-- @param stat A file.stat object
+-- @return Boolean indicating whether the precondition is ok
+-- @return Alternative status code if the precondition failed
+function if_range( req, stat )
+ -- Sorry, no subranges (yet)
+ return false, 412
+end
+
+--- 14.28 / If-Unmodified-Since
+-- Test whether the given message object contains an "If-Unmodified-Since"
+-- header and compare it against the given stat object.
+-- @param req HTTP request message object
+-- @param stat A file.stat object
+-- @return Boolean indicating whether the precondition is ok
+-- @return Alternative status code if the precondition failed
+function if_unmodified_since( req, stat )
+ local h = req.headers
+
+ -- Compare mtimes
+ if type(h['If-Unmodified-Since']) == "string" then
+ local since = date.to_unix( h['If-Unmodified-Since'] )
+
+ if stat ~= nil and since <= stat.mtime then
+ return false, 412
+ end
+ end
+
+ return true
+end
--- /dev/null
+--[[
+
+HTTP protocol implementation for LuCI - date handling
+(c) 2008 Freifunk Leipzig / Jo-Philipp Wich <xm@leipzig.freifunk.net>
+
+Licensed under the Apache License, Version 2.0 (the "License");
+you may not use this file except in compliance with the License.
+You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+$Id$
+
+]]--
+
+--- LuCI http protocol implementation - date helper class.
+-- This class contains functions to parse, compare and format http dates.
+module("luci.http.protocol.date", package.seeall)
+
+require("luci.sys.zoneinfo")
+
+
+MONTHS = {
+ "Jan", "Feb", "Mar", "Apr", "May", "Jun", "Jul", "Aug",
+ "Sep", "Oct", "Nov", "Dec"
+}
+
+--- Return the time offset in seconds between the UTC and given time zone.
+-- @param tz Symbolic or numeric timezone specifier
+-- @return Time offset to UTC in seconds
+function tz_offset(tz)
+
+ if type(tz) == "string" then
+
+ -- check for a numeric identifier
+ local s, v = tz:match("([%+%-])([0-9]+)")
+ if s == '+' then s = 1 else s = -1 end
+ if v then v = tonumber(v) end
+
+ if s and v then
+ return s * 60 * ( math.floor( v / 100 ) * 60 + ( v % 100 ) )
+
+ -- lookup symbolic tz
+ elseif luci.sys.zoneinfo.OFFSET[tz:lower()] then
+ return luci.sys.zoneinfo.OFFSET[tz:lower()]
+ end
+
+ end
+
+ -- bad luck
+ return 0
+end
+
+--- Parse given HTTP date string and convert it to unix epoch time.
+-- @param data String containing the date
+-- @return Unix epoch time
+function to_unix(date)
+
+ local wd, day, mon, yr, hr, min, sec, tz = date:match(
+ "([A-Z][a-z][a-z]), ([0-9]+) " ..
+ "([A-Z][a-z][a-z]) ([0-9]+) " ..
+ "([0-9]+):([0-9]+):([0-9]+) " ..
+ "([A-Z0-9%+%-]+)"
+ )
+
+ if day and mon and yr and hr and min and sec then
+ -- find month
+ local month = 1
+ for i = 1, 12 do
+ if MONTHS[i] == mon then
+ month = i
+ break
+ end
+ end
+
+ -- convert to epoch time
+ return tz_offset(tz) + os.time( {
+ year = yr,
+ month = month,
+ day = day,
+ hour = hr,
+ min = min,
+ sec = sec
+ } )
+ end
+
+ return 0
+end
+
+--- Convert the given unix epoch time to valid HTTP date string.
+-- @param time Unix epoch time
+-- @return String containing the formatted date
+function to_http(time)
+ return os.date( "%a, %d %b %Y %H:%M:%S GMT", time )
+end
+
+--- Compare two dates which can either be unix epoch times or HTTP date strings.
+-- @param d1 The first date or epoch time to compare
+-- @param d2 The first date or epoch time to compare
+-- @return -1 - if d1 is lower then d2
+-- @return 0 - if both dates are equal
+-- @return 1 - if d1 is higher then d2
+function compare(d1, d2)
+
+ if d1:match("[^0-9]") then d1 = to_unix(d1) end
+ if d2:match("[^0-9]") then d2 = to_unix(d2) end
+
+ if d1 == d2 then
+ return 0
+ elseif d1 < d2 then
+ return -1
+ else
+ return 1
+ end
+end
--- /dev/null
+--[[
+
+HTTP protocol implementation for LuCI - mime handling
+(c) 2008 Freifunk Leipzig / Jo-Philipp Wich <xm@leipzig.freifunk.net>
+
+Licensed under the Apache License, Version 2.0 (the "License");
+you may not use this file except in compliance with the License.
+You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+$Id$
+
+]]--
+
+--- LuCI http protocol implementation - mime helper class.
+-- This class provides functions to guess mime types from file extensions and
+-- vice versa.
+module("luci.http.protocol.mime", package.seeall)
+
+require("luci.util")
+
+--- MIME mapping table containg extension - mimetype relations.
+-- @class table
+MIME_TYPES = {
+ ["txt"] = "text/plain";
+ ["js"] = "text/javascript";
+ ["css"] = "text/css";
+ ["htm"] = "text/html";
+ ["html"] = "text/html";
+ ["patch"] = "text/x-patch";
+ ["c"] = "text/x-csrc";
+ ["h"] = "text/x-chdr";
+ ["o"] = "text/x-object";
+ ["ko"] = "text/x-object";
+
+ ["bmp"] = "image/bmp";
+ ["gif"] = "image/gif";
+ ["png"] = "image/png";
+ ["jpg"] = "image/jpeg";
+ ["jpeg"] = "image/jpeg";
+ ["svg"] = "image/svg+xml";
+
+ ["zip"] = "application/zip";
+ ["pdf"] = "application/pdf";
+ ["xml"] = "application/xml";
+ ["xsl"] = "application/xml";
+ ["doc"] = "application/msword";
+ ["ppt"] = "application/vnd.ms-powerpoint";
+ ["xls"] = "application/vnd.ms-excel";
+ ["odt"] = "application/vnd.oasis.opendocument.text";
+ ["odp"] = "application/vnd.oasis.opendocument.presentation";
+ ["pl"] = "application/x-perl";
+ ["sh"] = "application/x-shellscript";
+ ["php"] = "application/x-php";
+ ["deb"] = "application/x-deb";
+ ["iso"] = "application/x-cd-image";
+ ["tgz"] = "application/x-compressed-tar";
+
+ ["mp3"] = "audio/mpeg";
+ ["ogg"] = "audio/x-vorbis+ogg";
+ ["wav"] = "audio/x-wav";
+
+ ["mpg"] = "video/mpeg";
+ ["mpeg"] = "video/mpeg";
+ ["avi"] = "video/x-msvideo";
+}
+
+--- Extract extension from a filename and return corresponding mime-type or
+-- "application/octet-stream" if the extension is unknown.
+-- @param filename The filename for which the mime type is guessed
+-- @return String containign the determined mime type
+function to_mime(filename)
+ if type(filename) == "string" then
+ local ext = filename:match("[^%.]+$")
+
+ if ext and MIME_TYPES[ext:lower()] then
+ return MIME_TYPES[ext:lower()]
+ end
+ end
+
+ return "application/octet-stream"
+end
+
+--- Return corresponding extension for a given mime type or nil if the
+-- given mime-type is unknown.
+-- @param mimetype The mimetype to retrieve the extension from
+-- @return String with the extension or nil for unknown type
+function to_ext(mimetype)
+ if type(mimetype) == "string" then
+ for ext, type in luci.util.kspairs( MIME_TYPES ) do
+ if type == mimetype then
+ return ext
+ end
+ end
+ end
+
+ return nil
+end
--- /dev/null
+--[[
+LuCI - Internationalisation
+
+Description:
+A very minimalistic but yet effective internationalisation module
+
+FileId:
+$Id$
+
+License:
+Copyright 2008 Steven Barth <steven@midlink.org>
+
+Licensed under the Apache License, Version 2.0 (the "License");
+you may not use this file except in compliance with the License.
+You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+Unless required by applicable law or agreed to in writing, software
+distributed under the License is distributed on an "AS IS" BASIS,
+WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+See the License for the specific language governing permissions and
+limitations under the License.
+
+]]--
+
+--- LuCI translation library.
+module("luci.i18n", package.seeall)
+require("luci.util")
+
+local tparser = require "luci.template.parser"
+
+table = {}
+i18ndir = luci.util.libpath() .. "/i18n/"
+loaded = {}
+context = luci.util.threadlocal()
+default = "en"
+
+--- Clear the translation table.
+function clear()
+end
+
+--- Load a translation and copy its data into the translation table.
+-- @param file Language file
+-- @param lang Two-letter language code
+-- @param force Force reload even if already loaded (optional)
+-- @return Success status
+function load(file, lang, force)
+end
+
+--- Load a translation file using the default translation language.
+-- Alternatively load the translation of the fallback language.
+-- @param file Language file
+-- @param force Force reload even if already loaded (optional)
+function loadc(file, force)
+end
+
+--- Set the context default translation language.
+-- @param lang Two-letter language code
+function setlanguage(lang)
+ context.lang = lang:gsub("_", "-")
+ context.parent = (context.lang:match("^([a-z][a-z])_"))
+ if not tparser.load_catalog(context.lang, i18ndir) then
+ if context.parent then
+ tparser.load_catalog(context.parent, i18ndir)
+ return context.parent
+ end
+ end
+ return context.lang
+end
+
+--- Return the translated value for a specific translation key.
+-- @param key Default translation text
+-- @return Translated string
+function translate(key)
+ return tparser.translate(key) or key
+end
+
+--- Return the translated value for a specific translation key and use it as sprintf pattern.
+-- @param key Default translation text
+-- @param ... Format parameters
+-- @return Translated and formatted string
+function translatef(key, ...)
+ return tostring(translate(key)):format(...)
+end
+
+--- Return the translated value for a specific translation key
+-- and ensure that the returned value is a Lua string value.
+-- This is the same as calling <code>tostring(translate(...))</code>
+-- @param key Default translation text
+-- @return Translated string
+function string(key)
+ return tostring(translate(key))
+end
+
+--- Return the translated value for a specific translation key and use it as sprintf pattern.
+-- Ensure that the returned value is a Lua string value.
+-- This is the same as calling <code>tostring(translatef(...))</code>
+-- @param key Default translation text
+-- @param ... Format parameters
+-- @return Translated and formatted string
+function stringf(key, ...)
+ return tostring(translate(key)):format(...)
+end
--- /dev/null
+--[[
+
+Session authentication
+(c) 2008 Steven Barth <steven@midlink.org>
+
+Licensed under the Apache License, Version 2.0 (the "License");
+you may not use this file except in compliance with the License.
+You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+$Id$
+
+]]--
+
+--- LuCI session library.
+module("luci.sauth", package.seeall)
+require("luci.util")
+require("luci.sys")
+require("luci.config")
+local nixio = require "nixio", require "nixio.util"
+local fs = require "nixio.fs"
+
+
+luci.config.sauth = luci.config.sauth or {}
+sessionpath = luci.config.sauth.sessionpath
+sessiontime = tonumber(luci.config.sauth.sessiontime) or 15 * 60
+
+--- Prepare session storage by creating the session directory.
+function prepare()
+ fs.mkdir(sessionpath, 700)
+ if not sane() then
+ error("Security Exception: Session path is not sane!")
+ end
+end
+
+local function _read(id)
+ local blob = fs.readfile(sessionpath .. "/" .. id)
+ return blob
+end
+
+local function _write(id, data)
+ local f = nixio.open(sessionpath .. "/" .. id, "w", 600)
+ f:writeall(data)
+ f:close()
+end
+
+local function _checkid(id)
+ return not not (id and #id == 32 and id:match("^[a-fA-F0-9]+$"))
+end
+
+--- Write session data to a session file.
+-- @param id Session identifier
+-- @param data Session data table
+function write(id, data)
+ if not sane() then
+ prepare()
+ end
+
+ assert(_checkid(id), "Security Exception: Session ID is invalid!")
+ assert(type(data) == "table", "Security Exception: Session data invalid!")
+
+ data.atime = luci.sys.uptime()
+
+ _write(id, luci.util.get_bytecode(data))
+end
+
+--- Read a session and return its content.
+-- @param id Session identifier
+-- @return Session data table or nil if the given id is not found
+function read(id)
+ if not id or #id == 0 then
+ return nil
+ end
+
+ assert(_checkid(id), "Security Exception: Session ID is invalid!")
+
+ if not sane(sessionpath .. "/" .. id) then
+ return nil
+ end
+
+ local blob = _read(id)
+ local func = loadstring(blob)
+ setfenv(func, {})
+
+ local sess = func()
+ assert(type(sess) == "table", "Session data invalid!")
+
+ if sess.atime and sess.atime + sessiontime < luci.sys.uptime() then
+ kill(id)
+ return nil
+ end
+
+ -- refresh atime in session
+ write(id, sess)
+
+ return sess
+end
+
+--- Check whether Session environment is sane.
+-- @return Boolean status
+function sane(file)
+ return luci.sys.process.info("uid")
+ == fs.stat(file or sessionpath, "uid")
+ and fs.stat(file or sessionpath, "modestr")
+ == (file and "rw-------" or "rwx------")
+end
+
+--- Kills a session
+-- @param id Session identifier
+function kill(id)
+ assert(_checkid(id), "Security Exception: Session ID is invalid!")
+ fs.unlink(sessionpath .. "/" .. id)
+end
+
+--- Remove all expired session data files
+function reap()
+ if sane() then
+ local id
+ for id in nixio.fs.dir(sessionpath) do
+ if _checkid(id) then
+ -- reading the session will kill it if it is expired
+ read(id)
+ end
+ end
+ end
+end
--- /dev/null
+--[[
+LuCI - Template Parser
+
+Description:
+A template parser supporting includes, translations, Lua code blocks
+and more. It can be used either as a compiler or as an interpreter.
+
+FileId: $Id$
+
+License:
+Copyright 2008 Steven Barth <steven@midlink.org>
+
+Licensed under the Apache License, Version 2.0 (the "License");
+you may not use this file except in compliance with the License.
+You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+Unless required by applicable law or agreed to in writing, software
+distributed under the License is distributed on an "AS IS" BASIS,
+WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+See the License for the specific language governing permissions and
+limitations under the License.
+
+]]--
+
+local util = require "luci.util"
+local config = require "luci.config"
+local tparser = require "luci.template.parser"
+
+local tostring, pairs, loadstring = tostring, pairs, loadstring
+local setmetatable, loadfile = setmetatable, loadfile
+local getfenv, setfenv, rawget = getfenv, setfenv, rawget
+local assert, type, error = assert, type, error
+
+--- LuCI template library.
+module "luci.template"
+
+config.template = config.template or {}
+viewdir = config.template.viewdir or util.libpath() .. "/view"
+
+
+-- Define the namespace for template modules
+context = util.threadlocal()
+
+--- Render a certain template.
+-- @param name Template name
+-- @param scope Scope to assign to template (optional)
+function render(name, scope)
+ return Template(name):render(scope or getfenv(2))
+end
+
+
+-- Template class
+Template = util.class()
+
+-- Shared template cache to store templates in to avoid unnecessary reloading
+Template.cache = setmetatable({}, {__mode = "v"})
+
+
+-- Constructor - Reads and compiles the template on-demand
+function Template.__init__(self, name)
+
+ self.template = self.cache[name]
+ self.name = name
+
+ -- Create a new namespace for this template
+ self.viewns = context.viewns
+
+ -- If we have a cached template, skip compiling and loading
+ if not self.template then
+
+ -- Compile template
+ local err
+ local sourcefile = viewdir .. "/" .. name .. ".htm"
+
+ self.template, _, err = tparser.parse(sourcefile)
+
+ -- If we have no valid template throw error, otherwise cache the template
+ if not self.template then
+ error("Failed to load template '" .. name .. "'.\n" ..
+ "Error while parsing template '" .. sourcefile .. "':\n" ..
+ (err or "Unknown syntax error"))
+ else
+ self.cache[name] = self.template
+ end
+ end
+end
+
+
+-- Renders a template
+function Template.render(self, scope)
+ scope = scope or getfenv(2)
+
+ -- Put our predefined objects in the scope of the template
+ setfenv(self.template, setmetatable({}, {__index =
+ function(tbl, key)
+ return rawget(tbl, key) or self.viewns[key] or scope[key]
+ end}))
+
+ -- Now finally render the thing
+ local stat, err = util.copcall(self.template)
+ if not stat then
+ error("Failed to execute template '" .. self.name .. "'.\n" ..
+ "A runtime error occured: " .. tostring(err or "(nil)"))
+ end
+end
--- /dev/null
+<% export("cbi_apply_xhr", function(id, configs, redirect) -%>
+<fieldset class="cbi-section" id="cbi-apply-<%=id%>">
+ <legend><%:Applying changes%></legend>
+ <script type="text/javascript">//<![CDATA[
+ var apply_xhr = new XHR();
+
+ apply_xhr.get('<%=luci.dispatcher.build_url("servicectl", "restart", table.concat(configs, ","))%>', null,
+ function() {
+ var checkfinish = function() {
+ apply_xhr.get('<%=luci.dispatcher.build_url("servicectl", "status")%>', null,
+ function(x) {
+ if( x.responseText == 'finish' )
+ {
+ var e = document.getElementById('cbi-apply-<%=id%>-status');
+ if( e )
+ {
+ e.innerHTML = '<%:Configuration applied.%>';
+ window.setTimeout(function() {
+ e.parentNode.style.display = 'none';
+ <% if redirect then %>location.href='<%=redirect%>';<% end %>
+ }, 1000);
+ }
+ }
+ else
+ {
+ var e = document.getElementById('cbi-apply-<%=id%>-status');
+ if( e && x.responseText ) e.innerHTML = x.responseText;
+
+ window.setTimeout(checkfinish, 1000);
+ }
+ }
+ );
+ }
+
+ window.setTimeout(checkfinish, 1000);
+ }
+ );
+ //]]></script>
+
+ <img src="<%=resource%>/icons/loading.gif" alt="<%:Loading%>" style="vertical-align:middle" />
+ <span id="cbi-apply-<%=id%>-status"><%:Waiting for changes to be applied...%></span>
+</fieldset>
+<%- end) %>
--- /dev/null
+<% local v = self:cfgvalue(section) -%>
+<%+cbi/valueheader%>
+ <input class="cbi-input-text" type="text"<%= attr("value", v) .. attr("name", cbid) .. attr("id", cbid) %> />
+ <script type="text/javascript">
+cbi_browser_init('<%=cbid%>', '<%=resource%>', '<%=luci.dispatcher.build_url("admin", "filebrowser")%>'<%=self.default_path and ", '"..self.default_path.."'"%>);
+ </script>
+<%+cbi/valuefooter%>
--- /dev/null
+<%+cbi/valueheader%>
+ <% if self:cfgvalue(section) ~= false then %>
+ <input class="cbi-button cbi-input-<%=self.inputstyle or "button" %>" type="submit"<%= attr("name", cbid) .. attr("id", cbid) .. attr("value", self.inputtitle or self.title)%> />
+ <% else %>
+ -
+ <% end %>
+<%+cbi/valuefooter%>
--- /dev/null
+</div>
+<div id="cbip-<%=self.config.."-"..section.."-"..self.option%>"></div>
+</td>
+
+<% if #self.deps > 0 then -%>
+ <script type="text/javascript">
+ <% for j, d in ipairs(self.deps) do -%>
+ cbi_d_add("cbi-<%=self.config.."-"..section.."-"..self.option..d.add%>", {
+ <%-
+ for k,v in pairs(d.deps) do
+ -%>
+ <%-=string.format('"cbid.%s.%s.%s"', self.config, section, k) .. ":" .. string.format("%q", v)-%>
+ <%-if next(d.deps, k) then-%>,<%-end-%>
+ <%-
+ end
+ -%>
+ }, "cbip-<%=self.config.."-"..section.."-"..self.option%>");
+ <%- end %>
+ </script>
+<%- end %>
--- /dev/null
+<td class="cbi-value-field<% if self.error and self.error[section] then %> cbi-value-error<% end %>">
+<div id="cbi-<%=self.config.."-"..section.."-"..self.option%>">
--- /dev/null
+<%- self:render_children() %>
--- /dev/null
+<%- self.active:render() %>
+ <div class="cbi-page-actions">
+ <input type="hidden" name="cbi.delg.current" value="<%=self.current%>" />
+<% for _, x in ipairs(self.chain) do %>
+ <input type="hidden" name="cbi.delg.path" value="<%=x%>" />
+<% end %>
+<% if not self.disallow_pageactions then %>
+<% if self.allow_finish and not self:get_next(self.current) then %>
+ <input class="cbi-button cbi-button-finish" type="submit" value="<%:Finish%>" />
+<% elseif self:get_next(self.current) then %>
+ <input class="cbi-button cbi-button-next" type="submit" value="<%:Next »%>" />
+<% end %>
+<% if self.allow_cancel then %>
+ <input class="cbi-button cbi-button-cancel" type="submit" name="cbi.cancel" value="<%:Cancel%>" />
+<% end %>
+<% if self.allow_reset then %>
+ <input class="cbi-button cbi-button-reset" type="reset" value="<%:Reset%>" />
+<% end %>
+<% if self.allow_back and self:get_prev(self.current) then %>
+ <input class="cbi-button cbi-button-back" type="submit" name="cbi.delg.back" value="<%:« Back%>" />
+<% end %>
+<% end %>
+ <script type="text/javascript">cbi_d_update();</script>
+ </div>
--- /dev/null
+<%+cbi/valueheader%>
+<% if self.href then %><a href="<%=self.href%>"><% end -%>
+ <%
+ local val = self:cfgvalue(section) or self.default or ""
+ if not self.rawhtml then
+ write(pcdata(val))
+ else
+ write(val)
+ end
+ %>
+<%- if self.href then %></a><%end%>
+<input type="hidden" id="<%=cbid%>" value="<%=pcdata(self:cfgvalue(section) or self.default or "")%>" />
+<%+cbi/valuefooter%>
--- /dev/null
+<%+cbi/valueheader%>
+<div>
+<%
+ local vals = self:cfgvalue(section) or {}
+ for i=1, #vals + 1 do
+ local val = vals[i]
+ if (val and #val > 0) or (i == 1) then
+%>
+ <input class="cbi-input-text" value="<%=pcdata(val)%>" onchange="cbi_d_update(this.id)" type="text"<%=
+ attr("id", cbid .. "." .. i) .. attr("name", cbid) .. ifattr(self.size, "size") ..
+ ifattr(i == 1 and self.placeholder, "placeholder", self.placeholder)
+ %> /><br />
+<% end end %>
+</div>
+<script type="text/javascript">
+cbi_dynlist_init(
+ '<%=cbid%>', '<%=resource%>', '<%=self.datatype%>',
+ <%=tostring(self.optional or self.rmempty)%>
+ <%- if #self.keylist > 0 then -%>, [{
+ <%- for i, k in ipairs(self.keylist) do -%>
+ <%-=string.format("%q", k) .. ":" .. string.format("%q", self.vallist[i])-%>
+ <%-if i<#self.keylist then-%>,<%-end-%>
+ <%- end -%>
+ }, '<%: -- custom -- %>']<% end -%>);
+</script>
+<%+cbi/valuefooter%>
--- /dev/null
+<?xml version="1.0" encoding="UTF-8"?>
+<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Strict//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-strict.dtd">
+<html xmlns="http://www.w3.org/1999/xhtml" xml:lang="en" lang="en">
+<head>
+ <title>Filebrowser - LuCI</title>
+ <style type="text/css">
+ #path, #listing {
+ font-size: 85%;
+ }
+
+ ul {
+ padding-left: 0;
+ list-style-type: none;
+ }
+
+ li img {
+ vertical-align: bottom;
+ margin-right: 0.2em;
+ }
+ </style>
+
+ <script type="text/javascript">
+ function callback(path) {
+ if( window.opener ) {
+ var input = window.opener.document.getElementById('<%=luci.http.formvalue('field')%>');
+ if( input ) {
+ input.value = path;
+ window.close();
+ }
+ }
+ }
+ </script>
+</head>
+<body>
+ <%
+ require("nixio.fs")
+ require("nixio.util")
+ require("luci.http")
+ require("luci.dispatcher")
+
+ local field = luci.http.formvalue('field')
+ local request = luci.dispatcher.context.args
+ local path = { '' }
+
+ for i = 1, #request do
+ if request[i] ~= '..' and #request[i] > 0 then
+ path[#path+1] = request[i]
+ end
+ end
+
+ local filepath = table.concat( path, '/' )
+ local filestat = nixio.fs.stat( filepath )
+ local baseurl = luci.dispatcher.build_url('admin', 'filebrowser')
+
+ if filestat and filestat.type == "reg" then
+ table.remove( path, #path )
+ filepath = table.concat( path, '/' ) .. '/'
+ elseif not ( filestat and filestat.type == "dir" ) then
+ path = { '' }
+ filepath = '/'
+ else
+ filepath = filepath .. '/'
+ end
+
+ local entries = nixio.util.consume((nixio.fs.dir(filepath)))
+ -%>
+ <div id="path">
+ Location:
+ <% for i, dir in ipairs(path) do %>
+ <% if i == 1 then %>
+ <a href="<%=baseurl%>?field=<%=field%>">(root)</a>
+ <% elseif next(path, i) then %>
+ <% baseurl = baseurl .. '/' .. dir %>
+ / <a href="<%=baseurl%>?field=<%=field%>"><%=dir%></a>
+ <% else %>
+ <% baseurl = baseurl .. '/' .. dir %>
+ / <%=dir%>
+ <% end %>
+ <% end %>
+ </div>
+
+ <hr />
+
+ <div id="listing">
+ <ul>
+ <% for _, e in luci.util.vspairs(entries) do
+ local stat = nixio.fs.stat(filepath..e)
+ if stat and stat.type == 'dir' then
+ -%>
+ <li class="dir">
+ <img src="<%=resource%>/cbi/folder.gif" alt="<%:Directory%>" />
+ <a href="<%=baseurl%>/<%=e%>?field=<%=field%>"><%=e%>/</a>
+ </li>
+ <% end end -%>
+
+ <% for _, e in luci.util.vspairs(entries) do
+ local stat = nixio.fs.stat(filepath..e)
+ if stat and stat.type ~= 'dir' then
+ -%>
+ <li class="file">
+ <img src="<%=resource%>/cbi/file.gif" alt="<%:File%>" />
+ <a href="#" onclick="callback('<%=filepath..e%>')"><%=e%></a>
+ </li>
+ <% end end -%>
+ </ul>
+ </div>
+</body>
+</html>
--- /dev/null
+<%+cbi/valueheader%>
+
+<%-
+ local utl = require "luci.util"
+ local fwm = require "luci.model.firewall".init()
+ local nwm = require "luci.model.network".init()
+
+ local zone, fwd, fz
+ local value = self:formvalue(section)
+ if not value or value == "-" then
+ value = self:cfgvalue(section) or self.default
+ end
+
+ local def = fwm:get_defaults()
+ local zone = fwm:get_zone(value)
+ local empty = true
+-%>
+
+<% if zone then %>
+<div style="white-space:nowrap">
+ <label class="zonebadge" style="background-color:<%=zone:get_color()%>">
+ <strong><%=zone:name()%>:</strong>
+ <%-
+ local zempty = true
+ for _, net in ipairs(zone:get_networks()) do
+ net = nwm:get_network(net)
+ if net then
+ zempty = false
+ -%>
+ <span class="ifacebadge<% if net:name() == self.network then %> ifacebadge-active<% end %>"><%=net:name()%>:
+ <%
+ local nempty = true
+ for _, iface in ipairs(net:is_bridge() and net:get_interfaces() or { net:get_interface() }) do
+ nempty = false
+ %>
+ <img<%=attr("title", iface:get_i18n())%> style="width:16px; height:16px; vertical-align:middle" src="<%=resource%>/icons/<%=iface:type()%><%=iface:is_up() and "" or "_disabled"%>.png" />
+ <% end %>
+ <% if nempty then %><em><%:(empty)%></em><% end %>
+ </span>
+ <%- end end -%>
+ <%- if zempty then %><em><%:(empty)%></em><% end -%>
+ </label>
+  ⇒ 
+ <% for _, fwd in ipairs(zone:get_forwardings_by("src")) do
+ fz = fwd:dest_zone()
+ empty = false %>
+ <label class="zonebadge" style="background-color:<%=fz:get_color()%>">
+ <strong><%=fz:name()%></strong>
+ </label> 
+ <% end %>
+ <% if empty then %>
+ <label class="zonebadge zonebadge-empty">
+ <strong><%=zone:forward():upper()%></strong>
+ </label>
+ <% end %>
+</div>
+<% end %>
+
+<%+cbi/valuefooter%>
--- /dev/null
+<%+cbi/valueheader%>
+
+<%-
+ local utl = require "luci.util"
+ local fwm = require "luci.model.firewall".init()
+ local nwm = require "luci.model.network".init()
+
+ local zone, net, iface
+ local zones = fwm:get_zones()
+ local value = self:formvalue(section)
+ if not value or value == "-" then
+ value = self:cfgvalue(section) or self.default
+ end
+
+ local selected = false
+ local checked = { }
+
+ for value in utl.imatch(value) do
+ checked[value] = true
+ end
+
+ if not next(checked) then
+ checked[""] = true
+ end
+-%>
+
+<ul style="margin:0; list-style-type:none; text-align:left">
+ <% if self.allowlocal then %>
+ <li style="padding:0.5em">
+ <input class="cbi-input-radio" onclick="cbi_d_update(this.id)" onchange="cbi_d_update(this.id)"<%=attr("type", self.widget or "radio") .. attr("id", cbid .. "_empty") .. attr("name", cbid) .. attr("value", "") .. ifattr(checked[""], "checked", "checked")%> />  
+ <label<%=attr("for", cbid .. "_empty")%> style="background-color:<%=fwm.zone.get_color()%>" class="zonebadge">
+ <strong><%:Device%></strong>
+ <% if self.allowany and self.allowlocal then %>(<%:input%>)<% end %>
+ </label>
+ </li>
+ <% end %>
+ <% if self.allowany then %>
+ <li style="padding:0.5em">
+ <input class="cbi-input-radio" onclick="cbi_d_update(this.id)" onchange="cbi_d_update(this.id)"<%=attr("type", self.widget or "radio") .. attr("id", cbid .. "_any") .. attr("name", cbid) .. attr("value", "*") .. ifattr(checked["*"], "checked", "checked")%> />  
+ <label<%=attr("for", cbid .. "_any")%> style="background-color:<%=fwm.zone.get_color()%>" class="zonebadge">
+ <strong><%:Any zone%></strong>
+ <% if self.allowany and self.allowlocal then %>(<%:forward%>)<% end %>
+ </label>
+ </li>
+ <% end %>
+ <%
+ for _, zone in utl.spairs(zones, function(a,b) return (zones[a]:name() < zones[b]:name()) end) do
+ if zone:name() ~= self.exclude then
+ selected = selected or (value == zone:name())
+ %>
+ <li style="padding:0.5em">
+ <input class="cbi-input-radio" onclick="cbi_d_update(this.id)" onchange="cbi_d_update(this.id)"<%=attr("type", self.widget or "radio") .. attr("id", cbid .. "." .. zone:name()) .. attr("name", cbid) .. attr("value", zone:name()) .. ifattr(checked[zone:name()], "checked", "checked")%> />  
+ <label<%=attr("for", cbid .. "." .. zone:name())%> style="background-color:<%=zone:get_color()%>" class="zonebadge">
+ <strong><%=zone:name()%>:</strong>
+ <%
+ local zempty = true
+ for _, net in ipairs(zone:get_networks()) do
+ net = nwm:get_network(net)
+ if net then
+ zempty = false
+ %>
+ <span class="ifacebadge<% if net:name() == self.network then %> ifacebadge-active<% end %>"><%=net:name()%>:
+ <%
+ local nempty = true
+ for _, iface in ipairs(net:is_bridge() and net:get_interfaces() or { net:get_interface() }) do
+ nempty = false
+ %>
+ <img<%=attr("title", iface:get_i18n())%> style="width:16px; height:16px; vertical-align:middle" src="<%=resource%>/icons/<%=iface:type()%><%=iface:is_up() and "" or "_disabled"%>.png" />
+ <% end %>
+ <% if nempty then %><em><%:(empty)%></em><% end %>
+ </span>
+ <% end end %>
+ <% if zempty then %><em><%:(empty)%></em><% end %>
+ </label>
+ </li>
+ <% end end %>
+
+ <% if self.widget ~= "checkbox" and not self.nocreate then %>
+ <li style="padding:0.5em">
+ <input class="cbi-input-radio" onclick="cbi_d_update(this.id)" onchange="cbi_d_update(this.id)" type="radio"<%=attr("id", cbid .. "_new") .. attr("name", cbid) .. attr("value", "-") .. ifattr(not selected, "checked", "checked")%> />  
+ <div onclick="document.getElementById('<%=cbid%>_new').checked=true" class="zonebadge" style="background-color:<%=fwm.zone.get_color()%>">
+ <em><%:unspecified -or- create:%> </em>
+ <input type="text"<%=attr("name", cbid .. ".newzone") .. ifattr(not selected, "value", luci.http.formvalue(cbid .. ".newzone") or self.default)%> onfocus="document.getElementById('<%=cbid%>_new').checked=true" />
+ </div>
+ </li>
+ <% end %>
+</ul>
+
+<%+cbi/valuefooter%>
--- /dev/null
+ <%- if pageaction then -%>
+ <div class="cbi-page-actions">
+ <% if redirect then %>
+ <div style="float:left">
+ <input class="cbi-button cbi-button-link" type="button" value="<%:Back to Overview%>" onclick="location.href='<%=pcdata(redirect)%>'" />
+ </div>
+ <% end %>
+
+ <% if flow.skip then %>
+ <input class="cbi-button cbi-button-skip" type="submit" name="cbi.skip" value="<%:Skip%>" />
+ <% end %>
+ <% if not autoapply and not flow.hideapplybtn then %>
+ <input class="cbi-button cbi-button-apply" type="submit" name="cbi.apply" value="<%:Save & Apply%>" />
+ <% end %>
+ <% if not flow.hidesavebtn then %>
+ <input class="cbi-button cbi-button-save" type="submit" value="<%:Save%>" />
+ <% end %>
+ <% if not flow.hideresetbtn then %>
+ <input class="cbi-button cbi-button-reset" type="reset" value="<%:Reset%>" />
+ <% end %>
+
+ <script type="text/javascript">cbi_d_update();</script>
+ </div>
+ <%- end -%>
+</form>
+<%+footer%>
--- /dev/null
+ <% if self.description and #self.description > 0 then -%>
+ <% if not luci.util.instanceof(self, luci.cbi.DynamicList) and (not luci.util.instanceof(self, luci.cbi.Flag) or self.orientation == "horizontal") then -%>
+ <br />
+ <%- end %>
+ <div class="cbi-value-description">
+ <span class="cbi-value-helpicon"><img src="<%=resource%>/cbi/help.gif" alt="<%:help%>" /></span>
+ <%=self.description%>
+ </div>
+ <%- end %>
+ <%- if self.title and #self.title > 0 then -%>
+ </div>
+ <%- end -%>
+</div>
+
+
+<% if #self.deps > 0 or #self.subdeps > 0 then -%>
+ <script type="text/javascript" id="cbip-<%=self.config.."-"..section.."-"..self.option%>">
+ <% for j, d in ipairs(self.subdeps) do -%>
+ cbi_d_add("cbi-<%=self.config.."-"..section.."-"..self.option..d.add%>", {
+ <%-
+ for k,v in pairs(d.deps) do
+ local depk
+ if k:find("!", 1, true) then
+ depk = string.format('"%s"', k)
+ elseif k:find(".", 1, true) then
+ depk = string.format('"cbid.%s"', k)
+ else
+ depk = string.format('"cbid.%s.%s.%s"', self.config, section, k)
+ end
+ -%>
+ <%-= depk .. ":" .. string.format("%q", v)-%>
+ <%-if next(d.deps, k) then-%>,<%-end-%>
+ <%-
+ end
+ -%>
+ }, "cbip-<%=self.config.."-"..section.."-"..self.option..d.add%>");
+ <%- end %>
+ <% for j, d in ipairs(self.deps) do -%>
+ cbi_d_add("cbi-<%=self.config.."-"..section.."-"..self.option..d.add%>", {
+ <%-
+ for k,v in pairs(d.deps) do
+ local depk
+ if k:find("!", 1, true) then
+ depk = string.format('"%s"', k)
+ elseif k:find(".", 1, true) then
+ depk = string.format('"cbid.%s"', k)
+ else
+ depk = string.format('"cbid.%s.%s.%s"', self.config, section, k)
+ end
+ -%>
+ <%-= depk .. ":" .. string.format("%q", v)-%>
+ <%-if next(d.deps, k) then-%>,<%-end-%>
+ <%-
+ end
+ -%>
+ }, "cbip-<%=self.config.."-"..section.."-"..self.option..d.add%>");
+ <%- end %>
+ </script>
+<%- end %>
--- /dev/null
+<div class="cbi-value<% if self.error and self.error[section] then %> cbi-value-error<% end %><% if self.last_child then %> cbi-value-last<% end %>" id="cbi-<%=self.config.."-"..section.."-"..self.option%>">
+ <%- if self.title and #self.title > 0 then -%>
+ <label class="cbi-value-title"<%= attr("for", cbid) %>>
+ <%- if self.titleref then -%><a title="<%=self.titledesc or translate('Go to relevant configuration page')%>" class="cbi-title-ref" href="<%=self.titleref%>"><%- end -%>
+ <%-=self.title-%>
+ <%- if self.titleref then -%></a><%- end -%>
+ </label>
+ <div class="cbi-value-field">
+ <%- end -%>
--- /dev/null
+<%+cbi/valueheader%>
+ <input type="hidden" value="1"<%=
+ attr("name", "cbi.cbe." .. self.config .. "." .. section .. "." .. self.option)
+ %> />
+ <input class="cbi-input-checkbox" onclick="cbi_d_update(this.id)" onchange="cbi_d_update(this.id)" type="checkbox"<%=
+ attr("id", cbid) .. attr("name", cbid) .. attr("value", self.enabled or 1) ..
+ ifattr((self:cfgvalue(section) or self.default) == self.enabled, "checked", "checked")
+ %> />
+<%+cbi/valuefooter%>
--- /dev/null
+<%+header%>
+<form method="post" name="cbi" action="<%=REQUEST_URI%>" enctype="multipart/form-data" onreset="return cbi_validate_reset(this)" onsubmit="return cbi_validate_form(this, '<%:Some fields are invalid, cannot save values!%>')">
+ <div>
+ <script type="text/javascript" src="<%=resource%>/cbi.js"></script>
+ <input type="hidden" name="cbi.submit" value="1" />
+ <input type="submit" value="<%:Save%>" class="hidden" />
+ </div>
--- /dev/null
+<%+cbi/valueheader%>
+<% if self.widget == "select" then %>
+ <select class="cbi-input-select" onchange="cbi_d_update(this.id)"<%= attr("id", cbid) .. attr("name", cbid) .. ifattr(self.size, "size") %>>
+ <% for i, key in pairs(self.keylist) do -%>
+ <option id="cbi-<%=self.config.."-"..section.."-"..self.option.."-"..key%>"<%= attr("value", key) .. ifattr(tostring(self:cfgvalue(section) or self.default) == key, "selected", "selected") %>><%=striptags(self.vallist[i])%></option>
+ <%- end %>
+ </select>
+<% elseif self.widget == "radio" then
+ local c = 0
+ for i, key in pairs(self.keylist) do
+ c = c + 1
+%>
+ <input class="cbi-input-radio" onclick="cbi_d_update(this.id)" onchange="cbi_d_update(this.id)" type="radio"<%= attr("id", cbid..c) .. attr("name", cbid) .. attr("value", key) .. ifattr((self:cfgvalue(section) or self.default) == key, "checked", "checked") %> />
+ <label<%= attr("for", cbid..c) %>><%=self.vallist[i]%></label>
+<% if c == self.size then c = 0 %><% if self.orientation == "horizontal" then %> <% else %><br /><% end %>
+<% end end %>
+<% end %>
+<%+cbi/valuefooter%>
--- /dev/null
+<%- if firstmap and messages then local msg; for _, msg in ipairs(messages) do -%>
+ <div class="errorbox"><%=pcdata(msg)%></div>
+<%- end end -%>
+
+<%-+cbi/apply_xhr-%>
+
+<div class="cbi-map" id="cbi-<%=self.config%>">
+ <% if self.title and #self.title > 0 then %><h2><a id="content" name="content"><%=self.title%></a></h2><% end %>
+ <% if self.description and #self.description > 0 then %><div class="cbi-map-descr"><%=self.description%></div><% end %>
+ <%- if firstmap and applymap then cbi_apply_xhr(self.config, parsechain, redirect) end -%>
+ <%- self:render_children() %>
+ <br />
+</div>
--- /dev/null
+<% local v = self:valuelist(section) or {} -%>
+<%+cbi/valueheader%>
+<% if self.widget == "select" then %>
+ <select class="cbi-input-select" multiple="multiple" onclick="cbi_d_update(this.id)" onchange="cbi_d_update(this.id)"<%= attr("name", cbid) .. ifattr(self.size, "size") %>>
+ <% for i, key in pairs(self.keylist) do -%>
+ <option<%= attr("value", key) .. ifattr(luci.util.contains(v, key), "selected", "selected") %>><%=striptags(self.vallist[i])%></option>
+ <%- end %>
+ </select>
+<% elseif self.widget == "checkbox" then
+ local c = 0;
+ for i, key in pairs(self.keylist) do
+ c = c + 1
+%>
+ <input class="cbi-input-checkbox" type="checkbox" onclick="cbi_d_update(this.id)" onchange="cbi_d_update(this.id)"<%= attr("id", cbid..c) .. attr("name", cbid) .. attr("value", key) .. ifattr(luci.util.contains(v, key), "checked", "checked") %> />
+ <label<%= attr("for", cbid..c) %>><%=self.vallist[i]%></label><br />
+<% if c == self.size then c = 0 %><br />
+<% end end %>
+<% end %>
+<%+cbi/valuefooter%>
--- /dev/null
+<%+cbi/valueheader%>
+
+<%-
+ local utl = require "luci.util"
+ local net = require "luci.model.network".init()
+ local cbeid = luci.cbi.FEXIST_PREFIX .. self.config .. "." .. section .. "." .. self.option
+
+ local iface
+ local ifaces = net:get_interfaces()
+ local value
+
+ if self.map:formvalue(cbeid) == "1" then
+ value = self:formvalue(section) or self.default or ""
+ else
+ value = self:cfgvalue(section) or self.default
+ end
+
+ local checked = { }
+
+ if value then
+ for value in utl.imatch(value) do
+ checked[value] = true
+ end
+ else
+ local n = self.network and net:get_network(self.network)
+ if n then
+ local i
+ for _, i in ipairs(n:get_interfaces() or { n:get_interface() }) do
+ checked[i:name()] = true
+ end
+ end
+ end
+-%>
+
+<input type="hidden" name="<%=cbeid%>" value="1" />
+<ul style="margin:0; list-style-type:none">
+ <% for _, iface in ipairs(ifaces) do
+ local link = iface:adminlink()
+ if (not self.nobridges or not iface:is_bridge()) and
+ (not self.noinactive or iface:is_up()) and
+ iface:name() ~= self.exclude
+ then %>
+ <li>
+ <input class="cbi-input-<%=self.widget or "radio"%>" onclick="cbi_d_update(this.id)" onchange="cbi_d_update(this.id)"<%=
+ attr("type", self.widget or "radio") ..
+ attr("id", cbid .. "." .. iface:name()) ..
+ attr("name", cbid) .. attr("value", iface:name()) ..
+ ifattr(checked[iface:name()], "checked", "checked")
+ %> />  
+ <label<%=attr("for", cbid .. "." .. iface:name())%>>
+ <% if link then -%><a href="<%=link%>"><% end -%>
+ <img<%=attr("title", iface:get_i18n())%> style="width:16px; height:16px; vertical-align:middle" src="<%=resource%>/icons/<%=iface:type()%><%=iface:is_up() and "" or "_disabled"%>.png" />
+ <% if link then -%></a><% end -%>
+ <%=pcdata(iface:get_i18n())%>
+ <% local ns = iface:get_networks(); if #ns > 0 then %>(
+ <%- local i, n; for i, n in ipairs(ns) do -%>
+ <%-= (i>1) and ', ' -%>
+ <a href="<%=n:adminlink()%>"><%=n:name()%></a>
+ <%- end -%>
+ )<% end %>
+ </label>
+ </li>
+ <% end end %>
+ <% if not self.nocreate then %>
+ <li>
+ <input class="cbi-input-<%=self.widget or "radio"%>" onclick="cbi_d_update(this.id)" onchange="cbi_d_update(this.id)"<%=
+ attr("type", self.widget or "radio") ..
+ attr("id", cbid .. "_custom") ..
+ attr("name", cbid) ..
+ attr("value", " ")
+ %> />  
+ <label<%=attr("for", cbid .. "_custom")%>>
+ <img title="<%:Custom Interface%>" style="width:16px; height:16px; vertical-align:middle" src="<%=resource%>/icons/ethernet_disabled.png" />
+ <%:Custom Interface%>:
+ </label>
+ <input type="text" style="width:50px" onfocus="document.getElementById('<%=cbid%>_custom').checked=true" onblur="var x=document.getElementById('<%=cbid%>_custom'); x.value=this.value; x.checked=true" />
+ </li>
+ <% end %>
+</ul>
+
+<%+cbi/valuefooter%>
--- /dev/null
+<%+cbi/valueheader%>
+
+<%-
+ local value = self:formvalue(section)
+ if not value or value == "-" then
+ value = self:cfgvalue(section) or self.default
+ end
+
+ local nwm = require "luci.model.network".init()
+ local net = nwm:get_network(value)
+-%>
+
+<% if net then %>
+<span class="ifacebadge"><%=net:name()%>:
+ <%
+ local empty = true
+ for _, iface in ipairs(net:get_interfaces() or { net:get_interface() }) do
+ if not iface:is_bridge() then
+ empty = false
+ %>
+ <img<%=attr("title", iface:get_i18n())%> style="width:16px; height:16px; vertical-align:middle" src="<%=resource%>/icons/<%=iface:type()%><%=iface:is_up() and "" or "_disabled"%>.png" />
+ <% end end %>
+ <% if empty then %><em><%:(no interfaces attached)%></em><% end %>
+</span>
+<% end %>
+
+<%+cbi/valuefooter%>
--- /dev/null
+<%+cbi/valueheader%>
+
+<%-
+ local utl = require "luci.util"
+ local nwm = require "luci.model.network".init()
+
+ local net, iface
+ local networks = nwm:get_networks()
+ local value = self:formvalue(section)
+
+ self.cast = nil
+
+ if not value or value == "-" then
+ value = self:cfgvalue(section) or self.default
+ end
+
+ local checked = { }
+ for value in utl.imatch(value) do
+ checked[value] = true
+ end
+-%>
+
+<ul style="margin:0; list-style-type:none; text-align:left">
+ <% for _, net in ipairs(networks) do
+ if (net:name() ~= "loopback") and
+ (net:name() ~= self.exclude) and
+ (not self.novirtual or not net:is_virtual())
+ then %>
+ <li style="padding:0.25em 0">
+ <input class="cbi-input-<%=self.widget or "radio"%>" onclick="cbi_d_update(this.id)" onchange="cbi_d_update(this.id)"<%=
+ attr("type", self.widget or "radio") ..
+ attr("id", cbid .. "." .. net:name()) ..
+ attr("name", cbid) .. attr("value", net:name()) ..
+ ifattr(checked[net:name()], "checked", "checked")
+ %> />  
+ <label<%=attr("for", cbid .. "." .. net:name())%>>
+ <span class="ifacebadge"><%=net:name()%>:
+ <%
+ local empty = true
+ for _, iface in ipairs(net:is_bridge() and net:get_interfaces() or { net:get_interface() }) do
+ if not iface:is_bridge() then
+ empty = false
+ %>
+ <img<%=attr("title", iface:get_i18n())%> style="width:16px; height:16px; vertical-align:middle" src="<%=resource%>/icons/<%=iface:type()%><%=iface:is_up() and "" or "_disabled"%>.png" />
+ <% end end %>
+ <% if empty then %><em><%:(no interfaces attached)%></em><% end %>
+ </span>
+ </label>
+ </li>
+ <% end end %>
+
+ <% if not self.nocreate then %>
+ <li style="padding:0.25em 0">
+ <input class="cbi-input-<%=self.widget or "radio"%>" onclick="cbi_d_update(this.id)" onchange="cbi_d_update(this.id)"<%=attr("type", self.widget or "radio") .. attr("id", cbid .. "_new") .. attr("name", cbid) .. attr("value", "-") .. ifattr(not value and self.widget ~= "checkbox", "checked", "checked")%> />  
+ <div style="padding:0.5em; display:inline">
+ <label<%=attr("for", cbid .. "_new")%>><em>
+ <%- if self.widget == "checkbox" then -%>
+ <%:create:%>
+ <%- else -%>
+ <%:unspecified -or- create:%>
+ <%- end -%> </em></label>
+ <input style="width:6em" type="text"<%=attr("name", cbid .. ".newnet")%> onfocus="document.getElementById('<%=cbid%>_new').checked=true" />
+ </div>
+ </li>
+ <% elseif self.widget ~= "checkbox" and self.unspecified then %>
+ <li style="padding:0.25em 0">
+ <input class="cbi-input-<%=self.widget or "radio"%>" onclick="cbi_d_update(this.id)" onchange="cbi_d_update(this.id)"<%=
+ attr("type", self.widget or "radio") ..
+ attr("id", cbid .. "_uns") ..
+ attr("name", cbid) ..
+ attr("value", "") ..
+ ifattr(not value or #value == 0, "checked", "checked")
+ %> />  
+ <div style="padding:0.5em; display:inline">
+ <label<%=attr("for", cbid .. "_uns")%>><em><%:unspecified%></em></label>
+ </div>
+ </li>
+ <% end %>
+</ul>
+
+<%+cbi/valuefooter%>
--- /dev/null
+<% if self:cfgvalue(self.section) then section = self.section %>
+ <fieldset class="cbi-section" id="cbi-<%=self.config%>-<%=section%>">
+ <% if self.title and #self.title > 0 then -%>
+ <legend><%=self.title%></legend>
+ <%- end %>
+ <% if self.description and #self.description > 0 then -%>
+ <div class="cbi-section-descr"><%=self.description%></div>
+ <%- end %>
+ <% if self.addremove then -%>
+ <div class="cbi-section-remove right">
+ <input type="submit" name="cbi.rns.<%=self.config%>.<%=section%>" value="<%:Delete%>" />
+ </div>
+ <%- end %>
+ <%+cbi/tabmenu%>
+ <div class="cbi-section-node<% if self.tabs then %> cbi-section-node-tabbed<% end %>" id="cbi-<%=self.config%>-<%=section%>">
+ <%+cbi/ucisection%>
+ </div>
+ <br />
+ </fieldset>
+<% elseif self.addremove then %>
+ <% if self.template_addremove then include(self.template_addremove) else -%>
+ <fieldset class="cbi-section" id="cbi-<%=self.config%>-<%=self.section%>">
+ <% if self.title and #self.title > 0 then -%>
+ <legend><%=self.title%></legend>
+ <%- end %>
+ <div class="cbi-section-descr"><%=self.description%></div>
+ <input type="submit" class="cbi-button-add" name="cbi.cns.<%=self.config%>.<%=self.section%>" value="<%:Add%>" />
+ </fieldset>
+ <%- end %>
+<% end %>
+<!-- /nsection -->
--- /dev/null
+<fieldset class="cbi-section">
+ <% if self.title and #self.title > 0 then -%>
+ <legend><%=self.title%></legend>
+ <%- end %>
+ <% if self.description and #self.description > 0 then -%>
+ <div class="cbi-section-descr"><%=self.description%></div>
+ <%- end %>
+ <div class="cbi-section-node" id="cbi-<%=self.config%>-<%=tostring(self):sub(8)%>">
+ <div>
+ <% self:render_children(1, scope or {}) %>
+ </div>
+ <% if self.error and self.error[1] then -%>
+ <div class="cbi-section-error">
+ <ul><% for _, e in ipairs(self.error[1]) do -%>
+ <li>
+ <%- if e == "invalid" then -%>
+ <%:One or more fields contain invalid values!%>
+ <%- elseif e == "missing" then -%>
+ <%:One or more required fields have no value!%>
+ <%- else -%>
+ <%=pcdata(e)%>
+ <%- end -%>
+ </li>
+ <%- end %></ul>
+ </div>
+ <%- end %>
+ </div>
+ <br />
+</fieldset>
+<%-
+ if type(self.hidden) == "table" then
+ for k, v in pairs(self.hidden) do
+-%>
+ <input type="hidden" id="<%=k%>" name="<%=k%>" value="<%=pcdata(v)%>" />
+<%-
+ end
+ end
+%>
--- /dev/null
+<% if not self.embedded then %>
+<form method="post" enctype="multipart/form-data" action="<%=REQUEST_URI%>">
+ <div>
+ <script type="text/javascript" src="<%=resource%>/cbi.js"></script>
+ <input type="hidden" name="cbi.submit" value="1" />
+ </div>
+<% end %>
+ <div class="cbi-map" id="cbi-<%=self.config%>">
+ <% if self.title and #self.title > 0 then %><h2><a id="content" name="content"><%=self.title%></a></h2><% end %>
+ <% if self.description and #self.description > 0 then %><div class="cbi-map-descr"><%=self.description%></div><% end %>
+ <% self:render_children() %>
+ <br />
+ </div>
+<%- if self.message then %>
+ <div><%=self.message%></div>
+<%- end %>
+<%- if self.errmessage then %>
+ <div class="error"><%=self.errmessage%></div>
+<%- end %>
+<% if not self.embedded then %>
+ <div class="cbi-page-actions">
+<%-
+ if type(self.hidden) == "table" then
+ for k, v in pairs(self.hidden) do
+-%>
+ <input type="hidden" id="<%=k%>" name="<%=k%>" value="<%=pcdata(v)%>" />
+<%-
+ end
+ end
+%>
+<% if redirect then %>
+ <div style="float:left">
+ <input class="cbi-button cbi-button-link" type="button" value="<%:Back to Overview%>" onclick="location.href='<%=pcdata(redirect)%>'" />
+ </div>
+<% end %>
+<%- if self.flow and self.flow.skip then %>
+ <input class="cbi-button cbi-button-skip" type="submit" name="cbi.skip" value="<%:Skip%>" />
+<% end %>
+<%- if self.submit ~= false then %>
+ <input class="cbi-button cbi-button-save" type="submit" value="
+ <%- if not self.submit then -%><%-:Submit-%><%-else-%><%=self.submit%><%end-%>
+ " />
+<% end %>
+<%- if self.reset ~= false then %>
+ <input class="cbi-button cbi-button-reset" type="reset" value="
+ <%- if not self.reset then -%><%-:Reset-%><%-else-%><%=self.reset%><%end-%>
+ " />
+<% end %>
+<%- if self.cancel ~= false and self.on_cancel then %>
+ <input class="cbi-button cbi-button-reset" type="submit" name="cbi.cancel" value="
+ <%- if not self.cancel then -%><%-:Cancel-%><%-else-%><%=self.cancel%><%end-%>
+ " />
+<% end %>
+ <script type="text/javascript">cbi_d_update();</script>
+ </div>
+</form>
+<% end %>
--- /dev/null
+<% for tab, data in pairs(self.tabs) do %>
+ <div class="cbi-tabcontainer" id="container.<%=self.config%>.<%=section%>.<%=tab%>"<% if tab ~= self.selected_tab then %> style="display:none"<% end %>>
+ <% if data.description then %><div class="cbi-tab-descr"><%=data.description%></div><% end %>
+ <% self:render_tab(tab, section, scope or {}) %>
+ </div>
+ <script type="text/javascript">cbi_t_add('<%=self.config%>.<%=section%>', '<%=tab%>')</script>
+<% end %>
--- /dev/null
+<%- if self.tabs then %>
+ <ul class="cbi-tabmenu">
+ <%- self.selected_tab = luci.http.formvalue("tab." .. self.config .. "." .. section) %>
+ <%- for _, tab in ipairs(self.tab_names) do if #self.tabs[tab].childs > 0 then %>
+ <script type="text/javascript">cbi_c['container.<%=self.config%>.<%=section%>.<%=tab%>'] = <%=#self.tabs[tab].childs%>;</script>
+ <%- if not self.selected_tab then self.selected_tab = tab end %>
+ <li id="tab.<%=self.config%>.<%=section%>.<%=tab%>" class="cbi-tab<%=(tab == self.selected_tab) and '' or '-disabled'%>">
+ <a onclick="this.blur(); return cbi_t_switch('<%=self.config%>.<%=section%>', '<%=tab%>')" href="<%=REQUEST_URI%>?tab.<%=self.config%>.<%=section%>=<%=tab%>"><%=self.tabs[tab].title%></a>
+ <% if tab == self.selected_tab then %><input type="hidden" id="tab.<%=self.config%>.<%=section%>" name="tab.<%=self.config%>.<%=section%>" value="<%=tab%>" /><% end %>
+ </li>
+ <% end end -%>
+ </ul>
+<% end -%>
--- /dev/null
+<%-
+local rowcnt = 1
+function rowstyle()
+ rowcnt = rowcnt + 1
+ return (rowcnt % 2) + 1
+end
+
+function width(o)
+ if o.width then
+ if type(o.width) == 'number' then
+ return ' style="width:%dpx"' % o.width
+ end
+ return ' style="width:%s"' % o.width
+ end
+ return ''
+end
+-%>
+
+<!-- tblsection -->
+<fieldset class="cbi-section" id="cbi-<%=self.config%>-<%=self.sectiontype%>">
+ <% if self.title and #self.title > 0 then -%>
+ <legend><%=self.title%></legend>
+ <%- end %>
+ <%- if self.sortable then -%>
+ <input type="hidden" id="cbi.sts.<%=self.config%>.<%=self.sectiontype%>" name="cbi.sts.<%=self.config%>.<%=self.sectiontype%>" value="" />
+ <%- end -%>
+ <div class="cbi-section-descr"><%=self.description%></div>
+ <div class="cbi-section-node">
+ <%- local count = 0 -%>
+ <table class="cbi-section-table">
+ <tr class="cbi-section-table-titles">
+ <%- if not self.anonymous then -%>
+ <%- if self.sectionhead then -%>
+ <th class="cbi-section-table-cell"><%=self.sectionhead%></th>
+ <%- else -%>
+ <th> </th>
+ <%- end -%>
+ <%- end -%>
+ <%- for i, k in pairs(self.children) do if not k.optional then -%>
+ <th class="cbi-section-table-cell"<%=width(k)%>>
+ <%- if k.titleref then -%><a title="<%=self.titledesc or translate('Go to relevant configuration page')%>" class="cbi-title-ref" href="<%=k.titleref%>"><%- end -%>
+ <%-=k.title-%>
+ <%- if k.titleref then -%></a><%- end -%>
+ </th>
+ <%- count = count + 1; end; end; if self.sortable then -%>
+ <th class="cbi-section-table-cell"><%:Sort%></th>
+ <%- end; if self.extedit or self.addremove then -%>
+ <th class="cbi-section-table-cell"> </th>
+ <%- count = count + 1; end -%>
+ </tr>
+ <tr class="cbi-section-table-descr">
+ <%- if not self.anonymous then -%>
+ <%- if self.sectiondesc then -%>
+ <th class="cbi-section-table-cell"><%=self.sectiondesc%></th>
+ <%- else -%>
+ <th></th>
+ <%- end -%>
+ <%- end -%>
+ <%- for i, k in pairs(self.children) do if not k.optional then -%>
+ <th class="cbi-section-table-cell"<%=width(k)%>><%=k.description%></th>
+ <%- end; end; if self.sortable then -%>
+ <th class="cbi-section-table-cell"></th>
+ <%- end; if self.extedit or self.addremove then -%>
+ <th class="cbi-section-table-cell"></th>
+ <%- end -%>
+ </tr>
+ <%- local isempty = true
+ for i, k in ipairs(self:cfgsections()) do
+ section = k
+ isempty = false
+ scope = { valueheader = "cbi/cell_valueheader", valuefooter = "cbi/cell_valuefooter" }
+ -%>
+ <tr class="cbi-section-table-row<% if self.extedit or self.rowcolors then %> cbi-rowstyle-<%=rowstyle()%><% end %>" id="cbi-<%=self.config%>-<%=section%>">
+ <% if not self.anonymous then -%>
+ <th><h3><%=(type(self.sectiontitle) == "function") and self:sectiontitle(section) or k%></h3></th>
+ <%- end %>
+
+
+ <%-
+ for k, node in ipairs(self.children) do
+ if not node.optional then
+ node:render(section, scope or {})
+ end
+ end
+ -%>
+
+ <%- if self.sortable then -%>
+ <td class="cbi-section-table-cell">
+ <input class="cbi-button cbi-button-up" type="button" value="" onclick="return cbi_row_swap(this, true, 'cbi.sts.<%=self.config%>.<%=self.sectiontype%>')" alt="<%:Move up%>" title="<%:Move up%>" />
+ <input class="cbi-button cbi-button-down" type="button" value="" onclick="return cbi_row_swap(this, false, 'cbi.sts.<%=self.config%>.<%=self.sectiontype%>')" alt="<%:Move down%>" title="<%:Move down%>" />
+ </td>
+ <%- end -%>
+
+ <%- if self.extedit or self.addremove then -%>
+ <td class="cbi-section-table-cell">
+ <%- if self.extedit then -%>
+ <input class="cbi-button cbi-button-edit" type="button" value="<%:Edit%>"
+ <%- if type(self.extedit) == "string" then
+ %> onclick="location.href='<%=self.extedit:format(section)%>'"
+ <%- elseif type(self.extedit) == "function" then
+ %> onclick="location.href='<%=self:extedit(section)%>'"
+ <%- end
+ %> alt="<%:Edit%>" title="<%:Edit%>" />
+ <%- end; if self.addremove then %>
+ <input class="cbi-button cbi-button-remove" type="submit" value="<%:Delete%>" onclick="this.form.cbi_state='del-section'; return true" name="cbi.rts.<%=self.config%>.<%=k%>" alt="<%:Delete%>" title="<%:Delete%>" />
+ <%- end -%>
+ </td>
+ <%- end -%>
+ </tr>
+ <%- end -%>
+
+ <%- if isempty then -%>
+ <tr class="cbi-section-table-row">
+ <td colspan="<%=count%>"><em><br /><%:This section contains no values yet%></em></td>
+ </tr>
+ <%- end -%>
+ </table>
+
+ <% if self.error then %>
+ <div class="cbi-section-error">
+ <ul><% for _, c in pairs(self.error) do for _, e in ipairs(c) do -%>
+ <li><%=pcdata(e):gsub("\n","<br />")%></li>
+ <%- end end %></ul>
+ </div>
+ <% end %>
+
+ <%- if self.addremove then -%>
+ <% if self.template_addremove then include(self.template_addremove) else -%>
+ <div class="cbi-section-create cbi-tblsection-create">
+ <% if self.anonymous then %>
+ <input class="cbi-button cbi-button-add" type="submit" value="<%:Add%>" name="cbi.cts.<%=self.config%>.<%=self.sectiontype%>.<%=section%>" title="<%:Add%>" />
+ <% else %>
+ <% if self.invalid_cts then -%><div class="cbi-section-error"><% end %>
+ <input type="text" class="cbi-section-create-name" id="cbi.cts.<%=self.config%>.<%=self.sectiontype%>.<%=section%>" name="cbi.cts.<%=self.config%>.<%=self.sectiontype%>.<%=section%>" />
+ <script type="text/javascript">cbi_validate_field('cbi.cts.<%=self.config%>.<%=self.sectiontype%>.<%=section%>', true, 'uciname');</script>
+ <input class="cbi-button cbi-button-add" type="submit" onclick="this.form.cbi_state='add-section'; return true" value="<%:Add%>" title="<%:Add%>" />
+ <% if self.invalid_cts then -%>
+ <br /><%:Invalid%></div>
+ <%- end %>
+ <% end %>
+ </div>
+ <%- end %>
+ <%- end -%>
+ </div>
+</fieldset>
+<!-- /tblsection -->
--- /dev/null
+<fieldset class="cbi-section" id="cbi-<%=self.config%>-<%=self.sectiontype%>">
+ <% if self.title and #self.title > 0 then -%>
+ <legend><%=self.title%></legend>
+ <%- end %>
+ <div class="cbi-section-descr"><%=self.description%></div>
+ <% local isempty = true for i, k in ipairs(self:cfgsections()) do -%>
+ <% if self.addremove then -%>
+ <div class="cbi-section-remove right">
+ <input type="submit" name="cbi.rts.<%=self.config%>.<%=k%>" onclick="this.form.cbi_state='del-section'; return true" value="<%:Delete%>" class="cbi-button" />
+ </div>
+ <%- end %>
+
+ <%- section = k; isempty = false -%>
+
+ <% if not self.anonymous then -%>
+ <h3><%=section:upper()%></h3>
+ <%- end %>
+
+ <%+cbi/tabmenu%>
+
+ <fieldset class="cbi-section-node<% if self.tabs then %> cbi-section-node-tabbed<% end %>" id="cbi-<%=self.config%>-<%=section%>">
+ <%+cbi/ucisection%>
+ </fieldset>
+ <br />
+ <%- end %>
+
+ <% if isempty then -%>
+ <em><%:This section contains no values yet%><br /><br /></em>
+ <%- end %>
+
+ <% if self.addremove then -%>
+ <% if self.template_addremove then include(self.template_addremove) else -%>
+ <div class="cbi-section-create">
+ <% if self.anonymous then -%>
+ <input type="submit" class="cbi-button cbi-button-add" name="cbi.cts.<%=self.config%>.<%=self.sectiontype%>.<%=section%>" value="<%:Add%>" />
+ <%- else -%>
+ <% if self.invalid_cts then -%><div class="cbi-section-error"><% end %>
+ <input type="text" class="cbi-section-create-name" id="cbi.cts.<%=self.config%>.<%=self.sectiontype%>.<%=section%>" name="cbi.cts.<%=self.config%>.<%=self.sectiontype%>.<%=section%>" />
+ <script type="text/javascript">cbi_validate_field('cbi.cts.<%=self.config%>.<%=self.sectiontype%>.<%=section%>', true, 'uciname');</script>
+ <input type="submit" class="cbi-button cbi-button-add" onclick="this.form.cbi_state='add-section'; return true" value="<%:Add%>" />
+ <% if self.invalid_cts then -%>
+ <br /><%:Invalid%></div>
+ <%- end %>
+ <%- end %>
+ </div>
+ <%- end %>
+ <%- end %>
+</fieldset>
--- /dev/null
+<%+cbi/valueheader%>
+ <textarea class="cbi-input-textarea" <% if not self.size then %> style="width: 100%"<% else %> cols="<%=self.size%>"<% end %> onchange="cbi_d_update(this.id)"<%= attr("name", cbid) .. attr("id", cbid) .. ifattr(self.rows, "rows") .. ifattr(self.wrap, "wrap") %>>
+ <%-=pcdata(self:cfgvalue(section))-%>
+ </textarea>
+<%+cbi/valuefooter%>
--- /dev/null
+<%-
+ if type(self.hidden) == "table" then
+ for k, v in pairs(self.hidden) do
+-%>
+ <input type="hidden" id="<%=k%>" name="<%=k%>" value="<%=pcdata(v)%>" />
+<%-
+ end
+ end
+%>
+
+<% if self.tabs then %>
+ <%+cbi/tabcontainer%>
+<% else %>
+ <% self:render_children(section, scope or {}) %>
+<% end %>
+
+<% if self.error and self.error[section] then -%>
+ <div class="cbi-section-error">
+ <ul><% for _, e in ipairs(self.error[section]) do -%>
+ <li>
+ <%- if e == "invalid" then -%>
+ <%:One or more fields contain invalid values!%>
+ <%- elseif e == "missing" then -%>
+ <%:One or more required fields have no value!%>
+ <%- else -%>
+ <%=pcdata(e)%>
+ <%- end -%>
+ </li>
+ <%- end %></ul>
+ </div>
+<%- end %>
+
+<% if self.optionals[section] and #self.optionals[section] > 0 or self.dynamic then %>
+ <div class="cbi-optionals">
+ <% if self.dynamic then %>
+ <input type="text" id="cbi.opt.<%=self.config%>.<%=section%>" name="cbi.opt.<%=self.config%>.<%=section%>" />
+ <% if self.optionals[section] and #self.optionals[section] > 0 then %>
+ <script type="text/javascript">
+ cbi_combobox_init('cbi.opt.<%=self.config%>.<%=section%>', {
+ <%-
+ for i, val in pairs(self.optionals[section]) do
+ -%>
+ <%-=string.format("%q", val.option) .. ":" .. string.format("%q", striptags(val.title))-%>
+ <%-if next(self.optionals[section], i) then-%>,<%-end-%>
+ <%-
+ end
+ -%>
+ }, '', '<%-: -- custom -- -%>');
+ </script>
+ <% end %>
+ <% else %>
+ <select id="cbi.opt.<%=self.config%>.<%=section%>" name="cbi.opt.<%=self.config%>.<%=section%>">
+ <option><%: -- Additional Field -- %></option>
+ <% for key, val in pairs(self.optionals[section]) do -%>
+ <option id="cbi-<%=self.config.."-"..section.."-"..val.option%>" value="<%=val.option%>"><%=striptags(val.title)%></option>
+ <%- end %>
+ </select>
+ <script type="text/javascript"><% for key, val in pairs(self.optionals[section]) do %>
+ <% if #val.deps > 0 then %><% for j, d in ipairs(val.deps) do -%>
+ cbi_d_add("cbi-<%=self.config.."-"..section.."-"..val.option..d.add%>", {
+ <%-
+ for k,v in pairs(d.deps) do
+ -%>
+ <%-=string.format('"cbid.%s.%s.%s"', self.config, section, k) .. ":" .. string.format("%q", v)-%>
+ <%-if next(d.deps, k) then-%>,<%-end-%>
+ <%-
+ end
+ -%>
+ });
+ <%- end %><% end %>
+ <% end %></script>
+ <% end %>
+ <input type="submit" class="cbi-button cbi-button-fieldadd" value="<%:Add%>" />
+ </div>
+<% end %>
--- /dev/null
+<%
+ local t = require("luci.tools.webadmin")
+ local v = self:cfgvalue(section)
+ local s = v and nixio.fs.stat(v)
+-%>
+<%+cbi/valueheader%>
+ <% if s then %>
+ <%:Uploaded File%> (<%=t.byte_format(s.size)%>)
+ <input type="hidden"<%= attr("value", v) .. attr("name", cbid) .. attr("id", cbid) %> />
+ <input class="cbi-button cbi-input-image" type="image" value="<%:Replace entry%>" name="cbi.rlf.<%=section .. "." .. self.option%>" alt="<%:Replace entry%>" title="<%:Replace entry%>" src="<%=resource%>/cbi/reload.gif" />
+ <% else %>
+ <input class="cbi-input-file" type="file"<%= attr("name", cbid) .. attr("id", cbid) %> />
+ <% end %>
+<%+cbi/valuefooter%>
--- /dev/null
+<%+cbi/valueheader%>
+ <input type="<%=self.password and 'password" class="cbi-input-password' or 'text" class="cbi-input-text' %>" onchange="cbi_d_update(this.id)"<%=
+ attr("name", cbid) .. attr("id", cbid) .. attr("value", self:cfgvalue(section) or self.default) ..
+ ifattr(self.size, "size") .. ifattr(self.placeholder, "placeholder")
+ %> />
+ <% if self.password then %><img src="<%=resource%>/cbi/reload.gif" style="vertical-align:middle" title="<%:Reveal/hide password%>" onclick="var e = document.getElementById('<%=cbid%>'); e.type = (e.type=='password') ? 'text' : 'password';" /><% end %>
+ <% if #self.keylist > 0 or self.datatype then -%>
+ <script type="text/javascript">//<![CDATA[
+ <% if #self.keylist > 0 then -%>
+ cbi_combobox_init('<%=cbid%>', {
+ <%-
+ for i, k in ipairs(self.keylist) do
+ -%>
+ <%-=string.format("%q", k) .. ":" .. string.format("%q", self.vallist[i])-%>
+ <%-if i<#self.keylist then-%>,<%-end-%>
+ <%-
+ end
+ -%>
+ }, '<%- if not self.rmempty and not self.optional then -%>
+ <%-: -- Please choose -- -%>
+ <%- elseif self.placeholder then -%>
+ <%-= pcdata(self.placeholder) -%>
+ <%- end -%>', '
+ <%- if self.combobox_manual then -%>
+ <%-=self.combobox_manual-%>
+ <%- else -%>
+ <%-: -- custom -- -%>
+ <%- end -%>');
+ <%- end %>
+ <% if self.datatype then -%>
+ cbi_validate_field('<%=cbid%>', <%=tostring((self.optional or self.rmempty) == true)%>, '<%=self.datatype:gsub("'", "\\'")%>');
+ <%- end %>
+ //]]></script>
+ <% end -%>
+<%+cbi/valuefooter%>
--- /dev/null
+<% include( valuefooter or "cbi/full_valuefooter" ) %>
--- /dev/null
+<% include( valueheader or "cbi/full_valueheader" ) %>
--- /dev/null
+--[[
+LuCI - Lua Configuration Interface
+
+Copyright 2011-2012 Jo-Philipp Wich <xm@subsignal.org>
+
+Licensed under the Apache License, Version 2.0 (the "License");
+you may not use this file except in compliance with the License.
+You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+]]--
+
+local map, section, net = ...
+local ifc = net:get_interface()
+
+local hostname, accept_ra, send_rs
+local bcast, defaultroute, peerdns, dns, metric, clientid, vendorclass
+
+
+hostname = section:taboption("general", Value, "hostname",
+ translate("Hostname to send when requesting DHCP"))
+
+hostname.placeholder = luci.sys.hostname()
+hostname.datatype = "hostname"
+
+
+bcast = section:taboption("advanced", Flag, "broadcast",
+ translate("Use broadcast flag"),
+ translate("Required for certain ISPs, e.g. Charter with DOCSIS 3"))
+
+bcast.default = bcast.disabled
+
+
+defaultroute = section:taboption("advanced", Flag, "defaultroute",
+ translate("Use default gateway"),
+ translate("If unchecked, no default route is configured"))
+
+defaultroute.default = defaultroute.enabled
+
+
+peerdns = section:taboption("advanced", Flag, "peerdns",
+ translate("Use DNS servers advertised by peer"),
+ translate("If unchecked, the advertised DNS server addresses are ignored"))
+
+peerdns.default = peerdns.enabled
+
+
+dns = section:taboption("advanced", DynamicList, "dns",
+ translate("Use custom DNS servers"))
+
+dns:depends("peerdns", "")
+dns.datatype = "ipaddr"
+dns.cast = "string"
+
+
+metric = section:taboption("advanced", Value, "metric",
+ translate("Use gateway metric"))
+
+metric.placeholder = "0"
+metric.datatype = "uinteger"
+
+
+clientid = section:taboption("advanced", Value, "clientid",
+ translate("Client ID to send when requesting DHCP"))
+
+
+vendorclass = section:taboption("advanced", Value, "vendorid",
+ translate("Vendor Class to send when requesting DHCP"))
+
+
+luci.tools.proto.opt_macaddr(section, ifc, translate("Override MAC address"))
+
+
+mtu = section:taboption("advanced", Value, "mtu", translate("Override MTU"))
+mtu.placeholder = "1500"
+mtu.datatype = "max(9200)"
--- /dev/null
+--[[
+LuCI - Lua Configuration Interface
+
+Copyright 2011 Jo-Philipp Wich <xm@subsignal.org>
+
+Licensed under the Apache License, Version 2.0 (the "License");
+you may not use this file except in compliance with the License.
+You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+]]--
+
+local map, section, net = ...
--- /dev/null
+--[[
+LuCI - Lua Configuration Interface
+
+Copyright 2011 Jo-Philipp Wich <xm@subsignal.org>
+
+Licensed under the Apache License, Version 2.0 (the "License");
+you may not use this file except in compliance with the License.
+You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+]]--
+
+local map, section, net = ...
+local ifc = net:get_interface()
+
+local ipaddr, netmask, gateway, broadcast, dns, accept_ra, send_rs, ip6addr, ip6gw
+local mtu, metric
+
+
+ipaddr = section:taboption("general", Value, "ipaddr", translate("IPv4 address"))
+ipaddr.datatype = "ip4addr"
+
+
+netmask = section:taboption("general", Value, "netmask",
+ translate("IPv4 netmask"))
+
+netmask.datatype = "ip4addr"
+netmask:value("255.255.255.0")
+netmask:value("255.255.0.0")
+netmask:value("255.0.0.0")
+
+
+gateway = section:taboption("general", Value, "gateway", translate("IPv4 gateway"))
+gateway.datatype = "ip4addr"
+
+
+broadcast = section:taboption("general", Value, "broadcast", translate("IPv4 broadcast"))
+broadcast.datatype = "ip4addr"
+
+
+dns = section:taboption("general", DynamicList, "dns",
+ translate("Use custom DNS servers"))
+
+dns.datatype = "ipaddr"
+dns.cast = "string"
+
+
+if luci.model.network:has_ipv6() then
+
+ local ip6assign = section:taboption("general", Value, "ip6assign", translate("IPv6 assignment length"),
+ translate("Assign a part of given length of every public IPv6-prefix to this interface"))
+ ip6assign:value("", translate("disabled"))
+ ip6assign:value("64")
+ ip6assign.datatype = "max(64)"
+
+ local ip6hint = section:taboption("general", Value, "ip6hint", translate("IPv6 assignment hint"),
+ translate("Assign prefix parts using this hexadecimal subprefix ID for this interface."))
+ for i=33,64 do ip6hint:depends("ip6assign", i) end
+
+ ip6addr = section:taboption("general", Value, "ip6addr", translate("IPv6 address"))
+ ip6addr.datatype = "ip6addr"
+ ip6addr:depends("ip6assign", "")
+
+
+ ip6gw = section:taboption("general", Value, "ip6gw", translate("IPv6 gateway"))
+ ip6gw.datatype = "ip6addr"
+ ip6gw:depends("ip6assign", "")
+
+
+ local ip6prefix = s:taboption("general", Value, "ip6prefix", translate("IPv6 routed prefix"),
+ translate("Public prefix routed to this device for distribution to clients."))
+ ip6prefix.datatype = "ip6addr"
+ ip6prefix:depends("ip6assign", "")
+
+end
+
+
+luci.tools.proto.opt_macaddr(section, ifc, translate("Override MAC address"))
+
+
+mtu = section:taboption("advanced", Value, "mtu", translate("Override MTU"))
+mtu.placeholder = "1500"
+mtu.datatype = "max(9200)"
+
+
+metric = section:taboption("advanced", Value, "metric",
+ translate("Use gateway metric"))
+
+metric.placeholder = "0"
+metric.datatype = "uinteger"
--- /dev/null
+--[[
+LuCI - Firewall model
+
+Copyright 2009 Jo-Philipp Wich <xm@subsignal.org>
+
+Licensed under the Apache License, Version 2.0 (the "License");
+you may not use this file except in compliance with the License.
+You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+Unless required by applicable law or agreed to in writing, software
+distributed under the License is distributed on an "AS IS" BASIS,
+WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+See the License for the specific language governing permissions and
+limitations under the License.
+
+]]--
+
+local type, pairs, ipairs, table, luci, math
+ = type, pairs, ipairs, table, luci, math
+
+local tpl = require "luci.template.parser"
+local utl = require "luci.util"
+local uci = require "luci.model.uci"
+
+module "luci.model.firewall"
+
+
+local uci_r, uci_s
+
+function _valid_id(x)
+ return (x and #x > 0 and x:match("^[a-zA-Z0-9_]+$"))
+end
+
+function _get(c, s, o)
+ return uci_r:get(c, s, o)
+end
+
+function _set(c, s, o, v)
+ if v ~= nil then
+ if type(v) == "boolean" then v = v and "1" or "0" end
+ return uci_r:set(c, s, o, v)
+ else
+ return uci_r:delete(c, s, o)
+ end
+end
+
+
+function init(cursor)
+ uci_r = cursor or uci_r or uci.cursor()
+ uci_s = uci_r:substate()
+
+ return _M
+end
+
+function save(self, ...)
+ uci_r:save(...)
+ uci_r:load(...)
+end
+
+function commit(self, ...)
+ uci_r:commit(...)
+ uci_r:load(...)
+end
+
+function get_defaults()
+ return defaults()
+end
+
+function new_zone(self)
+ local name = "newzone"
+ local count = 1
+
+ while self:get_zone(name) do
+ count = count + 1
+ name = "newzone%d" % count
+ end
+
+ return self:add_zone(name)
+end
+
+function add_zone(self, n)
+ if _valid_id(n) and not self:get_zone(n) then
+ local d = defaults()
+ local z = uci_r:section("firewall", "zone", nil, {
+ name = n,
+ network = " ",
+ input = d:input() or "DROP",
+ forward = d:forward() or "DROP",
+ output = d:output() or "DROP"
+ })
+
+ return z and zone(z)
+ end
+end
+
+function get_zone(self, n)
+ if uci_r:get("firewall", n) == "zone" then
+ return zone(n)
+ else
+ local z
+ uci_r:foreach("firewall", "zone",
+ function(s)
+ if n and s.name == n then
+ z = s['.name']
+ return false
+ end
+ end)
+ return z and zone(z)
+ end
+end
+
+function get_zones(self)
+ local zones = { }
+ local znl = { }
+
+ uci_r:foreach("firewall", "zone",
+ function(s)
+ if s.name then
+ znl[s.name] = zone(s['.name'])
+ end
+ end)
+
+ local z
+ for z in utl.kspairs(znl) do
+ zones[#zones+1] = znl[z]
+ end
+
+ return zones
+end
+
+function get_zone_by_network(self, net)
+ local z
+
+ uci_r:foreach("firewall", "zone",
+ function(s)
+ if s.name and net then
+ local n
+ for n in utl.imatch(s.network or s.name) do
+ if n == net then
+ z = s['.name']
+ return false
+ end
+ end
+ end
+ end)
+
+ return z and zone(z)
+end
+
+function del_zone(self, n)
+ local r = false
+
+ if uci_r:get("firewall", n) == "zone" then
+ local z = uci_r:get("firewall", n, "name")
+ r = uci_r:delete("firewall", n)
+ n = z
+ else
+ uci_r:foreach("firewall", "zone",
+ function(s)
+ if n and s.name == n then
+ r = uci_r:delete("firewall", s['.name'])
+ return false
+ end
+ end)
+ end
+
+ if r then
+ uci_r:foreach("firewall", "rule",
+ function(s)
+ if s.src == n or s.dest == n then
+ uci_r:delete("firewall", s['.name'])
+ end
+ end)
+
+ uci_r:foreach("firewall", "redirect",
+ function(s)
+ if s.src == n or s.dest == n then
+ uci_r:delete("firewall", s['.name'])
+ end
+ end)
+
+ uci_r:foreach("firewall", "forwarding",
+ function(s)
+ if s.src == n or s.dest == n then
+ uci_r:delete("firewall", s['.name'])
+ end
+ end)
+ end
+
+ return r
+end
+
+function rename_zone(self, old, new)
+ local r = false
+
+ if _valid_id(new) and not self:get_zone(new) then
+ uci_r:foreach("firewall", "zone",
+ function(s)
+ if old and s.name == old then
+ if not s.network then
+ uci_r:set("firewall", s['.name'], "network", old)
+ end
+ uci_r:set("firewall", s['.name'], "name", new)
+ r = true
+ return false
+ end
+ end)
+
+ if r then
+ uci_r:foreach("firewall", "rule",
+ function(s)
+ if s.src == old then
+ uci_r:set("firewall", s['.name'], "src", new)
+ end
+ if s.dest == old then
+ uci_r:set("firewall", s['.name'], "dest", new)
+ end
+ end)
+
+ uci_r:foreach("firewall", "redirect",
+ function(s)
+ if s.src == old then
+ uci_r:set("firewall", s['.name'], "src", new)
+ end
+ if s.dest == old then
+ uci_r:set("firewall", s['.name'], "dest", new)
+ end
+ end)
+
+ uci_r:foreach("firewall", "forwarding",
+ function(s)
+ if s.src == old then
+ uci_r:set("firewall", s['.name'], "src", new)
+ end
+ if s.dest == old then
+ uci_r:set("firewall", s['.name'], "dest", new)
+ end
+ end)
+ end
+ end
+
+ return r
+end
+
+function del_network(self, net)
+ local z
+ if net then
+ for _, z in ipairs(self:get_zones()) do
+ z:del_network(net)
+ end
+ end
+end
+
+
+defaults = utl.class()
+function defaults.__init__(self)
+ uci_r:foreach("firewall", "defaults",
+ function(s)
+ self.sid = s['.name']
+ return false
+ end)
+
+ self.sid = self.sid or uci_r:section("firewall", "defaults", nil, { })
+end
+
+function defaults.get(self, opt)
+ return _get("firewall", self.sid, opt)
+end
+
+function defaults.set(self, opt, val)
+ return _set("firewall", self.sid, opt, val)
+end
+
+function defaults.syn_flood(self)
+ return (self:get("syn_flood") == "1")
+end
+
+function defaults.drop_invalid(self)
+ return (self:get("drop_invalid") == "1")
+end
+
+function defaults.input(self)
+ return self:get("input") or "DROP"
+end
+
+function defaults.forward(self)
+ return self:get("forward") or "DROP"
+end
+
+function defaults.output(self)
+ return self:get("output") or "DROP"
+end
+
+
+zone = utl.class()
+function zone.__init__(self, z)
+ if uci_r:get("firewall", z) == "zone" then
+ self.sid = z
+ self.data = uci_r:get_all("firewall", z)
+ else
+ uci_r:foreach("firewall", "zone",
+ function(s)
+ if s.name == z then
+ self.sid = s['.name']
+ self.data = s
+ return false
+ end
+ end)
+ end
+end
+
+function zone.get(self, opt)
+ return _get("firewall", self.sid, opt)
+end
+
+function zone.set(self, opt, val)
+ return _set("firewall", self.sid, opt, val)
+end
+
+function zone.masq(self)
+ return (self:get("masq") == "1")
+end
+
+function zone.name(self)
+ return self:get("name")
+end
+
+function zone.network(self)
+ return self:get("network")
+end
+
+function zone.input(self)
+ return self:get("input") or defaults():input() or "DROP"
+end
+
+function zone.forward(self)
+ return self:get("forward") or defaults():forward() or "DROP"
+end
+
+function zone.output(self)
+ return self:get("output") or defaults():output() or "DROP"
+end
+
+function zone.add_network(self, net)
+ if uci_r:get("network", net) == "interface" then
+ local nets = { }
+
+ local n
+ for n in utl.imatch(self:get("network") or self:get("name")) do
+ if n ~= net then
+ nets[#nets+1] = n
+ end
+ end
+
+ nets[#nets+1] = net
+
+ _M:del_network(net)
+ self:set("network", table.concat(nets, " "))
+ end
+end
+
+function zone.del_network(self, net)
+ local nets = { }
+
+ local n
+ for n in utl.imatch(self:get("network") or self:get("name")) do
+ if n ~= net then
+ nets[#nets+1] = n
+ end
+ end
+
+ if #nets > 0 then
+ self:set("network", table.concat(nets, " "))
+ else
+ self:set("network", " ")
+ end
+end
+
+function zone.get_networks(self)
+ local nets = { }
+
+ local n
+ for n in utl.imatch(self:get("network") or self:get("name")) do
+ nets[#nets+1] = n
+ end
+
+ return nets
+end
+
+function zone.clear_networks(self)
+ self:set("network", " ")
+end
+
+function zone.get_forwardings_by(self, what)
+ local name = self:name()
+ local forwards = { }
+
+ uci_r:foreach("firewall", "forwarding",
+ function(s)
+ if s.src and s.dest and s[what] == name then
+ forwards[#forwards+1] = forwarding(s['.name'])
+ end
+ end)
+
+ return forwards
+end
+
+function zone.add_forwarding_to(self, dest)
+ local exist, forward
+
+ for _, forward in ipairs(self:get_forwardings_by('src')) do
+ if forward:dest() == dest then
+ exist = true
+ break
+ end
+ end
+
+ if not exist and dest ~= self:name() and _valid_id(dest) then
+ local s = uci_r:section("firewall", "forwarding", nil, {
+ src = self:name(),
+ dest = dest
+ })
+
+ return s and forwarding(s)
+ end
+end
+
+function zone.add_forwarding_from(self, src)
+ local exist, forward
+
+ for _, forward in ipairs(self:get_forwardings_by('dest')) do
+ if forward:src() == src then
+ exist = true
+ break
+ end
+ end
+
+ if not exist and src ~= self:name() and _valid_id(src) then
+ local s = uci_r:section("firewall", "forwarding", nil, {
+ src = src,
+ dest = self:name()
+ })
+
+ return s and forwarding(s)
+ end
+end
+
+function zone.del_forwardings_by(self, what)
+ local name = self:name()
+
+ uci_r:delete_all("firewall", "forwarding",
+ function(s)
+ return (s.src and s.dest and s[what] == name)
+ end)
+end
+
+function zone.add_redirect(self, options)
+ options = options or { }
+ options.src = self:name()
+
+ local s = uci_r:section("firewall", "redirect", nil, options)
+ return s and redirect(s)
+end
+
+function zone.add_rule(self, options)
+ options = options or { }
+ options.src = self:name()
+
+ local s = uci_r:section("firewall", "rule", nil, options)
+ return s and rule(s)
+end
+
+function zone.get_color(self)
+ if self and self:name() == "lan" then
+ return "#90f090"
+ elseif self and self:name() == "wan" then
+ return "#f09090"
+ elseif self then
+ math.randomseed(tpl.hash(self:name()))
+
+ local r = math.random(128)
+ local g = math.random(128)
+ local min = 0
+ local max = 128
+
+ if ( r + g ) < 128 then
+ min = 128 - r - g
+ else
+ max = 255 - r - g
+ end
+
+ local b = min + math.floor( math.random() * ( max - min ) )
+
+ return "#%02x%02x%02x" % { 0xFF - r, 0xFF - g, 0xFF - b }
+ else
+ return "#eeeeee"
+ end
+end
+
+
+forwarding = utl.class()
+function forwarding.__init__(self, f)
+ self.sid = f
+end
+
+function forwarding.src(self)
+ return uci_r:get("firewall", self.sid, "src")
+end
+
+function forwarding.dest(self)
+ return uci_r:get("firewall", self.sid, "dest")
+end
+
+function forwarding.src_zone(self)
+ return zone(self:src())
+end
+
+function forwarding.dest_zone(self)
+ return zone(self:dest())
+end
+
+
+rule = utl.class()
+function rule.__init__(self, f)
+ self.sid = f
+end
+
+function rule.get(self, opt)
+ return _get("firewall", self.sid, opt)
+end
+
+function rule.set(self, opt, val)
+ return _set("firewall", self.sid, opt, val)
+end
+
+function rule.src(self)
+ return uci_r:get("firewall", self.sid, "src")
+end
+
+function rule.dest(self)
+ return uci_r:get("firewall", self.sid, "dest")
+end
+
+function rule.src_zone(self)
+ return zone(self:src())
+end
+
+function rule.dest_zone(self)
+ return zone(self:dest())
+end
+
+
+redirect = utl.class()
+function redirect.__init__(self, f)
+ self.sid = f
+end
+
+function redirect.get(self, opt)
+ return _get("firewall", self.sid, opt)
+end
+
+function redirect.set(self, opt, val)
+ return _set("firewall", self.sid, opt, val)
+end
+
+function redirect.src(self)
+ return uci_r:get("firewall", self.sid, "src")
+end
+
+function redirect.dest(self)
+ return uci_r:get("firewall", self.sid, "dest")
+end
+
+function redirect.src_zone(self)
+ return zone(self:src())
+end
+
+function redirect.dest_zone(self)
+ return zone(self:dest())
+end
--- /dev/null
+--[[
+LuCI - Lua Configuration Interface
+
+(c) 2008-2011 Jo-Philipp Wich <xm@subsignal.org>
+(c) 2008 Steven Barth <steven@midlink.org>
+
+Licensed under the Apache License, Version 2.0 (the "License");
+you may not use this file except in compliance with the License.
+You may obtain a copy of the License at
+
+http://www.apache.org/licenses/LICENSE-2.0
+
+]]--
+
+local os = require "os"
+local io = require "io"
+local fs = require "nixio.fs"
+local util = require "luci.util"
+
+local type = type
+local pairs = pairs
+local error = error
+local table = table
+
+local ipkg = "opkg --force-removal-of-dependent-packages --force-overwrite --nocase"
+local icfg = "/etc/opkg.conf"
+
+--- LuCI OPKG call abstraction library
+module "luci.model.ipkg"
+
+
+-- Internal action function
+local function _action(cmd, ...)
+ local pkg = ""
+ for k, v in pairs({...}) do
+ pkg = pkg .. " '" .. v:gsub("'", "") .. "'"
+ end
+
+ local c = "%s %s %s >/tmp/opkg.stdout 2>/tmp/opkg.stderr" %{ ipkg, cmd, pkg }
+ local r = os.execute(c)
+ local e = fs.readfile("/tmp/opkg.stderr")
+ local o = fs.readfile("/tmp/opkg.stdout")
+
+ fs.unlink("/tmp/opkg.stderr")
+ fs.unlink("/tmp/opkg.stdout")
+
+ return r, o or "", e or ""
+end
+
+-- Internal parser function
+local function _parselist(rawdata)
+ if type(rawdata) ~= "function" then
+ error("OPKG: Invalid rawdata given")
+ end
+
+ local data = {}
+ local c = {}
+ local l = nil
+
+ for line in rawdata do
+ if line:sub(1, 1) ~= " " then
+ local key, val = line:match("(.-): ?(.*)%s*")
+
+ if key and val then
+ if key == "Package" then
+ c = {Package = val}
+ data[val] = c
+ elseif key == "Status" then
+ c.Status = {}
+ for j in val:gmatch("([^ ]+)") do
+ c.Status[j] = true
+ end
+ else
+ c[key] = val
+ end
+ l = key
+ end
+ else
+ -- Multi-line field
+ c[l] = c[l] .. "\n" .. line
+ end
+ end
+
+ return data
+end
+
+-- Internal lookup function
+local function _lookup(act, pkg)
+ local cmd = ipkg .. " " .. act
+ if pkg then
+ cmd = cmd .. " '" .. pkg:gsub("'", "") .. "'"
+ end
+
+ -- OPKG sometimes kills the whole machine because it sucks
+ -- Therefore we have to use a sucky approach too and use
+ -- tmpfiles instead of directly reading the output
+ local tmpfile = os.tmpname()
+ os.execute(cmd .. (" >%s 2>/dev/null" % tmpfile))
+
+ local data = _parselist(io.lines(tmpfile))
+ os.remove(tmpfile)
+ return data
+end
+
+
+--- Return information about installed and available packages.
+-- @param pkg Limit output to a (set of) packages
+-- @return Table containing package information
+function info(pkg)
+ return _lookup("info", pkg)
+end
+
+--- Return the package status of one or more packages.
+-- @param pkg Limit output to a (set of) packages
+-- @return Table containing package status information
+function status(pkg)
+ return _lookup("status", pkg)
+end
+
+--- Install one or more packages.
+-- @param ... List of packages to install
+-- @return Boolean indicating the status of the action
+-- @return OPKG return code, STDOUT and STDERR
+function install(...)
+ return _action("install", ...)
+end
+
+--- Determine whether a given package is installed.
+-- @param pkg Package
+-- @return Boolean
+function installed(pkg)
+ local p = status(pkg)[pkg]
+ return (p and p.Status and p.Status.installed)
+end
+
+--- Remove one or more packages.
+-- @param ... List of packages to install
+-- @return Boolean indicating the status of the action
+-- @return OPKG return code, STDOUT and STDERR
+function remove(...)
+ return _action("remove", ...)
+end
+
+--- Update package lists.
+-- @return Boolean indicating the status of the action
+-- @return OPKG return code, STDOUT and STDERR
+function update()
+ return _action("update")
+end
+
+--- Upgrades all installed packages.
+-- @return Boolean indicating the status of the action
+-- @return OPKG return code, STDOUT and STDERR
+function upgrade()
+ return _action("upgrade")
+end
+
+-- List helper
+function _list(action, pat, cb)
+ local fd = io.popen(ipkg .. " " .. action ..
+ (pat and (" '%s'" % pat:gsub("'", "")) or ""))
+
+ if fd then
+ local name, version, desc
+ while true do
+ local line = fd:read("*l")
+ if not line then break end
+
+ name, version, desc = line:match("^(.-) %- (.-) %- (.+)")
+
+ if not name then
+ name, version = line:match("^(.-) %- (.+)")
+ desc = ""
+ end
+
+ cb(name, version, desc)
+
+ name = nil
+ version = nil
+ desc = nil
+ end
+
+ fd:close()
+ end
+end
+
+--- List all packages known to opkg.
+-- @param pat Only find packages matching this pattern, nil lists all packages
+-- @param cb Callback function invoked for each package, receives name, version and description as arguments
+-- @return nothing
+function list_all(pat, cb)
+ _list("list", pat, cb)
+end
+
+--- List installed packages.
+-- @param pat Only find packages matching this pattern, nil lists all packages
+-- @param cb Callback function invoked for each package, receives name, version and description as arguments
+-- @return nothing
+function list_installed(pat, cb)
+ _list("list_installed", pat, cb)
+end
+
+--- Find packages that match the given pattern.
+-- @param pat Find packages whose names or descriptions match this pattern, nil results in zero results
+-- @param cb Callback function invoked for each patckage, receives name, version and description as arguments
+-- @return nothing
+function find(pat, cb)
+ _list("find", pat, cb)
+end
+
+
+--- Determines the overlay root used by opkg.
+-- @return String containing the directory path of the overlay root.
+function overlay_root()
+ local od = "/"
+ local fd = io.open(icfg, "r")
+
+ if fd then
+ local ln
+
+ repeat
+ ln = fd:read("*l")
+ if ln and ln:match("^%s*option%s+overlay_root%s+") then
+ od = ln:match("^%s*option%s+overlay_root%s+(%S+)")
+
+ local s = fs.stat(od)
+ if not s or s.type ~= "dir" then
+ od = "/"
+ end
+
+ break
+ end
+ until not ln
+
+ fd:close()
+ end
+
+ return od
+end
--- /dev/null
+--[[
+LuCI - Network model
+
+Copyright 2009-2010 Jo-Philipp Wich <xm@subsignal.org>
+
+Licensed under the Apache License, Version 2.0 (the "License");
+you may not use this file except in compliance with the License.
+You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+Unless required by applicable law or agreed to in writing, software
+distributed under the License is distributed on an "AS IS" BASIS,
+WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+See the License for the specific language governing permissions and
+limitations under the License.
+
+]]--
+
+local type, next, pairs, ipairs, loadfile, table
+ = type, next, pairs, ipairs, loadfile, table
+
+local tonumber, tostring, math = tonumber, tostring, math
+
+local require = require
+
+local bus = require "ubus"
+local nxo = require "nixio"
+local nfs = require "nixio.fs"
+local ipc = require "luci.ip"
+local sys = require "luci.sys"
+local utl = require "luci.util"
+local dsp = require "luci.dispatcher"
+local uci = require "luci.model.uci"
+local lng = require "luci.i18n"
+
+module "luci.model.network"
+
+
+IFACE_PATTERNS_VIRTUAL = { }
+IFACE_PATTERNS_IGNORE = { "^wmaster%d", "^wifi%d", "^hwsim%d", "^imq%d", "^ifb%d", "^mon%.wlan%d", "^sit%d", "^gre%d", "^lo$" }
+IFACE_PATTERNS_WIRELESS = { "^wlan%d", "^wl%d", "^ath%d", "^%w+%.network%d" }
+
+
+protocol = utl.class()
+
+local _protocols = { }
+
+local _interfaces, _bridge, _switch, _tunnel
+local _ubus, _ubusnetcache, _ubusdevcache, _ubuswificache
+local _uci_real, _uci_state
+
+function _filter(c, s, o, r)
+ local val = _uci_real:get(c, s, o)
+ if val then
+ local l = { }
+ if type(val) == "string" then
+ for val in val:gmatch("%S+") do
+ if val ~= r then
+ l[#l+1] = val
+ end
+ end
+ if #l > 0 then
+ _uci_real:set(c, s, o, table.concat(l, " "))
+ else
+ _uci_real:delete(c, s, o)
+ end
+ elseif type(val) == "table" then
+ for _, val in ipairs(val) do
+ if val ~= r then
+ l[#l+1] = val
+ end
+ end
+ if #l > 0 then
+ _uci_real:set(c, s, o, l)
+ else
+ _uci_real:delete(c, s, o)
+ end
+ end
+ end
+end
+
+function _append(c, s, o, a)
+ local val = _uci_real:get(c, s, o) or ""
+ if type(val) == "string" then
+ local l = { }
+ for val in val:gmatch("%S+") do
+ if val ~= a then
+ l[#l+1] = val
+ end
+ end
+ l[#l+1] = a
+ _uci_real:set(c, s, o, table.concat(l, " "))
+ elseif type(val) == "table" then
+ local l = { }
+ for _, val in ipairs(val) do
+ if val ~= a then
+ l[#l+1] = val
+ end
+ end
+ l[#l+1] = a
+ _uci_real:set(c, s, o, l)
+ end
+end
+
+function _stror(s1, s2)
+ if not s1 or #s1 == 0 then
+ return s2 and #s2 > 0 and s2
+ else
+ return s1
+ end
+end
+
+function _get(c, s, o)
+ return _uci_real:get(c, s, o)
+end
+
+function _set(c, s, o, v)
+ if v ~= nil then
+ if type(v) == "boolean" then v = v and "1" or "0" end
+ return _uci_real:set(c, s, o, v)
+ else
+ return _uci_real:delete(c, s, o)
+ end
+end
+
+function _wifi_iface(x)
+ local _, p
+ for _, p in ipairs(IFACE_PATTERNS_WIRELESS) do
+ if x:match(p) then
+ return true
+ end
+ end
+ return false
+end
+
+function _wifi_state(key, val, field)
+ if not next(_ubuswificache) then
+ _ubuswificache = _ubus:call("network.wireless", "status", {}) or {}
+ end
+
+ local radio, radiostate
+ for radio, radiostate in pairs(_ubuswificache) do
+ local ifc, ifcstate
+ for ifc, ifcstate in pairs(radiostate.interfaces) do
+ if ifcstate[key] == val then
+ return ifcstate[field]
+ end
+ end
+ end
+end
+
+function _wifi_lookup(ifn)
+ -- got a radio#.network# pseudo iface, locate the corresponding section
+ local radio, ifnidx = ifn:match("^(%w+)%.network(%d+)$")
+ if radio and ifnidx then
+ local sid = nil
+ local num = 0
+
+ ifnidx = tonumber(ifnidx)
+ _uci_real:foreach("wireless", "wifi-iface",
+ function(s)
+ if s.device == radio then
+ num = num + 1
+ if num == ifnidx then
+ sid = s['.name']
+ return false
+ end
+ end
+ end)
+
+ return sid
+
+ -- looks like wifi, try to locate the section via state vars
+ elseif _wifi_iface(ifn) then
+ local sid = _wifi_state("ifname", ifn, "section")
+ if not sid then
+ _uci_state:foreach("wireless", "wifi-iface",
+ function(s)
+ if s.ifname == ifn then
+ sid = s['.name']
+ return false
+ end
+ end)
+ end
+
+ return sid
+ end
+end
+
+function _iface_virtual(x)
+ local _, p
+ for _, p in ipairs(IFACE_PATTERNS_VIRTUAL) do
+ if x:match(p) then
+ return true
+ end
+ end
+ return false
+end
+
+function _iface_ignore(x)
+ local _, p
+ for _, p in ipairs(IFACE_PATTERNS_IGNORE) do
+ if x:match(p) then
+ return true
+ end
+ end
+ return _iface_virtual(x)
+end
+
+
+function init(cursor)
+ _uci_real = cursor or _uci_real or uci.cursor()
+ _uci_state = _uci_real:substate()
+
+ _interfaces = { }
+ _bridge = { }
+ _switch = { }
+ _tunnel = { }
+
+ _ubus = bus.connect()
+ _ubusnetcache = { }
+ _ubusdevcache = { }
+ _ubuswificache = { }
+
+ -- read interface information
+ local n, i
+ for n, i in ipairs(nxo.getifaddrs()) do
+ local name = i.name:match("[^:]+")
+ local prnt = name:match("^([^%.]+)%.")
+
+ if _iface_virtual(name) then
+ _tunnel[name] = true
+ end
+
+ if _tunnel[name] or not _iface_ignore(name) then
+ _interfaces[name] = _interfaces[name] or {
+ idx = i.ifindex or n,
+ name = name,
+ rawname = i.name,
+ flags = { },
+ ipaddrs = { },
+ ip6addrs = { }
+ }
+
+ if prnt then
+ _switch[name] = true
+ _switch[prnt] = true
+ end
+
+ if i.family == "packet" then
+ _interfaces[name].flags = i.flags
+ _interfaces[name].stats = i.data
+ _interfaces[name].macaddr = i.addr
+ elseif i.family == "inet" then
+ _interfaces[name].ipaddrs[#_interfaces[name].ipaddrs+1] = ipc.IPv4(i.addr, i.netmask)
+ elseif i.family == "inet6" then
+ _interfaces[name].ip6addrs[#_interfaces[name].ip6addrs+1] = ipc.IPv6(i.addr, i.netmask)
+ end
+ end
+ end
+
+ -- read bridge informaton
+ local b, l
+ for l in utl.execi("brctl show") do
+ if not l:match("STP") then
+ local r = utl.split(l, "%s+", nil, true)
+ if #r == 4 then
+ b = {
+ name = r[1],
+ id = r[2],
+ stp = r[3] == "yes",
+ ifnames = { _interfaces[r[4]] }
+ }
+ if b.ifnames[1] then
+ b.ifnames[1].bridge = b
+ end
+ _bridge[r[1]] = b
+ elseif b then
+ b.ifnames[#b.ifnames+1] = _interfaces[r[2]]
+ b.ifnames[#b.ifnames].bridge = b
+ end
+ end
+ end
+
+ return _M
+end
+
+function save(self, ...)
+ _uci_real:save(...)
+ _uci_real:load(...)
+end
+
+function commit(self, ...)
+ _uci_real:commit(...)
+ _uci_real:load(...)
+end
+
+function ifnameof(self, x)
+ if utl.instanceof(x, interface) then
+ return x:name()
+ elseif utl.instanceof(x, protocol) then
+ return x:ifname()
+ elseif type(x) == "string" then
+ return x:match("^[^:]+")
+ end
+end
+
+function get_protocol(self, protoname, netname)
+ local v = _protocols[protoname]
+ if v then
+ return v(netname or "__dummy__")
+ end
+end
+
+function get_protocols(self)
+ local p = { }
+ local _, v
+ for _, v in ipairs(_protocols) do
+ p[#p+1] = v("__dummy__")
+ end
+ return p
+end
+
+function register_protocol(self, protoname)
+ local proto = utl.class(protocol)
+
+ function proto.__init__(self, name)
+ self.sid = name
+ end
+
+ function proto.proto(self)
+ return protoname
+ end
+
+ _protocols[#_protocols+1] = proto
+ _protocols[protoname] = proto
+
+ return proto
+end
+
+function register_pattern_virtual(self, pat)
+ IFACE_PATTERNS_VIRTUAL[#IFACE_PATTERNS_VIRTUAL+1] = pat
+end
+
+
+function has_ipv6(self)
+ return nfs.access("/proc/net/ipv6_route")
+end
+
+function add_network(self, n, options)
+ local oldnet = self:get_network(n)
+ if n and #n > 0 and n:match("^[a-zA-Z0-9_]+$") and not oldnet then
+ if _uci_real:section("network", "interface", n, options) then
+ return network(n)
+ end
+ elseif oldnet and oldnet:is_empty() then
+ if options then
+ local k, v
+ for k, v in pairs(options) do
+ oldnet:set(k, v)
+ end
+ end
+ return oldnet
+ end
+end
+
+function get_network(self, n)
+ if n and _uci_real:get("network", n) == "interface" then
+ return network(n)
+ end
+end
+
+function get_networks(self)
+ local nets = { }
+ local nls = { }
+
+ _uci_real:foreach("network", "interface",
+ function(s)
+ nls[s['.name']] = network(s['.name'])
+ end)
+
+ local n
+ for n in utl.kspairs(nls) do
+ nets[#nets+1] = nls[n]
+ end
+
+ return nets
+end
+
+function del_network(self, n)
+ local r = _uci_real:delete("network", n)
+ if r then
+ _uci_real:delete_all("network", "alias",
+ function(s) return (s.interface == n) end)
+
+ _uci_real:delete_all("network", "route",
+ function(s) return (s.interface == n) end)
+
+ _uci_real:delete_all("network", "route6",
+ function(s) return (s.interface == n) end)
+
+ _uci_real:foreach("wireless", "wifi-iface",
+ function(s)
+ local net
+ local rest = { }
+ for net in utl.imatch(s.network) do
+ if net ~= n then
+ rest[#rest+1] = net
+ end
+ end
+ if #rest > 0 then
+ _uci_real:set("wireless", s['.name'], "network",
+ table.concat(rest, " "))
+ else
+ _uci_real:delete("wireless", s['.name'], "network")
+ end
+ end)
+ end
+ return r
+end
+
+function rename_network(self, old, new)
+ local r
+ if new and #new > 0 and new:match("^[a-zA-Z0-9_]+$") and not self:get_network(new) then
+ r = _uci_real:section("network", "interface", new, _uci_real:get_all("network", old))
+
+ if r then
+ _uci_real:foreach("network", "alias",
+ function(s)
+ if s.interface == old then
+ _uci_real:set("network", s['.name'], "interface", new)
+ end
+ end)
+
+ _uci_real:foreach("network", "route",
+ function(s)
+ if s.interface == old then
+ _uci_real:set("network", s['.name'], "interface", new)
+ end
+ end)
+
+ _uci_real:foreach("network", "route6",
+ function(s)
+ if s.interface == old then
+ _uci_real:set("network", s['.name'], "interface", new)
+ end
+ end)
+
+ _uci_real:foreach("wireless", "wifi-iface",
+ function(s)
+ local net
+ local list = { }
+ for net in utl.imatch(s.network) do
+ if net == old then
+ list[#list+1] = new
+ else
+ list[#list+1] = net
+ end
+ end
+ if #list > 0 then
+ _uci_real:set("wireless", s['.name'], "network",
+ table.concat(list, " "))
+ end
+ end)
+
+ _uci_real:delete("network", old)
+ end
+ end
+ return r or false
+end
+
+function get_interface(self, i)
+ if _interfaces[i] or _wifi_iface(i) then
+ return interface(i)
+ else
+ local ifc
+ local num = { }
+ _uci_real:foreach("wireless", "wifi-iface",
+ function(s)
+ if s.device then
+ num[s.device] = num[s.device] and num[s.device] + 1 or 1
+ if s['.name'] == i then
+ ifc = interface(
+ "%s.network%d" %{s.device, num[s.device] })
+ return false
+ end
+ end
+ end)
+ return ifc
+ end
+end
+
+function get_interfaces(self)
+ local iface
+ local ifaces = { }
+ local seen = { }
+ local nfs = { }
+ local baseof = { }
+
+ -- find normal interfaces
+ _uci_real:foreach("network", "interface",
+ function(s)
+ for iface in utl.imatch(s.ifname) do
+ if not _iface_ignore(iface) and not _wifi_iface(iface) then
+ seen[iface] = true
+ nfs[iface] = interface(iface)
+ end
+ end
+ end)
+
+ for iface in utl.kspairs(_interfaces) do
+ if not (seen[iface] or _iface_ignore(iface) or _wifi_iface(iface)) then
+ nfs[iface] = interface(iface)
+ end
+ end
+
+ -- find vlan interfaces
+ _uci_real:foreach("network", "switch_vlan",
+ function(s)
+ if not s.device then
+ return
+ end
+
+ local base = baseof[s.device]
+ if not base then
+ if not s.device:match("^eth%d") then
+ local l
+ for l in utl.execi("swconfig dev %q help 2>/dev/null" % s.device) do
+ if not base then
+ base = l:match("^%w+: (%w+)")
+ end
+ end
+ if not base or not base:match("^eth%d") then
+ base = "eth0"
+ end
+ else
+ base = s.device
+ end
+ baseof[s.device] = base
+ end
+
+ local vid = tonumber(s.vid or s.vlan)
+ if vid ~= nil and vid >= 0 and vid <= 4095 then
+ local iface = "%s.%d" %{ base, vid }
+ if not seen[iface] then
+ seen[iface] = true
+ nfs[iface] = interface(iface)
+ end
+ end
+ end)
+
+ for iface in utl.kspairs(nfs) do
+ ifaces[#ifaces+1] = nfs[iface]
+ end
+
+ -- find wifi interfaces
+ local num = { }
+ local wfs = { }
+ _uci_real:foreach("wireless", "wifi-iface",
+ function(s)
+ if s.device then
+ num[s.device] = num[s.device] and num[s.device] + 1 or 1
+ local i = "%s.network%d" %{ s.device, num[s.device] }
+ wfs[i] = interface(i)
+ end
+ end)
+
+ for iface in utl.kspairs(wfs) do
+ ifaces[#ifaces+1] = wfs[iface]
+ end
+
+ return ifaces
+end
+
+function ignore_interface(self, x)
+ return _iface_ignore(x)
+end
+
+function get_wifidev(self, dev)
+ if _uci_real:get("wireless", dev) == "wifi-device" then
+ return wifidev(dev)
+ end
+end
+
+function get_wifidevs(self)
+ local devs = { }
+ local wfd = { }
+
+ _uci_real:foreach("wireless", "wifi-device",
+ function(s) wfd[#wfd+1] = s['.name'] end)
+
+ local dev
+ for _, dev in utl.vspairs(wfd) do
+ devs[#devs+1] = wifidev(dev)
+ end
+
+ return devs
+end
+
+function get_wifinet(self, net)
+ local wnet = _wifi_lookup(net)
+ if wnet then
+ return wifinet(wnet)
+ end
+end
+
+function add_wifinet(self, net, options)
+ if type(options) == "table" and options.device and
+ _uci_real:get("wireless", options.device) == "wifi-device"
+ then
+ local wnet = _uci_real:section("wireless", "wifi-iface", nil, options)
+ return wifinet(wnet)
+ end
+end
+
+function del_wifinet(self, net)
+ local wnet = _wifi_lookup(net)
+ if wnet then
+ _uci_real:delete("wireless", wnet)
+ return true
+ end
+ return false
+end
+
+function get_status_by_route(self, addr, mask)
+ local _, object
+ for _, object in ipairs(_ubus:objects()) do
+ local net = object:match("^network%.interface%.(.+)")
+ if net then
+ local s = _ubus:call(object, "status", {})
+ if s and s.route then
+ local rt
+ for _, rt in ipairs(s.route) do
+ if not rt.table and rt.target == addr and rt.mask == mask then
+ return net, s
+ end
+ end
+ end
+ end
+ end
+end
+
+function get_status_by_address(self, addr)
+ local _, object
+ for _, object in ipairs(_ubus:objects()) do
+ local net = object:match("^network%.interface%.(.+)")
+ if net then
+ local s = _ubus:call(object, "status", {})
+ if s and s['ipv4-address'] then
+ local a
+ for _, a in ipairs(s['ipv4-address']) do
+ if a.address == addr then
+ return net, s
+ end
+ end
+ end
+ if s and s['ipv6-address'] then
+ local a
+ for _, a in ipairs(s['ipv6-address']) do
+ if a.address == addr then
+ return net, s
+ end
+ end
+ end
+ end
+ end
+end
+
+function get_wannet(self)
+ local net = self:get_status_by_route("0.0.0.0", 0)
+ return net and network(net)
+end
+
+function get_wandev(self)
+ local _, stat = self:get_status_by_route("0.0.0.0", 0)
+ return stat and interface(stat.l3_device or stat.device)
+end
+
+function get_wan6net(self)
+ local net = self:get_status_by_route("::", 0)
+ return net and network(net)
+end
+
+function get_wan6dev(self)
+ local _, stat = self:get_status_by_route("::", 0)
+ return stat and interface(stat.l3_device or stat.device)
+end
+
+
+function network(name, proto)
+ if name then
+ local p = proto or _uci_real:get("network", name, "proto")
+ local c = p and _protocols[p] or protocol
+ return c(name)
+ end
+end
+
+function protocol.__init__(self, name)
+ self.sid = name
+end
+
+function protocol._get(self, opt)
+ local v = _uci_real:get("network", self.sid, opt)
+ if type(v) == "table" then
+ return table.concat(v, " ")
+ end
+ return v or ""
+end
+
+function protocol._ubus(self, field)
+ if not _ubusnetcache[self.sid] then
+ _ubusnetcache[self.sid] = _ubus:call("network.interface.%s" % self.sid,
+ "status", { })
+ end
+ if _ubusnetcache[self.sid] and field then
+ return _ubusnetcache[self.sid][field]
+ end
+ return _ubusnetcache[self.sid]
+end
+
+function protocol.get(self, opt)
+ return _get("network", self.sid, opt)
+end
+
+function protocol.set(self, opt, val)
+ return _set("network", self.sid, opt, val)
+end
+
+function protocol.ifname(self)
+ local ifname
+ if self:is_floating() then
+ ifname = self:_ubus("l3_device")
+ else
+ ifname = self:_ubus("device")
+ end
+ if not ifname then
+ local num = { }
+ _uci_real:foreach("wireless", "wifi-iface",
+ function(s)
+ if s.device then
+ num[s.device] = num[s.device]
+ and num[s.device] + 1 or 1
+
+ local net
+ for net in utl.imatch(s.network) do
+ if net == self.sid then
+ ifname = "%s.network%d" %{ s.device, num[s.device] }
+ return false
+ end
+ end
+ end
+ end)
+ end
+ return ifname
+end
+
+function protocol.proto(self)
+ return "none"
+end
+
+function protocol.get_i18n(self)
+ local p = self:proto()
+ if p == "none" then
+ return lng.translate("Unmanaged")
+ elseif p == "static" then
+ return lng.translate("Static address")
+ elseif p == "dhcp" then
+ return lng.translate("DHCP client")
+ else
+ return lng.translate("Unknown")
+ end
+end
+
+function protocol.type(self)
+ return self:_get("type")
+end
+
+function protocol.name(self)
+ return self.sid
+end
+
+function protocol.uptime(self)
+ return self:_ubus("uptime") or 0
+end
+
+function protocol.expires(self)
+ local a = tonumber(_uci_state:get("network", self.sid, "lease_acquired"))
+ local l = tonumber(_uci_state:get("network", self.sid, "lease_lifetime"))
+ if a and l then
+ l = l - (nxo.sysinfo().uptime - a)
+ return l > 0 and l or 0
+ end
+ return -1
+end
+
+function protocol.metric(self)
+ return tonumber(_uci_state:get("network", self.sid, "metric")) or 0
+end
+
+function protocol.ipaddr(self)
+ local addrs = self:_ubus("ipv4-address")
+ return addrs and #addrs > 0 and addrs[1].address
+end
+
+function protocol.netmask(self)
+ local addrs = self:_ubus("ipv4-address")
+ return addrs and #addrs > 0 and
+ ipc.IPv4("0.0.0.0/%d" % addrs[1].mask):mask():string()
+end
+
+function protocol.gwaddr(self)
+ local _, route
+ for _, route in ipairs(self:_ubus("route") or { }) do
+ if route.target == "0.0.0.0" and route.mask == 0 then
+ return route.nexthop
+ end
+ end
+end
+
+function protocol.dnsaddrs(self)
+ local dns = { }
+ local _, addr
+ for _, addr in ipairs(self:_ubus("dns-server") or { }) do
+ if not addr:match(":") then
+ dns[#dns+1] = addr
+ end
+ end
+ return dns
+end
+
+function protocol.ip6addr(self)
+ local addrs = self:_ubus("ipv6-address")
+ if addrs and #addrs > 0 then
+ return "%s/%d" %{ addrs[1].address, addrs[1].mask }
+ else
+ addrs = self:_ubus("ipv6-prefix-assignment")
+ if addrs and #addrs > 0 then
+ return "%s/%d" %{ addrs[1].address, addrs[1].mask }
+ end
+ end
+end
+
+function protocol.gw6addr(self)
+ local _, route
+ for _, route in ipairs(self:_ubus("route") or { }) do
+ if route.target == "::" and route.mask == 0 then
+ return ipc.IPv6(route.nexthop):string()
+ end
+ end
+end
+
+function protocol.dns6addrs(self)
+ local dns = { }
+ local _, addr
+ for _, addr in ipairs(self:_ubus("dns-server") or { }) do
+ if addr:match(":") then
+ dns[#dns+1] = addr
+ end
+ end
+ return dns
+end
+
+function protocol.is_bridge(self)
+ return (not self:is_virtual() and self:type() == "bridge")
+end
+
+function protocol.opkg_package(self)
+ return nil
+end
+
+function protocol.is_installed(self)
+ return true
+end
+
+function protocol.is_virtual(self)
+ return false
+end
+
+function protocol.is_floating(self)
+ return false
+end
+
+function protocol.is_empty(self)
+ if self:is_floating() then
+ return false
+ else
+ local rv = true
+
+ if (self:_get("ifname") or ""):match("%S+") then
+ rv = false
+ end
+
+ _uci_real:foreach("wireless", "wifi-iface",
+ function(s)
+ local n
+ for n in utl.imatch(s.network) do
+ if n == self.sid then
+ rv = false
+ return false
+ end
+ end
+ end)
+
+ return rv
+ end
+end
+
+function protocol.add_interface(self, ifname)
+ ifname = _M:ifnameof(ifname)
+ if ifname and not self:is_floating() then
+ -- if its a wifi interface, change its network option
+ local wif = _wifi_lookup(ifname)
+ if wif then
+ _append("wireless", wif, "network", self.sid)
+
+ -- add iface to our iface list
+ else
+ _append("network", self.sid, "ifname", ifname)
+ end
+ end
+end
+
+function protocol.del_interface(self, ifname)
+ ifname = _M:ifnameof(ifname)
+ if ifname and not self:is_floating() then
+ -- if its a wireless interface, clear its network option
+ local wif = _wifi_lookup(ifname)
+ if wif then _filter("wireless", wif, "network", self.sid) end
+
+ -- remove the interface
+ _filter("network", self.sid, "ifname", ifname)
+ end
+end
+
+function protocol.get_interface(self)
+ if self:is_virtual() then
+ _tunnel[self:proto() .. "-" .. self.sid] = true
+ return interface(self:proto() .. "-" .. self.sid, self)
+ elseif self:is_bridge() then
+ _bridge["br-" .. self.sid] = true
+ return interface("br-" .. self.sid, self)
+ else
+ local ifn = nil
+ local num = { }
+ for ifn in utl.imatch(_uci_real:get("network", self.sid, "ifname")) do
+ ifn = ifn:match("^[^:/]+")
+ return ifn and interface(ifn, self)
+ end
+ ifn = nil
+ _uci_real:foreach("wireless", "wifi-iface",
+ function(s)
+ if s.device then
+ num[s.device] = num[s.device] and num[s.device] + 1 or 1
+
+ local net
+ for net in utl.imatch(s.network) do
+ if net == self.sid then
+ ifn = "%s.network%d" %{ s.device, num[s.device] }
+ return false
+ end
+ end
+ end
+ end)
+ return ifn and interface(ifn, self)
+ end
+end
+
+function protocol.get_interfaces(self)
+ if self:is_bridge() or (self:is_virtual() and not self:is_floating()) then
+ local ifaces = { }
+
+ local ifn
+ local nfs = { }
+ for ifn in utl.imatch(self:get("ifname")) do
+ ifn = ifn:match("^[^:/]+")
+ nfs[ifn] = interface(ifn, self)
+ end
+
+ for ifn in utl.kspairs(nfs) do
+ ifaces[#ifaces+1] = nfs[ifn]
+ end
+
+ local num = { }
+ local wfs = { }
+ _uci_real:foreach("wireless", "wifi-iface",
+ function(s)
+ if s.device then
+ num[s.device] = num[s.device] and num[s.device] + 1 or 1
+
+ local net
+ for net in utl.imatch(s.network) do
+ if net == self.sid then
+ ifn = "%s.network%d" %{ s.device, num[s.device] }
+ wfs[ifn] = interface(ifn, self)
+ end
+ end
+ end
+ end)
+
+ for ifn in utl.kspairs(wfs) do
+ ifaces[#ifaces+1] = wfs[ifn]
+ end
+
+ return ifaces
+ end
+end
+
+function protocol.contains_interface(self, ifname)
+ ifname = _M:ifnameof(ifname)
+ if not ifname then
+ return false
+ elseif self:is_virtual() and self:proto() .. "-" .. self.sid == ifname then
+ return true
+ elseif self:is_bridge() and "br-" .. self.sid == ifname then
+ return true
+ else
+ local ifn
+ for ifn in utl.imatch(self:get("ifname")) do
+ ifn = ifn:match("[^:]+")
+ if ifn == ifname then
+ return true
+ end
+ end
+
+ local wif = _wifi_lookup(ifname)
+ if wif then
+ local n
+ for n in utl.imatch(_uci_real:get("wireless", wif, "network")) do
+ if n == self.sid then
+ return true
+ end
+ end
+ end
+ end
+
+ return false
+end
+
+function protocol.adminlink(self)
+ return dsp.build_url("admin", "network", "network", self.sid)
+end
+
+
+interface = utl.class()
+
+function interface.__init__(self, ifname, network)
+ local wif = _wifi_lookup(ifname)
+ if wif then
+ self.wif = wifinet(wif)
+ self.ifname = _wifi_state("section", wif, "ifname")
+ end
+
+ self.ifname = self.ifname or ifname
+ self.dev = _interfaces[self.ifname]
+ self.network = network
+end
+
+function interface._ubus(self, field)
+ if not _ubusdevcache[self.ifname] then
+ _ubusdevcache[self.ifname] = _ubus:call("network.device", "status",
+ { name = self.ifname })
+ end
+ if _ubusdevcache[self.ifname] and field then
+ return _ubusdevcache[self.ifname][field]
+ end
+ return _ubusdevcache[self.ifname]
+end
+
+function interface.name(self)
+ return self.wif and self.wif:ifname() or self.ifname
+end
+
+function interface.mac(self)
+ return (self:_ubus("macaddr") or "00:00:00:00:00:00"):upper()
+end
+
+function interface.ipaddrs(self)
+ return self.dev and self.dev.ipaddrs or { }
+end
+
+function interface.ip6addrs(self)
+ return self.dev and self.dev.ip6addrs or { }
+end
+
+function interface.type(self)
+ if self.wif or _wifi_iface(self.ifname) then
+ return "wifi"
+ elseif _bridge[self.ifname] then
+ return "bridge"
+ elseif _tunnel[self.ifname] then
+ return "tunnel"
+ elseif self.ifname:match("%.") then
+ return "vlan"
+ elseif _switch[self.ifname] then
+ return "switch"
+ else
+ return "ethernet"
+ end
+end
+
+function interface.shortname(self)
+ if self.wif then
+ return "%s %q" %{
+ self.wif:active_mode(),
+ self.wif:active_ssid() or self.wif:active_bssid()
+ }
+ else
+ return self.ifname
+ end
+end
+
+function interface.get_i18n(self)
+ if self.wif then
+ return "%s: %s %q" %{
+ lng.translate("Wireless Network"),
+ self.wif:active_mode(),
+ self.wif:active_ssid() or self.wif:active_bssid()
+ }
+ else
+ return "%s: %q" %{ self:get_type_i18n(), self:name() }
+ end
+end
+
+function interface.get_type_i18n(self)
+ local x = self:type()
+ if x == "wifi" then
+ return lng.translate("Wireless Adapter")
+ elseif x == "bridge" then
+ return lng.translate("Bridge")
+ elseif x == "switch" then
+ return lng.translate("Ethernet Switch")
+ elseif x == "vlan" then
+ return lng.translate("VLAN Interface")
+ elseif x == "tunnel" then
+ return lng.translate("Tunnel Interface")
+ else
+ return lng.translate("Ethernet Adapter")
+ end
+end
+
+function interface.adminlink(self)
+ if self.wif then
+ return self.wif:adminlink()
+ end
+end
+
+function interface.ports(self)
+ local members = self:_ubus("bridge-members")
+ if members then
+ local _, iface
+ local ifaces = { }
+ for _, iface in ipairs(members) do
+ ifaces[#ifaces+1] = interface(iface)
+ end
+ end
+end
+
+function interface.bridge_id(self)
+ if self.br then
+ return self.br.id
+ else
+ return nil
+ end
+end
+
+function interface.bridge_stp(self)
+ if self.br then
+ return self.br.stp
+ else
+ return false
+ end
+end
+
+function interface.is_up(self)
+ return self:_ubus("up") or false
+end
+
+function interface.is_bridge(self)
+ return (self:type() == "bridge")
+end
+
+function interface.is_bridgeport(self)
+ return self.dev and self.dev.bridge and true or false
+end
+
+function interface.tx_bytes(self)
+ local stat = self:_ubus("statistics")
+ return stat and stat.tx_bytes or 0
+end
+
+function interface.rx_bytes(self)
+ local stat = self:_ubus("statistics")
+ return stat and stat.rx_bytes or 0
+end
+
+function interface.tx_packets(self)
+ local stat = self:_ubus("statistics")
+ return stat and stat.tx_packets or 0
+end
+
+function interface.rx_packets(self)
+ local stat = self:_ubus("statistics")
+ return stat and stat.rx_packets or 0
+end
+
+function interface.get_network(self)
+ return self:get_networks()[1]
+end
+
+function interface.get_networks(self)
+ if not self.networks then
+ local nets = { }
+ local _, net
+ for _, net in ipairs(_M:get_networks()) do
+ if net:contains_interface(self.ifname) or
+ net:ifname() == self.ifname
+ then
+ nets[#nets+1] = net
+ end
+ end
+ table.sort(nets, function(a, b) return a.sid < b.sid end)
+ self.networks = nets
+ return nets
+ else
+ return self.networks
+ end
+end
+
+function interface.get_wifinet(self)
+ return self.wif
+end
+
+
+wifidev = utl.class()
+
+function wifidev.__init__(self, dev)
+ self.sid = dev
+ self.iwinfo = dev and sys.wifi.getiwinfo(dev) or { }
+end
+
+function wifidev.get(self, opt)
+ return _get("wireless", self.sid, opt)
+end
+
+function wifidev.set(self, opt, val)
+ return _set("wireless", self.sid, opt, val)
+end
+
+function wifidev.name(self)
+ return self.sid
+end
+
+function wifidev.hwmodes(self)
+ local l = self.iwinfo.hwmodelist
+ if l and next(l) then
+ return l
+ else
+ return { b = true, g = true }
+ end
+end
+
+function wifidev.get_i18n(self)
+ local t = "Generic"
+ if self.iwinfo.type == "wl" then
+ t = "Broadcom"
+ elseif self.iwinfo.type == "madwifi" then
+ t = "Atheros"
+ end
+
+ local m = ""
+ local l = self:hwmodes()
+ if l.a then m = m .. "a" end
+ if l.b then m = m .. "b" end
+ if l.g then m = m .. "g" end
+ if l.n then m = m .. "n" end
+
+ return "%s 802.11%s Wireless Controller (%s)" %{ t, m, self:name() }
+end
+
+function wifidev.is_up(self)
+ if _ubuswificache[self.sid] then
+ return (_ubuswificache[self.sid].up == true)
+ end
+
+ local up = false
+ _uci_state:foreach("wireless", "wifi-iface",
+ function(s)
+ if s.device == self.sid then
+ if s.up == "1" then
+ up = true
+ return false
+ end
+ end
+ end)
+
+ return up
+end
+
+function wifidev.get_wifinet(self, net)
+ if _uci_real:get("wireless", net) == "wifi-iface" then
+ return wifinet(net)
+ else
+ local wnet = _wifi_lookup(net)
+ if wnet then
+ return wifinet(wnet)
+ end
+ end
+end
+
+function wifidev.get_wifinets(self)
+ local nets = { }
+
+ _uci_real:foreach("wireless", "wifi-iface",
+ function(s)
+ if s.device == self.sid then
+ nets[#nets+1] = wifinet(s['.name'])
+ end
+ end)
+
+ return nets
+end
+
+function wifidev.add_wifinet(self, options)
+ options = options or { }
+ options.device = self.sid
+
+ local wnet = _uci_real:section("wireless", "wifi-iface", nil, options)
+ if wnet then
+ return wifinet(wnet, options)
+ end
+end
+
+function wifidev.del_wifinet(self, net)
+ if utl.instanceof(net, wifinet) then
+ net = net.sid
+ elseif _uci_real:get("wireless", net) ~= "wifi-iface" then
+ net = _wifi_lookup(net)
+ end
+
+ if net and _uci_real:get("wireless", net, "device") == self.sid then
+ _uci_real:delete("wireless", net)
+ return true
+ end
+
+ return false
+end
+
+
+wifinet = utl.class()
+
+function wifinet.__init__(self, net, data)
+ self.sid = net
+
+ local num = { }
+ local netid
+ _uci_real:foreach("wireless", "wifi-iface",
+ function(s)
+ if s.device then
+ num[s.device] = num[s.device] and num[s.device] + 1 or 1
+ if s['.name'] == self.sid then
+ netid = "%s.network%d" %{ s.device, num[s.device] }
+ return false
+ end
+ end
+ end)
+
+ local dev = _wifi_state("section", self.sid, "ifname") or netid
+
+ self.netid = netid
+ self.wdev = dev
+ self.iwinfo = dev and sys.wifi.getiwinfo(dev) or { }
+ self.iwdata = data or _uci_state:get_all("wireless", self.sid) or
+ _uci_real:get_all("wireless", self.sid) or { }
+end
+
+function wifinet.get(self, opt)
+ return _get("wireless", self.sid, opt)
+end
+
+function wifinet.set(self, opt, val)
+ return _set("wireless", self.sid, opt, val)
+end
+
+function wifinet.mode(self)
+ return _uci_state:get("wireless", self.sid, "mode") or "ap"
+end
+
+function wifinet.ssid(self)
+ return _uci_state:get("wireless", self.sid, "ssid")
+end
+
+function wifinet.bssid(self)
+ return _uci_state:get("wireless", self.sid, "bssid")
+end
+
+function wifinet.network(self)
+ return _uci_state:get("wifinet", self.sid, "network")
+end
+
+function wifinet.id(self)
+ return self.netid
+end
+
+function wifinet.name(self)
+ return self.sid
+end
+
+function wifinet.ifname(self)
+ local ifname = self.iwinfo.ifname
+ if not ifname or ifname:match("^wifi%d") or ifname:match("^radio%d") then
+ ifname = self.wdev
+ end
+ return ifname
+end
+
+function wifinet.get_device(self)
+ if self.iwdata.device then
+ return wifidev(self.iwdata.device)
+ end
+end
+
+function wifinet.is_up(self)
+ local ifc = self:get_interface()
+ return (ifc and ifc:is_up() or false)
+end
+
+function wifinet.active_mode(self)
+ local m = _stror(self.iwinfo.mode, self.iwdata.mode) or "ap"
+
+ if m == "ap" then m = "Master"
+ elseif m == "sta" then m = "Client"
+ elseif m == "adhoc" then m = "Ad-Hoc"
+ elseif m == "mesh" then m = "Mesh"
+ elseif m == "monitor" then m = "Monitor"
+ end
+
+ return m
+end
+
+function wifinet.active_mode_i18n(self)
+ return lng.translate(self:active_mode())
+end
+
+function wifinet.active_ssid(self)
+ return _stror(self.iwinfo.ssid, self.iwdata.ssid)
+end
+
+function wifinet.active_bssid(self)
+ return _stror(self.iwinfo.bssid, self.iwdata.bssid) or "00:00:00:00:00:00"
+end
+
+function wifinet.active_encryption(self)
+ local enc = self.iwinfo and self.iwinfo.encryption
+ return enc and enc.description or "-"
+end
+
+function wifinet.assoclist(self)
+ return self.iwinfo.assoclist or { }
+end
+
+function wifinet.frequency(self)
+ local freq = self.iwinfo.frequency
+ if freq and freq > 0 then
+ return "%.03f" % (freq / 1000)
+ end
+end
+
+function wifinet.bitrate(self)
+ local rate = self.iwinfo.bitrate
+ if rate and rate > 0 then
+ return (rate / 1000)
+ end
+end
+
+function wifinet.channel(self)
+ return self.iwinfo.channel or
+ tonumber(_uci_state:get("wireless", self.iwdata.device, "channel"))
+end
+
+function wifinet.signal(self)
+ return self.iwinfo.signal or 0
+end
+
+function wifinet.noise(self)
+ return self.iwinfo.noise or 0
+end
+
+function wifinet.country(self)
+ return self.iwinfo.country or "00"
+end
+
+function wifinet.txpower(self)
+ local pwr = (self.iwinfo.txpower or 0)
+ return pwr + self:txpower_offset()
+end
+
+function wifinet.txpower_offset(self)
+ return self.iwinfo.txpower_offset or 0
+end
+
+function wifinet.signal_level(self, s, n)
+ if self:active_bssid() ~= "00:00:00:00:00:00" then
+ local signal = s or self:signal()
+ local noise = n or self:noise()
+
+ if signal < 0 and noise < 0 then
+ local snr = -1 * (noise - signal)
+ return math.floor(snr / 5)
+ else
+ return 0
+ end
+ else
+ return -1
+ end
+end
+
+function wifinet.signal_percent(self)
+ local qc = self.iwinfo.quality or 0
+ local qm = self.iwinfo.quality_max or 0
+
+ if qc > 0 and qm > 0 then
+ return math.floor((100 / qm) * qc)
+ else
+ return 0
+ end
+end
+
+function wifinet.shortname(self)
+ return "%s %q" %{
+ lng.translate(self:active_mode()),
+ self:active_ssid() or self:active_bssid()
+ }
+end
+
+function wifinet.get_i18n(self)
+ return "%s: %s %q (%s)" %{
+ lng.translate("Wireless Network"),
+ lng.translate(self:active_mode()),
+ self:active_ssid() or self:active_bssid(),
+ self:ifname()
+ }
+end
+
+function wifinet.adminlink(self)
+ return dsp.build_url("admin", "network", "wireless", self.netid)
+end
+
+function wifinet.get_network(self)
+ return self:get_networks()[1]
+end
+
+function wifinet.get_networks(self)
+ local nets = { }
+ local net
+ for net in utl.imatch(tostring(self.iwdata.network)) do
+ if _uci_real:get("network", net) == "interface" then
+ nets[#nets+1] = network(net)
+ end
+ end
+ table.sort(nets, function(a, b) return a.sid < b.sid end)
+ return nets
+end
+
+function wifinet.get_interface(self)
+ return interface(self:ifname())
+end
+
+
+-- setup base protocols
+_M:register_protocol("static")
+_M:register_protocol("dhcp")
+_M:register_protocol("none")
+
+-- load protocol extensions
+local exts = nfs.dir(utl.libpath() .. "/model/network")
+if exts then
+ local ext
+ for ext in exts do
+ if ext:match("%.lua$") then
+ require("luci.model.network." .. ext:gsub("%.lua$", ""))
+ end
+ end
+end
--- /dev/null
+--[[
+LuCI - UCI model
+
+Description:
+Generalized UCI model
+
+FileId:
+$Id$
+
+License:
+Copyright 2008 Steven Barth <steven@midlink.org>
+
+Licensed under the Apache License, Version 2.0 (the "License");
+you may not use this file except in compliance with the License.
+You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+Unless required by applicable law or agreed to in writing, software
+distributed under the License is distributed on an "AS IS" BASIS,
+WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+See the License for the specific language governing permissions and
+limitations under the License.
+
+]]--
+local os = require "os"
+local uci = require "uci"
+local util = require "luci.util"
+local table = require "table"
+
+
+local setmetatable, rawget, rawset = setmetatable, rawget, rawset
+local require, getmetatable = require, getmetatable
+local error, pairs, ipairs = error, pairs, ipairs
+local type, tostring, tonumber, unpack = type, tostring, tonumber, unpack
+
+--- LuCI UCI model library.
+-- The typical workflow for UCI is: Get a cursor instance from the
+-- cursor factory, modify data (via Cursor.add, Cursor.delete, etc.),
+-- save the changes to the staging area via Cursor.save and finally
+-- Cursor.commit the data to the actual config files.
+-- LuCI then needs to Cursor.apply the changes so deamons etc. are
+-- reloaded.
+-- @cstyle instance
+module "luci.model.uci"
+
+--- Create a new UCI-Cursor.
+-- @class function
+-- @name cursor
+-- @return UCI-Cursor
+cursor = uci.cursor
+
+APIVERSION = uci.APIVERSION
+
+--- Create a new Cursor initialized to the state directory.
+-- @return UCI cursor
+function cursor_state()
+ return cursor(nil, "/var/state")
+end
+
+
+inst = cursor()
+inst_state = cursor_state()
+
+local Cursor = getmetatable(inst)
+
+--- Applies UCI configuration changes
+-- @param configlist List of UCI configurations
+-- @param command Don't apply only return the command
+function Cursor.apply(self, configlist, command)
+ configlist = self:_affected(configlist)
+ if command then
+ return { "/sbin/luci-reload", unpack(configlist) }
+ else
+ return os.execute("/sbin/luci-reload %s >/dev/null 2>&1"
+ % table.concat(configlist, " "))
+ end
+end
+
+
+--- Delete all sections of a given type that match certain criteria.
+-- @param config UCI config
+-- @param type UCI section type
+-- @param comparator Function that will be called for each section and
+-- returns a boolean whether to delete the current section (optional)
+function Cursor.delete_all(self, config, stype, comparator)
+ local del = {}
+
+ if type(comparator) == "table" then
+ local tbl = comparator
+ comparator = function(section)
+ for k, v in pairs(tbl) do
+ if section[k] ~= v then
+ return false
+ end
+ end
+ return true
+ end
+ end
+
+ local function helper (section)
+
+ if not comparator or comparator(section) then
+ del[#del+1] = section[".name"]
+ end
+ end
+
+ self:foreach(config, stype, helper)
+
+ for i, j in ipairs(del) do
+ self:delete(config, j)
+ end
+end
+
+--- Create a new section and initialize it with data.
+-- @param config UCI config
+-- @param type UCI section type
+-- @param name UCI section name (optional)
+-- @param values Table of key - value pairs to initialize the section with
+-- @return Name of created section
+function Cursor.section(self, config, type, name, values)
+ local stat = true
+ if name then
+ stat = self:set(config, name, type)
+ else
+ name = self:add(config, type)
+ stat = name and true
+ end
+
+ if stat and values then
+ stat = self:tset(config, name, values)
+ end
+
+ return stat and name
+end
+
+--- Updated the data of a section using data from a table.
+-- @param config UCI config
+-- @param section UCI section name (optional)
+-- @param values Table of key - value pairs to update the section with
+function Cursor.tset(self, config, section, values)
+ local stat = true
+ for k, v in pairs(values) do
+ if k:sub(1, 1) ~= "." then
+ stat = stat and self:set(config, section, k, v)
+ end
+ end
+ return stat
+end
+
+--- Get a boolean option and return it's value as true or false.
+-- @param config UCI config
+-- @param section UCI section name
+-- @param option UCI option
+-- @return Boolean
+function Cursor.get_bool(self, ...)
+ local val = self:get(...)
+ return ( val == "1" or val == "true" or val == "yes" or val == "on" )
+end
+
+--- Get an option or list and return values as table.
+-- @param config UCI config
+-- @param section UCI section name
+-- @param option UCI option
+-- @return UCI value
+function Cursor.get_list(self, config, section, option)
+ if config and section and option then
+ local val = self:get(config, section, option)
+ return ( type(val) == "table" and val or { val } )
+ end
+ return nil
+end
+
+--- Get the given option from the first section with the given type.
+-- @param config UCI config
+-- @param type UCI section type
+-- @param option UCI option (optional)
+-- @param default Default value (optional)
+-- @return UCI value
+function Cursor.get_first(self, conf, stype, opt, def)
+ local rv = def
+
+ self:foreach(conf, stype,
+ function(s)
+ local val = not opt and s['.name'] or s[opt]
+
+ if type(def) == "number" then
+ val = tonumber(val)
+ elseif type(def) == "boolean" then
+ val = (val == "1" or val == "true" or
+ val == "yes" or val == "on")
+ end
+
+ if val ~= nil then
+ rv = val
+ return false
+ end
+ end)
+
+ return rv
+end
+
+--- Set given values as list.
+-- @param config UCI config
+-- @param section UCI section name
+-- @param option UCI option
+-- @param value UCI value
+-- @return Boolean whether operation succeeded
+function Cursor.set_list(self, config, section, option, value)
+ if config and section and option then
+ return self:set(
+ config, section, option,
+ ( type(value) == "table" and value or { value } )
+ )
+ end
+ return false
+end
+
+-- Return a list of initscripts affected by configuration changes.
+function Cursor._affected(self, configlist)
+ configlist = type(configlist) == "table" and configlist or {configlist}
+
+ local c = cursor()
+ c:load("ucitrack")
+
+ -- Resolve dependencies
+ local reloadlist = {}
+
+ local function _resolve_deps(name)
+ local reload = {name}
+ local deps = {}
+
+ c:foreach("ucitrack", name,
+ function(section)
+ if section.affects then
+ for i, aff in ipairs(section.affects) do
+ deps[#deps+1] = aff
+ end
+ end
+ end)
+
+ for i, dep in ipairs(deps) do
+ for j, add in ipairs(_resolve_deps(dep)) do
+ reload[#reload+1] = add
+ end
+ end
+
+ return reload
+ end
+
+ -- Collect initscripts
+ for j, config in ipairs(configlist) do
+ for i, e in ipairs(_resolve_deps(config)) do
+ if not util.contains(reloadlist, e) then
+ reloadlist[#reloadlist+1] = e
+ end
+ end
+ end
+
+ return reloadlist
+end
+
+--- Create a sub-state of this cursor. The sub-state is tied to the parent
+-- curser, means it the parent unloads or loads configs, the sub state will
+-- do so as well.
+-- @return UCI state cursor tied to the parent cursor
+function Cursor.substate(self)
+ Cursor._substates = Cursor._substates or { }
+ Cursor._substates[self] = Cursor._substates[self] or cursor_state()
+ return Cursor._substates[self]
+end
+
+local _load = Cursor.load
+function Cursor.load(self, ...)
+ if Cursor._substates and Cursor._substates[self] then
+ _load(Cursor._substates[self], ...)
+ end
+ return _load(self, ...)
+end
+
+local _unload = Cursor.unload
+function Cursor.unload(self, ...)
+ if Cursor._substates and Cursor._substates[self] then
+ _unload(Cursor._substates[self], ...)
+ end
+ return _unload(self, ...)
+end
+
+
+--- Add an anonymous section.
+-- @class function
+-- @name Cursor.add
+-- @param config UCI config
+-- @param type UCI section type
+-- @return Name of created section
+
+--- Get a table of saved but uncommitted changes.
+-- @class function
+-- @name Cursor.changes
+-- @param config UCI config
+-- @return Table of changes
+-- @see Cursor.save
+
+--- Commit saved changes.
+-- @class function
+-- @name Cursor.commit
+-- @param config UCI config
+-- @return Boolean whether operation succeeded
+-- @see Cursor.revert
+-- @see Cursor.save
+
+--- Deletes a section or an option.
+-- @class function
+-- @name Cursor.delete
+-- @param config UCI config
+-- @param section UCI section name
+-- @param option UCI option (optional)
+-- @return Boolean whether operation succeeded
+
+--- Call a function for every section of a certain type.
+-- @class function
+-- @name Cursor.foreach
+-- @param config UCI config
+-- @param type UCI section type
+-- @param callback Function to be called
+-- @return Boolean whether operation succeeded
+
+--- Get a section type or an option
+-- @class function
+-- @name Cursor.get
+-- @param config UCI config
+-- @param section UCI section name
+-- @param option UCI option (optional)
+-- @return UCI value
+
+--- Get all sections of a config or all values of a section.
+-- @class function
+-- @name Cursor.get_all
+-- @param config UCI config
+-- @param section UCI section name (optional)
+-- @return Table of UCI sections or table of UCI values
+
+--- Manually load a config.
+-- @class function
+-- @name Cursor.load
+-- @param config UCI config
+-- @return Boolean whether operation succeeded
+-- @see Cursor.save
+-- @see Cursor.unload
+
+--- Revert saved but uncommitted changes.
+-- @class function
+-- @name Cursor.revert
+-- @param config UCI config
+-- @return Boolean whether operation succeeded
+-- @see Cursor.commit
+-- @see Cursor.save
+
+--- Saves changes made to a config to make them committable.
+-- @class function
+-- @name Cursor.save
+-- @param config UCI config
+-- @return Boolean whether operation succeeded
+-- @see Cursor.load
+-- @see Cursor.unload
+
+--- Set a value or create a named section.
+-- @class function
+-- @name Cursor.set
+-- @param config UCI config
+-- @param section UCI section name
+-- @param option UCI option or UCI section type
+-- @param value UCI value or nil if you want to create a section
+-- @return Boolean whether operation succeeded
+
+--- Get the configuration directory.
+-- @class function
+-- @name Cursor.get_confdir
+-- @return Configuration directory
+
+--- Get the directory for uncomitted changes.
+-- @class function
+-- @name Cursor.get_savedir
+-- @return Save directory
+
+--- Set the configuration directory.
+-- @class function
+-- @name Cursor.set_confdir
+-- @param directory UCI configuration directory
+-- @return Boolean whether operation succeeded
+
+--- Set the directory for uncommited changes.
+-- @class function
+-- @name Cursor.set_savedir
+-- @param directory UCI changes directory
+-- @return Boolean whether operation succeeded
+
+--- Discard changes made to a config.
+-- @class function
+-- @name Cursor.unload
+-- @param config UCI config
+-- @return Boolean whether operation succeeded
+-- @see Cursor.load
+-- @see Cursor.save
--- /dev/null
+--[[
+LuCI - SGI-Module for CGI
+
+Description:
+Server Gateway Interface for CGI
+
+FileId:
+$Id$
+
+License:
+Copyright 2008 Steven Barth <steven@midlink.org>
+
+Licensed under the Apache License, Version 2.0 (the "License");
+you may not use this file except in compliance with the License.
+You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+Unless required by applicable law or agreed to in writing, software
+distributed under the License is distributed on an "AS IS" BASIS,
+WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+See the License for the specific language governing permissions and
+limitations under the License.
+
+]]--
+exectime = os.clock()
+module("luci.sgi.cgi", package.seeall)
+local ltn12 = require("luci.ltn12")
+require("nixio.util")
+require("luci.http")
+require("luci.sys")
+require("luci.dispatcher")
+
+-- Limited source to avoid endless blocking
+local function limitsource(handle, limit)
+ limit = limit or 0
+ local BLOCKSIZE = ltn12.BLOCKSIZE
+
+ return function()
+ if limit < 1 then
+ handle:close()
+ return nil
+ else
+ local read = (limit > BLOCKSIZE) and BLOCKSIZE or limit
+ limit = limit - read
+
+ local chunk = handle:read(read)
+ if not chunk then handle:close() end
+ return chunk
+ end
+ end
+end
+
+function run()
+ local r = luci.http.Request(
+ luci.sys.getenv(),
+ limitsource(io.stdin, tonumber(luci.sys.getenv("CONTENT_LENGTH"))),
+ ltn12.sink.file(io.stderr)
+ )
+
+ local x = coroutine.create(luci.dispatcher.httpdispatch)
+ local hcache = ""
+ local active = true
+
+ while coroutine.status(x) ~= "dead" do
+ local res, id, data1, data2 = coroutine.resume(x, r)
+
+ if not res then
+ print("Status: 500 Internal Server Error")
+ print("Content-Type: text/plain\n")
+ print(id)
+ break;
+ end
+
+ if active then
+ if id == 1 then
+ io.write("Status: " .. tostring(data1) .. " " .. data2 .. "\r\n")
+ elseif id == 2 then
+ hcache = hcache .. data1 .. ": " .. data2 .. "\r\n"
+ elseif id == 3 then
+ io.write(hcache)
+ io.write("\r\n")
+ elseif id == 4 then
+ io.write(tostring(data1 or ""))
+ elseif id == 5 then
+ io.flush()
+ io.close()
+ active = false
+ elseif id == 6 then
+ data1:copyz(nixio.stdout, data2)
+ data1:close()
+ end
+ end
+ end
+end
--- /dev/null
+--[[
+LuCI - Server Gateway Interface for the uHTTPd server
+
+Copyright 2010 Jo-Philipp Wich <xm@subsignal.org>
+
+Licensed under the Apache License, Version 2.0 (the "License");
+you may not use this file except in compliance with the License.
+You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+Unless required by applicable law or agreed to in writing, software
+distributed under the License is distributed on an "AS IS" BASIS,
+WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+See the License for the specific language governing permissions and
+limitations under the License.
+
+]]--
+
+require "nixio.util"
+require "luci.http"
+require "luci.sys"
+require "luci.dispatcher"
+require "luci.ltn12"
+
+function handle_request(env)
+ exectime = os.clock()
+ local renv = {
+ CONTENT_LENGTH = env.CONTENT_LENGTH,
+ CONTENT_TYPE = env.CONTENT_TYPE,
+ REQUEST_METHOD = env.REQUEST_METHOD,
+ REQUEST_URI = env.REQUEST_URI,
+ PATH_INFO = env.PATH_INFO,
+ SCRIPT_NAME = env.SCRIPT_NAME:gsub("/+$", ""),
+ SCRIPT_FILENAME = env.SCRIPT_NAME,
+ SERVER_PROTOCOL = env.SERVER_PROTOCOL,
+ QUERY_STRING = env.QUERY_STRING
+ }
+
+ local k, v
+ for k, v in pairs(env.headers) do
+ k = k:upper():gsub("%-", "_")
+ renv["HTTP_" .. k] = v
+ end
+
+ local len = tonumber(env.CONTENT_LENGTH) or 0
+ local function recv()
+ if len > 0 then
+ local rlen, rbuf = uhttpd.recv(4096)
+ if rlen >= 0 then
+ len = len - rlen
+ return rbuf
+ end
+ end
+ return nil
+ end
+
+ local send = uhttpd.send
+
+ local req = luci.http.Request(
+ renv, recv, luci.ltn12.sink.file(io.stderr)
+ )
+
+
+ local x = coroutine.create(luci.dispatcher.httpdispatch)
+ local hcache = { }
+ local active = true
+
+ while coroutine.status(x) ~= "dead" do
+ local res, id, data1, data2 = coroutine.resume(x, req)
+
+ if not res then
+ send("Status: 500 Internal Server Error\r\n")
+ send("Content-Type: text/plain\r\n\r\n")
+ send(tostring(id))
+ break
+ end
+
+ if active then
+ if id == 1 then
+ send("Status: ")
+ send(tostring(data1))
+ send(" ")
+ send(tostring(data2))
+ send("\r\n")
+ elseif id == 2 then
+ hcache[data1] = data2
+ elseif id == 3 then
+ for k, v in pairs(hcache) do
+ send(tostring(k))
+ send(": ")
+ send(tostring(v))
+ send("\r\n")
+ end
+ send("\r\n")
+ elseif id == 4 then
+ send(tostring(data1 or ""))
+ elseif id == 5 then
+ active = false
+ elseif id == 6 then
+ data1:copyz(nixio.stdout, data2)
+ end
+ end
+ end
+end
--- /dev/null
+--[[
+
+LuCI - Lua Development Framework
+(c) 2009 Steven Barth <steven@midlink.org>
+(c) 2009 Jo-Philipp Wich <xm@leipzig.freifunk.net>
+
+Licensed under the Apache License, Version 2.0 (the "License");
+you may not use this file except in compliance with the License.
+You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+]]--
+
+local util = require "luci.util"
+module("luci.store", util.threadlocal)
\ No newline at end of file
--- /dev/null
+--[[
+LuCI - System library
+
+Description:
+Utilities for interaction with the Linux system
+
+FileId:
+$Id$
+
+License:
+Copyright 2008 Steven Barth <steven@midlink.org>
+
+Licensed under the Apache License, Version 2.0 (the "License");
+you may not use this file except in compliance with the License.
+You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+Unless required by applicable law or agreed to in writing, software
+distributed under the License is distributed on an "AS IS" BASIS,
+WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+See the License for the specific language governing permissions and
+limitations under the License.
+
+]]--
+
+
+local io = require "io"
+local os = require "os"
+local table = require "table"
+local nixio = require "nixio"
+local fs = require "nixio.fs"
+local uci = require "luci.model.uci"
+
+local luci = {}
+luci.util = require "luci.util"
+luci.ip = require "luci.ip"
+
+local tonumber, ipairs, pairs, pcall, type, next, setmetatable, require, select =
+ tonumber, ipairs, pairs, pcall, type, next, setmetatable, require, select
+
+
+--- LuCI Linux and POSIX system utilities.
+module "luci.sys"
+
+--- Execute a given shell command and return the error code
+-- @class function
+-- @name call
+-- @param ... Command to call
+-- @return Error code of the command
+function call(...)
+ return os.execute(...) / 256
+end
+
+--- Execute a given shell command and capture its standard output
+-- @class function
+-- @name exec
+-- @param command Command to call
+-- @return String containg the return the output of the command
+exec = luci.util.exec
+
+--- Retrieve information about currently mounted file systems.
+-- @return Table containing mount information
+function mounts()
+ local data = {}
+ local k = {"fs", "blocks", "used", "available", "percent", "mountpoint"}
+ local ps = luci.util.execi("df")
+
+ if not ps then
+ return
+ else
+ ps()
+ end
+
+ for line in ps do
+ local row = {}
+
+ local j = 1
+ for value in line:gmatch("[^%s]+") do
+ row[k[j]] = value
+ j = j + 1
+ end
+
+ if row[k[1]] then
+
+ -- this is a rather ugly workaround to cope with wrapped lines in
+ -- the df output:
+ --
+ -- /dev/scsi/host0/bus0/target0/lun0/part3
+ -- 114382024 93566472 15005244 86% /mnt/usb
+ --
+
+ if not row[k[2]] then
+ j = 2
+ line = ps()
+ for value in line:gmatch("[^%s]+") do
+ row[k[j]] = value
+ j = j + 1
+ end
+ end
+
+ table.insert(data, row)
+ end
+ end
+
+ return data
+end
+
+--- Retrieve environment variables. If no variable is given then a table
+-- containing the whole environment is returned otherwise this function returns
+-- the corresponding string value for the given name or nil if no such variable
+-- exists.
+-- @class function
+-- @name getenv
+-- @param var Name of the environment variable to retrieve (optional)
+-- @return String containg the value of the specified variable
+-- @return Table containing all variables if no variable name is given
+getenv = nixio.getenv
+
+--- Get or set the current hostname.
+-- @param String containing a new hostname to set (optional)
+-- @return String containing the system hostname
+function hostname(newname)
+ if type(newname) == "string" and #newname > 0 then
+ fs.writefile( "/proc/sys/kernel/hostname", newname )
+ return newname
+ else
+ return nixio.uname().nodename
+ end
+end
+
+--- Returns the contents of a documented referred by an URL.
+-- @param url The URL to retrieve
+-- @param stream Return a stream instead of a buffer
+-- @param target Directly write to target file name
+-- @return String containing the contents of given the URL
+function httpget(url, stream, target)
+ if not target then
+ local source = stream and io.popen or luci.util.exec
+ return source("wget -qO- '"..url:gsub("'", "").."'")
+ else
+ return os.execute("wget -qO '%s' '%s'" %
+ {target:gsub("'", ""), url:gsub("'", "")})
+ end
+end
+
+--- Returns the system load average values.
+-- @return String containing the average load value 1 minute ago
+-- @return String containing the average load value 5 minutes ago
+-- @return String containing the average load value 15 minutes ago
+function loadavg()
+ local info = nixio.sysinfo()
+ return info.loads[1], info.loads[2], info.loads[3]
+end
+
+--- Initiate a system reboot.
+-- @return Return value of os.execute()
+function reboot()
+ return os.execute("reboot >/dev/null 2>&1")
+end
+
+--- Returns the system type, cpu name and installed physical memory.
+-- @return String containing the system or platform identifier
+-- @return String containing hardware model information
+-- @return String containing the total memory amount in kB
+-- @return String containing the memory used for caching in kB
+-- @return String containing the memory used for buffering in kB
+-- @return String containing the free memory amount in kB
+-- @return String containing the cpu bogomips (number)
+function sysinfo()
+ local cpuinfo = fs.readfile("/proc/cpuinfo")
+ local meminfo = fs.readfile("/proc/meminfo")
+
+ local memtotal = tonumber(meminfo:match("MemTotal:%s*(%d+)"))
+ local memcached = tonumber(meminfo:match("\nCached:%s*(%d+)"))
+ local memfree = tonumber(meminfo:match("MemFree:%s*(%d+)"))
+ local membuffers = tonumber(meminfo:match("Buffers:%s*(%d+)"))
+ local bogomips = tonumber(cpuinfo:match("[Bb]ogo[Mm][Ii][Pp][Ss].-: ([^\n]+)")) or 0
+ local swaptotal = tonumber(meminfo:match("SwapTotal:%s*(%d+)"))
+ local swapcached = tonumber(meminfo:match("SwapCached:%s*(%d+)"))
+ local swapfree = tonumber(meminfo:match("SwapFree:%s*(%d+)"))
+
+ local system =
+ cpuinfo:match("system type\t+: ([^\n]+)") or
+ cpuinfo:match("Processor\t+: ([^\n]+)") or
+ cpuinfo:match("model name\t+: ([^\n]+)")
+
+ local model =
+ luci.util.pcdata(fs.readfile("/tmp/sysinfo/model")) or
+ cpuinfo:match("machine\t+: ([^\n]+)") or
+ cpuinfo:match("Hardware\t+: ([^\n]+)") or
+ luci.util.pcdata(fs.readfile("/proc/diag/model")) or
+ nixio.uname().machine or
+ system
+
+ return system, model, memtotal, memcached, membuffers, memfree, bogomips, swaptotal, swapcached, swapfree
+end
+
+--- Retrieves the output of the "logread" command.
+-- @return String containing the current log buffer
+function syslog()
+ return luci.util.exec("logread")
+end
+
+--- Retrieves the output of the "dmesg" command.
+-- @return String containing the current log buffer
+function dmesg()
+ return luci.util.exec("dmesg")
+end
+
+--- Generates a random id with specified length.
+-- @param bytes Number of bytes for the unique id
+-- @return String containing hex encoded id
+function uniqueid(bytes)
+ local rand = fs.readfile("/dev/urandom", bytes)
+ return rand and nixio.bin.hexlify(rand)
+end
+
+--- Returns the current system uptime stats.
+-- @return String containing total uptime in seconds
+function uptime()
+ return nixio.sysinfo().uptime
+end
+
+
+--- LuCI system utilities / network related functions.
+-- @class module
+-- @name luci.sys.net
+net = {}
+
+--- Returns the current arp-table entries as two-dimensional table.
+-- @return Table of table containing the current arp entries.
+-- The following fields are defined for arp entry objects:
+-- { "IP address", "HW address", "HW type", "Flags", "Mask", "Device" }
+function net.arptable(callback)
+ local arp = (not callback) and {} or nil
+ local e, r, v
+ if fs.access("/proc/net/arp") then
+ for e in io.lines("/proc/net/arp") do
+ local r = { }, v
+ for v in e:gmatch("%S+") do
+ r[#r+1] = v
+ end
+
+ if r[1] ~= "IP" then
+ local x = {
+ ["IP address"] = r[1],
+ ["HW type"] = r[2],
+ ["Flags"] = r[3],
+ ["HW address"] = r[4],
+ ["Mask"] = r[5],
+ ["Device"] = r[6]
+ }
+
+ if callback then
+ callback(x)
+ else
+ arp = arp or { }
+ arp[#arp+1] = x
+ end
+ end
+ end
+ end
+ return arp
+end
+
+local function _nethints(what, callback)
+ local _, k, e, mac, ip, name
+ local cur = uci.cursor()
+ local ifn = { }
+ local hosts = { }
+
+ local function _add(i, ...)
+ local k = select(i, ...)
+ if k then
+ if not hosts[k] then hosts[k] = { } end
+ hosts[k][1] = select(1, ...) or hosts[k][1]
+ hosts[k][2] = select(2, ...) or hosts[k][2]
+ hosts[k][3] = select(3, ...) or hosts[k][3]
+ hosts[k][4] = select(4, ...) or hosts[k][4]
+ end
+ end
+
+ if fs.access("/proc/net/arp") then
+ for e in io.lines("/proc/net/arp") do
+ ip, mac = e:match("^([%d%.]+)%s+%S+%s+%S+%s+([a-fA-F0-9:]+)%s+")
+ if ip and mac then
+ _add(what, mac:upper(), ip, nil, nil)
+ end
+ end
+ end
+
+ if fs.access("/etc/ethers") then
+ for e in io.lines("/etc/ethers") do
+ mac, ip = e:match("^([a-f0-9]%S+) (%S+)")
+ if mac and ip then
+ _add(what, mac:upper(), ip, nil, nil)
+ end
+ end
+ end
+
+ if fs.access("/var/dhcp.leases") then
+ for e in io.lines("/var/dhcp.leases") do
+ mac, ip, name = e:match("^%d+ (%S+) (%S+) (%S+)")
+ if mac and ip then
+ _add(what, mac:upper(), ip, nil, name ~= "*" and name)
+ end
+ end
+ end
+
+ cur:foreach("dhcp", "host",
+ function(s)
+ for mac in luci.util.imatch(s.mac) do
+ _add(what, mac:upper(), s.ip, nil, s.name)
+ end
+ end)
+
+ for _, e in ipairs(nixio.getifaddrs()) do
+ if e.name ~= "lo" then
+ ifn[e.name] = ifn[e.name] or { }
+ if e.family == "packet" and e.addr and #e.addr == 17 then
+ ifn[e.name][1] = e.addr:upper()
+ elseif e.family == "inet" then
+ ifn[e.name][2] = e.addr
+ elseif e.family == "inet6" then
+ ifn[e.name][3] = e.addr
+ end
+ end
+ end
+
+ for _, e in pairs(ifn) do
+ if e[what] and (e[2] or e[3]) then
+ _add(what, e[1], e[2], e[3], e[4])
+ end
+ end
+
+ for _, e in luci.util.kspairs(hosts) do
+ callback(e[1], e[2], e[3], e[4])
+ end
+end
+
+--- Returns a two-dimensional table of mac address hints.
+-- @return Table of table containing known hosts from various sources.
+-- Each entry contains the values in the following order:
+-- [ "mac", "name" ]
+function net.mac_hints(callback)
+ if callback then
+ _nethints(1, function(mac, v4, v6, name)
+ name = name or nixio.getnameinfo(v4 or v6, nil, 100) or v4
+ if name and name ~= mac then
+ callback(mac, name or nixio.getnameinfo(v4 or v6, nil, 100) or v4)
+ end
+ end)
+ else
+ local rv = { }
+ _nethints(1, function(mac, v4, v6, name)
+ name = name or nixio.getnameinfo(v4 or v6, nil, 100) or v4
+ if name and name ~= mac then
+ rv[#rv+1] = { mac, name or nixio.getnameinfo(v4 or v6, nil, 100) or v4 }
+ end
+ end)
+ return rv
+ end
+end
+
+--- Returns a two-dimensional table of IPv4 address hints.
+-- @return Table of table containing known hosts from various sources.
+-- Each entry contains the values in the following order:
+-- [ "ip", "name" ]
+function net.ipv4_hints(callback)
+ if callback then
+ _nethints(2, function(mac, v4, v6, name)
+ name = name or nixio.getnameinfo(v4, nil, 100) or mac
+ if name and name ~= v4 then
+ callback(v4, name)
+ end
+ end)
+ else
+ local rv = { }
+ _nethints(2, function(mac, v4, v6, name)
+ name = name or nixio.getnameinfo(v4, nil, 100) or mac
+ if name and name ~= v4 then
+ rv[#rv+1] = { v4, name }
+ end
+ end)
+ return rv
+ end
+end
+
+--- Returns a two-dimensional table of IPv6 address hints.
+-- @return Table of table containing known hosts from various sources.
+-- Each entry contains the values in the following order:
+-- [ "ip", "name" ]
+function net.ipv6_hints(callback)
+ if callback then
+ _nethints(3, function(mac, v4, v6, name)
+ name = name or nixio.getnameinfo(v6, nil, 100) or mac
+ if name and name ~= v6 then
+ callback(v6, name)
+ end
+ end)
+ else
+ local rv = { }
+ _nethints(3, function(mac, v4, v6, name)
+ name = name or nixio.getnameinfo(v6, nil, 100) or mac
+ if name and name ~= v6 then
+ rv[#rv+1] = { v6, name }
+ end
+ end)
+ return rv
+ end
+end
+
+--- Returns conntrack information
+-- @return Table with the currently tracked IP connections
+function net.conntrack(callback)
+ local connt = {}
+ if fs.access("/proc/net/nf_conntrack", "r") then
+ for line in io.lines("/proc/net/nf_conntrack") do
+ line = line:match "^(.-( [^ =]+=).-)%2"
+ local entry, flags = _parse_mixed_record(line, " +")
+ if flags[6] ~= "TIME_WAIT" then
+ entry.layer3 = flags[1]
+ entry.layer4 = flags[3]
+ for i=1, #entry do
+ entry[i] = nil
+ end
+
+ if callback then
+ callback(entry)
+ else
+ connt[#connt+1] = entry
+ end
+ end
+ end
+ elseif fs.access("/proc/net/ip_conntrack", "r") then
+ for line in io.lines("/proc/net/ip_conntrack") do
+ line = line:match "^(.-( [^ =]+=).-)%2"
+ local entry, flags = _parse_mixed_record(line, " +")
+ if flags[4] ~= "TIME_WAIT" then
+ entry.layer3 = "ipv4"
+ entry.layer4 = flags[1]
+ for i=1, #entry do
+ entry[i] = nil
+ end
+
+ if callback then
+ callback(entry)
+ else
+ connt[#connt+1] = entry
+ end
+ end
+ end
+ else
+ return nil
+ end
+ return connt
+end
+
+--- Determine the current IPv4 default route. If multiple default routes exist,
+-- return the one with the lowest metric.
+-- @return Table with the properties of the current default route.
+-- The following fields are defined:
+-- { "dest", "gateway", "metric", "refcount", "usecount", "irtt",
+-- "flags", "device" }
+function net.defaultroute()
+ local route
+
+ net.routes(function(rt)
+ if rt.dest:prefix() == 0 and (not route or route.metric > rt.metric) then
+ route = rt
+ end
+ end)
+
+ return route
+end
+
+--- Determine the current IPv6 default route. If multiple default routes exist,
+-- return the one with the lowest metric.
+-- @return Table with the properties of the current default route.
+-- The following fields are defined:
+-- { "source", "dest", "nexthop", "metric", "refcount", "usecount",
+-- "flags", "device" }
+function net.defaultroute6()
+ local route
+
+ net.routes6(function(rt)
+ if rt.dest:prefix() == 0 and rt.device ~= "lo" and
+ (not route or route.metric > rt.metric)
+ then
+ route = rt
+ end
+ end)
+
+ if not route then
+ local global_unicast = luci.ip.IPv6("2000::/3")
+ net.routes6(function(rt)
+ if rt.dest:equal(global_unicast) and
+ (not route or route.metric > rt.metric)
+ then
+ route = rt
+ end
+ end)
+ end
+
+ return route
+end
+
+--- Determine the names of available network interfaces.
+-- @return Table containing all current interface names
+function net.devices()
+ local devs = {}
+ for k, v in ipairs(nixio.getifaddrs()) do
+ if v.family == "packet" then
+ devs[#devs+1] = v.name
+ end
+ end
+ return devs
+end
+
+
+--- Return information about available network interfaces.
+-- @return Table containing all current interface names and their information
+function net.deviceinfo()
+ local devs = {}
+ for k, v in ipairs(nixio.getifaddrs()) do
+ if v.family == "packet" then
+ local d = v.data
+ d[1] = d.rx_bytes
+ d[2] = d.rx_packets
+ d[3] = d.rx_errors
+ d[4] = d.rx_dropped
+ d[5] = 0
+ d[6] = 0
+ d[7] = 0
+ d[8] = d.multicast
+ d[9] = d.tx_bytes
+ d[10] = d.tx_packets
+ d[11] = d.tx_errors
+ d[12] = d.tx_dropped
+ d[13] = 0
+ d[14] = d.collisions
+ d[15] = 0
+ d[16] = 0
+ devs[v.name] = d
+ end
+ end
+ return devs
+end
+
+
+-- Determine the MAC address belonging to the given IP address.
+-- @param ip IPv4 address
+-- @return String containing the MAC address or nil if it cannot be found
+function net.ip4mac(ip)
+ local mac = nil
+ net.arptable(function(e)
+ if e["IP address"] == ip then
+ mac = e["HW address"]
+ end
+ end)
+ return mac
+end
+
+--- Returns the current kernel routing table entries.
+-- @return Table of tables with properties of the corresponding routes.
+-- The following fields are defined for route entry tables:
+-- { "dest", "gateway", "metric", "refcount", "usecount", "irtt",
+-- "flags", "device" }
+function net.routes(callback)
+ local routes = { }
+
+ for line in io.lines("/proc/net/route") do
+
+ local dev, dst_ip, gateway, flags, refcnt, usecnt, metric,
+ dst_mask, mtu, win, irtt = line:match(
+ "([^%s]+)\t([A-F0-9]+)\t([A-F0-9]+)\t([A-F0-9]+)\t" ..
+ "(%d+)\t(%d+)\t(%d+)\t([A-F0-9]+)\t(%d+)\t(%d+)\t(%d+)"
+ )
+
+ if dev then
+ gateway = luci.ip.Hex( gateway, 32, luci.ip.FAMILY_INET4 )
+ dst_mask = luci.ip.Hex( dst_mask, 32, luci.ip.FAMILY_INET4 )
+ dst_ip = luci.ip.Hex(
+ dst_ip, dst_mask:prefix(dst_mask), luci.ip.FAMILY_INET4
+ )
+
+ local rt = {
+ dest = dst_ip,
+ gateway = gateway,
+ metric = tonumber(metric),
+ refcount = tonumber(refcnt),
+ usecount = tonumber(usecnt),
+ mtu = tonumber(mtu),
+ window = tonumber(window),
+ irtt = tonumber(irtt),
+ flags = tonumber(flags, 16),
+ device = dev
+ }
+
+ if callback then
+ callback(rt)
+ else
+ routes[#routes+1] = rt
+ end
+ end
+ end
+
+ return routes
+end
+
+--- Returns the current ipv6 kernel routing table entries.
+-- @return Table of tables with properties of the corresponding routes.
+-- The following fields are defined for route entry tables:
+-- { "source", "dest", "nexthop", "metric", "refcount", "usecount",
+-- "flags", "device" }
+function net.routes6(callback)
+ if fs.access("/proc/net/ipv6_route", "r") then
+ local routes = { }
+
+ for line in io.lines("/proc/net/ipv6_route") do
+
+ local dst_ip, dst_prefix, src_ip, src_prefix, nexthop,
+ metric, refcnt, usecnt, flags, dev = line:match(
+ "([a-f0-9]+) ([a-f0-9]+) " ..
+ "([a-f0-9]+) ([a-f0-9]+) " ..
+ "([a-f0-9]+) ([a-f0-9]+) " ..
+ "([a-f0-9]+) ([a-f0-9]+) " ..
+ "([a-f0-9]+) +([^%s]+)"
+ )
+
+ if dst_ip and dst_prefix and
+ src_ip and src_prefix and
+ nexthop and metric and
+ refcnt and usecnt and
+ flags and dev
+ then
+ src_ip = luci.ip.Hex(
+ src_ip, tonumber(src_prefix, 16), luci.ip.FAMILY_INET6, false
+ )
+
+ dst_ip = luci.ip.Hex(
+ dst_ip, tonumber(dst_prefix, 16), luci.ip.FAMILY_INET6, false
+ )
+
+ nexthop = luci.ip.Hex( nexthop, 128, luci.ip.FAMILY_INET6, false )
+
+ local rt = {
+ source = src_ip,
+ dest = dst_ip,
+ nexthop = nexthop,
+ metric = tonumber(metric, 16),
+ refcount = tonumber(refcnt, 16),
+ usecount = tonumber(usecnt, 16),
+ flags = tonumber(flags, 16),
+ device = dev,
+
+ -- lua number is too small for storing the metric
+ -- add a metric_raw field with the original content
+ metric_raw = metric
+ }
+
+ if callback then
+ callback(rt)
+ else
+ routes[#routes+1] = rt
+ end
+ end
+ end
+
+ return routes
+ end
+end
+
+--- Tests whether the given host responds to ping probes.
+-- @param host String containing a hostname or IPv4 address
+-- @return Number containing 0 on success and >= 1 on error
+function net.pingtest(host)
+ return os.execute("ping -c1 '"..host:gsub("'", '').."' >/dev/null 2>&1")
+end
+
+
+--- LuCI system utilities / process related functions.
+-- @class module
+-- @name luci.sys.process
+process = {}
+
+--- Get the current process id.
+-- @class function
+-- @name process.info
+-- @return Number containing the current pid
+function process.info(key)
+ local s = {uid = nixio.getuid(), gid = nixio.getgid()}
+ return not key and s or s[key]
+end
+
+--- Retrieve information about currently running processes.
+-- @return Table containing process information
+function process.list()
+ local data = {}
+ local k
+ local ps = luci.util.execi("/bin/busybox top -bn1")
+
+ if not ps then
+ return
+ end
+
+ for line in ps do
+ local pid, ppid, user, stat, vsz, mem, cpu, cmd = line:match(
+ "^ *(%d+) +(%d+) +(%S.-%S) +([RSDZTW][W ][<N ]) +(%d+) +(%d+%%) +(%d+%%) +(.+)"
+ )
+
+ local idx = tonumber(pid)
+ if idx then
+ data[idx] = {
+ ['PID'] = pid,
+ ['PPID'] = ppid,
+ ['USER'] = user,
+ ['STAT'] = stat,
+ ['VSZ'] = vsz,
+ ['%MEM'] = mem,
+ ['%CPU'] = cpu,
+ ['COMMAND'] = cmd
+ }
+ end
+ end
+
+ return data
+end
+
+--- Set the gid of a process identified by given pid.
+-- @param gid Number containing the Unix group id
+-- @return Boolean indicating successful operation
+-- @return String containing the error message if failed
+-- @return Number containing the error code if failed
+function process.setgroup(gid)
+ return nixio.setgid(gid)
+end
+
+--- Set the uid of a process identified by given pid.
+-- @param uid Number containing the Unix user id
+-- @return Boolean indicating successful operation
+-- @return String containing the error message if failed
+-- @return Number containing the error code if failed
+function process.setuser(uid)
+ return nixio.setuid(uid)
+end
+
+--- Send a signal to a process identified by given pid.
+-- @class function
+-- @name process.signal
+-- @param pid Number containing the process id
+-- @param sig Signal to send (default: 15 [SIGTERM])
+-- @return Boolean indicating successful operation
+-- @return Number containing the error code if failed
+process.signal = nixio.kill
+
+
+--- LuCI system utilities / user related functions.
+-- @class module
+-- @name luci.sys.user
+user = {}
+
+--- Retrieve user informations for given uid.
+-- @class function
+-- @name getuser
+-- @param uid Number containing the Unix user id
+-- @return Table containing the following fields:
+-- { "uid", "gid", "name", "passwd", "dir", "shell", "gecos" }
+user.getuser = nixio.getpw
+
+--- Retrieve the current user password hash.
+-- @param username String containing the username to retrieve the password for
+-- @return String containing the hash or nil if no password is set.
+-- @return Password database entry
+function user.getpasswd(username)
+ local pwe = nixio.getsp and nixio.getsp(username) or nixio.getpw(username)
+ local pwh = pwe and (pwe.pwdp or pwe.passwd)
+ if not pwh or #pwh < 1 or pwh == "!" or pwh == "x" then
+ return nil, pwe
+ else
+ return pwh, pwe
+ end
+end
+
+--- Test whether given string matches the password of a given system user.
+-- @param username String containing the Unix user name
+-- @param pass String containing the password to compare
+-- @return Boolean indicating wheather the passwords are equal
+function user.checkpasswd(username, pass)
+ local pwh, pwe = user.getpasswd(username)
+ if pwe then
+ return (pwh == nil or nixio.crypt(pass, pwh) == pwh)
+ end
+ return false
+end
+
+--- Change the password of given user.
+-- @param username String containing the Unix user name
+-- @param password String containing the password to compare
+-- @return Number containing 0 on success and >= 1 on error
+function user.setpasswd(username, password)
+ if password then
+ password = password:gsub("'", [['"'"']])
+ end
+
+ if username then
+ username = username:gsub("'", [['"'"']])
+ end
+
+ return os.execute(
+ "(echo '" .. password .. "'; sleep 1; echo '" .. password .. "') | " ..
+ "passwd '" .. username .. "' >/dev/null 2>&1"
+ )
+end
+
+
+--- LuCI system utilities / wifi related functions.
+-- @class module
+-- @name luci.sys.wifi
+wifi = {}
+
+--- Get wireless information for given interface.
+-- @param ifname String containing the interface name
+-- @return A wrapped iwinfo object instance
+function wifi.getiwinfo(ifname)
+ local stat, iwinfo = pcall(require, "iwinfo")
+
+ if ifname then
+ local c = 0
+ local u = uci.cursor_state()
+ local d, n = ifname:match("^(%w+)%.network(%d+)")
+ if d and n then
+ ifname = d
+ n = tonumber(n)
+ u:foreach("wireless", "wifi-iface",
+ function(s)
+ if s.device == d then
+ c = c + 1
+ if c == n then
+ ifname = s.ifname or s.device
+ return false
+ end
+ end
+ end)
+ elseif u:get("wireless", ifname) == "wifi-device" then
+ u:foreach("wireless", "wifi-iface",
+ function(s)
+ if s.device == ifname and s.ifname then
+ ifname = s.ifname
+ return false
+ end
+ end)
+ end
+
+ local t = stat and iwinfo.type(ifname)
+ local x = t and iwinfo[t] or { }
+ return setmetatable({}, {
+ __index = function(t, k)
+ if k == "ifname" then
+ return ifname
+ elseif x[k] then
+ return x[k](ifname)
+ end
+ end
+ })
+ end
+end
+
+
+--- LuCI system utilities / init related functions.
+-- @class module
+-- @name luci.sys.init
+init = {}
+init.dir = "/etc/init.d/"
+
+--- Get the names of all installed init scripts
+-- @return Table containing the names of all inistalled init scripts
+function init.names()
+ local names = { }
+ for name in fs.glob(init.dir.."*") do
+ names[#names+1] = fs.basename(name)
+ end
+ return names
+end
+
+--- Get the index of he given init script
+-- @param name Name of the init script
+-- @return Numeric index value
+function init.index(name)
+ if fs.access(init.dir..name) then
+ return call("env -i sh -c 'source %s%s enabled; exit ${START:-255}' >/dev/null"
+ %{ init.dir, name })
+ end
+end
+
+local function init_action(action, name)
+ if fs.access(init.dir..name) then
+ return call("env -i %s%s %s >/dev/null" %{ init.dir, name, action })
+ end
+end
+
+--- Test whether the given init script is enabled
+-- @param name Name of the init script
+-- @return Boolean indicating whether init is enabled
+function init.enabled(name)
+ return (init_action("enabled", name) == 0)
+end
+
+--- Enable the given init script
+-- @param name Name of the init script
+-- @return Boolean indicating success
+function init.enable(name)
+ return (init_action("enable", name) == 1)
+end
+
+--- Disable the given init script
+-- @param name Name of the init script
+-- @return Boolean indicating success
+function init.disable(name)
+ return (init_action("disable", name) == 0)
+end
+
+--- Start the given init script
+-- @param name Name of the init script
+-- @return Boolean indicating success
+function init.start(name)
+ return (init_action("start", name) == 0)
+end
+
+--- Stop the given init script
+-- @param name Name of the init script
+-- @return Boolean indicating success
+function init.stop(name)
+ return (init_action("stop", name) == 0)
+end
+
+
+-- Internal functions
+
+function _parse_mixed_record(cnt, delimiter)
+ delimiter = delimiter or " "
+ local data = {}
+ local flags = {}
+
+ for i, l in pairs(luci.util.split(luci.util.trim(cnt), "\n")) do
+ for j, f in pairs(luci.util.split(luci.util.trim(l), delimiter, nil, true)) do
+ local k, x, v = f:match('([^%s][^:=]*) *([:=]*) *"*([^\n"]*)"*')
+
+ if k then
+ if x == "" then
+ table.insert(flags, k)
+ else
+ data[k] = v
+ end
+ end
+ end
+ end
+
+ return data, flags
+end
--- /dev/null
+--[[
+
+Iptables parser and query library
+(c) 2008-2009 Jo-Philipp Wich <xm@leipzig.freifunk.net>
+(c) 2008-2009 Steven Barth <steven@midlink.org>
+
+Licensed under the Apache License, Version 2.0 (the "License");
+you may not use this file except in compliance with the License.
+You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+$Id$
+
+]]--
+
+local luci = {}
+luci.util = require "luci.util"
+luci.sys = require "luci.sys"
+luci.ip = require "luci.ip"
+
+local tonumber, ipairs, table = tonumber, ipairs, table
+
+--- LuCI iptables parser and query library
+-- @cstyle instance
+module("luci.sys.iptparser")
+
+--- Create a new iptables parser object.
+-- @class function
+-- @name IptParser
+-- @param family Number specifying the address family. 4 for IPv4, 6 for IPv6
+-- @return IptParser instance
+IptParser = luci.util.class()
+
+function IptParser.__init__( self, family )
+ self._family = (tonumber(family) == 6) and 6 or 4
+ self._rules = { }
+ self._chains = { }
+
+ if self._family == 4 then
+ self._nulladdr = "0.0.0.0/0"
+ self._tables = { "filter", "nat", "mangle", "raw" }
+ self._command = "iptables -t %s --line-numbers -nxvL"
+ else
+ self._nulladdr = "::/0"
+ self._tables = { "filter", "mangle", "raw" }
+ self._command = "ip6tables -t %s --line-numbers -nxvL"
+ end
+
+ self:_parse_rules()
+end
+
+--- Find all firewall rules that match the given criteria. Expects a table with
+-- search criteria as only argument. If args is nil or an empty table then all
+-- rules will be returned.
+--
+-- The following keys in the args table are recognized:
+-- <ul>
+-- <li> table - Match rules that are located within the given table
+-- <li> chain - Match rules that are located within the given chain
+-- <li> target - Match rules with the given target
+-- <li> protocol - Match rules that match the given protocol, rules with
+-- protocol "all" are always matched
+-- <li> source - Match rules with the given source, rules with source
+-- "0.0.0.0/0" (::/0) are always matched
+-- <li> destination - Match rules with the given destination, rules with
+-- destination "0.0.0.0/0" (::/0) are always matched
+-- <li> inputif - Match rules with the given input interface, rules
+-- with input interface "*" (=all) are always matched
+-- <li> outputif - Match rules with the given output interface, rules
+-- with output interface "*" (=all) are always matched
+-- <li> flags - Match rules that match the given flags, current
+-- supported values are "-f" (--fragment)
+-- and "!f" (! --fragment)
+-- <li> options - Match rules containing all given options
+-- </ul>
+-- The return value is a list of tables representing the matched rules.
+-- Each rule table contains the following fields:
+-- <ul>
+-- <li> index - The index number of the rule
+-- <li> table - The table where the rule is located, can be one
+-- of "filter", "nat" or "mangle"
+-- <li> chain - The chain where the rule is located, e.g. "INPUT"
+-- or "postrouting_wan"
+-- <li> target - The rule target, e.g. "REJECT" or "DROP"
+-- <li> protocol The matching protocols, e.g. "all" or "tcp"
+-- <li> flags - Special rule options ("--", "-f" or "!f")
+-- <li> inputif - Input interface of the rule, e.g. "eth0.0"
+-- or "*" for all interfaces
+-- <li> outputif - Output interface of the rule,e.g. "eth0.0"
+-- or "*" for all interfaces
+-- <li> source - The source ip range, e.g. "0.0.0.0/0" (::/0)
+-- <li> destination - The destination ip range, e.g. "0.0.0.0/0" (::/0)
+-- <li> options - A list of specific options of the rule,
+-- e.g. { "reject-with", "tcp-reset" }
+-- <li> packets - The number of packets matched by the rule
+-- <li> bytes - The number of total bytes matched by the rule
+-- </ul>
+-- Example:
+-- <pre>
+-- ip = luci.sys.iptparser.IptParser()
+-- result = ip.find( {
+-- target="REJECT",
+-- protocol="tcp",
+-- options={ "reject-with", "tcp-reset" }
+-- } )
+-- </pre>
+-- This will match all rules with target "-j REJECT",
+-- protocol "-p tcp" (or "-p all")
+-- and the option "--reject-with tcp-reset".
+-- @params args Table containing the search arguments (optional)
+-- @return Table of matching rule tables
+function IptParser.find( self, args )
+
+ local args = args or { }
+ local rv = { }
+
+ args.source = args.source and self:_parse_addr(args.source)
+ args.destination = args.destination and self:_parse_addr(args.destination)
+
+ for i, rule in ipairs(self._rules) do
+ local match = true
+
+ -- match table
+ if not ( not args.table or args.table:lower() == rule.table ) then
+ match = false
+ end
+
+ -- match chain
+ if not ( match == true and (
+ not args.chain or args.chain == rule.chain
+ ) ) then
+ match = false
+ end
+
+ -- match target
+ if not ( match == true and (
+ not args.target or args.target == rule.target
+ ) ) then
+ match = false
+ end
+
+ -- match protocol
+ if not ( match == true and (
+ not args.protocol or rule.protocol == "all" or
+ args.protocol:lower() == rule.protocol
+ ) ) then
+ match = false
+ end
+
+ -- match source
+ if not ( match == true and (
+ not args.source or rule.source == self._nulladdr or
+ self:_parse_addr(rule.source):contains(args.source)
+ ) ) then
+ match = false
+ end
+
+ -- match destination
+ if not ( match == true and (
+ not args.destination or rule.destination == self._nulladdr or
+ self:_parse_addr(rule.destination):contains(args.destination)
+ ) ) then
+ match = false
+ end
+
+ -- match input interface
+ if not ( match == true and (
+ not args.inputif or rule.inputif == "*" or
+ args.inputif == rule.inputif
+ ) ) then
+ match = false
+ end
+
+ -- match output interface
+ if not ( match == true and (
+ not args.outputif or rule.outputif == "*" or
+ args.outputif == rule.outputif
+ ) ) then
+ match = false
+ end
+
+ -- match flags (the "opt" column)
+ if not ( match == true and (
+ not args.flags or rule.flags == args.flags
+ ) ) then
+ match = false
+ end
+
+ -- match specific options
+ if not ( match == true and (
+ not args.options or
+ self:_match_options( rule.options, args.options )
+ ) ) then
+ match = false
+ end
+
+ -- insert match
+ if match == true then
+ rv[#rv+1] = rule
+ end
+ end
+
+ return rv
+end
+
+
+--- Rebuild the internal lookup table, for example when rules have changed
+-- through external commands.
+-- @return nothing
+function IptParser.resync( self )
+ self._rules = { }
+ self._chain = nil
+ self:_parse_rules()
+end
+
+
+--- Find the names of all tables.
+-- @return Table of table names.
+function IptParser.tables( self )
+ return self._tables
+end
+
+
+--- Find the names of all chains within the given table name.
+-- @param table String containing the table name
+-- @return Table of chain names in the order they occur.
+function IptParser.chains( self, table )
+ local lookup = { }
+ local chains = { }
+ for _, r in ipairs(self:find({table=table})) do
+ if not lookup[r.chain] then
+ lookup[r.chain] = true
+ chains[#chains+1] = r.chain
+ end
+ end
+ return chains
+end
+
+
+--- Return the given firewall chain within the given table name.
+-- @param table String containing the table name
+-- @param chain String containing the chain name
+-- @return Table containing the fields "policy", "packets", "bytes"
+-- and "rules". The "rules" field is a table of rule tables.
+function IptParser.chain( self, table, chain )
+ return self._chains[table:lower()] and self._chains[table:lower()][chain]
+end
+
+
+--- Test whether the given target points to a custom chain.
+-- @param target String containing the target action
+-- @return Boolean indicating whether target is a custom chain.
+function IptParser.is_custom_target( self, target )
+ for _, r in ipairs(self._rules) do
+ if r.chain == target then
+ return true
+ end
+ end
+ return false
+end
+
+
+-- [internal] Parse address according to family.
+function IptParser._parse_addr( self, addr )
+ if self._family == 4 then
+ return luci.ip.IPv4(addr)
+ else
+ return luci.ip.IPv6(addr)
+ end
+end
+
+-- [internal] Parse iptables output from all tables.
+function IptParser._parse_rules( self )
+
+ for i, tbl in ipairs(self._tables) do
+
+ self._chains[tbl] = { }
+
+ for i, rule in ipairs(luci.util.execl(self._command % tbl)) do
+
+ if rule:find( "^Chain " ) == 1 then
+
+ local crefs
+ local cname, cpol, cpkt, cbytes = rule:match(
+ "^Chain ([^%s]*) %(policy (%w+) " ..
+ "(%d+) packets, (%d+) bytes%)"
+ )
+
+ if not cname then
+ cname, crefs = rule:match(
+ "^Chain ([^%s]*) %((%d+) references%)"
+ )
+ end
+
+ self._chain = cname
+ self._chains[tbl][cname] = {
+ policy = cpol,
+ packets = tonumber(cpkt or 0),
+ bytes = tonumber(cbytes or 0),
+ references = tonumber(crefs or 0),
+ rules = { }
+ }
+
+ else
+ if rule:find("%d") == 1 then
+
+ local rule_parts = luci.util.split( rule, "%s+", nil, true )
+ local rule_details = { }
+
+ -- cope with rules that have no target assigned
+ if rule:match("^%d+%s+%d+%s+%d+%s%s") then
+ table.insert(rule_parts, 4, nil)
+ end
+
+ -- ip6tables opt column is usually zero-width
+ if self._family == 6 then
+ table.insert(rule_parts, 6, "--")
+ end
+
+ rule_details["table"] = tbl
+ rule_details["chain"] = self._chain
+ rule_details["index"] = tonumber(rule_parts[1])
+ rule_details["packets"] = tonumber(rule_parts[2])
+ rule_details["bytes"] = tonumber(rule_parts[3])
+ rule_details["target"] = rule_parts[4]
+ rule_details["protocol"] = rule_parts[5]
+ rule_details["flags"] = rule_parts[6]
+ rule_details["inputif"] = rule_parts[7]
+ rule_details["outputif"] = rule_parts[8]
+ rule_details["source"] = rule_parts[9]
+ rule_details["destination"] = rule_parts[10]
+ rule_details["options"] = { }
+
+ for i = 11, #rule_parts do
+ if #rule_parts[i] > 0 then
+ rule_details["options"][i-10] = rule_parts[i]
+ end
+ end
+
+ self._rules[#self._rules+1] = rule_details
+
+ self._chains[tbl][self._chain].rules[
+ #self._chains[tbl][self._chain].rules + 1
+ ] = rule_details
+ end
+ end
+ end
+ end
+
+ self._chain = nil
+end
+
+
+-- [internal] Return true if optlist1 contains all elements of optlist 2.
+-- Return false in all other cases.
+function IptParser._match_options( self, o1, o2 )
+
+ -- construct a hashtable of first options list to speed up lookups
+ local oh = { }
+ for i, opt in ipairs( o1 ) do oh[opt] = true end
+
+ -- iterate over second options list
+ -- each string in o2 must be also present in o1
+ -- if o2 contains a string which is not found in o1 then return false
+ for i, opt in ipairs( o2 ) do
+ if not oh[opt] then
+ return false
+ end
+ end
+
+ return true
+end
--- /dev/null
+--[[
+LuCI - Autogenerated Zoneinfo Module
+
+Licensed under the Apache License, Version 2.0 (the "License");
+you may not use this file except in compliance with the License.
+You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+]]--
+
+local setmetatable, require, rawget, rawset = setmetatable, require, rawget, rawset
+
+module "luci.sys.zoneinfo"
+
+setmetatable(_M, {
+ __index = function(t, k)
+ if k == "TZ" and not rawget(t, k) then
+ local m = require "luci.sys.zoneinfo.tzdata"
+ rawset(t, k, rawget(m, k))
+ elseif k == "OFFSET" and not rawget(t, k) then
+ local m = require "luci.sys.zoneinfo.tzoffset"
+ rawset(t, k, rawget(m, k))
+ end
+
+ return rawget(t, k)
+ end
+})
--- /dev/null
+--[[
+LuCI - Autogenerated Zoneinfo Module
+
+Licensed under the Apache License, Version 2.0 (the "License");
+you may not use this file except in compliance with the License.
+You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+]]--
+
+module "luci.sys.zoneinfo.tzdata"
+
+TZ = {
+ { 'Africa/Abidjan', 'GMT0' },
+ { 'Africa/Accra', 'GMT0' },
+ { 'Africa/Addis Ababa', 'EAT-3' },
+ { 'Africa/Algiers', 'CET-1' },
+ { 'Africa/Asmara', 'EAT-3' },
+ { 'Africa/Bamako', 'GMT0' },
+ { 'Africa/Bangui', 'WAT-1' },
+ { 'Africa/Banjul', 'GMT0' },
+ { 'Africa/Bissau', 'GMT0' },
+ { 'Africa/Blantyre', 'CAT-2' },
+ { 'Africa/Brazzaville', 'WAT-1' },
+ { 'Africa/Bujumbura', 'CAT-2' },
+ { 'Africa/Casablanca', 'WET0' },
+ { 'Africa/Ceuta', 'CET-1CEST,M3.5.0,M10.5.0/3' },
+ { 'Africa/Conakry', 'GMT0' },
+ { 'Africa/Dakar', 'GMT0' },
+ { 'Africa/Dar es Salaam', 'EAT-3' },
+ { 'Africa/Djibouti', 'EAT-3' },
+ { 'Africa/Douala', 'WAT-1' },
+ { 'Africa/El Aaiun', 'WET0' },
+ { 'Africa/Freetown', 'GMT0' },
+ { 'Africa/Gaborone', 'CAT-2' },
+ { 'Africa/Harare', 'CAT-2' },
+ { 'Africa/Johannesburg', 'SAST-2' },
+ { 'Africa/Juba', 'EAT-3' },
+ { 'Africa/Kampala', 'EAT-3' },
+ { 'Africa/Khartoum', 'EAT-3' },
+ { 'Africa/Kigali', 'CAT-2' },
+ { 'Africa/Kinshasa', 'WAT-1' },
+ { 'Africa/Lagos', 'WAT-1' },
+ { 'Africa/Libreville', 'WAT-1' },
+ { 'Africa/Lome', 'GMT0' },
+ { 'Africa/Luanda', 'WAT-1' },
+ { 'Africa/Lubumbashi', 'CAT-2' },
+ { 'Africa/Lusaka', 'CAT-2' },
+ { 'Africa/Malabo', 'WAT-1' },
+ { 'Africa/Maputo', 'CAT-2' },
+ { 'Africa/Maseru', 'SAST-2' },
+ { 'Africa/Mbabane', 'SAST-2' },
+ { 'Africa/Mogadishu', 'EAT-3' },
+ { 'Africa/Monrovia', 'GMT0' },
+ { 'Africa/Nairobi', 'EAT-3' },
+ { 'Africa/Ndjamena', 'WAT-1' },
+ { 'Africa/Niamey', 'WAT-1' },
+ { 'Africa/Nouakchott', 'GMT0' },
+ { 'Africa/Ouagadougou', 'GMT0' },
+ { 'Africa/Porto-Novo', 'WAT-1' },
+ { 'Africa/Sao Tome', 'GMT0' },
+ { 'Africa/Tripoli', 'EET-2' },
+ { 'Africa/Tunis', 'CET-1' },
+ { 'Africa/Windhoek', 'WAT-1WAST,M9.1.0,M4.1.0' },
+ { 'America/Adak', 'HAST10HADT,M3.2.0,M11.1.0' },
+ { 'America/Anchorage', 'AKST9AKDT,M3.2.0,M11.1.0' },
+ { 'America/Anguilla', 'AST4' },
+ { 'America/Antigua', 'AST4' },
+ { 'America/Araguaina', 'BRT3' },
+ { 'America/Argentina/Buenos Aires', 'ART3' },
+ { 'America/Argentina/Catamarca', 'ART3' },
+ { 'America/Argentina/Cordoba', 'ART3' },
+ { 'America/Argentina/Jujuy', 'ART3' },
+ { 'America/Argentina/La Rioja', 'ART3' },
+ { 'America/Argentina/Mendoza', 'ART3' },
+ { 'America/Argentina/Rio Gallegos', 'ART3' },
+ { 'America/Argentina/Salta', 'ART3' },
+ { 'America/Argentina/San Juan', 'ART3' },
+ { 'America/Argentina/Tucuman', 'ART3' },
+ { 'America/Argentina/Ushuaia', 'ART3' },
+ { 'America/Aruba', 'AST4' },
+ { 'America/Asuncion', 'PYT4PYST,M10.1.0/0,M4.2.0/0' },
+ { 'America/Atikokan', 'EST5' },
+ { 'America/Bahia', 'BRT3BRST,M10.3.0/0,M2.3.0/0' },
+ { 'America/Bahia Banderas', 'CST6CDT,M4.1.0,M10.5.0' },
+ { 'America/Barbados', 'AST4' },
+ { 'America/Belem', 'BRT3' },
+ { 'America/Belize', 'CST6' },
+ { 'America/Blanc-Sablon', 'AST4' },
+ { 'America/Boa Vista', 'AMT4' },
+ { 'America/Bogota', 'COT5' },
+ { 'America/Boise', 'MST7MDT,M3.2.0,M11.1.0' },
+ { 'America/Cambridge Bay', 'MST7MDT,M3.2.0,M11.1.0' },
+ { 'America/Campo Grande', 'AMT4AMST,M10.3.0/0,M2.3.0/0' },
+ { 'America/Cancun', 'CST6CDT,M4.1.0,M10.5.0' },
+ { 'America/Caracas', 'VET4:30' },
+ { 'America/Cayenne', 'GFT3' },
+ { 'America/Cayman', 'EST5' },
+ { 'America/Chicago', 'CST6CDT,M3.2.0,M11.1.0' },
+ { 'America/Chihuahua', 'MST7MDT,M4.1.0,M10.5.0' },
+ { 'America/Costa Rica', 'CST6' },
+ { 'America/Cuiaba', 'AMT4AMST,M10.3.0/0,M2.3.0/0' },
+ { 'America/Curacao', 'AST4' },
+ { 'America/Danmarkshavn', 'GMT0' },
+ { 'America/Dawson', 'PST8PDT,M3.2.0,M11.1.0' },
+ { 'America/Dawson Creek', 'MST7' },
+ { 'America/Denver', 'MST7MDT,M3.2.0,M11.1.0' },
+ { 'America/Detroit', 'EST5EDT,M3.2.0,M11.1.0' },
+ { 'America/Dominica', 'AST4' },
+ { 'America/Edmonton', 'MST7MDT,M3.2.0,M11.1.0' },
+ { 'America/Eirunepe', 'AMT4' },
+ { 'America/El Salvador', 'CST6' },
+ { 'America/Fortaleza', 'BRT3' },
+ { 'America/Glace Bay', 'AST4ADT,M3.2.0,M11.1.0' },
+ { 'America/Goose Bay', 'AST4ADT,M3.2.0,M11.1.0' },
+ { 'America/Grand Turk', 'EST5EDT,M3.2.0,M11.1.0' },
+ { 'America/Grenada', 'AST4' },
+ { 'America/Guadeloupe', 'AST4' },
+ { 'America/Guatemala', 'CST6' },
+ { 'America/Guayaquil', 'ECT5' },
+ { 'America/Guyana', 'GYT4' },
+ { 'America/Halifax', 'AST4ADT,M3.2.0,M11.1.0' },
+ { 'America/Havana', 'CST5CDT,M3.2.0/0,M10.5.0/1' },
+ { 'America/Hermosillo', 'MST7' },
+ { 'America/Indiana/Indianapolis', 'EST5EDT,M3.2.0,M11.1.0' },
+ { 'America/Indiana/Knox', 'CST6CDT,M3.2.0,M11.1.0' },
+ { 'America/Indiana/Marengo', 'EST5EDT,M3.2.0,M11.1.0' },
+ { 'America/Indiana/Petersburg', 'EST5EDT,M3.2.0,M11.1.0' },
+ { 'America/Indiana/Tell City', 'CST6CDT,M3.2.0,M11.1.0' },
+ { 'America/Indiana/Vevay', 'EST5EDT,M3.2.0,M11.1.0' },
+ { 'America/Indiana/Vincennes', 'EST5EDT,M3.2.0,M11.1.0' },
+ { 'America/Indiana/Winamac', 'EST5EDT,M3.2.0,M11.1.0' },
+ { 'America/Inuvik', 'MST7MDT,M3.2.0,M11.1.0' },
+ { 'America/Iqaluit', 'EST5EDT,M3.2.0,M11.1.0' },
+ { 'America/Jamaica', 'EST5' },
+ { 'America/Juneau', 'AKST9AKDT,M3.2.0,M11.1.0' },
+ { 'America/Kentucky/Louisville', 'EST5EDT,M3.2.0,M11.1.0' },
+ { 'America/Kentucky/Monticello', 'EST5EDT,M3.2.0,M11.1.0' },
+ { 'America/Kralendijk', 'AST4' },
+ { 'America/La Paz', 'BOT4' },
+ { 'America/Lima', 'PET5' },
+ { 'America/Los Angeles', 'PST8PDT,M3.2.0,M11.1.0' },
+ { 'America/Lower Princes', 'AST4' },
+ { 'America/Maceio', 'BRT3' },
+ { 'America/Managua', 'CST6' },
+ { 'America/Manaus', 'AMT4' },
+ { 'America/Marigot', 'AST4' },
+ { 'America/Martinique', 'AST4' },
+ { 'America/Matamoros', 'CST6CDT,M3.2.0,M11.1.0' },
+ { 'America/Mazatlan', 'MST7MDT,M4.1.0,M10.5.0' },
+ { 'America/Menominee', 'CST6CDT,M3.2.0,M11.1.0' },
+ { 'America/Merida', 'CST6CDT,M4.1.0,M10.5.0' },
+ { 'America/Metlakatla', 'MeST8' },
+ { 'America/Mexico City', 'CST6CDT,M4.1.0,M10.5.0' },
+ { 'America/Miquelon', 'PMST3PMDT,M3.2.0,M11.1.0' },
+ { 'America/Moncton', 'AST4ADT,M3.2.0,M11.1.0' },
+ { 'America/Monterrey', 'CST6CDT,M4.1.0,M10.5.0' },
+ { 'America/Montevideo', 'UYT3UYST,M10.1.0,M3.2.0' },
+ { 'America/Montreal', 'EST5EDT,M3.2.0,M11.1.0' },
+ { 'America/Montserrat', 'AST4' },
+ { 'America/Nassau', 'EST5EDT,M3.2.0,M11.1.0' },
+ { 'America/New York', 'EST5EDT,M3.2.0,M11.1.0' },
+ { 'America/Nipigon', 'EST5EDT,M3.2.0,M11.1.0' },
+ { 'America/Nome', 'AKST9AKDT,M3.2.0,M11.1.0' },
+ { 'America/Noronha', 'FNT2' },
+ { 'America/North Dakota/Beulah', 'CST6CDT,M3.2.0,M11.1.0' },
+ { 'America/North Dakota/Center', 'CST6CDT,M3.2.0,M11.1.0' },
+ { 'America/North Dakota/New Salem', 'CST6CDT,M3.2.0,M11.1.0' },
+ { 'America/Ojinaga', 'MST7MDT,M3.2.0,M11.1.0' },
+ { 'America/Panama', 'EST5' },
+ { 'America/Pangnirtung', 'EST5EDT,M3.2.0,M11.1.0' },
+ { 'America/Paramaribo', 'SRT3' },
+ { 'America/Phoenix', 'MST7' },
+ { 'America/Port of Spain', 'AST4' },
+ { 'America/Port-au-Prince', 'EST5' },
+ { 'America/Porto Velho', 'AMT4' },
+ { 'America/Puerto Rico', 'AST4' },
+ { 'America/Rainy River', 'CST6CDT,M3.2.0,M11.1.0' },
+ { 'America/Rankin Inlet', 'CST6CDT,M3.2.0,M11.1.0' },
+ { 'America/Recife', 'BRT3' },
+ { 'America/Regina', 'CST6' },
+ { 'America/Resolute', 'CST6CDT,M3.2.0,M11.1.0' },
+ { 'America/Rio Branco', 'AMT4' },
+ { 'America/Santa Isabel', 'PST8PDT,M4.1.0,M10.5.0' },
+ { 'America/Santarem', 'BRT3' },
+ { 'America/Santo Domingo', 'AST4' },
+ { 'America/Sao Paulo', 'BRT3BRST,M10.3.0/0,M2.3.0/0' },
+ { 'America/Scoresbysund', 'EGT1EGST,M3.5.0/0,M10.5.0/1' },
+ { 'America/Shiprock', 'MST7MDT,M3.2.0,M11.1.0' },
+ { 'America/Sitka', 'AKST9AKDT,M3.2.0,M11.1.0' },
+ { 'America/St Barthelemy', 'AST4' },
+ { 'America/St Johns', 'NST3:30NDT,M3.2.0,M11.1.0' },
+ { 'America/St Kitts', 'AST4' },
+ { 'America/St Lucia', 'AST4' },
+ { 'America/St Thomas', 'AST4' },
+ { 'America/St Vincent', 'AST4' },
+ { 'America/Swift Current', 'CST6' },
+ { 'America/Tegucigalpa', 'CST6' },
+ { 'America/Thule', 'AST4ADT,M3.2.0,M11.1.0' },
+ { 'America/Thunder Bay', 'EST5EDT,M3.2.0,M11.1.0' },
+ { 'America/Tijuana', 'PST8PDT,M3.2.0,M11.1.0' },
+ { 'America/Toronto', 'EST5EDT,M3.2.0,M11.1.0' },
+ { 'America/Tortola', 'AST4' },
+ { 'America/Vancouver', 'PST8PDT,M3.2.0,M11.1.0' },
+ { 'America/Whitehorse', 'PST8PDT,M3.2.0,M11.1.0' },
+ { 'America/Winnipeg', 'CST6CDT,M3.2.0,M11.1.0' },
+ { 'America/Yakutat', 'AKST9AKDT,M3.2.0,M11.1.0' },
+ { 'America/Yellowknife', 'MST7MDT,M3.2.0,M11.1.0' },
+ { 'Antarctica/Casey', 'WST-8' },
+ { 'Antarctica/Davis', 'DAVT-7' },
+ { 'Antarctica/DumontDUrville', 'DDUT-10' },
+ { 'Antarctica/Macquarie', 'MIST-11' },
+ { 'Antarctica/Mawson', 'MAWT-5' },
+ { 'Antarctica/McMurdo', 'NZST-12NZDT,M9.5.0,M4.1.0/3' },
+ { 'Antarctica/Rothera', 'ROTT3' },
+ { 'Antarctica/South Pole', 'NZST-12NZDT,M9.5.0,M4.1.0/3' },
+ { 'Antarctica/Syowa', 'SYOT-3' },
+ { 'Antarctica/Vostok', 'VOST-6' },
+ { 'Arctic/Longyearbyen', 'CET-1CEST,M3.5.0,M10.5.0/3' },
+ { 'Asia/Aden', 'AST-3' },
+ { 'Asia/Almaty', 'ALMT-6' },
+ { 'Asia/Anadyr', 'ANAT-12' },
+ { 'Asia/Aqtau', 'AQTT-5' },
+ { 'Asia/Aqtobe', 'AQTT-5' },
+ { 'Asia/Ashgabat', 'TMT-5' },
+ { 'Asia/Baghdad', 'AST-3' },
+ { 'Asia/Bahrain', 'AST-3' },
+ { 'Asia/Baku', 'AZT-4AZST,M3.5.0/4,M10.5.0/5' },
+ { 'Asia/Bangkok', 'ICT-7' },
+ { 'Asia/Beirut', 'EET-2EEST,M3.5.0/0,M10.5.0/0' },
+ { 'Asia/Bishkek', 'KGT-6' },
+ { 'Asia/Brunei', 'BNT-8' },
+ { 'Asia/Choibalsan', 'CHOT-8' },
+ { 'Asia/Chongqing', 'CST-8' },
+ { 'Asia/Colombo', 'IST-5:30' },
+ { 'Asia/Damascus', 'EET-2EEST,M4.1.5/0,M10.5.5/0' },
+ { 'Asia/Dhaka', 'BDT-6' },
+ { 'Asia/Dili', 'TLT-9' },
+ { 'Asia/Dubai', 'GST-4' },
+ { 'Asia/Dushanbe', 'TJT-5' },
+ { 'Asia/Gaza', 'EET-2' },
+ { 'Asia/Harbin', 'CST-8' },
+ { 'Asia/Hebron', 'EET-2' },
+ { 'Asia/Ho Chi Minh', 'ICT-7' },
+ { 'Asia/Hong Kong', 'HKT-8' },
+ { 'Asia/Hovd', 'HOVT-7' },
+ { 'Asia/Irkutsk', 'IRKT-9' },
+ { 'Asia/Jakarta', 'WIT-7' },
+ { 'Asia/Jayapura', 'EIT-9' },
+ { 'Asia/Kabul', 'AFT-4:30' },
+ { 'Asia/Kamchatka', 'PETT-12' },
+ { 'Asia/Karachi', 'PKT-5' },
+ { 'Asia/Kashgar', 'CST-8' },
+ { 'Asia/Kathmandu', 'NPT-5:45' },
+ { 'Asia/Kolkata', 'IST-5:30' },
+ { 'Asia/Krasnoyarsk', 'KRAT-8' },
+ { 'Asia/Kuala Lumpur', 'MYT-8' },
+ { 'Asia/Kuching', 'MYT-8' },
+ { 'Asia/Kuwait', 'AST-3' },
+ { 'Asia/Macau', 'CST-8' },
+ { 'Asia/Magadan', 'MAGT-12' },
+ { 'Asia/Makassar', 'CIT-8' },
+ { 'Asia/Manila', 'PHT-8' },
+ { 'Asia/Muscat', 'GST-4' },
+ { 'Asia/Nicosia', 'EET-2EEST,M3.5.0/3,M10.5.0/4' },
+ { 'Asia/Novokuznetsk', 'NOVT-7' },
+ { 'Asia/Novosibirsk', 'NOVT-7' },
+ { 'Asia/Omsk', 'OMST-7' },
+ { 'Asia/Oral', 'ORAT-5' },
+ { 'Asia/Phnom Penh', 'ICT-7' },
+ { 'Asia/Pontianak', 'WIT-7' },
+ { 'Asia/Pyongyang', 'KST-9' },
+ { 'Asia/Qatar', 'AST-3' },
+ { 'Asia/Qyzylorda', 'QYZT-6' },
+ { 'Asia/Rangoon', 'MMT-6:30' },
+ { 'Asia/Riyadh', 'AST-3' },
+ { 'Asia/Sakhalin', 'SAKT-11' },
+ { 'Asia/Samarkand', 'UZT-5' },
+ { 'Asia/Seoul', 'KST-9' },
+ { 'Asia/Shanghai', 'CST-8' },
+ { 'Asia/Singapore', 'SGT-8' },
+ { 'Asia/Taipei', 'CST-8' },
+ { 'Asia/Tashkent', 'UZT-5' },
+ { 'Asia/Tbilisi', 'GET-4' },
+ { 'Asia/Thimphu', 'BTT-6' },
+ { 'Asia/Tokyo', 'JST-9' },
+ { 'Asia/Ulaanbaatar', 'ULAT-8' },
+ { 'Asia/Urumqi', 'CST-8' },
+ { 'Asia/Vientiane', 'ICT-7' },
+ { 'Asia/Vladivostok', 'VLAT-11' },
+ { 'Asia/Yakutsk', 'YAKT-10' },
+ { 'Asia/Yekaterinburg', 'YEKT-6' },
+ { 'Asia/Yerevan', 'AMT-4AMST,M3.5.0,M10.5.0/3' },
+ { 'Atlantic/Azores', 'AZOT1AZOST,M3.5.0/0,M10.5.0/1' },
+ { 'Atlantic/Bermuda', 'AST4ADT,M3.2.0,M11.1.0' },
+ { 'Atlantic/Canary', 'WET0WEST,M3.5.0/1,M10.5.0' },
+ { 'Atlantic/Cape Verde', 'CVT1' },
+ { 'Atlantic/Faroe', 'WET0WEST,M3.5.0/1,M10.5.0' },
+ { 'Atlantic/Madeira', 'WET0WEST,M3.5.0/1,M10.5.0' },
+ { 'Atlantic/Reykjavik', 'GMT0' },
+ { 'Atlantic/South Georgia', 'GST2' },
+ { 'Atlantic/St Helena', 'GMT0' },
+ { 'Atlantic/Stanley', 'FKT4FKST,M9.1.0,M4.3.0' },
+ { 'Australia/Adelaide', 'CST-9:30CST,M10.1.0,M4.1.0/3' },
+ { 'Australia/Brisbane', 'EST-10' },
+ { 'Australia/Broken Hill', 'CST-9:30CST,M10.1.0,M4.1.0/3' },
+ { 'Australia/Currie', 'EST-10EST,M10.1.0,M4.1.0/3' },
+ { 'Australia/Darwin', 'CST-9:30' },
+ { 'Australia/Eucla', 'CWST-8:45' },
+ { 'Australia/Hobart', 'EST-10EST,M10.1.0,M4.1.0/3' },
+ { 'Australia/Lindeman', 'EST-10' },
+ { 'Australia/Lord Howe', 'LHST-10:30LHST-11,M10.1.0,M4.1.0' },
+ { 'Australia/Melbourne', 'EST-10EST,M10.1.0,M4.1.0/3' },
+ { 'Australia/Perth', 'WST-8' },
+ { 'Australia/Sydney', 'EST-10EST,M10.1.0,M4.1.0/3' },
+ { 'Europe/Amsterdam', 'CET-1CEST,M3.5.0,M10.5.0/3' },
+ { 'Europe/Andorra', 'CET-1CEST,M3.5.0,M10.5.0/3' },
+ { 'Europe/Athens', 'EET-2EEST,M3.5.0/3,M10.5.0/4' },
+ { 'Europe/Belgrade', 'CET-1CEST,M3.5.0,M10.5.0/3' },
+ { 'Europe/Berlin', 'CET-1CEST,M3.5.0,M10.5.0/3' },
+ { 'Europe/Bratislava', 'CET-1CEST,M3.5.0,M10.5.0/3' },
+ { 'Europe/Brussels', 'CET-1CEST,M3.5.0,M10.5.0/3' },
+ { 'Europe/Bucharest', 'EET-2EEST,M3.5.0/3,M10.5.0/4' },
+ { 'Europe/Budapest', 'CET-1CEST,M3.5.0,M10.5.0/3' },
+ { 'Europe/Chisinau', 'EET-2EEST,M3.5.0/3,M10.5.0/4' },
+ { 'Europe/Copenhagen', 'CET-1CEST,M3.5.0,M10.5.0/3' },
+ { 'Europe/Dublin', 'GMT0IST,M3.5.0/1,M10.5.0' },
+ { 'Europe/Gibraltar', 'CET-1CEST,M3.5.0,M10.5.0/3' },
+ { 'Europe/Guernsey', 'GMT0BST,M3.5.0/1,M10.5.0' },
+ { 'Europe/Helsinki', 'EET-2EEST,M3.5.0/3,M10.5.0/4' },
+ { 'Europe/Isle of Man', 'GMT0BST,M3.5.0/1,M10.5.0' },
+ { 'Europe/Istanbul', 'EET-2EEST,M3.5.0/3,M10.5.0/4' },
+ { 'Europe/Jersey', 'GMT0BST,M3.5.0/1,M10.5.0' },
+ { 'Europe/Kaliningrad', 'FET-3' },
+ { 'Europe/Kiev', 'EET-2EEST,M3.5.0/3,M10.5.0/4' },
+ { 'Europe/Lisbon', 'WET0WEST,M3.5.0/1,M10.5.0' },
+ { 'Europe/Ljubljana', 'CET-1CEST,M3.5.0,M10.5.0/3' },
+ { 'Europe/London', 'GMT0BST,M3.5.0/1,M10.5.0' },
+ { 'Europe/Luxembourg', 'CET-1CEST,M3.5.0,M10.5.0/3' },
+ { 'Europe/Madrid', 'CET-1CEST,M3.5.0,M10.5.0/3' },
+ { 'Europe/Malta', 'CET-1CEST,M3.5.0,M10.5.0/3' },
+ { 'Europe/Mariehamn', 'EET-2EEST,M3.5.0/3,M10.5.0/4' },
+ { 'Europe/Minsk', 'FET-3' },
+ { 'Europe/Monaco', 'CET-1CEST,M3.5.0,M10.5.0/3' },
+ { 'Europe/Moscow', 'MSK-4' },
+ { 'Europe/Oslo', 'CET-1CEST,M3.5.0,M10.5.0/3' },
+ { 'Europe/Paris', 'CET-1CEST,M3.5.0,M10.5.0/3' },
+ { 'Europe/Podgorica', 'CET-1CEST,M3.5.0,M10.5.0/3' },
+ { 'Europe/Prague', 'CET-1CEST,M3.5.0,M10.5.0/3' },
+ { 'Europe/Riga', 'EET-2EEST,M3.5.0/3,M10.5.0/4' },
+ { 'Europe/Rome', 'CET-1CEST,M3.5.0,M10.5.0/3' },
+ { 'Europe/Samara', 'SAMT-4' },
+ { 'Europe/San Marino', 'CET-1CEST,M3.5.0,M10.5.0/3' },
+ { 'Europe/Sarajevo', 'CET-1CEST,M3.5.0,M10.5.0/3' },
+ { 'Europe/Simferopol', 'EET-2EEST,M3.5.0/3,M10.5.0/4' },
+ { 'Europe/Skopje', 'CET-1CEST,M3.5.0,M10.5.0/3' },
+ { 'Europe/Sofia', 'EET-2EEST,M3.5.0/3,M10.5.0/4' },
+ { 'Europe/Stockholm', 'CET-1CEST,M3.5.0,M10.5.0/3' },
+ { 'Europe/Tallinn', 'EET-2EEST,M3.5.0/3,M10.5.0/4' },
+ { 'Europe/Tirane', 'CET-1CEST,M3.5.0,M10.5.0/3' },
+ { 'Europe/Uzhgorod', 'EET-2EEST,M3.5.0/3,M10.5.0/4' },
+ { 'Europe/Vaduz', 'CET-1CEST,M3.5.0,M10.5.0/3' },
+ { 'Europe/Vatican', 'CET-1CEST,M3.5.0,M10.5.0/3' },
+ { 'Europe/Vienna', 'CET-1CEST,M3.5.0,M10.5.0/3' },
+ { 'Europe/Vilnius', 'EET-2EEST,M3.5.0/3,M10.5.0/4' },
+ { 'Europe/Volgograd', 'VOLT-4' },
+ { 'Europe/Warsaw', 'CET-1CEST,M3.5.0,M10.5.0/3' },
+ { 'Europe/Zagreb', 'CET-1CEST,M3.5.0,M10.5.0/3' },
+ { 'Europe/Zaporozhye', 'EET-2EEST,M3.5.0/3,M10.5.0/4' },
+ { 'Europe/Zurich', 'CET-1CEST,M3.5.0,M10.5.0/3' },
+ { 'Indian/Antananarivo', 'EAT-3' },
+ { 'Indian/Chagos', 'IOT-6' },
+ { 'Indian/Christmas', 'CXT-7' },
+ { 'Indian/Cocos', 'CCT-6:30' },
+ { 'Indian/Comoro', 'EAT-3' },
+ { 'Indian/Kerguelen', 'TFT-5' },
+ { 'Indian/Mahe', 'SCT-4' },
+ { 'Indian/Maldives', 'MVT-5' },
+ { 'Indian/Mauritius', 'MUT-4' },
+ { 'Indian/Mayotte', 'EAT-3' },
+ { 'Indian/Reunion', 'RET-4' },
+ { 'Pacific/Apia', 'WST-13' },
+ { 'Pacific/Auckland', 'NZST-12NZDT,M9.5.0,M4.1.0/3' },
+ { 'Pacific/Chatham', 'CHAST-12:45CHADT,M9.5.0/2:45,M4.1.0/3:45' },
+ { 'Pacific/Chuuk', 'CHUT-10' },
+ { 'Pacific/Efate', 'VUT-11' },
+ { 'Pacific/Enderbury', 'PHOT-13' },
+ { 'Pacific/Fakaofo', 'TKT10' },
+ { 'Pacific/Fiji', 'FJT-12' },
+ { 'Pacific/Funafuti', 'TVT-12' },
+ { 'Pacific/Galapagos', 'GALT6' },
+ { 'Pacific/Gambier', 'GAMT9' },
+ { 'Pacific/Guadalcanal', 'SBT-11' },
+ { 'Pacific/Guam', 'ChST-10' },
+ { 'Pacific/Honolulu', 'HST10' },
+ { 'Pacific/Johnston', 'HST10' },
+ { 'Pacific/Kiritimati', 'LINT-14' },
+ { 'Pacific/Kosrae', 'KOST-11' },
+ { 'Pacific/Kwajalein', 'MHT-12' },
+ { 'Pacific/Majuro', 'MHT-12' },
+ { 'Pacific/Marquesas', 'MART9:30' },
+ { 'Pacific/Midway', 'SST11' },
+ { 'Pacific/Nauru', 'NRT-12' },
+ { 'Pacific/Niue', 'NUT11' },
+ { 'Pacific/Norfolk', 'NFT-11:30' },
+ { 'Pacific/Noumea', 'NCT-11' },
+ { 'Pacific/Pago Pago', 'SST11' },
+ { 'Pacific/Palau', 'PWT-9' },
+ { 'Pacific/Pitcairn', 'PST8' },
+ { 'Pacific/Pohnpei', 'PONT-11' },
+ { 'Pacific/Port Moresby', 'PGT-10' },
+ { 'Pacific/Rarotonga', 'CKT10' },
+ { 'Pacific/Saipan', 'ChST-10' },
+ { 'Pacific/Tahiti', 'TAHT10' },
+ { 'Pacific/Tarawa', 'GILT-12' },
+ { 'Pacific/Tongatapu', 'TOT-13' },
+ { 'Pacific/Wake', 'WAKT-12' },
+ { 'Pacific/Wallis', 'WFT-12' },
+}
--- /dev/null
+--[[
+LuCI - Autogenerated Zoneinfo Module
+
+Licensed under the Apache License, Version 2.0 (the "License");
+you may not use this file except in compliance with the License.
+You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+]]--
+
+module "luci.sys.zoneinfo.tzoffset"
+
+OFFSET = {
+ gmt = 0, -- GMT
+ eat = 10800, -- EAT
+ cet = 3600, -- CET
+ wat = 3600, -- WAT
+ cat = 7200, -- CAT
+ wet = 0, -- WET
+ sast = 7200, -- SAST
+ eet = 7200, -- EET
+ hast = -36000, -- HAST
+ hadt = -32400, -- HADT
+ akst = -32400, -- AKST
+ akdt = -28800, -- AKDT
+ ast = -14400, -- AST
+ brt = -10800, -- BRT
+ art = -10800, -- ART
+ pyt = -14400, -- PYT
+ pyst = -10800, -- PYST
+ est = -18000, -- EST
+ cst = -21600, -- CST
+ cdt = -18000, -- CDT
+ amt = -14400, -- AMT
+ cot = -18000, -- COT
+ mst = -25200, -- MST
+ mdt = -21600, -- MDT
+ vet = -16200, -- VET
+ gft = -10800, -- GFT
+ pst = -28800, -- PST
+ pdt = -25200, -- PDT
+ ect = -18000, -- ECT
+ gyt = -14400, -- GYT
+ bot = -14400, -- BOT
+ pet = -18000, -- PET
+ pmst = -10800, -- PMST
+ pmdt = -7200, -- PMDT
+ uyt = -10800, -- UYT
+ uyst = -7200, -- UYST
+ fnt = -7200, -- FNT
+ srt = -10800, -- SRT
+ egt = -3600, -- EGT
+ egst = 0, -- EGST
+ nst = -12600, -- NST
+ ndt = -9000, -- NDT
+ wst = 28800, -- WST
+ davt = 25200, -- DAVT
+ ddut = 36000, -- DDUT
+ mist = 39600, -- MIST
+ mawt = 18000, -- MAWT
+ nzst = 43200, -- NZST
+ nzdt = 46800, -- NZDT
+ rott = -10800, -- ROTT
+ syot = 10800, -- SYOT
+ vost = 21600, -- VOST
+ almt = 21600, -- ALMT
+ anat = 43200, -- ANAT
+ aqtt = 18000, -- AQTT
+ tmt = 18000, -- TMT
+ azt = 14400, -- AZT
+ azst = 18000, -- AZST
+ ict = 25200, -- ICT
+ kgt = 21600, -- KGT
+ bnt = 28800, -- BNT
+ chot = 28800, -- CHOT
+ ist = 19800, -- IST
+ bdt = 21600, -- BDT
+ tlt = 32400, -- TLT
+ gst = 14400, -- GST
+ tjt = 18000, -- TJT
+ hkt = 28800, -- HKT
+ hovt = 25200, -- HOVT
+ irkt = 32400, -- IRKT
+ wit = 25200, -- WIT
+ eit = 32400, -- EIT
+ aft = 16200, -- AFT
+ pett = 43200, -- PETT
+ pkt = 18000, -- PKT
+ npt = 20700, -- NPT
+ krat = 28800, -- KRAT
+ myt = 28800, -- MYT
+ magt = 43200, -- MAGT
+ cit = 28800, -- CIT
+ pht = 28800, -- PHT
+ novt = 25200, -- NOVT
+ omst = 25200, -- OMST
+ orat = 18000, -- ORAT
+ kst = 32400, -- KST
+ qyzt = 21600, -- QYZT
+ mmt = 23400, -- MMT
+ sakt = 39600, -- SAKT
+ uzt = 18000, -- UZT
+ sgt = 28800, -- SGT
+ get = 14400, -- GET
+ btt = 21600, -- BTT
+ jst = 32400, -- JST
+ ulat = 28800, -- ULAT
+ vlat = 39600, -- VLAT
+ yakt = 36000, -- YAKT
+ yekt = 21600, -- YEKT
+ azot = -3600, -- AZOT
+ azost = 0, -- AZOST
+ cvt = -3600, -- CVT
+ fkt = -14400, -- FKT
+ fkst = -10800, -- FKST
+ cwst = 31500, -- CWST
+ lhst = 37800, -- LHST
+ lhst = 39600, -- LHST
+ fet = 10800, -- FET
+ msk = 14400, -- MSK
+ samt = 14400, -- SAMT
+ volt = 14400, -- VOLT
+ iot = 21600, -- IOT
+ cxt = 25200, -- CXT
+ cct = 23400, -- CCT
+ tft = 18000, -- TFT
+ sct = 14400, -- SCT
+ mvt = 18000, -- MVT
+ mut = 14400, -- MUT
+ ret = 14400, -- RET
+ chast = 45900, -- CHAST
+ chadt = 49500, -- CHADT
+ chut = 36000, -- CHUT
+ vut = 39600, -- VUT
+ phot = 46800, -- PHOT
+ tkt = -36000, -- TKT
+ fjt = 43200, -- FJT
+ tvt = 43200, -- TVT
+ galt = -21600, -- GALT
+ gamt = -32400, -- GAMT
+ sbt = 39600, -- SBT
+ hst = -36000, -- HST
+ lint = 50400, -- LINT
+ kost = 39600, -- KOST
+ mht = 43200, -- MHT
+ mart = -34200, -- MART
+ sst = -39600, -- SST
+ nrt = 43200, -- NRT
+ nut = -39600, -- NUT
+ nft = 41400, -- NFT
+ nct = 39600, -- NCT
+ pwt = 32400, -- PWT
+ pont = 39600, -- PONT
+ pgt = 36000, -- PGT
+ ckt = -36000, -- CKT
+ taht = -36000, -- TAHT
+ gilt = 43200, -- GILT
+ tot = 46800, -- TOT
+ wakt = 43200, -- WAKT
+ wft = 43200, -- WFT
+}
--- /dev/null
+--[[
+LuCI - Lua Configuration Interface
+
+Copyright 2012 Jo-Philipp Wich <xm@subsignal.org>
+
+Licensed under the Apache License, Version 2.0 (the "License");
+you may not use this file except in compliance with the License.
+You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+]]--
+
+module("luci.tools.proto", package.seeall)
+
+function opt_macaddr(s, ifc, ...)
+ local v = luci.cbi.Value
+ local o = s:taboption("advanced", v, "macaddr", ...)
+
+ o.placeholder = ifc and ifc:mac()
+ o.datatype = "macaddr"
+
+ function o.cfgvalue(self, section)
+ local w = ifc and ifc:get_wifinet()
+ if w then
+ return w:get("macaddr")
+ else
+ return v.cfgvalue(self, section)
+ end
+ end
+
+ function o.write(self, section, value)
+ local w = ifc and ifc:get_wifinet()
+ if w then
+ w:set("macaddr", value)
+ elseif value then
+ v.write(self, section, value)
+ else
+ v.remove(self, section)
+ end
+ end
+
+ function o.remove(self, section)
+ self:write(section, nil)
+ end
+end
--- /dev/null
+--[[
+LuCI - Lua Configuration Interface
+
+Copyright 2011 Jo-Philipp Wich <xm@subsignal.org>
+
+Licensed under the Apache License, Version 2.0 (the "License");
+you may not use this file except in compliance with the License.
+You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+]]--
+
+module("luci.tools.status", package.seeall)
+
+local uci = require "luci.model.uci".cursor()
+
+local function dhcp_leases_common(family)
+ local rv = { }
+ local nfs = require "nixio.fs"
+ local leasefile = "/var/dhcp.leases"
+
+ uci:foreach("dhcp", "dnsmasq",
+ function(s)
+ if s.leasefile and nfs.access(s.leasefile) then
+ leasefile = s.leasefile
+ return false
+ end
+ end)
+
+ local fd = io.open(leasefile, "r")
+ if fd then
+ while true do
+ local ln = fd:read("*l")
+ if not ln then
+ break
+ else
+ local ts, mac, ip, name, duid = ln:match("^(%d+) (%S+) (%S+) (%S+) (%S+)")
+ if ts and mac and ip and name and duid then
+ if family == 4 and not ip:match(":") then
+ rv[#rv+1] = {
+ expires = os.difftime(tonumber(ts) or 0, os.time()),
+ macaddr = mac,
+ ipaddr = ip,
+ hostname = (name ~= "*") and name
+ }
+ elseif family == 6 and ip:match(":") then
+ rv[#rv+1] = {
+ expires = os.difftime(tonumber(ts) or 0, os.time()),
+ ip6addr = ip,
+ duid = (duid ~= "*") and duid,
+ hostname = (name ~= "*") and name
+ }
+ end
+ end
+ end
+ end
+ fd:close()
+ end
+
+ local fd = io.open("/tmp/hosts/odhcpd", "r")
+ if fd then
+ while true do
+ local ln = fd:read("*l")
+ if not ln then
+ break
+ else
+ local iface, duid, iaid, name, ts, id, length, ip = ln:match("^# (%S+) (%S+) (%S+) (%S+) (%d+) (%S+) (%S+) (.*)")
+ if ip and iaid ~= "ipv4" and family == 6 then
+ rv[#rv+1] = {
+ expires = os.difftime(tonumber(ts) or 0, os.time()),
+ duid = duid,
+ ip6addr = ip,
+ hostname = (name ~= "-") and name
+ }
+ elseif ip and iaid == "ipv4" and family == 4 then
+ rv[#rv+1] = {
+ expires = os.difftime(tonumber(ts) or 0, os.time()),
+ macaddr = duid,
+ ipaddr = ip,
+ hostname = (name ~= "-") and name
+ }
+ end
+ end
+ end
+ fd:close()
+ end
+
+ return rv
+end
+
+function dhcp_leases()
+ return dhcp_leases_common(4)
+end
+
+function dhcp6_leases()
+ return dhcp_leases_common(6)
+end
+
+function wifi_networks()
+ local rv = { }
+ local ntm = require "luci.model.network".init()
+
+ local dev
+ for _, dev in ipairs(ntm:get_wifidevs()) do
+ local rd = {
+ up = dev:is_up(),
+ device = dev:name(),
+ name = dev:get_i18n(),
+ networks = { }
+ }
+
+ local net
+ for _, net in ipairs(dev:get_wifinets()) do
+ rd.networks[#rd.networks+1] = {
+ name = net:shortname(),
+ link = net:adminlink(),
+ up = net:is_up(),
+ mode = net:active_mode(),
+ ssid = net:active_ssid(),
+ bssid = net:active_bssid(),
+ encryption = net:active_encryption(),
+ frequency = net:frequency(),
+ channel = net:channel(),
+ signal = net:signal(),
+ quality = net:signal_percent(),
+ noise = net:noise(),
+ bitrate = net:bitrate(),
+ ifname = net:ifname(),
+ assoclist = net:assoclist(),
+ country = net:country(),
+ txpower = net:txpower(),
+ txpoweroff = net:txpower_offset()
+ }
+ end
+
+ rv[#rv+1] = rd
+ end
+
+ return rv
+end
+
+function wifi_network(id)
+ local ntm = require "luci.model.network".init()
+ local net = ntm:get_wifinet(id)
+ if net then
+ local dev = net:get_device()
+ if dev then
+ return {
+ id = id,
+ name = net:shortname(),
+ link = net:adminlink(),
+ up = net:is_up(),
+ mode = net:active_mode(),
+ ssid = net:active_ssid(),
+ bssid = net:active_bssid(),
+ encryption = net:active_encryption(),
+ frequency = net:frequency(),
+ channel = net:channel(),
+ signal = net:signal(),
+ quality = net:signal_percent(),
+ noise = net:noise(),
+ bitrate = net:bitrate(),
+ ifname = net:ifname(),
+ assoclist = net:assoclist(),
+ country = net:country(),
+ txpower = net:txpower(),
+ txpoweroff = net:txpower_offset(),
+ device = {
+ up = dev:is_up(),
+ device = dev:name(),
+ name = dev:get_i18n()
+ }
+ }
+ end
+ end
+ return { }
+end
+
+function switch_status(devs)
+ local dev
+ local switches = { }
+ for dev in devs:gmatch("[^%s,]+") do
+ local ports = { }
+ local swc = io.popen("swconfig dev %q show" % dev, "r")
+ if swc then
+ local l
+ repeat
+ l = swc:read("*l")
+ if l then
+ local port, up = l:match("port:(%d+) link:(%w+)")
+ if port then
+ local speed = l:match(" speed:(%d+)")
+ local duplex = l:match(" (%w+)-duplex")
+ local txflow = l:match(" (txflow)")
+ local rxflow = l:match(" (rxflow)")
+ local auto = l:match(" (auto)")
+
+ ports[#ports+1] = {
+ port = tonumber(port) or 0,
+ speed = tonumber(speed) or 0,
+ link = (up == "up"),
+ duplex = (duplex == "full"),
+ rxflow = (not not rxflow),
+ txflow = (not not txflow),
+ auto = (not not auto)
+ }
+ end
+ end
+ until not l
+ swc:close()
+ end
+ switches[dev] = ports
+ end
+ return switches
+end
--- /dev/null
+--[[
+LuCI - Lua Configuration Interface
+
+Copyright 2008 Steven Barth <steven@midlink.org>
+Copyright 2008 Jo-Philipp Wich <xm@leipzig.freifunk.net>
+
+Licensed under the Apache License, Version 2.0 (the "License");
+you may not use this file except in compliance with the License.
+You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+$Id$
+]]--
+
+module("luci.tools.webadmin", package.seeall)
+local uci = require("luci.model.uci")
+require("luci.sys")
+require("luci.ip")
+
+function byte_format(byte)
+ local suff = {"B", "KB", "MB", "GB", "TB"}
+ for i=1, 5 do
+ if byte > 1024 and i < 5 then
+ byte = byte / 1024
+ else
+ return string.format("%.2f %s", byte, suff[i])
+ end
+ end
+end
+
+function date_format(secs)
+ local suff = {"min", "h", "d"}
+ local mins = 0
+ local hour = 0
+ local days = 0
+
+ secs = math.floor(secs)
+ if secs > 60 then
+ mins = math.floor(secs / 60)
+ secs = secs % 60
+ end
+
+ if mins > 60 then
+ hour = math.floor(mins / 60)
+ mins = mins % 60
+ end
+
+ if hour > 24 then
+ days = math.floor(hour / 24)
+ hour = hour % 24
+ end
+
+ if days > 0 then
+ return string.format("%.0fd %02.0fh %02.0fmin %02.0fs", days, hour, mins, secs)
+ else
+ return string.format("%02.0fh %02.0fmin %02.0fs", hour, mins, secs)
+ end
+end
+
+function network_get_addresses(net)
+ local state = uci.cursor_state()
+ state:load("network")
+ local addr = {}
+ local ipv4 = state:get("network", net, "ipaddr")
+ local mav4 = state:get("network", net, "netmask")
+ local ipv6 = state:get("network", net, "ip6addr")
+
+ if ipv4 and #ipv4 > 0 then
+ if mav4 and #mav4 == 0 then mav4 = nil end
+
+ ipv4 = luci.ip.IPv4(ipv4, mav4)
+
+ if ipv4 then
+ table.insert(addr, ipv4:string())
+ end
+ end
+
+ if ipv6 then
+ table.insert(addr, ipv6)
+ end
+
+ state:foreach("network", "alias",
+ function (section)
+ if section.interface == net then
+ if section.ipaddr and section.netmask then
+ local ipv4 = luci.ip.IPv4(section.ipaddr, section.netmask)
+
+ if ipv4 then
+ table.insert(addr, ipv4:string())
+ end
+ end
+
+ if section.ip6addr then
+ table.insert(addr, section.ip6addr)
+ end
+ end
+ end
+ )
+
+ return addr
+end
+
+function cbi_add_networks(field)
+ uci.cursor():foreach("network", "interface",
+ function (section)
+ if section[".name"] ~= "loopback" then
+ field:value(section[".name"])
+ end
+ end
+ )
+ field.titleref = luci.dispatcher.build_url("admin", "network", "network")
+end
+
+function cbi_add_knownips(field)
+ for i, dataset in ipairs(luci.sys.net.arptable()) do
+ field:value(dataset["IP address"])
+ end
+end
+
+function network_get_zones(net)
+ local state = uci.cursor_state()
+ if not state:load("firewall") then
+ return nil
+ end
+
+ local zones = {}
+
+ state:foreach("firewall", "zone",
+ function (section)
+ local znet = section.network or section.name
+ if luci.util.contains(luci.util.split(znet, " "), net) then
+ table.insert(zones, section.name)
+ end
+ end
+ )
+
+ return zones
+end
+
+function firewall_find_zone(name)
+ local find
+
+ luci.model.uci.cursor():foreach("firewall", "zone",
+ function (section)
+ if section.name == name then
+ find = section[".name"]
+ end
+ end
+ )
+
+ return find
+end
+
+function iface_get_network(iface)
+ local state = uci.cursor_state()
+ state:load("network")
+ local net
+
+ state:foreach("network", "interface",
+ function (section)
+ local ifname = state:get(
+ "network", section[".name"], "ifname"
+ )
+
+ if iface == ifname then
+ net = section[".name"]
+ end
+ end
+ )
+
+ return net
+end
--- /dev/null
+--[[
+LuCI - Utility library
+
+Description:
+Several common useful Lua functions
+
+License:
+Copyright 2008 Steven Barth <steven@midlink.org>
+
+Licensed under the Apache License, Version 2.0 (the "License");
+you may not use this file except in compliance with the License.
+You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+Unless required by applicable law or agreed to in writing, software
+distributed under the License is distributed on an "AS IS" BASIS,
+WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+See the License for the specific language governing permissions and
+limitations under the License.
+
+]]--
+
+local io = require "io"
+local math = require "math"
+local table = require "table"
+local debug = require "debug"
+local ldebug = require "luci.debug"
+local string = require "string"
+local coroutine = require "coroutine"
+local tparser = require "luci.template.parser"
+
+local getmetatable, setmetatable = getmetatable, setmetatable
+local rawget, rawset, unpack = rawget, rawset, unpack
+local tostring, type, assert = tostring, type, assert
+local ipairs, pairs, next, loadstring = ipairs, pairs, next, loadstring
+local require, pcall, xpcall = require, pcall, xpcall
+local collectgarbage, get_memory_limit = collectgarbage, get_memory_limit
+
+--- LuCI utility functions.
+module "luci.util"
+
+--
+-- Pythonic string formatting extension
+--
+getmetatable("").__mod = function(a, b)
+ if not b then
+ return a
+ elseif type(b) == "table" then
+ for k, _ in pairs(b) do if type(b[k]) == "userdata" then b[k] = tostring(b[k]) end end
+ return a:format(unpack(b))
+ else
+ if type(b) == "userdata" then b = tostring(b) end
+ return a:format(b)
+ end
+end
+
+
+--
+-- Class helper routines
+--
+
+-- Instantiates a class
+local function _instantiate(class, ...)
+ local inst = setmetatable({}, {__index = class})
+
+ if inst.__init__ then
+ inst:__init__(...)
+ end
+
+ return inst
+end
+
+--- Create a Class object (Python-style object model).
+-- The class object can be instantiated by calling itself.
+-- Any class functions or shared parameters can be attached to this object.
+-- Attaching a table to the class object makes this table shared between
+-- all instances of this class. For object parameters use the __init__ function.
+-- Classes can inherit member functions and values from a base class.
+-- Class can be instantiated by calling them. All parameters will be passed
+-- to the __init__ function of this class - if such a function exists.
+-- The __init__ function must be used to set any object parameters that are not shared
+-- with other objects of this class. Any return values will be ignored.
+-- @param base The base class to inherit from (optional)
+-- @return A class object
+-- @see instanceof
+-- @see clone
+function class(base)
+ return setmetatable({}, {
+ __call = _instantiate,
+ __index = base
+ })
+end
+
+--- Test whether the given object is an instance of the given class.
+-- @param object Object instance
+-- @param class Class object to test against
+-- @return Boolean indicating whether the object is an instance
+-- @see class
+-- @see clone
+function instanceof(object, class)
+ local meta = getmetatable(object)
+ while meta and meta.__index do
+ if meta.__index == class then
+ return true
+ end
+ meta = getmetatable(meta.__index)
+ end
+ return false
+end
+
+
+--
+-- Scope manipulation routines
+--
+
+local tl_meta = {
+ __mode = "k",
+
+ __index = function(self, key)
+ local t = rawget(self, coxpt[coroutine.running()]
+ or coroutine.running() or 0)
+ return t and t[key]
+ end,
+
+ __newindex = function(self, key, value)
+ local c = coxpt[coroutine.running()] or coroutine.running() or 0
+ if not rawget(self, c) then
+ rawset(self, c, { [key] = value })
+ else
+ rawget(self, c)[key] = value
+ end
+ end
+}
+
+--- Create a new or get an already existing thread local store associated with
+-- the current active coroutine. A thread local store is private a table object
+-- whose values can't be accessed from outside of the running coroutine.
+-- @return Table value representing the corresponding thread local store
+function threadlocal(tbl)
+ return setmetatable(tbl or {}, tl_meta)
+end
+
+
+--
+-- Debugging routines
+--
+
+--- Write given object to stderr.
+-- @param obj Value to write to stderr
+-- @return Boolean indicating whether the write operation was successful
+function perror(obj)
+ return io.stderr:write(tostring(obj) .. "\n")
+end
+
+--- Recursively dumps a table to stdout, useful for testing and debugging.
+-- @param t Table value to dump
+-- @param maxdepth Maximum depth
+-- @return Always nil
+function dumptable(t, maxdepth, i, seen)
+ i = i or 0
+ seen = seen or setmetatable({}, {__mode="k"})
+
+ for k,v in pairs(t) do
+ perror(string.rep("\t", i) .. tostring(k) .. "\t" .. tostring(v))
+ if type(v) == "table" and (not maxdepth or i < maxdepth) then
+ if not seen[v] then
+ seen[v] = true
+ dumptable(v, maxdepth, i+1, seen)
+ else
+ perror(string.rep("\t", i) .. "*** RECURSION ***")
+ end
+ end
+ end
+end
+
+
+--
+-- String and data manipulation routines
+--
+
+--- Create valid XML PCDATA from given string.
+-- @param value String value containing the data to escape
+-- @return String value containing the escaped data
+function pcdata(value)
+ return value and tparser.pcdata(tostring(value))
+end
+
+--- Strip HTML tags from given string.
+-- @param value String containing the HTML text
+-- @return String with HTML tags stripped of
+function striptags(value)
+ return value and tparser.striptags(tostring(value))
+end
+
+--- Splits given string on a defined separator sequence and return a table
+-- containing the resulting substrings. The optional max parameter specifies
+-- the number of bytes to process, regardless of the actual length of the given
+-- string. The optional last parameter, regex, specifies whether the separator
+-- sequence is interpreted as regular expression.
+-- @param str String value containing the data to split up
+-- @param pat String with separator pattern (optional, defaults to "\n")
+-- @param max Maximum times to split (optional)
+-- @param regex Boolean indicating whether to interpret the separator
+-- pattern as regular expression (optional, default is false)
+-- @return Table containing the resulting substrings
+function split(str, pat, max, regex)
+ pat = pat or "\n"
+ max = max or #str
+
+ local t = {}
+ local c = 1
+
+ if #str == 0 then
+ return {""}
+ end
+
+ if #pat == 0 then
+ return nil
+ end
+
+ if max == 0 then
+ return str
+ end
+
+ repeat
+ local s, e = str:find(pat, c, not regex)
+ max = max - 1
+ if s and max < 0 then
+ t[#t+1] = str:sub(c)
+ else
+ t[#t+1] = str:sub(c, s and s - 1)
+ end
+ c = e and e + 1 or #str + 1
+ until not s or max < 0
+
+ return t
+end
+
+--- Remove leading and trailing whitespace from given string value.
+-- @param str String value containing whitespace padded data
+-- @return String value with leading and trailing space removed
+function trim(str)
+ return (str:gsub("^%s*(.-)%s*$", "%1"))
+end
+
+--- Count the occurences of given substring in given string.
+-- @param str String to search in
+-- @param pattern String containing pattern to find
+-- @return Number of found occurences
+function cmatch(str, pat)
+ local count = 0
+ for _ in str:gmatch(pat) do count = count + 1 end
+ return count
+end
+
+--- Return a matching iterator for the given value. The iterator will return
+-- one token per invocation, the tokens are separated by whitespace. If the
+-- input value is a table, it is transformed into a string first. A nil value
+-- will result in a valid interator which aborts with the first invocation.
+-- @param val The value to scan (table, string or nil)
+-- @return Iterator which returns one token per call
+function imatch(v)
+ if type(v) == "table" then
+ local k = nil
+ return function()
+ k = next(v, k)
+ return v[k]
+ end
+
+ elseif type(v) == "number" or type(v) == "boolean" then
+ local x = true
+ return function()
+ if x then
+ x = false
+ return tostring(v)
+ end
+ end
+
+ elseif type(v) == "userdata" or type(v) == "string" then
+ return tostring(v):gmatch("%S+")
+ end
+
+ return function() end
+end
+
+--- Parse certain units from the given string and return the canonical integer
+-- value or 0 if the unit is unknown. Upper- or lower case is irrelevant.
+-- Recognized units are:
+-- o "y" - one year (60*60*24*366)
+-- o "m" - one month (60*60*24*31)
+-- o "w" - one week (60*60*24*7)
+-- o "d" - one day (60*60*24)
+-- o "h" - one hour (60*60)
+-- o "min" - one minute (60)
+-- o "kb" - one kilobyte (1024)
+-- o "mb" - one megabyte (1024*1024)
+-- o "gb" - one gigabyte (1024*1024*1024)
+-- o "kib" - one si kilobyte (1000)
+-- o "mib" - one si megabyte (1000*1000)
+-- o "gib" - one si gigabyte (1000*1000*1000)
+-- @param ustr String containing a numerical value with trailing unit
+-- @return Number containing the canonical value
+function parse_units(ustr)
+
+ local val = 0
+
+ -- unit map
+ local map = {
+ -- date stuff
+ y = 60 * 60 * 24 * 366,
+ m = 60 * 60 * 24 * 31,
+ w = 60 * 60 * 24 * 7,
+ d = 60 * 60 * 24,
+ h = 60 * 60,
+ min = 60,
+
+ -- storage sizes
+ kb = 1024,
+ mb = 1024 * 1024,
+ gb = 1024 * 1024 * 1024,
+
+ -- storage sizes (si)
+ kib = 1000,
+ mib = 1000 * 1000,
+ gib = 1000 * 1000 * 1000
+ }
+
+ -- parse input string
+ for spec in ustr:lower():gmatch("[0-9%.]+[a-zA-Z]*") do
+
+ local num = spec:gsub("[^0-9%.]+$","")
+ local spn = spec:gsub("^[0-9%.]+", "")
+
+ if map[spn] or map[spn:sub(1,1)] then
+ val = val + num * ( map[spn] or map[spn:sub(1,1)] )
+ else
+ val = val + num
+ end
+ end
+
+
+ return val
+end
+
+-- also register functions above in the central string class for convenience
+string.pcdata = pcdata
+string.striptags = striptags
+string.split = split
+string.trim = trim
+string.cmatch = cmatch
+string.parse_units = parse_units
+
+
+--- Appends numerically indexed tables or single objects to a given table.
+-- @param src Target table
+-- @param ... Objects to insert
+-- @return Target table
+function append(src, ...)
+ for i, a in ipairs({...}) do
+ if type(a) == "table" then
+ for j, v in ipairs(a) do
+ src[#src+1] = v
+ end
+ else
+ src[#src+1] = a
+ end
+ end
+ return src
+end
+
+--- Combines two or more numerically indexed tables and single objects into one table.
+-- @param tbl1 Table value to combine
+-- @param tbl2 Table value to combine
+-- @param ... More tables to combine
+-- @return Table value containing all values of given tables
+function combine(...)
+ return append({}, ...)
+end
+
+--- Checks whether the given table contains the given value.
+-- @param table Table value
+-- @param value Value to search within the given table
+-- @return Boolean indicating whether the given value occurs within table
+function contains(table, value)
+ for k, v in pairs(table) do
+ if value == v then
+ return k
+ end
+ end
+ return false
+end
+
+--- Update values in given table with the values from the second given table.
+-- Both table are - in fact - merged together.
+-- @param t Table which should be updated
+-- @param updates Table containing the values to update
+-- @return Always nil
+function update(t, updates)
+ for k, v in pairs(updates) do
+ t[k] = v
+ end
+end
+
+--- Retrieve all keys of given associative table.
+-- @param t Table to extract keys from
+-- @return Sorted table containing the keys
+function keys(t)
+ local keys = { }
+ if t then
+ for k, _ in kspairs(t) do
+ keys[#keys+1] = k
+ end
+ end
+ return keys
+end
+
+--- Clones the given object and return it's copy.
+-- @param object Table value to clone
+-- @param deep Boolean indicating whether to do recursive cloning
+-- @return Cloned table value
+function clone(object, deep)
+ local copy = {}
+
+ for k, v in pairs(object) do
+ if deep and type(v) == "table" then
+ v = clone(v, deep)
+ end
+ copy[k] = v
+ end
+
+ return setmetatable(copy, getmetatable(object))
+end
+
+
+--- Create a dynamic table which automatically creates subtables.
+-- @return Dynamic Table
+function dtable()
+ return setmetatable({}, { __index =
+ function(tbl, key)
+ return rawget(tbl, key)
+ or rawget(rawset(tbl, key, dtable()), key)
+ end
+ })
+end
+
+
+-- Serialize the contents of a table value.
+function _serialize_table(t, seen)
+ assert(not seen[t], "Recursion detected.")
+ seen[t] = true
+
+ local data = ""
+ local idata = ""
+ local ilen = 0
+
+ for k, v in pairs(t) do
+ if type(k) ~= "number" or k < 1 or math.floor(k) ~= k or ( k - #t ) > 3 then
+ k = serialize_data(k, seen)
+ v = serialize_data(v, seen)
+ data = data .. ( #data > 0 and ", " or "" ) ..
+ '[' .. k .. '] = ' .. v
+ elseif k > ilen then
+ ilen = k
+ end
+ end
+
+ for i = 1, ilen do
+ local v = serialize_data(t[i], seen)
+ idata = idata .. ( #idata > 0 and ", " or "" ) .. v
+ end
+
+ return idata .. ( #data > 0 and #idata > 0 and ", " or "" ) .. data
+end
+
+--- Recursively serialize given data to lua code, suitable for restoring
+-- with loadstring().
+-- @param val Value containing the data to serialize
+-- @return String value containing the serialized code
+-- @see restore_data
+-- @see get_bytecode
+function serialize_data(val, seen)
+ seen = seen or setmetatable({}, {__mode="k"})
+
+ if val == nil then
+ return "nil"
+ elseif type(val) == "number" then
+ return val
+ elseif type(val) == "string" then
+ return "%q" % val
+ elseif type(val) == "boolean" then
+ return val and "true" or "false"
+ elseif type(val) == "function" then
+ return "loadstring(%q)" % get_bytecode(val)
+ elseif type(val) == "table" then
+ return "{ " .. _serialize_table(val, seen) .. " }"
+ else
+ return '"[unhandled data type:' .. type(val) .. ']"'
+ end
+end
+
+--- Restore data previously serialized with serialize_data().
+-- @param str String containing the data to restore
+-- @return Value containing the restored data structure
+-- @see serialize_data
+-- @see get_bytecode
+function restore_data(str)
+ return loadstring("return " .. str)()
+end
+
+
+--
+-- Byte code manipulation routines
+--
+
+--- Return the current runtime bytecode of the given data. The byte code
+-- will be stripped before it is returned.
+-- @param val Value to return as bytecode
+-- @return String value containing the bytecode of the given data
+function get_bytecode(val)
+ local code
+
+ if type(val) == "function" then
+ code = string.dump(val)
+ else
+ code = string.dump( loadstring( "return " .. serialize_data(val) ) )
+ end
+
+ return code -- and strip_bytecode(code)
+end
+
+--- Strips unnescessary lua bytecode from given string. Information like line
+-- numbers and debugging numbers will be discarded. Original version by
+-- Peter Cawley (http://lua-users.org/lists/lua-l/2008-02/msg01158.html)
+-- @param code String value containing the original lua byte code
+-- @return String value containing the stripped lua byte code
+function strip_bytecode(code)
+ local version, format, endian, int, size, ins, num, lnum = code:byte(5, 12)
+ local subint
+ if endian == 1 then
+ subint = function(code, i, l)
+ local val = 0
+ for n = l, 1, -1 do
+ val = val * 256 + code:byte(i + n - 1)
+ end
+ return val, i + l
+ end
+ else
+ subint = function(code, i, l)
+ local val = 0
+ for n = 1, l, 1 do
+ val = val * 256 + code:byte(i + n - 1)
+ end
+ return val, i + l
+ end
+ end
+
+ local function strip_function(code)
+ local count, offset = subint(code, 1, size)
+ local stripped = { string.rep("\0", size) }
+ local dirty = offset + count
+ offset = offset + count + int * 2 + 4
+ offset = offset + int + subint(code, offset, int) * ins
+ count, offset = subint(code, offset, int)
+ for n = 1, count do
+ local t
+ t, offset = subint(code, offset, 1)
+ if t == 1 then
+ offset = offset + 1
+ elseif t == 4 then
+ offset = offset + size + subint(code, offset, size)
+ elseif t == 3 then
+ offset = offset + num
+ elseif t == 254 or t == 9 then
+ offset = offset + lnum
+ end
+ end
+ count, offset = subint(code, offset, int)
+ stripped[#stripped+1] = code:sub(dirty, offset - 1)
+ for n = 1, count do
+ local proto, off = strip_function(code:sub(offset, -1))
+ stripped[#stripped+1] = proto
+ offset = offset + off - 1
+ end
+ offset = offset + subint(code, offset, int) * int + int
+ count, offset = subint(code, offset, int)
+ for n = 1, count do
+ offset = offset + subint(code, offset, size) + size + int * 2
+ end
+ count, offset = subint(code, offset, int)
+ for n = 1, count do
+ offset = offset + subint(code, offset, size) + size
+ end
+ stripped[#stripped+1] = string.rep("\0", int * 3)
+ return table.concat(stripped), offset
+ end
+
+ return code:sub(1,12) .. strip_function(code:sub(13,-1))
+end
+
+
+--
+-- Sorting iterator functions
+--
+
+function _sortiter( t, f )
+ local keys = { }
+
+ local k, v
+ for k, v in pairs(t) do
+ keys[#keys+1] = k
+ end
+
+ local _pos = 0
+
+ table.sort( keys, f )
+
+ return function()
+ _pos = _pos + 1
+ if _pos <= #keys then
+ return keys[_pos], t[keys[_pos]], _pos
+ end
+ end
+end
+
+--- Return a key, value iterator which returns the values sorted according to
+-- the provided callback function.
+-- @param t The table to iterate
+-- @param f A callback function to decide the order of elements
+-- @return Function value containing the corresponding iterator
+function spairs(t,f)
+ return _sortiter( t, f )
+end
+
+--- Return a key, value iterator for the given table.
+-- The table pairs are sorted by key.
+-- @param t The table to iterate
+-- @return Function value containing the corresponding iterator
+function kspairs(t)
+ return _sortiter( t )
+end
+
+--- Return a key, value iterator for the given table.
+-- The table pairs are sorted by value.
+-- @param t The table to iterate
+-- @return Function value containing the corresponding iterator
+function vspairs(t)
+ return _sortiter( t, function (a,b) return t[a] < t[b] end )
+end
+
+
+--
+-- System utility functions
+--
+
+--- Test whether the current system is operating in big endian mode.
+-- @return Boolean value indicating whether system is big endian
+function bigendian()
+ return string.byte(string.dump(function() end), 7) == 0
+end
+
+--- Execute given commandline and gather stdout.
+-- @param command String containing command to execute
+-- @return String containing the command's stdout
+function exec(command)
+ local pp = io.popen(command)
+ local data = pp:read("*a")
+ pp:close()
+
+ return data
+end
+
+--- Return a line-buffered iterator over the output of given command.
+-- @param command String containing the command to execute
+-- @return Iterator
+function execi(command)
+ local pp = io.popen(command)
+
+ return pp and function()
+ local line = pp:read()
+
+ if not line then
+ pp:close()
+ end
+
+ return line
+ end
+end
+
+-- Deprecated
+function execl(command)
+ local pp = io.popen(command)
+ local line = ""
+ local data = {}
+
+ while true do
+ line = pp:read()
+ if (line == nil) then break end
+ data[#data+1] = line
+ end
+ pp:close()
+
+ return data
+end
+
+--- Returns the absolute path to LuCI base directory.
+-- @return String containing the directory path
+function libpath()
+ return require "nixio.fs".dirname(ldebug.__file__)
+end
+
+
+--
+-- Coroutine safe xpcall and pcall versions modified for Luci
+-- original version:
+-- coxpcall 1.13 - Copyright 2005 - Kepler Project (www.keplerproject.org)
+--
+-- Copyright © 2005 Kepler Project.
+-- Permission is hereby granted, free of charge, to any person obtaining a
+-- copy of this software and associated documentation files (the "Software"),
+-- to deal in the Software without restriction, including without limitation
+-- the rights to use, copy, modify, merge, publish, distribute, sublicense,
+-- and/or sell copies of the Software, and to permit persons to whom the
+-- Software is furnished to do so, subject to the following conditions:
+--
+-- The above copyright notice and this permission notice shall be
+-- included in all copies or substantial portions of the Software.
+--
+-- THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND,
+-- EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES
+-- OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+-- IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM,
+-- DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT,
+-- TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE
+-- OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
+
+local performResume, handleReturnValue
+local oldpcall, oldxpcall = pcall, xpcall
+coxpt = {}
+setmetatable(coxpt, {__mode = "kv"})
+
+-- Identity function for copcall
+local function copcall_id(trace, ...)
+ return ...
+end
+
+--- This is a coroutine-safe drop-in replacement for Lua's "xpcall"-function
+-- @param f Lua function to be called protected
+-- @param err Custom error handler
+-- @param ... Parameters passed to the function
+-- @return A boolean whether the function call succeeded and the return
+-- values of either the function or the error handler
+function coxpcall(f, err, ...)
+ local res, co = oldpcall(coroutine.create, f)
+ if not res then
+ local params = {...}
+ local newf = function() return f(unpack(params)) end
+ co = coroutine.create(newf)
+ end
+ local c = coroutine.running()
+ coxpt[co] = coxpt[c] or c or 0
+
+ return performResume(err, co, ...)
+end
+
+--- This is a coroutine-safe drop-in replacement for Lua's "pcall"-function
+-- @param f Lua function to be called protected
+-- @param ... Parameters passed to the function
+-- @return A boolean whether the function call succeeded and the returns
+-- values of the function or the error object
+function copcall(f, ...)
+ return coxpcall(f, copcall_id, ...)
+end
+
+-- Handle return value of protected call
+function handleReturnValue(err, co, status, ...)
+ if not status then
+ return false, err(debug.traceback(co, (...)), ...)
+ end
+
+ if coroutine.status(co) ~= 'suspended' then
+ return true, ...
+ end
+
+ return performResume(err, co, coroutine.yield(...))
+end
+
+-- Resume execution of protected function call
+function performResume(err, co, ...)
+ return handleReturnValue(err, co, coroutine.resume(co, ...))
+end
--- /dev/null
+--[[
+LuCI - Lua Configuration Interface
+Version definition - do not edit this file
+]]--
+
+module "luci.version"
+
+distname = "Host System"
+distversion = "SDK"
+
+luciname = "LuCI"
+luciversion = "SVN"
--- /dev/null
+<%#
+LuCI - Lua Configuration Interface
+Copyright 2008 Steven Barth <steven@midlink.org>
+Copyright 2008 Jo-Philipp Wich <xm@leipzig.freifunk.net>
+
+Licensed under the Apache License, Version 2.0 (the "License");
+you may not use this file except in compliance with the License.
+You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+$Id$
+
+-%>
+<%+header%>
+<h2><a id="content" name="content">404 <%:Not Found%></a></h2>
+<p><%:Sorry, the object you requested was not found.%></p>
+<tt><%:Unable to dispatch%>: <%=luci.http.request.env.PATH_INFO%></tt>
+<%+footer%>
--- /dev/null
+<%#
+LuCI - Lua Configuration Interface
+Copyright 2008 Steven Barth <steven@midlink.org>
+Copyright 2008 Jo-Philipp Wich <xm@leipzig.freifunk.net>
+
+Licensed under the Apache License, Version 2.0 (the "License");
+you may not use this file except in compliance with the License.
+You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+$Id$
+
+-%>
+<%+header%>
+<h2><a id="content" name="content">500 <%:Internal Server Error%></a></h2>
+<p><%:Sorry, the server encountered an unexpected error.%></p>
+<pre class="error500"><%=message%></pre>
+<%+footer%>
--- /dev/null
+<%#
+LuCI - Lua Configuration Interface
+Copyright 2008 Steven Barth <steven@midlink.org>
+Copyright 2008 Jo-Philipp Wich <xm@leipzig.freifunk.net>
+
+Licensed under the Apache License, Version 2.0 (the "License");
+you may not use this file except in compliance with the License.
+You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+$Id$
+
+-%>
+<% include("themes/" .. theme .. "/footer") %>
\ No newline at end of file
--- /dev/null
+<%#
+LuCI - Lua Configuration Interface
+Copyright 2008 Steven Barth <steven@midlink.org>
+Copyright 2008 Jo-Philipp Wich <xm@leipzig.freifunk.net>
+
+Licensed under the Apache License, Version 2.0 (the "License");
+you may not use this file except in compliance with the License.
+You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+$Id$
+
+-%>
+
+<%
+ if not luci.dispatcher.context.template_header_sent then
+ include("themes/" .. theme .. "/header")
+ luci.dispatcher.context.template_header_sent = true
+ end
+%>
--- /dev/null
+<%#
+LuCI - Lua Configuration Interface
+Copyright 2008 Steven Barth <steven@midlink.org>
+Copyright 2008 Jo-Philipp Wich <xm@leipzig.freifunk.net>
+
+Licensed under the Apache License, Version 2.0 (the "License");
+you may not use this file except in compliance with the License.
+You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+$Id$
+
+-%>
+<% include("themes/" .. theme .. "/indexer") %>
\ No newline at end of file
--- /dev/null
+<%#
+LuCI - Lua Configuration Interface
+Copyright 2008 Steven Barth <steven@midlink.org>
+Copyright 2008-2012 Jo-Philipp Wich <xm@subsignal.org>
+
+Licensed under the Apache License, Version 2.0 (the "License");
+you may not use this file except in compliance with the License.
+You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+-%>
+
+<%+header%>
+
+<form method="post" action="<%=pcdata(luci.http.getenv("REQUEST_URI"))%>">
+ <div class="cbi-map">
+ <h2><a id="content" name="content"><%:Authorization Required%></a></h2>
+ <div class="cbi-map-descr">
+ <%:Please enter your username and password.%>
+ <%- if fuser then %>
+ <div class="error"><%:Invalid username and/or password! Please try again.%></div>
+ <br />
+ <% end -%>
+ </div>
+ <fieldset class="cbi-section"><fieldset class="cbi-section-node">
+ <div class="cbi-value">
+ <label class="cbi-value-title"><%:Username%></label>
+ <div class="cbi-value-field">
+ <input class="cbi-input-user" type="text" name="username" value="<%=duser%>" />
+ </div>
+ </div>
+ <div class="cbi-value cbi-value-last">
+ <label class="cbi-value-title"><%:Password%></label>
+ <div class="cbi-value-field">
+ <input id="focus_password" class="cbi-input-password" type="password" name="password" />
+ </div>
+ </div>
+ </fieldset></fieldset>
+ </div>
+
+ <div>
+ <input type="submit" value="<%:Login%>" class="cbi-button cbi-button-apply" />
+ <input type="reset" value="<%:Reset%>" class="cbi-button cbi-button-reset" />
+ </div>
+</form>
+<script type="text/javascript">//<![CDATA[
+ var input = document.getElementById('focus_password');
+ if (input)
+ input.focus();
+//]]></script>
+
+<%
+local uci = require "luci.model.uci".cursor()
+local fs = require "nixio.fs"
+local https_key = uci:get("uhttpd", "main", "key")
+local https_port = uci:get("uhttpd", "main", "listen_https")
+if type(https_port) == "table" then
+ https_port = https_port[1]
+end
+
+if https_port and fs.access(https_key) then
+ https_port = https_port:match("(%d+)$")
+%>
+
+<script type="text/javascript">//<![CDATA[
+ if (document.location.protocol != 'https:') {
+ var url = 'https://' + window.location.hostname + ':' + '<%=https_port%>' + window.location.pathname;
+ var img=new Image;
+ img.onload=function(){window.location = url};
+ img.src='https://' + window.location.hostname + ':' + '<%=https_port%>' + '<%=resource%>/cbi/up.gif?' + Math.random();;
+ setTimeout(function(){
+ img.src=''
+ }, 5000);
+ }
+//]]></script>
+
+<% end %>
+
+<%+footer%>
--- /dev/null
+config network
+ option init network
+ list affects dhcp
+ list affects radvd
+
+config wireless
+ list affects network
+
+config firewall
+ option init firewall
+ list affects luci-splash
+ list affects qos
+ list affects miniupnpd
+
+config olsr
+ option init olsrd
+
+config dhcp
+ option init dnsmasq
+
+config dropbear
+ option init dropbear
+
+config httpd
+ option init httpd
+
+config fstab
+ option init fstab
+
+config qos
+ option init qos
+
+config system
+ option init led
+ list affects luci_statistics
+
+config luci_splash
+ option init luci_splash
+
+config upnpd
+ option init miniupnpd
+
+config ntpclient
+ option init ntpclient
+
+config samba
+ option init samba
+
+config tinyproxy
+ option init tinyproxy
+
+config 6relayd
+ option init 6relayd
--- /dev/null
+config core main
+ option lang auto
+ option mediaurlbase /luci-static/openwrt.org
+ option resourcebase /luci-static/resources
+
+config extern flash_keep
+ option uci "/etc/config/"
+ option dropbear "/etc/dropbear/"
+ option openvpn "/etc/openvpn/"
+ option passwd "/etc/passwd"
+ option opkg "/etc/opkg.conf"
+ option firewall "/etc/firewall.user"
+ option uploads "/lib/uci/upload/"
+
+config internal languages
+
+config internal sauth
+ option sessionpath "/tmp/luci-sessions"
+ option sessiontime 3600
+
+config internal ccache
+ option enable 1
+
+config internal themes
--- /dev/null
+#!/bin/sh
+. /lib/functions.sh
+
+apply_config() {
+ config_get init "$1" init
+ config_get exec "$1" exec
+ config_get test "$1" test
+
+ echo "$2" > "/var/run/luci-reload-status"
+
+ [ -n "$init" ] && reload_init "$2" "$init" "$test"
+ [ -n "$exec" ] && reload_exec "$2" "$exec" "$test"
+}
+
+reload_exec() {
+ local service="$1"
+ local ok="$3"
+ set -- $2
+ local cmd="$1"; shift
+
+ [ -x "$cmd" ] && {
+ echo "Reloading $service... "
+ ( $cmd "$@" ) 2>/dev/null 1>&2
+ [ -n "$ok" -a "$?" != "$ok" ] && echo '!!! Failed to reload' $service '!!!'
+ }
+}
+
+reload_init() {
+ [ -x /etc/init.d/$2 ] && /etc/init.d/$2 enabled && {
+ echo "Reloading $1... "
+ /etc/init.d/$2 reload >/dev/null 2>&1
+ [ -n "$3" -a "$?" != "$3" ] && echo '!!! Failed to reload' $1 '!!!'
+ }
+}
+
+lock "/var/run/luci-reload"
+
+config_load ucitrack
+
+for i in $*; do
+ config_foreach apply_config $i $i
+done
+
+rm -f "/var/run/luci-reload-status"
+lock -u "/var/run/luci-reload"
--- /dev/null
+<?xml version="1.0" encoding="utf-8"?>
+<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.1//EN" "http://www.w3.org/TR/xhtml11/DTD/xhtml11.dtd">
+<html xmlns="http://www.w3.org/1999/xhtml">
+<head>
+<meta http-equiv="refresh" content="0; URL=/cgi-bin/luci" />
+</head>
+<body style="background-color: black">
+<a style="color: white; text-decoration: none" href="/cgi-bin/luci">LuCI - Lua Configuration Interface</a>
+</body>
+</html>
--- /dev/null
+/*
+ * lmo - Lua Machine Objects - PO to LMO conversion tool
+ *
+ * Copyright (C) 2009-2012 Jo-Philipp Wich <xm@subsignal.org>
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#include "template_lmo.h"
+
+static void die(const char *msg)
+{
+ fprintf(stderr, "Error: %s\n", msg);
+ exit(1);
+}
+
+static void usage(const char *name)
+{
+ fprintf(stderr, "Usage: %s input.po output.lmo\n", name);
+ exit(1);
+}
+
+static void print(const void *ptr, size_t size, size_t nmemb, FILE *stream)
+{
+ if( fwrite(ptr, size, nmemb, stream) == 0 )
+ die("Failed to write stdout");
+}
+
+static int extract_string(const char *src, char *dest, int len)
+{
+ int pos = 0;
+ int esc = 0;
+ int off = -1;
+
+ for( pos = 0; (pos < strlen(src)) && (pos < len); pos++ )
+ {
+ if( (off == -1) && (src[pos] == '"') )
+ {
+ off = pos + 1;
+ }
+ else if( off >= 0 )
+ {
+ if( esc == 1 )
+ {
+ switch (src[pos])
+ {
+ case '"':
+ case '\\':
+ off++;
+ break;
+ }
+ dest[pos-off] = src[pos];
+ esc = 0;
+ }
+ else if( src[pos] == '\\' )
+ {
+ dest[pos-off] = src[pos];
+ esc = 1;
+ }
+ else if( src[pos] != '"' )
+ {
+ dest[pos-off] = src[pos];
+ }
+ else
+ {
+ dest[pos-off] = '\0';
+ break;
+ }
+ }
+ }
+
+ return (off > -1) ? strlen(dest) : -1;
+}
+
+static int cmp_index(const void *a, const void *b)
+{
+ uint32_t x = ((const lmo_entry_t *)a)->key_id;
+ uint32_t y = ((const lmo_entry_t *)b)->key_id;
+
+ if (x < y)
+ return -1;
+ else if (x > y)
+ return 1;
+
+ return 0;
+}
+
+static void print_uint32(uint32_t x, FILE *out)
+{
+ uint32_t y = htonl(x);
+ print(&y, sizeof(uint32_t), 1, out);
+}
+
+static void print_index(void *array, int n, FILE *out)
+{
+ lmo_entry_t *e;
+
+ qsort(array, n, sizeof(*e), cmp_index);
+
+ for (e = array; n > 0; n--, e++)
+ {
+ print_uint32(e->key_id, out);
+ print_uint32(e->val_id, out);
+ print_uint32(e->offset, out);
+ print_uint32(e->length, out);
+ }
+}
+
+int main(int argc, char *argv[])
+{
+ char line[4096];
+ char key[4096];
+ char val[4096];
+ char tmp[4096];
+ int state = 0;
+ int offset = 0;
+ int length = 0;
+ int n_entries = 0;
+ void *array = NULL;
+ lmo_entry_t *entry = NULL;
+ uint32_t key_id, val_id;
+
+ FILE *in;
+ FILE *out;
+
+ if( (argc != 3) || ((in = fopen(argv[1], "r")) == NULL) || ((out = fopen(argv[2], "w")) == NULL) )
+ usage(argv[0]);
+
+ memset(line, 0, sizeof(key));
+ memset(key, 0, sizeof(val));
+ memset(val, 0, sizeof(val));
+
+ while( (NULL != fgets(line, sizeof(line), in)) || (state >= 2 && feof(in)) )
+ {
+ if( state == 0 && strstr(line, "msgid \"") == line )
+ {
+ switch(extract_string(line, key, sizeof(key)))
+ {
+ case -1:
+ die("Syntax error in msgid");
+ case 0:
+ state = 1;
+ break;
+ default:
+ state = 2;
+ }
+ }
+ else if( state == 1 || state == 2 )
+ {
+ if( strstr(line, "msgstr \"") == line || state == 2 )
+ {
+ switch(extract_string(line, val, sizeof(val)))
+ {
+ case -1:
+ state = 4;
+ break;
+ default:
+ state = 3;
+ }
+ }
+ else
+ {
+ switch(extract_string(line, tmp, sizeof(tmp)))
+ {
+ case -1:
+ state = 2;
+ break;
+ default:
+ strcat(key, tmp);
+ }
+ }
+ }
+ else if( state == 3 )
+ {
+ switch(extract_string(line, tmp, sizeof(tmp)))
+ {
+ case -1:
+ state = 4;
+ break;
+ default:
+ strcat(val, tmp);
+ }
+ }
+
+ if( state == 4 )
+ {
+ if( strlen(key) > 0 && strlen(val) > 0 )
+ {
+ key_id = sfh_hash(key, strlen(key));
+ val_id = sfh_hash(val, strlen(val));
+
+ if( key_id != val_id )
+ {
+ n_entries++;
+ array = realloc(array, n_entries * sizeof(lmo_entry_t));
+ entry = (lmo_entry_t *)array + n_entries - 1;
+
+ if (!array)
+ die("Out of memory");
+
+ entry->key_id = key_id;
+ entry->val_id = val_id;
+ entry->offset = offset;
+ entry->length = strlen(val);
+
+ length = strlen(val) + ((4 - (strlen(val) % 4)) % 4);
+
+ print(val, length, 1, out);
+ offset += length;
+ }
+ }
+
+ state = 0;
+ memset(key, 0, sizeof(key));
+ memset(val, 0, sizeof(val));
+ }
+
+ memset(line, 0, sizeof(line));
+ }
+
+ print_index(array, n_entries, out);
+
+ if( offset > 0 )
+ {
+ print_uint32(offset, out);
+ fsync(fileno(out));
+ fclose(out);
+ }
+ else
+ {
+ fclose(out);
+ unlink(argv[2]);
+ }
+
+ fclose(in);
+ return(0);
+}
--- /dev/null
+/*
+ * lmo - Lua Machine Objects - Base functions
+ *
+ * Copyright (C) 2009-2010 Jo-Philipp Wich <xm@subsignal.org>
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#include "template_lmo.h"
+
+/*
+ * Hash function from http://www.azillionmonkeys.com/qed/hash.html
+ * Copyright (C) 2004-2008 by Paul Hsieh
+ */
+
+uint32_t sfh_hash(const char *data, int len)
+{
+ uint32_t hash = len, tmp;
+ int rem;
+
+ if (len <= 0 || data == NULL) return 0;
+
+ rem = len & 3;
+ len >>= 2;
+
+ /* Main loop */
+ for (;len > 0; len--) {
+ hash += sfh_get16(data);
+ tmp = (sfh_get16(data+2) << 11) ^ hash;
+ hash = (hash << 16) ^ tmp;
+ data += 2*sizeof(uint16_t);
+ hash += hash >> 11;
+ }
+
+ /* Handle end cases */
+ switch (rem) {
+ case 3: hash += sfh_get16(data);
+ hash ^= hash << 16;
+ hash ^= data[sizeof(uint16_t)] << 18;
+ hash += hash >> 11;
+ break;
+ case 2: hash += sfh_get16(data);
+ hash ^= hash << 11;
+ hash += hash >> 17;
+ break;
+ case 1: hash += *data;
+ hash ^= hash << 10;
+ hash += hash >> 1;
+ }
+
+ /* Force "avalanching" of final 127 bits */
+ hash ^= hash << 3;
+ hash += hash >> 5;
+ hash ^= hash << 4;
+ hash += hash >> 17;
+ hash ^= hash << 25;
+ hash += hash >> 6;
+
+ return hash;
+}
+
+uint32_t lmo_canon_hash(const char *str, int len)
+{
+ char res[4096];
+ char *ptr, prev;
+ int off;
+
+ if (!str || len >= sizeof(res))
+ return 0;
+
+ for (prev = ' ', ptr = res, off = 0; off < len; prev = *str, off++, str++)
+ {
+ if (isspace(*str))
+ {
+ if (!isspace(prev))
+ *ptr++ = ' ';
+ }
+ else
+ {
+ *ptr++ = *str;
+ }
+ }
+
+ if ((ptr > res) && isspace(*(ptr-1)))
+ ptr--;
+
+ return sfh_hash(res, ptr - res);
+}
+
+lmo_archive_t * lmo_open(const char *file)
+{
+ int in = -1;
+ uint32_t idx_offset = 0;
+ struct stat s;
+
+ lmo_archive_t *ar = NULL;
+
+ if (stat(file, &s) == -1)
+ goto err;
+
+ if ((in = open(file, O_RDONLY)) == -1)
+ goto err;
+
+ if ((ar = (lmo_archive_t *)malloc(sizeof(*ar))) != NULL)
+ {
+ memset(ar, 0, sizeof(*ar));
+
+ ar->fd = in;
+ ar->size = s.st_size;
+
+ fcntl(ar->fd, F_SETFD, fcntl(ar->fd, F_GETFD) | FD_CLOEXEC);
+
+ if ((ar->mmap = mmap(NULL, ar->size, PROT_READ, MAP_SHARED, ar->fd, 0)) == MAP_FAILED)
+ goto err;
+
+ idx_offset = ntohl(*((const uint32_t *)
+ (ar->mmap + ar->size - sizeof(uint32_t))));
+
+ if (idx_offset >= ar->size)
+ goto err;
+
+ ar->index = (lmo_entry_t *)(ar->mmap + idx_offset);
+ ar->length = (ar->size - idx_offset - sizeof(uint32_t)) / sizeof(lmo_entry_t);
+ ar->end = ar->mmap + ar->size;
+
+ return ar;
+ }
+
+err:
+ if (in > -1)
+ close(in);
+
+ if (ar != NULL)
+ {
+ if ((ar->mmap != NULL) && (ar->mmap != MAP_FAILED))
+ munmap(ar->mmap, ar->size);
+
+ free(ar);
+ }
+
+ return NULL;
+}
+
+void lmo_close(lmo_archive_t *ar)
+{
+ if (ar != NULL)
+ {
+ if ((ar->mmap != NULL) && (ar->mmap != MAP_FAILED))
+ munmap(ar->mmap, ar->size);
+
+ close(ar->fd);
+ free(ar);
+
+ ar = NULL;
+ }
+}
+
+
+lmo_catalog_t *_lmo_catalogs = NULL;
+lmo_catalog_t *_lmo_active_catalog = NULL;
+
+int lmo_load_catalog(const char *lang, const char *dir)
+{
+ DIR *dh = NULL;
+ char pattern[16];
+ char path[PATH_MAX];
+ struct dirent *de = NULL;
+
+ lmo_archive_t *ar = NULL;
+ lmo_catalog_t *cat = NULL;
+
+ if (!lmo_change_catalog(lang))
+ return 0;
+
+ if (!dir || !(dh = opendir(dir)))
+ goto err;
+
+ if (!(cat = malloc(sizeof(*cat))))
+ goto err;
+
+ memset(cat, 0, sizeof(*cat));
+
+ snprintf(cat->lang, sizeof(cat->lang), "%s", lang);
+ snprintf(pattern, sizeof(pattern), "*.%s.lmo", lang);
+
+ while ((de = readdir(dh)) != NULL)
+ {
+ if (!fnmatch(pattern, de->d_name, 0))
+ {
+ snprintf(path, sizeof(path), "%s/%s", dir, de->d_name);
+ ar = lmo_open(path);
+
+ if (ar)
+ {
+ ar->next = cat->archives;
+ cat->archives = ar;
+ }
+ }
+ }
+
+ closedir(dh);
+
+ cat->next = _lmo_catalogs;
+ _lmo_catalogs = cat;
+
+ if (!_lmo_active_catalog)
+ _lmo_active_catalog = cat;
+
+ return 0;
+
+err:
+ if (dh) closedir(dh);
+ if (cat) free(cat);
+
+ return -1;
+}
+
+int lmo_change_catalog(const char *lang)
+{
+ lmo_catalog_t *cat;
+
+ for (cat = _lmo_catalogs; cat; cat = cat->next)
+ {
+ if (!strncmp(cat->lang, lang, sizeof(cat->lang)))
+ {
+ _lmo_active_catalog = cat;
+ return 0;
+ }
+ }
+
+ return -1;
+}
+
+static lmo_entry_t * lmo_find_entry(lmo_archive_t *ar, uint32_t hash)
+{
+ unsigned int m, l, r;
+ uint32_t k;
+
+ l = 0;
+ r = ar->length - 1;
+
+ while (1)
+ {
+ m = l + ((r - l) / 2);
+
+ if (r < l)
+ break;
+
+ k = ntohl(ar->index[m].key_id);
+
+ if (k == hash)
+ return &ar->index[m];
+
+ if (k > hash)
+ {
+ if (!m)
+ break;
+
+ r = m - 1;
+ }
+ else
+ {
+ l = m + 1;
+ }
+ }
+
+ return NULL;
+}
+
+int lmo_translate(const char *key, int keylen, char **out, int *outlen)
+{
+ uint32_t hash;
+ lmo_entry_t *e;
+ lmo_archive_t *ar;
+
+ if (!key || !_lmo_active_catalog)
+ return -2;
+
+ hash = lmo_canon_hash(key, keylen);
+
+ for (ar = _lmo_active_catalog->archives; ar; ar = ar->next)
+ {
+ if ((e = lmo_find_entry(ar, hash)) != NULL)
+ {
+ *out = ar->mmap + ntohl(e->offset);
+ *outlen = ntohl(e->length);
+ return 0;
+ }
+ }
+
+ return -1;
+}
+
+void lmo_close_catalog(const char *lang)
+{
+ lmo_archive_t *ar, *next;
+ lmo_catalog_t *cat, *prev;
+
+ for (prev = NULL, cat = _lmo_catalogs; cat; prev = cat, cat = cat->next)
+ {
+ if (!strncmp(cat->lang, lang, sizeof(cat->lang)))
+ {
+ if (prev)
+ prev->next = cat->next;
+ else
+ _lmo_catalogs = cat->next;
+
+ for (ar = cat->archives; ar; ar = next)
+ {
+ next = ar->next;
+ lmo_close(ar);
+ }
+
+ free(cat);
+ break;
+ }
+ }
+}
--- /dev/null
+/*
+ * lmo - Lua Machine Objects - General header
+ *
+ * Copyright (C) 2009-2012 Jo-Philipp Wich <xm@subsignal.org>
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#ifndef _TEMPLATE_LMO_H_
+#define _TEMPLATE_LMO_H_
+
+#include <stdlib.h>
+#include <stdio.h>
+#include <stdint.h>
+#include <string.h>
+#include <fcntl.h>
+#include <sys/stat.h>
+#include <sys/mman.h>
+#include <arpa/inet.h>
+#include <unistd.h>
+#include <errno.h>
+#include <fnmatch.h>
+#include <dirent.h>
+#include <ctype.h>
+#include <limits.h>
+
+#if (defined(__GNUC__) && defined(__i386__))
+#define sfh_get16(d) (*((const uint16_t *) (d)))
+#else
+#define sfh_get16(d) ((((uint32_t)(((const uint8_t *)(d))[1])) << 8)\
+ +(uint32_t)(((const uint8_t *)(d))[0]) )
+#endif
+
+
+struct lmo_entry {
+ uint32_t key_id;
+ uint32_t val_id;
+ uint32_t offset;
+ uint32_t length;
+} __attribute__((packed));
+
+typedef struct lmo_entry lmo_entry_t;
+
+
+struct lmo_archive {
+ int fd;
+ int length;
+ uint32_t size;
+ lmo_entry_t *index;
+ char *mmap;
+ char *end;
+ struct lmo_archive *next;
+};
+
+typedef struct lmo_archive lmo_archive_t;
+
+
+struct lmo_catalog {
+ char lang[6];
+ struct lmo_archive *archives;
+ struct lmo_catalog *next;
+};
+
+typedef struct lmo_catalog lmo_catalog_t;
+
+
+uint32_t sfh_hash(const char *data, int len);
+uint32_t lmo_canon_hash(const char *data, int len);
+
+lmo_archive_t * lmo_open(const char *file);
+void lmo_close(lmo_archive_t *ar);
+
+
+extern lmo_catalog_t *_lmo_catalogs;
+extern lmo_catalog_t *_lmo_active_catalog;
+
+int lmo_load_catalog(const char *lang, const char *dir);
+int lmo_change_catalog(const char *lang);
+int lmo_translate(const char *key, int keylen, char **out, int *outlen);
+void lmo_close_catalog(const char *lang);
+
+#endif
--- /dev/null
+/*
+ * LuCI Template - Lua binding
+ *
+ * Copyright (C) 2009 Jo-Philipp Wich <xm@subsignal.org>
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#include "template_lualib.h"
+
+int template_L_parse(lua_State *L)
+{
+ const char *file = luaL_checkstring(L, 1);
+ struct template_parser *parser = template_open(file);
+ int lua_status, rv;
+
+ if (!parser)
+ {
+ lua_pushnil(L);
+ lua_pushinteger(L, errno);
+ lua_pushstring(L, strerror(errno));
+ return 3;
+ }
+
+ lua_status = lua_load(L, template_reader, parser, file);
+
+ if (lua_status == 0)
+ rv = 1;
+ else
+ rv = template_error(L, parser);
+
+ template_close(parser);
+
+ return rv;
+}
+
+int template_L_utf8(lua_State *L)
+{
+ size_t len = 0;
+ const char *str = luaL_checklstring(L, 1, &len);
+ char *res = utf8(str, len);
+
+ if (res != NULL)
+ {
+ lua_pushstring(L, res);
+ free(res);
+
+ return 1;
+ }
+
+ return 0;
+}
+
+int template_L_pcdata(lua_State *L)
+{
+ size_t len = 0;
+ const char *str = luaL_checklstring(L, 1, &len);
+ char *res = pcdata(str, len);
+
+ if (res != NULL)
+ {
+ lua_pushstring(L, res);
+ free(res);
+
+ return 1;
+ }
+
+ return 0;
+}
+
+int template_L_striptags(lua_State *L)
+{
+ size_t len = 0;
+ const char *str = luaL_checklstring(L, 1, &len);
+ char *res = striptags(str, len);
+
+ if (res != NULL)
+ {
+ lua_pushstring(L, res);
+ free(res);
+
+ return 1;
+ }
+
+ return 0;
+}
+
+static int template_L_load_catalog(lua_State *L) {
+ const char *lang = luaL_optstring(L, 1, "en");
+ const char *dir = luaL_optstring(L, 2, NULL);
+ lua_pushboolean(L, !lmo_load_catalog(lang, dir));
+ return 1;
+}
+
+static int template_L_close_catalog(lua_State *L) {
+ const char *lang = luaL_optstring(L, 1, "en");
+ lmo_close_catalog(lang);
+ return 0;
+}
+
+static int template_L_change_catalog(lua_State *L) {
+ const char *lang = luaL_optstring(L, 1, "en");
+ lua_pushboolean(L, !lmo_change_catalog(lang));
+ return 1;
+}
+
+static int template_L_translate(lua_State *L) {
+ size_t len;
+ char *tr;
+ int trlen;
+ const char *key = luaL_checklstring(L, 1, &len);
+
+ switch (lmo_translate(key, len, &tr, &trlen))
+ {
+ case 0:
+ lua_pushlstring(L, tr, trlen);
+ return 1;
+
+ case -1:
+ return 0;
+ }
+
+ lua_pushnil(L);
+ lua_pushstring(L, "no catalog loaded");
+ return 2;
+}
+
+static int template_L_hash(lua_State *L) {
+ size_t len;
+ const char *key = luaL_checklstring(L, 1, &len);
+ lua_pushinteger(L, sfh_hash(key, len));
+ return 1;
+}
+
+
+/* module table */
+static const luaL_reg R[] = {
+ { "parse", template_L_parse },
+ { "utf8", template_L_utf8 },
+ { "pcdata", template_L_pcdata },
+ { "striptags", template_L_striptags },
+ { "load_catalog", template_L_load_catalog },
+ { "close_catalog", template_L_close_catalog },
+ { "change_catalog", template_L_change_catalog },
+ { "translate", template_L_translate },
+ { "hash", template_L_hash },
+ { NULL, NULL }
+};
+
+LUALIB_API int luaopen_luci_template_parser(lua_State *L) {
+ luaL_register(L, TEMPLATE_LUALIB_META, R);
+ return 1;
+}
--- /dev/null
+/*
+ * LuCI Template - Lua library header
+ *
+ * Copyright (C) 2009 Jo-Philipp Wich <xm@subsignal.org>
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#ifndef _TEMPLATE_LUALIB_H_
+#define _TEMPLATE_LUALIB_H_
+
+#include "template_parser.h"
+#include "template_utils.h"
+#include "template_lmo.h"
+
+#define TEMPLATE_LUALIB_META "template.parser"
+
+LUALIB_API int luaopen_luci_template_parser(lua_State *L);
+
+#endif
--- /dev/null
+/*
+ * LuCI Template - Parser implementation
+ *
+ * Copyright (C) 2009-2012 Jo-Philipp Wich <xm@subsignal.org>
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#include "template_parser.h"
+#include "template_utils.h"
+#include "template_lmo.h"
+
+
+/* leading and trailing code for different types */
+const char *gen_code[9][2] = {
+ { NULL, NULL },
+ { "write(\"", "\")" },
+ { NULL, NULL },
+ { "write(tostring(", " or \"\"))" },
+ { "include(\"", "\")" },
+ { "write(\"", "\")" },
+ { "write(\"", "\")" },
+ { NULL, " " },
+ { NULL, NULL },
+};
+
+/* Simple strstr() like function that takes len arguments for both haystack and needle. */
+static char *strfind(char *haystack, int hslen, const char *needle, int ndlen)
+{
+ int match = 0;
+ int i, j;
+
+ for( i = 0; i < hslen; i++ )
+ {
+ if( haystack[i] == needle[0] )
+ {
+ match = ((ndlen == 1) || ((i + ndlen) <= hslen));
+
+ for( j = 1; (j < ndlen) && ((i + j) < hslen); j++ )
+ {
+ if( haystack[i+j] != needle[j] )
+ {
+ match = 0;
+ break;
+ }
+ }
+
+ if( match )
+ return &haystack[i];
+ }
+ }
+
+ return NULL;
+}
+
+struct template_parser * template_open(const char *file)
+{
+ struct stat s;
+ static struct template_parser *parser;
+
+ if (!(parser = malloc(sizeof(*parser))))
+ goto err;
+
+ memset(parser, 0, sizeof(*parser));
+ parser->fd = -1;
+ parser->file = file;
+
+ if (stat(file, &s))
+ goto err;
+
+ if ((parser->fd = open(file, O_RDONLY)) < 0)
+ goto err;
+
+ parser->size = s.st_size;
+ parser->mmap = mmap(NULL, parser->size, PROT_READ, MAP_PRIVATE,
+ parser->fd, 0);
+
+ if (parser->mmap != MAP_FAILED)
+ {
+ parser->off = parser->mmap;
+ parser->cur_chunk.type = T_TYPE_INIT;
+ parser->cur_chunk.s = parser->mmap;
+ parser->cur_chunk.e = parser->mmap;
+
+ return parser;
+ }
+
+err:
+ template_close(parser);
+ return NULL;
+}
+
+void template_close(struct template_parser *parser)
+{
+ if (!parser)
+ return;
+
+ if (parser->gc != NULL)
+ free(parser->gc);
+
+ if ((parser->mmap != NULL) && (parser->mmap != MAP_FAILED))
+ munmap(parser->mmap, parser->size);
+
+ if (parser->fd >= 0)
+ close(parser->fd);
+
+ free(parser);
+}
+
+void template_text(struct template_parser *parser, const char *e)
+{
+ const char *s = parser->off;
+
+ if (s < (parser->mmap + parser->size))
+ {
+ if (parser->strip_after)
+ {
+ while ((s <= e) && isspace(*s))
+ s++;
+ }
+
+ parser->cur_chunk.type = T_TYPE_TEXT;
+ }
+ else
+ {
+ parser->cur_chunk.type = T_TYPE_EOF;
+ }
+
+ parser->cur_chunk.line = parser->line;
+ parser->cur_chunk.s = s;
+ parser->cur_chunk.e = e;
+}
+
+void template_code(struct template_parser *parser, const char *e)
+{
+ const char *s = parser->off;
+
+ parser->strip_before = 0;
+ parser->strip_after = 0;
+
+ if (*s == '-')
+ {
+ parser->strip_before = 1;
+ for (s++; (s <= e) && (*s == ' ' || *s == '\t'); s++);
+ }
+
+ if (*(e-1) == '-')
+ {
+ parser->strip_after = 1;
+ for (e--; (e >= s) && (*e == ' ' || *e == '\t'); e--);
+ }
+
+ switch (*s)
+ {
+ /* comment */
+ case '#':
+ s++;
+ parser->cur_chunk.type = T_TYPE_COMMENT;
+ break;
+
+ /* include */
+ case '+':
+ s++;
+ parser->cur_chunk.type = T_TYPE_INCLUDE;
+ break;
+
+ /* translate */
+ case ':':
+ s++;
+ parser->cur_chunk.type = T_TYPE_I18N;
+ break;
+
+ /* translate raw */
+ case '_':
+ s++;
+ parser->cur_chunk.type = T_TYPE_I18N_RAW;
+ break;
+
+ /* expr */
+ case '=':
+ s++;
+ parser->cur_chunk.type = T_TYPE_EXPR;
+ break;
+
+ /* code */
+ default:
+ parser->cur_chunk.type = T_TYPE_CODE;
+ break;
+ }
+
+ parser->cur_chunk.line = parser->line;
+ parser->cur_chunk.s = s;
+ parser->cur_chunk.e = e;
+}
+
+static const char *
+template_format_chunk(struct template_parser *parser, size_t *sz)
+{
+ const char *s, *p;
+ const char *head, *tail;
+ struct template_chunk *c = &parser->prv_chunk;
+ struct template_buffer *buf;
+
+ *sz = 0;
+ s = parser->gc = NULL;
+
+ if (parser->strip_before && c->type == T_TYPE_TEXT)
+ {
+ while ((c->e > c->s) && isspace(*(c->e - 1)))
+ c->e--;
+ }
+
+ /* empty chunk */
+ if (c->s == c->e)
+ {
+ if (c->type == T_TYPE_EOF)
+ {
+ *sz = 0;
+ s = NULL;
+ }
+ else
+ {
+ *sz = 1;
+ s = " ";
+ }
+ }
+
+ /* format chunk */
+ else if ((buf = buf_init(c->e - c->s)) != NULL)
+ {
+ if ((head = gen_code[c->type][0]) != NULL)
+ buf_append(buf, head, strlen(head));
+
+ switch (c->type)
+ {
+ case T_TYPE_TEXT:
+ luastr_escape(buf, c->s, c->e - c->s, 0);
+ break;
+
+ case T_TYPE_EXPR:
+ buf_append(buf, c->s, c->e - c->s);
+ for (p = c->s; p < c->e; p++)
+ parser->line += (*p == '\n');
+ break;
+
+ case T_TYPE_INCLUDE:
+ luastr_escape(buf, c->s, c->e - c->s, 0);
+ break;
+
+ case T_TYPE_I18N:
+ luastr_translate(buf, c->s, c->e - c->s, 1);
+ break;
+
+ case T_TYPE_I18N_RAW:
+ luastr_translate(buf, c->s, c->e - c->s, 0);
+ break;
+
+ case T_TYPE_CODE:
+ buf_append(buf, c->s, c->e - c->s);
+ for (p = c->s; p < c->e; p++)
+ parser->line += (*p == '\n');
+ break;
+ }
+
+ if ((tail = gen_code[c->type][1]) != NULL)
+ buf_append(buf, tail, strlen(tail));
+
+ *sz = buf_length(buf);
+ s = parser->gc = buf_destroy(buf);
+
+ if (!*sz)
+ {
+ *sz = 1;
+ s = " ";
+ }
+ }
+
+ return s;
+}
+
+const char *template_reader(lua_State *L, void *ud, size_t *sz)
+{
+ struct template_parser *parser = ud;
+ int rem = parser->size - (parser->off - parser->mmap);
+ char *tag;
+
+ parser->prv_chunk = parser->cur_chunk;
+
+ /* free previous string */
+ if (parser->gc)
+ {
+ free(parser->gc);
+ parser->gc = NULL;
+ }
+
+ /* before tag */
+ if (!parser->in_expr)
+ {
+ if ((tag = strfind(parser->off, rem, "<%", 2)) != NULL)
+ {
+ template_text(parser, tag);
+ parser->off = tag + 2;
+ parser->in_expr = 1;
+ }
+ else
+ {
+ template_text(parser, parser->mmap + parser->size);
+ parser->off = parser->mmap + parser->size;
+ }
+ }
+
+ /* inside tag */
+ else
+ {
+ if ((tag = strfind(parser->off, rem, "%>", 2)) != NULL)
+ {
+ template_code(parser, tag);
+ parser->off = tag + 2;
+ parser->in_expr = 0;
+ }
+ else
+ {
+ /* unexpected EOF */
+ template_code(parser, parser->mmap + parser->size);
+
+ *sz = 1;
+ return "\033";
+ }
+ }
+
+ return template_format_chunk(parser, sz);
+}
+
+int template_error(lua_State *L, struct template_parser *parser)
+{
+ const char *err = luaL_checkstring(L, -1);
+ const char *off = parser->prv_chunk.s;
+ const char *ptr;
+ char msg[1024];
+ int line = 0;
+ int chunkline = 0;
+
+ if ((ptr = strfind((char *)err, strlen(err), "]:", 2)) != NULL)
+ {
+ chunkline = atoi(ptr + 2) - parser->prv_chunk.line;
+
+ while (*ptr)
+ {
+ if (*ptr++ == ' ')
+ {
+ err = ptr;
+ break;
+ }
+ }
+ }
+
+ if (strfind((char *)err, strlen(err), "'char(27)'", 10) != NULL)
+ {
+ off = parser->mmap + parser->size;
+ err = "'%>' expected before end of file";
+ chunkline = 0;
+ }
+
+ for (ptr = parser->mmap; ptr < off; ptr++)
+ if (*ptr == '\n')
+ line++;
+
+ snprintf(msg, sizeof(msg), "Syntax error in %s:%d: %s",
+ parser->file, line + chunkline, err ? err : "(unknown error)");
+
+ lua_pushnil(L);
+ lua_pushinteger(L, line + chunkline);
+ lua_pushstring(L, msg);
+
+ return 3;
+}
--- /dev/null
+/*
+ * LuCI Template - Parser header
+ *
+ * Copyright (C) 2009 Jo-Philipp Wich <xm@subsignal.org>
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#ifndef _TEMPLATE_PARSER_H_
+#define _TEMPLATE_PARSER_H_
+
+#include <stdlib.h>
+#include <stdio.h>
+#include <stdint.h>
+#include <unistd.h>
+#include <fcntl.h>
+#include <sys/stat.h>
+#include <sys/mman.h>
+#include <string.h>
+#include <ctype.h>
+#include <errno.h>
+
+#include <lua.h>
+#include <lualib.h>
+#include <lauxlib.h>
+
+
+/* code types */
+#define T_TYPE_INIT 0
+#define T_TYPE_TEXT 1
+#define T_TYPE_COMMENT 2
+#define T_TYPE_EXPR 3
+#define T_TYPE_INCLUDE 4
+#define T_TYPE_I18N 5
+#define T_TYPE_I18N_RAW 6
+#define T_TYPE_CODE 7
+#define T_TYPE_EOF 8
+
+
+struct template_chunk {
+ const char *s;
+ const char *e;
+ int type;
+ int line;
+};
+
+/* parser state */
+struct template_parser {
+ int fd;
+ uint32_t size;
+ char *mmap;
+ char *off;
+ char *gc;
+ int line;
+ int in_expr;
+ int strip_before;
+ int strip_after;
+ struct template_chunk prv_chunk;
+ struct template_chunk cur_chunk;
+ const char *file;
+};
+
+struct template_parser * template_open(const char *file);
+void template_close(struct template_parser *parser);
+
+const char *template_reader(lua_State *L, void *ud, size_t *sz);
+int template_error(lua_State *L, struct template_parser *parser);
+
+#endif
--- /dev/null
+/*
+ * LuCI Template - Utility functions
+ *
+ * Copyright (C) 2010 Jo-Philipp Wich <xm@subsignal.org>
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#include "template_utils.h"
+#include "template_lmo.h"
+
+/* initialize a buffer object */
+struct template_buffer * buf_init(int size)
+{
+ struct template_buffer *buf;
+
+ if (size <= 0)
+ size = 1024;
+
+ buf = (struct template_buffer *)malloc(sizeof(struct template_buffer));
+
+ if (buf != NULL)
+ {
+ buf->fill = 0;
+ buf->size = size;
+ buf->data = malloc(buf->size);
+
+ if (buf->data != NULL)
+ {
+ buf->dptr = buf->data;
+ buf->data[0] = 0;
+
+ return buf;
+ }
+
+ free(buf);
+ }
+
+ return NULL;
+}
+
+/* grow buffer */
+int buf_grow(struct template_buffer *buf, int size)
+{
+ unsigned int off = (buf->dptr - buf->data);
+ char *data;
+
+ if (size <= 0)
+ size = 1024;
+
+ data = realloc(buf->data, buf->size + size);
+
+ if (data != NULL)
+ {
+ buf->data = data;
+ buf->dptr = data + off;
+ buf->size += size;
+
+ return buf->size;
+ }
+
+ return 0;
+}
+
+/* put one char into buffer object */
+int buf_putchar(struct template_buffer *buf, char c)
+{
+ if( ((buf->fill + 1) >= buf->size) && !buf_grow(buf, 0) )
+ return 0;
+
+ *(buf->dptr++) = c;
+ *(buf->dptr) = 0;
+
+ buf->fill++;
+ return 1;
+}
+
+/* append data to buffer */
+int buf_append(struct template_buffer *buf, const char *s, int len)
+{
+ if ((buf->fill + len + 1) >= buf->size)
+ {
+ if (!buf_grow(buf, len + 1))
+ return 0;
+ }
+
+ memcpy(buf->dptr, s, len);
+ buf->fill += len;
+ buf->dptr += len;
+
+ *(buf->dptr) = 0;
+
+ return len;
+}
+
+/* read buffer length */
+int buf_length(struct template_buffer *buf)
+{
+ return buf->fill;
+}
+
+/* destroy buffer object and return pointer to data */
+char * buf_destroy(struct template_buffer *buf)
+{
+ char *data = buf->data;
+
+ free(buf);
+ return data;
+}
+
+
+/* calculate the number of expected continuation chars */
+static inline int mb_num_chars(unsigned char c)
+{
+ if ((c & 0xE0) == 0xC0)
+ return 2;
+ else if ((c & 0xF0) == 0xE0)
+ return 3;
+ else if ((c & 0xF8) == 0xF0)
+ return 4;
+ else if ((c & 0xFC) == 0xF8)
+ return 5;
+ else if ((c & 0xFE) == 0xFC)
+ return 6;
+
+ return 1;
+}
+
+/* test whether the given byte is a valid continuation char */
+static inline int mb_is_cont(unsigned char c)
+{
+ return ((c >= 0x80) && (c <= 0xBF));
+}
+
+/* test whether the byte sequence at the given pointer with the given
+ * length is the shortest possible representation of the code point */
+static inline int mb_is_shortest(unsigned char *s, int n)
+{
+ switch (n)
+ {
+ case 2:
+ /* 1100000x (10xxxxxx) */
+ return !(((*s >> 1) == 0x60) &&
+ ((*(s+1) >> 6) == 0x02));
+
+ case 3:
+ /* 11100000 100xxxxx (10xxxxxx) */
+ return !((*s == 0xE0) &&
+ ((*(s+1) >> 5) == 0x04) &&
+ ((*(s+2) >> 6) == 0x02));
+
+ case 4:
+ /* 11110000 1000xxxx (10xxxxxx 10xxxxxx) */
+ return !((*s == 0xF0) &&
+ ((*(s+1) >> 4) == 0x08) &&
+ ((*(s+2) >> 6) == 0x02) &&
+ ((*(s+3) >> 6) == 0x02));
+
+ case 5:
+ /* 11111000 10000xxx (10xxxxxx 10xxxxxx 10xxxxxx) */
+ return !((*s == 0xF8) &&
+ ((*(s+1) >> 3) == 0x10) &&
+ ((*(s+2) >> 6) == 0x02) &&
+ ((*(s+3) >> 6) == 0x02) &&
+ ((*(s+4) >> 6) == 0x02));
+
+ case 6:
+ /* 11111100 100000xx (10xxxxxx 10xxxxxx 10xxxxxx 10xxxxxx) */
+ return !((*s == 0xF8) &&
+ ((*(s+1) >> 2) == 0x20) &&
+ ((*(s+2) >> 6) == 0x02) &&
+ ((*(s+3) >> 6) == 0x02) &&
+ ((*(s+4) >> 6) == 0x02) &&
+ ((*(s+5) >> 6) == 0x02));
+ }
+
+ return 1;
+}
+
+/* test whether the byte sequence at the given pointer with the given
+ * length is an UTF-16 surrogate */
+static inline int mb_is_surrogate(unsigned char *s, int n)
+{
+ return ((n == 3) && (*s == 0xED) && (*(s+1) >= 0xA0) && (*(s+1) <= 0xBF));
+}
+
+/* test whether the byte sequence at the given pointer with the given
+ * length is an illegal UTF-8 code point */
+static inline int mb_is_illegal(unsigned char *s, int n)
+{
+ return ((n == 3) && (*s == 0xEF) && (*(s+1) == 0xBF) &&
+ (*(s+2) >= 0xBE) && (*(s+2) <= 0xBF));
+}
+
+
+/* scan given source string, validate UTF-8 sequence and store result
+ * in given buffer object */
+static int _validate_utf8(unsigned char **s, int l, struct template_buffer *buf)
+{
+ unsigned char *ptr = *s;
+ unsigned int o = 0, v, n;
+
+ /* ascii byte without null */
+ if ((*(ptr+0) >= 0x01) && (*(ptr+0) <= 0x7F))
+ {
+ if (!buf_putchar(buf, *ptr++))
+ return 0;
+
+ o = 1;
+ }
+
+ /* multi byte sequence */
+ else if ((n = mb_num_chars(*ptr)) > 1)
+ {
+ /* count valid chars */
+ for (v = 1; (v <= n) && ((o+v) < l) && mb_is_cont(*(ptr+v)); v++);
+
+ switch (n)
+ {
+ case 6:
+ case 5:
+ /* five and six byte sequences are always invalid */
+ if (!buf_putchar(buf, '?'))
+ return 0;
+
+ break;
+
+ default:
+ /* if the number of valid continuation bytes matches the
+ * expected number and if the sequence is legal, copy
+ * the bytes to the destination buffer */
+ if ((v == n) && mb_is_shortest(ptr, n) &&
+ !mb_is_surrogate(ptr, n) && !mb_is_illegal(ptr, n))
+ {
+ /* copy sequence */
+ if (!buf_append(buf, (char *)ptr, n))
+ return 0;
+ }
+
+ /* the found sequence is illegal, skip it */
+ else
+ {
+ /* invalid sequence */
+ if (!buf_putchar(buf, '?'))
+ return 0;
+ }
+
+ break;
+ }
+
+ /* advance beyound the last found valid continuation char */
+ o = v;
+ ptr += v;
+ }
+
+ /* invalid byte (0x00) */
+ else
+ {
+ if (!buf_putchar(buf, '?')) /* or 0xEF, 0xBF, 0xBD */
+ return 0;
+
+ o = 1;
+ ptr++;
+ }
+
+ *s = ptr;
+ return o;
+}
+
+/* sanitize given string and replace all invalid UTF-8 sequences with "?" */
+char * utf8(const char *s, unsigned int l)
+{
+ struct template_buffer *buf = buf_init(l);
+ unsigned char *ptr = (unsigned char *)s;
+ unsigned int v, o;
+
+ if (!buf)
+ return NULL;
+
+ for (o = 0; o < l; o++)
+ {
+ /* ascii char */
+ if ((*ptr >= 0x01) && (*ptr <= 0x7F))
+ {
+ if (!buf_putchar(buf, (char)*ptr++))
+ break;
+ }
+
+ /* invalid byte or multi byte sequence */
+ else
+ {
+ if (!(v = _validate_utf8(&ptr, l - o, buf)))
+ break;
+
+ o += (v - 1);
+ }
+ }
+
+ return buf_destroy(buf);
+}
+
+/* Sanitize given string and strip all invalid XML bytes
+ * Validate UTF-8 sequences
+ * Escape XML control chars */
+char * pcdata(const char *s, unsigned int l)
+{
+ struct template_buffer *buf = buf_init(l);
+ unsigned char *ptr = (unsigned char *)s;
+ unsigned int o, v;
+ char esq[8];
+ int esl;
+
+ if (!buf)
+ return NULL;
+
+ for (o = 0; o < l; o++)
+ {
+ /* Invalid XML bytes */
+ if (((*ptr >= 0x00) && (*ptr <= 0x08)) ||
+ ((*ptr >= 0x0B) && (*ptr <= 0x0C)) ||
+ ((*ptr >= 0x0E) && (*ptr <= 0x1F)) ||
+ (*ptr == 0x7F))
+ {
+ ptr++;
+ }
+
+ /* Escapes */
+ else if ((*ptr == 0x26) ||
+ (*ptr == 0x27) ||
+ (*ptr == 0x22) ||
+ (*ptr == 0x3C) ||
+ (*ptr == 0x3E))
+ {
+ esl = snprintf(esq, sizeof(esq), "&#%i;", *ptr);
+
+ if (!buf_append(buf, esq, esl))
+ break;
+
+ ptr++;
+ }
+
+ /* ascii char */
+ else if (*ptr <= 0x7F)
+ {
+ buf_putchar(buf, (char)*ptr++);
+ }
+
+ /* multi byte sequence */
+ else
+ {
+ if (!(v = _validate_utf8(&ptr, l - o, buf)))
+ break;
+
+ o += (v - 1);
+ }
+ }
+
+ return buf_destroy(buf);
+}
+
+char * striptags(const char *s, unsigned int l)
+{
+ struct template_buffer *buf = buf_init(l);
+ unsigned char *ptr = (unsigned char *)s;
+ unsigned char *end = ptr + l;
+ unsigned char *tag;
+ unsigned char prev;
+ char esq[8];
+ int esl;
+
+ for (prev = ' '; ptr < end; ptr++)
+ {
+ if ((*ptr == '<') && ((ptr + 2) < end) &&
+ ((*(ptr + 1) == '/') || isalpha(*(ptr + 1))))
+ {
+ for (tag = ptr; tag < end; tag++)
+ {
+ if (*tag == '>')
+ {
+ if (!isspace(prev))
+ buf_putchar(buf, ' ');
+
+ ptr = tag;
+ prev = ' ';
+ break;
+ }
+ }
+ }
+ else if (isspace(*ptr))
+ {
+ if (!isspace(prev))
+ buf_putchar(buf, *ptr);
+
+ prev = *ptr;
+ }
+ else
+ {
+ switch(*ptr)
+ {
+ case '"':
+ case '\'':
+ case '<':
+ case '>':
+ case '&':
+ esl = snprintf(esq, sizeof(esq), "&#%i;", *ptr);
+ buf_append(buf, esq, esl);
+ break;
+
+ default:
+ buf_putchar(buf, *ptr);
+ break;
+ }
+
+ prev = *ptr;
+ }
+ }
+
+ return buf_destroy(buf);
+}
+
+void luastr_escape(struct template_buffer *out, const char *s, unsigned int l,
+ int escape_xml)
+{
+ int esl;
+ char esq[8];
+ char *ptr;
+
+ for (ptr = (char *)s; ptr < (s + l); ptr++)
+ {
+ switch (*ptr)
+ {
+ case '\\':
+ buf_append(out, "\\\\", 2);
+ break;
+
+ case '"':
+ if (escape_xml)
+ buf_append(out, """, 5);
+ else
+ buf_append(out, "\\\"", 2);
+ break;
+
+ case '\n':
+ buf_append(out, "\\n", 2);
+ break;
+
+ case '\'':
+ case '&':
+ case '<':
+ case '>':
+ if (escape_xml)
+ {
+ esl = snprintf(esq, sizeof(esq), "&#%i;", *ptr);
+ buf_append(out, esq, esl);
+ break;
+ }
+
+ default:
+ buf_putchar(out, *ptr);
+ }
+ }
+}
+
+void luastr_translate(struct template_buffer *out, const char *s, unsigned int l,
+ int escape_xml)
+{
+ char *tr;
+ int trlen;
+
+ switch (lmo_translate(s, l, &tr, &trlen))
+ {
+ case 0:
+ luastr_escape(out, tr, trlen, escape_xml);
+ break;
+
+ case -1:
+ luastr_escape(out, s, l, escape_xml);
+ break;
+
+ default:
+ /* no catalog loaded */
+ break;
+ }
+}
--- /dev/null
+/*
+ * LuCI Template - Utility header
+ *
+ * Copyright (C) 2010-2012 Jo-Philipp Wich <xm@subsignal.org>
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#ifndef _TEMPLATE_UTILS_H_
+#define _TEMPLATE_UTILS_H_
+
+#include <stdlib.h>
+#include <stdio.h>
+#include <string.h>
+
+
+/* buffer object */
+struct template_buffer {
+ char *data;
+ char *dptr;
+ unsigned int size;
+ unsigned int fill;
+};
+
+struct template_buffer * buf_init(int size);
+int buf_grow(struct template_buffer *buf, int size);
+int buf_putchar(struct template_buffer *buf, char c);
+int buf_append(struct template_buffer *buf, const char *s, int len);
+int buf_length(struct template_buffer *buf);
+char * buf_destroy(struct template_buffer *buf);
+
+char * utf8(const char *s, unsigned int l);
+char * pcdata(const char *s, unsigned int l);
+char * striptags(const char *s, unsigned int l);
+
+void luastr_escape(struct template_buffer *out, const char *s, unsigned int l, int escape_xml);
+void luastr_translate(struct template_buffer *out, const char *s, unsigned int l, int escape_xml);
+
+#endif
--- /dev/null
+LUAC = luac
+LUAC_OPTIONS = -s
+LUA_TARGET ?= source
+
+LUA_MODULEDIR = /usr/local/share/lua/5.1
+LUA_LIBRARYDIR = /usr/local/lib/lua/5.1
+
+OS ?= $(shell uname)
+
+LUA_SHLIBS = $(shell pkg-config --silence-errors --libs lua5.1 || pkg-config --silence-errors --libs lua-5.1 || pkg-config --silence-errors --libs lua)
+LUA_LIBS = $(if $(LUA_SHLIBS),$(LUA_SHLIBS),$(firstword $(wildcard /usr/lib/liblua.a /usr/local/lib/liblua.a /opt/local/lib/liblua.a)))
+LUA_CFLAGS = $(shell pkg-config --silence-errors --cflags lua5.1 || pkg-config --silence-errors --cflags lua-5.1 || pkg-config --silence-errors --cflags lua)
+
+CC = gcc
+AR = ar
+RANLIB = ranlib
+CFLAGS = -O2
+FPIC = -fPIC
+EXTRA_CFLAGS = --std=gnu99
+WFLAGS = -Wall -Werror -pedantic
+CPPFLAGS =
+COMPILE = $(CC) $(CPPFLAGS) $(CFLAGS) $(EXTRA_CFLAGS) $(WFLAGS)
+ifeq ($(OS),Darwin)
+ SHLIB_FLAGS = -bundle -undefined dynamic_lookup
+else
+ SHLIB_FLAGS = -shared
+endif
+LINK = $(CC) $(LDFLAGS)
+
+.PHONY: all build compile luacompile luasource clean luaclean
+
+all: build
+
+build: luabuild gccbuild
+
+luabuild: lua$(LUA_TARGET)
+
+gccbuild: compile
+compile:
+
+clean: luaclean
+
+luasource:
+ mkdir -p dist$(LUA_MODULEDIR)
+ cp -pR root/* dist 2>/dev/null || true
+ cp -pR lua/* dist$(LUA_MODULEDIR) 2>/dev/null || true
+ for i in $$(find dist -name .svn); do rm -rf $$i || true; done
+
+luastrip: luasource
+ for i in $$(find dist -type f -name '*.lua'); do perl -e 'undef $$/; open( F, "< $$ARGV[0]" ) || die $$!; $$src = <F>; close F; $$src =~ s/--\[\[.*?\]\](--)?//gs; $$src =~ s/^\s*--.*?\n//gm; open( F, "> $$ARGV[0]" ) || die $$!; print F $$src; close F' $$i; done
+
+luacompile: luasource
+ for i in $$(find dist -name *.lua -not -name debug.lua); do $(LUAC) $(LUAC_OPTIONS) -o $$i $$i; done
+
+luaclean:
+ rm -rf dist
+++ /dev/null
-include ../../build/config.mk
-include ../../build/module.mk
+++ /dev/null
---[[
-LuCI - Lua Configuration Interface
-
-Copyright 2011-2012 Jo-Philipp Wich <xm@subsignal.org>
-
-Licensed under the Apache License, Version 2.0 (the "License");
-you may not use this file except in compliance with the License.
-You may obtain a copy of the License at
-
- http://www.apache.org/licenses/LICENSE-2.0
-]]--
-
-local map, section, net = ...
-local ifc = net:get_interface()
-
-local hostname, accept_ra, send_rs
-local bcast, defaultroute, peerdns, dns, metric, clientid, vendorclass
-
-
-hostname = section:taboption("general", Value, "hostname",
- translate("Hostname to send when requesting DHCP"))
-
-hostname.placeholder = luci.sys.hostname()
-hostname.datatype = "hostname"
-
-
-bcast = section:taboption("advanced", Flag, "broadcast",
- translate("Use broadcast flag"),
- translate("Required for certain ISPs, e.g. Charter with DOCSIS 3"))
-
-bcast.default = bcast.disabled
-
-
-defaultroute = section:taboption("advanced", Flag, "defaultroute",
- translate("Use default gateway"),
- translate("If unchecked, no default route is configured"))
-
-defaultroute.default = defaultroute.enabled
-
-
-peerdns = section:taboption("advanced", Flag, "peerdns",
- translate("Use DNS servers advertised by peer"),
- translate("If unchecked, the advertised DNS server addresses are ignored"))
-
-peerdns.default = peerdns.enabled
-
-
-dns = section:taboption("advanced", DynamicList, "dns",
- translate("Use custom DNS servers"))
-
-dns:depends("peerdns", "")
-dns.datatype = "ipaddr"
-dns.cast = "string"
-
-
-metric = section:taboption("advanced", Value, "metric",
- translate("Use gateway metric"))
-
-metric.placeholder = "0"
-metric.datatype = "uinteger"
-
-
-clientid = section:taboption("advanced", Value, "clientid",
- translate("Client ID to send when requesting DHCP"))
-
-
-vendorclass = section:taboption("advanced", Value, "vendorid",
- translate("Vendor Class to send when requesting DHCP"))
-
-
-luci.tools.proto.opt_macaddr(section, ifc, translate("Override MAC address"))
-
-
-mtu = section:taboption("advanced", Value, "mtu", translate("Override MTU"))
-mtu.placeholder = "1500"
-mtu.datatype = "max(9200)"
+++ /dev/null
---[[
-LuCI - Lua Configuration Interface
-
-Copyright 2011 Jo-Philipp Wich <xm@subsignal.org>
-
-Licensed under the Apache License, Version 2.0 (the "License");
-you may not use this file except in compliance with the License.
-You may obtain a copy of the License at
-
- http://www.apache.org/licenses/LICENSE-2.0
-]]--
-
-local map, section, net = ...
+++ /dev/null
---[[
-LuCI - Lua Configuration Interface
-
-Copyright 2011 Jo-Philipp Wich <xm@subsignal.org>
-
-Licensed under the Apache License, Version 2.0 (the "License");
-you may not use this file except in compliance with the License.
-You may obtain a copy of the License at
-
- http://www.apache.org/licenses/LICENSE-2.0
-]]--
-
-local map, section, net = ...
-local ifc = net:get_interface()
-
-local ipaddr, netmask, gateway, broadcast, dns, accept_ra, send_rs, ip6addr, ip6gw
-local mtu, metric
-
-
-ipaddr = section:taboption("general", Value, "ipaddr", translate("IPv4 address"))
-ipaddr.datatype = "ip4addr"
-
-
-netmask = section:taboption("general", Value, "netmask",
- translate("IPv4 netmask"))
-
-netmask.datatype = "ip4addr"
-netmask:value("255.255.255.0")
-netmask:value("255.255.0.0")
-netmask:value("255.0.0.0")
-
-
-gateway = section:taboption("general", Value, "gateway", translate("IPv4 gateway"))
-gateway.datatype = "ip4addr"
-
-
-broadcast = section:taboption("general", Value, "broadcast", translate("IPv4 broadcast"))
-broadcast.datatype = "ip4addr"
-
-
-dns = section:taboption("general", DynamicList, "dns",
- translate("Use custom DNS servers"))
-
-dns.datatype = "ipaddr"
-dns.cast = "string"
-
-
-if luci.model.network:has_ipv6() then
-
- local ip6assign = section:taboption("general", Value, "ip6assign", translate("IPv6 assignment length"),
- translate("Assign a part of given length of every public IPv6-prefix to this interface"))
- ip6assign:value("", translate("disabled"))
- ip6assign:value("64")
- ip6assign.datatype = "max(64)"
-
- local ip6hint = section:taboption("general", Value, "ip6hint", translate("IPv6 assignment hint"),
- translate("Assign prefix parts using this hexadecimal subprefix ID for this interface."))
- for i=33,64 do ip6hint:depends("ip6assign", i) end
-
- ip6addr = section:taboption("general", Value, "ip6addr", translate("IPv6 address"))
- ip6addr.datatype = "ip6addr"
- ip6addr:depends("ip6assign", "")
-
-
- ip6gw = section:taboption("general", Value, "ip6gw", translate("IPv6 gateway"))
- ip6gw.datatype = "ip6addr"
- ip6gw:depends("ip6assign", "")
-
-
- local ip6prefix = s:taboption("general", Value, "ip6prefix", translate("IPv6 routed prefix"),
- translate("Public prefix routed to this device for distribution to clients."))
- ip6prefix.datatype = "ip6addr"
- ip6prefix:depends("ip6assign", "")
-
-end
-
-
-luci.tools.proto.opt_macaddr(section, ifc, translate("Override MAC address"))
-
-
-mtu = section:taboption("advanced", Value, "mtu", translate("Override MTU"))
-mtu.placeholder = "1500"
-mtu.datatype = "max(9200)"
-
-
-metric = section:taboption("advanced", Value, "metric",
- translate("Use gateway metric"))
-
-metric.placeholder = "0"
-metric.datatype = "uinteger"
+++ /dev/null
---[[
-LuCI - Lua Configuration Interface
-
-Copyright 2012 Jo-Philipp Wich <xm@subsignal.org>
-
-Licensed under the Apache License, Version 2.0 (the "License");
-you may not use this file except in compliance with the License.
-You may obtain a copy of the License at
-
- http://www.apache.org/licenses/LICENSE-2.0
-
-]]--
-
-module("luci.tools.proto", package.seeall)
-
-function opt_macaddr(s, ifc, ...)
- local v = luci.cbi.Value
- local o = s:taboption("advanced", v, "macaddr", ...)
-
- o.placeholder = ifc and ifc:mac()
- o.datatype = "macaddr"
-
- function o.cfgvalue(self, section)
- local w = ifc and ifc:get_wifinet()
- if w then
- return w:get("macaddr")
- else
- return v.cfgvalue(self, section)
- end
- end
-
- function o.write(self, section, value)
- local w = ifc and ifc:get_wifinet()
- if w then
- w:set("macaddr", value)
- elseif value then
- v.write(self, section, value)
- else
- v.remove(self, section)
- end
- end
-
- function o.remove(self, section)
- self:write(section, nil)
- end
-end
+++ /dev/null
-include ../../build/config.mk
-include ../../build/module.mk
\ No newline at end of file
+++ /dev/null
-/*
- * xhr.js - XMLHttpRequest helper class
- * (c) 2008-2010 Jo-Philipp Wich
- */
-
-XHR = function()
-{
- this.reinit = function()
- {
- if (window.XMLHttpRequest) {
- this._xmlHttp = new XMLHttpRequest();
- }
- else if (window.ActiveXObject) {
- this._xmlHttp = new ActiveXObject("Microsoft.XMLHTTP");
- }
- else {
- alert("xhr.js: XMLHttpRequest is not supported by this browser!");
- }
- }
-
- this.busy = function() {
- if (!this._xmlHttp)
- return false;
-
- switch (this._xmlHttp.readyState)
- {
- case 1:
- case 2:
- case 3:
- return true;
-
- default:
- return false;
- }
- }
-
- this.abort = function() {
- if (this.busy())
- this._xmlHttp.abort();
- }
-
- this.get = function(url,data,callback)
- {
- this.reinit();
-
- var xhr = this._xmlHttp;
- var code = this._encode(data);
-
- url = location.protocol + '//' + location.host + url;
-
- if (code)
- if (url.substr(url.length-1,1) == '&')
- url += code;
- else
- url += '?' + code;
-
- xhr.open('GET', url, true);
-
- xhr.onreadystatechange = function()
- {
- if (xhr.readyState == 4) {
- var json = null;
- if (xhr.getResponseHeader("Content-Type") == "application/json") {
- try {
- json = eval('(' + xhr.responseText + ')');
- }
- catch(e) {
- json = null;
- }
- }
-
- callback(xhr, json);
- }
- }
-
- xhr.send(null);
- }
-
- this.post = function(url,data,callback)
- {
- this.reinit();
-
- var xhr = this._xmlHttp;
- var code = this._encode(data);
-
- xhr.onreadystatechange = function()
- {
- if (xhr.readyState == 4)
- callback(xhr);
- }
-
- xhr.open('POST', url, true);
- xhr.setRequestHeader('Content-type', 'application/x-www-form-urlencoded');
- xhr.setRequestHeader('Content-length', code.length);
- xhr.setRequestHeader('Connection', 'close');
- xhr.send(code);
- }
-
- this.cancel = function()
- {
- this._xmlHttp.onreadystatechange = function(){};
- this._xmlHttp.abort();
- }
-
- this.send_form = function(form,callback,extra_values)
- {
- var code = '';
-
- for (var i = 0; i < form.elements.length; i++)
- {
- var e = form.elements[i];
-
- if (e.options)
- {
- code += (code ? '&' : '') +
- form.elements[i].name + '=' + encodeURIComponent(
- e.options[e.selectedIndex].value
- );
- }
- else if (e.length)
- {
- for (var j = 0; j < e.length; j++)
- if (e[j].name) {
- code += (code ? '&' : '') +
- e[j].name + '=' + encodeURIComponent(e[j].value);
- }
- }
- else
- {
- code += (code ? '&' : '') +
- e.name + '=' + encodeURIComponent(e.value);
- }
- }
-
- if (typeof extra_values == 'object')
- for (var key in extra_values)
- code += (code ? '&' : '') +
- key + '=' + encodeURIComponent(extra_values[key]);
-
- return(
- (form.method == 'get')
- ? this.get(form.getAttribute('action'), code, callback)
- : this.post(form.getAttribute('action'), code, callback)
- );
- }
-
- this._encode = function(obj)
- {
- obj = obj ? obj : { };
- obj['_'] = Math.random();
-
- if (typeof obj == 'object')
- {
- var code = '';
- var self = this;
-
- for (var k in obj)
- code += (code ? '&' : '') +
- k + '=' + encodeURIComponent(obj[k]);
-
- return code;
- }
-
- return obj;
- }
-}
-
-XHR.get = function(url, data, callback)
-{
- (new XHR()).get(url, data, callback);
-}
-
-XHR.poll = function(interval, url, data, callback)
-{
- if (isNaN(interval) || interval < 1)
- interval = 5;
-
- if (!XHR._q)
- {
- XHR._t = 0;
- XHR._q = [ ];
- XHR._r = function() {
- for (var i = 0, e = XHR._q[0]; i < XHR._q.length; e = XHR._q[++i])
- {
- if (!(XHR._t % e.interval) && !e.xhr.busy())
- e.xhr.get(e.url, e.data, e.callback);
- }
-
- XHR._t++;
- };
- }
-
- XHR._q.push({
- interval: interval,
- callback: callback,
- url: url,
- data: data,
- xhr: new XHR()
- });
-
- XHR.run();
-}
-
-XHR.halt = function()
-{
- if (XHR._i)
- {
- /* show & set poll indicator */
- try {
- document.getElementById('xhr_poll_status').style.display = '';
- document.getElementById('xhr_poll_status_on').style.display = 'none';
- document.getElementById('xhr_poll_status_off').style.display = '';
- } catch(e) { }
-
- window.clearInterval(XHR._i);
- XHR._i = null;
- }
-}
-
-XHR.run = function()
-{
- if (XHR._r && !XHR._i)
- {
- /* show & set poll indicator */
- try {
- document.getElementById('xhr_poll_status').style.display = '';
- document.getElementById('xhr_poll_status_on').style.display = '';
- document.getElementById('xhr_poll_status_off').style.display = 'none';
- } catch(e) { }
-
- /* kick first round manually to prevent one second lag when setting up
- * the poll interval */
- XHR._r();
- XHR._i = window.setInterval(XHR._r, 1000);
- }
-}
-
-XHR.running = function()
-{
- return !!(XHR._r && XHR._i);
-}
projects / project / luci.git / commitdiff
